![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | говорить/ | 2026-03-28 18:09 | - | |
| голос/ | 2026-03-28 18:09 | - | |
| звонок/ | 2026-03-28 18:09 | - | |
| мгновенные-сообщения/ | 2026-03-28 18:09 | - | |
| обмен-сообщениями/ | 2026-03-28 18:09 | - | |
| отправить/ | 2026-03-28 18:09 | - | |
| поделиться/ | 2026-03-28 18:09 | - | |
| сообщение/ | 2026-03-28 18:09 | - | |
| чат/ | 2026-03-28 18:09 | - | |
| ニコニコ動画/ | 2026-03-28 18:09 | - | |
| ニコニコ/ | 2026-03-28 18:10 | - | |
| ニコ動/ | 2026-03-28 18:10 | - | |
| ニコ生/ | 2026-03-28 18:09 | - | |
| ハッカ油/ | 2026-03-28 18:09 | - | |
| ㄊㄞˊㄨㄢㄉㄧˋㄓㄣˋㄙㄨˋㄅㄠˋ/ | 2026-03-28 18:09 | - | |
| ㄑㄧㄤˊㄓㄣˋㄐㄧˊㄕˊㄐㄧㄥˇㄅㄠˋ/ | 2026-03-28 18:09 | - | |
| ㄓㄨㄥㄏㄨㄚˊㄇㄧㄣˊㄍㄨㄛˊ/ | 2026-03-28 18:09 | - | |
| 七圣召唤/ | 2026-03-28 18:09 | - | |
| 上传/ | 2026-03-28 18:09 | - | |
| 下载器/ | 2026-03-28 18:10 | - | |
| 下载/ | 2026-03-28 18:09 | - | |
| 专辑/ | 2026-03-28 18:09 | - | |
| 东方财富/ | 2026-03-28 18:09 | - | |
| 个人知识管理/ | 2026-03-28 18:09 | - | |
| 中国政务/ | 2026-03-28 18:09 | - | |
| 中国政府/ | 2026-03-28 18:09 | - | |
| 中国铁路/ | 2026-03-28 18:09 | - | |
| 中国/ | 2026-03-28 18:09 | - | |
| 中学/ | 2026-03-28 18:10 | - | |
| 中文简体/ | 2026-03-28 18:09 | - | |
| 中文/ | 2026-03-28 18:09 | - | |
| 中華民國/ | 2026-03-28 18:09 | - | |
| 串流/ | 2026-03-28 18:09 | - | |
| 云村/ | 2026-03-28 18:09 | - | |
| 云游戏/ | 2026-03-28 18:09 | - | |
| 云盘/ | 2026-03-28 18:09 | - | |
| 云音乐/ | 2026-03-28 18:09 | - | |
| 云顶之弈/ | 2026-03-28 18:10 | - | |
| 云/ | 2026-03-28 18:09 | - | |
| 互联网/ | 2026-03-28 18:09 | - | |
| 交易/ | 2026-03-28 18:09 | - | |
| 人工智能/ | 2026-03-28 18:09 | - | |
| 人民政府/ | 2026-03-28 18:09 | - | |
| 代理/ | 2026-03-28 18:09 | - | |
| 代码/ | 2026-03-28 18:09 | - | |
| 任务管理器/ | 2026-03-28 18:10 | - | |
| 任务/ | 2026-03-28 18:09 | - | |
| 企业/ | 2026-03-28 18:10 | - | |
| 会议/ | 2026-03-28 18:09 | - | |
| 传输/ | 2026-03-28 18:09 | - | |
| 信息显示/ | 2026-03-28 18:09 | - | |
| 信息查看/ | 2026-03-28 18:09 | - | |
| 信息/ | 2026-03-28 18:09 | - | |
| 修改/ | 2026-03-28 18:09 | - | |
| 儿童/ | 2026-03-28 18:09 | - | |
| 光标/ | 2026-03-28 18:09 | - | |
| 免费/ | 2026-03-28 18:10 | - | |
| 公司/ | 2026-03-28 18:10 | - | |
| 公文/ | 2026-03-28 18:10 | - | |
| 共享/ | 2026-03-28 18:09 | - | |
| 内容块/ | 2026-03-28 18:09 | - | |
| 分享/ | 2026-03-28 18:09 | - | |
| 分析/ | 2026-03-28 18:09 | - | |
| 切片/ | 2026-03-28 18:09 | - | |
| 列表/ | 2026-03-28 18:09 | - | |
| 列车站/ | 2026-03-28 18:09 | - | |
| 创意/ | 2026-03-28 18:09 | - | |
| 剪贴板/ | 2026-03-28 18:10 | - | |
| 剪辑/ | 2026-03-28 18:09 | - | |
| 办公/ | 2026-03-28 18:09 | - | |
| 动车站/ | 2026-03-28 18:09 | - | |
| 动车/ | 2026-03-28 18:09 | - | |
| 助手/ | 2026-03-28 18:10 | - | |
| 协作/ | 2026-03-28 18:09 | - | |
| 协同/ | 2026-03-28 18:09 | - | |
| 原神成就导出/ | 2026-03-28 18:09 | - | |
| 原神/ | 2026-03-28 18:09 | - | |
| 双向链接/ | 2026-03-28 18:09 | - | |
| 反向链接/ | 2026-03-28 18:09 | - | |
| 发送/ | 2026-03-28 18:09 | - | |
| 可视化/ | 2026-03-28 18:09 | - | |
| 台灣/ | 2026-03-28 18:09 | - | |
| 同传/ | 2026-03-28 18:09 | - | |
| 同声传译/ | 2026-03-28 18:09 | - | |
| 同步/ | 2026-03-28 18:09 | - | |
| 听写/ | 2026-03-28 18:10 | - | |
| 启动器/ | 2026-03-28 18:09 | - | |
| 命令工具/ | 2026-03-28 18:09 | - | |
| 命令行工具/ | 2026-03-28 18:09 | - | |
| 命令行/ | 2026-03-28 18:09 | - | |
| 命令/ | 2026-03-28 18:09 | - | |
| 响应/ | 2026-03-28 18:09 | - | |
| 哔哩哔哩/ | 2026-03-28 18:09 | - | |
| 售后/ | 2026-03-28 18:09 | - | |
| 商务/ | 2026-03-28 18:10 | - | |
| 团结引擎/ | 2026-03-28 18:10 | - | |
| 团结hub/ | 2026-03-28 18:10 | - | |
| 团队/ | 2026-03-28 18:09 | - | |
| 国铁/ | 2026-03-28 18:09 | - | |
| 图像/ | 2026-03-28 18:09 | - | |
| 图形化编程/ | 2026-03-28 18:09 | - | |
| 图形/ | 2026-03-28 18:09 | - | |
| 图片/ | 2026-03-28 18:09 | - | |
| 图表/ | 2026-03-28 18:10 | - | |
| 图谱/ | 2026-03-28 18:09 | - | |
| 备份/ | 2026-03-28 18:09 | - | |
| 备忘录/ | 2026-03-28 18:09 | - | |
| 备忘/ | 2026-03-28 18:09 | - | |
| 复制/ | 2026-03-28 18:09 | - | |
| 多媒体/ | 2026-03-28 18:10 | - | |
| 多进程/ | 2026-03-28 18:09 | - | |
| 大盘/ | 2026-03-28 18:09 | - | |
| 大纲/ | 2026-03-28 18:09 | - | |
| 大语言模型/ | 2026-03-28 18:09 | - | |
| 天猫/ | 2026-03-28 18:09 | - | |
| 好友/ | 2026-03-28 18:09 | - | |
| 媒体/ | 2026-03-28 18:10 | - | |
| 字体文件/ | 2026-03-28 18:09 | - | |
| 字体设计/ | 2026-03-28 18:09 | - | |
| 字体/ | 2026-03-28 18:09 | - | |
| 字幕/ | 2026-03-28 18:09 | - | |
| 字玩/ | 2026-03-28 18:09 | - | |
| 存储/ | 2026-03-28 18:09 | - | |
| 学习/ | 2026-03-28 18:09 | - | |
| 安全/ | 2026-03-28 18:10 | - | |
| 定制课/ | 2026-03-28 18:09 | - | |
| 实时/ | 2026-03-28 18:09 | - | |
| 客户/ | 2026-03-28 18:10 | - | |
| 客服/ | 2026-03-28 18:09 | - | |
| 导出/ | 2026-03-28 18:09 | - | |
| 导播/ | 2026-03-28 18:09 | - | |
| 小学/ | 2026-03-28 18:10 | - | |
| 小恐龙/ | 2026-03-28 18:10 | - | |
| 小组件/ | 2026-03-28 18:09 | - | |
| 少儿编程/ | 2026-03-28 18:09 | - | |
| 少儿/ | 2026-03-28 18:09 | - | |
| 屏幕镜像/ | 2026-03-28 18:09 | - | |
| 屏幕/ | 2026-03-28 18:09 | - | |
| 工具包/ | 2026-03-28 18:09 | - | |
| 工具箱/ | 2026-03-28 18:09 | - | |
| 工具集/ | 2026-03-28 18:09 | - | |
| 工具/ | 2026-03-28 18:09 | - | |
| 幻灯片/ | 2026-03-28 18:10 | - | |
| 广东省/ | 2026-03-28 18:09 | - | |
| 广东/ | 2026-03-28 18:09 | - | |
| 应用/ | 2026-03-28 18:09 | - | |
| 开会/ | 2026-03-28 18:09 | - | |
| 开发工具/ | 2026-03-28 18:09 | - | |
| 开发/ | 2026-03-28 18:09 | - | |
| 开源/ | 2026-03-28 18:09 | - | |
| 引用/ | 2026-03-28 18:09 | - | |
| 強震即時警報/ | 2026-03-28 18:09 | - | |
| 录制/ | 2026-03-28 18:09 | - | |
| 录屏/ | 2026-03-28 18:09 | - | |
| 影片/ | 2026-03-28 18:09 | - | |
| 影音/ | 2026-03-28 18:10 | - | |
| 待办事项/ | 2026-03-28 18:09 | - | |
| 待办/ | 2026-03-28 18:09 | - | |
| 微信/ | 2026-03-28 18:10 | - | |
| 德语/ | 2026-03-28 18:10 | - | |
| 心更远/ | 2026-03-28 18:09 | - | |
| 快捷键/ | 2026-03-28 18:09 | - | |
| 快速/ | 2026-03-28 18:09 | - | |
| 思源笔记/ | 2026-03-28 18:09 | - | |
| 思维导图/ | 2026-03-28 18:09 | - | |
| 思维/ | 2026-03-28 18:09 | - | |
| 怡氧/ | 2026-03-28 18:10 | - | |
| 成就导出/ | 2026-03-28 18:09 | - | |
| 成长/ | 2026-03-28 18:09 | - | |
| 我的世界/ | 2026-03-28 18:10 | - | |
| 截图/ | 2026-03-28 18:09 | - | |
| 手写/ | 2026-03-28 18:09 | - | |
| 手机/ | 2026-03-28 18:09 | - | |
| 打工人/ | 2026-03-28 18:09 | - | |
| 扩展/ | 2026-03-28 18:09 | - | |
| 批量转存/ | 2026-03-28 18:09 | - | |
| 批量/ | 2026-03-28 18:09 | - | |
| 投射/ | 2026-03-28 18:09 | - | |
| 投屏/ | 2026-03-28 18:09 | - | |
| 抖音/ | 2026-03-28 18:09 | - | |
| 抽屉/ | 2026-03-28 18:10 | - | |
| 拼音/ | 2026-03-28 18:09 | - | |
| 指数/ | 2026-03-28 18:09 | - | |
| 指纹/ | 2026-03-28 18:10 | - | |
| 按键显示/ | 2026-03-28 18:09 | - | |
| 按键/ | 2026-03-28 18:09 | - | |
| 捕获/ | 2026-03-28 18:09 | - | |
| 排版/ | 2026-03-28 18:10 | - | |
| 接口/ | 2026-03-28 18:09 | - | |
| 控制台/ | 2026-03-28 18:09 | - | |
| 推流/ | 2026-03-28 18:10 | - | |
| 提取/ | 2026-03-28 18:09 | - | |
| 提示词/ | 2026-03-28 18:09 | - | |
| 提示/ | 2026-03-28 18:09 | - | |
| 提醒事项/ | 2026-03-28 18:09 | - | |
| 插件/ | 2026-03-28 18:09 | - | |
| 搜索/ | 2026-03-28 18:09 | - | |
| 摸鱼/ | 2026-03-28 18:09 | - | |
| 播放器/ | 2026-03-28 18:09 | - | |
| 播放/ | 2026-03-28 18:10 | - | |
| 政务/ | 2026-03-28 18:09 | - | |
| 政府/ | 2026-03-28 18:09 | - | |
| 效率/ | 2026-03-28 18:09 | - | |
| 教育/ | 2026-03-28 18:09 | - | |
| 数据/ | 2026-03-28 18:09 | - | |
| 整理/ | 2026-03-28 18:09 | - | |
| 文件管理/ | 2026-03-28 18:10 | - | |
| 文件/ | 2026-03-28 18:09 | - | |
| 文字/ | 2026-03-28 18:09 | - | |
| 文档/ | 2026-03-28 18:09 | - | |
| 日历/ | 2026-03-28 18:09 | - | |
| 日志分析/ | 2026-03-28 18:09 | - | |
| 日志/ | 2026-03-28 18:10 | - | |
| 日程管理/ | 2026-03-28 18:09 | - | |
| 日程/ | 2026-03-28 18:09 | - | |
| 日记本/ | 2026-03-28 18:10 | - | |
| 日记/ | 2026-03-28 18:10 | - | |
| 时间管理/ | 2026-03-28 18:09 | - | |
| 显示屏/ | 2026-03-28 18:09 | - | |
| 智能体/ | 2026-03-28 18:09 | - | |
| 智能/ | 2026-03-28 18:09 | - | |
| 智谱清言/ | 2026-03-28 18:09 | - | |
| 朋友/ | 2026-03-28 18:09 | - | |
| 服务器/ | 2026-03-28 18:09 | - | |
| 期货/ | 2026-03-28 18:10 | - | |
| 机器人/ | 2026-03-28 18:09 | - | |
| 来画演示/ | 2026-03-28 18:09 | - | |
| 查找/ | 2026-03-28 18:09 | - | |
| 查重/ | 2026-03-28 18:09 | - | |
| 标签/ | 2026-03-28 18:09 | - | |
| 栗田穣崇/ | 2026-03-28 18:09 | - | |
| 校对/ | 2026-03-28 18:09 | - | |
| 桌面/ | 2026-03-28 18:10 | - | |
| 梗图/ | 2026-03-28 18:09 | - | |
| 检查/ | 2026-03-28 18:09 | - | |
| 检测/ | 2026-03-28 18:09 | - | |
| 模型/ | 2026-03-28 18:09 | - | |
| 模拟/ | 2026-03-28 18:09 | - | |
| 模板/ | 2026-03-28 18:10 | - | |
| 模糊搜索/ | 2026-03-28 18:09 | - | |
| 歌单/ | 2026-03-28 18:09 | - | |
| 歌手/ | 2026-03-28 18:09 | - | |
| 歌曲/ | 2026-03-28 18:09 | - | |
| 汉语/ | 2026-03-28 18:09 | - | |
| 沟通/ | 2026-03-28 18:09 | - | |
| 法语/ | 2026-03-28 18:09 | - | |
| 浏览器/ | 2026-03-28 18:09 | - | |
| 海腾/ | 2026-03-28 18:09 | - | |
| 消息管理/ | 2026-03-28 18:09 | - | |
| 消息/ | 2026-03-28 18:09 | - | |
| 淘宝/ | 2026-03-28 18:09 | - | |
| 深度求索/ | 2026-03-28 18:09 | - | |
| 清单/ | 2026-03-28 18:09 | - | |
| 游戏/ | 2026-03-28 18:09 | - | |
| 火车站/ | 2026-03-28 18:09 | - | |
| 火车/ | 2026-03-28 18:09 | - | |
| 点猫科技/ | 2026-03-28 18:09 | - | |
| 状态切换/ | 2026-03-28 18:09 | - | |
| 状态/ | 2026-03-28 18:09 | - | |
| 班级优化大师/ | 2026-03-28 18:10 | - | |
| 班级/ | 2026-03-28 18:10 | - | |
| 生产力/ | 2026-03-28 18:09 | - | |
| 用户画像/ | 2026-03-28 18:09 | - | |
| 电子邮件/ | 2026-03-28 18:10 | - | |
| 电影/ | 2026-03-28 18:09 | - | |
| 电视剧/ | 2026-03-28 18:10 | - | |
| 电话/ | 2026-03-28 18:09 | - | |
| 百度云管家/ | 2026-03-28 18:09 | - | |
| 百度云/ | 2026-03-28 18:09 | - | |
| 百度网盘/ | 2026-03-28 18:09 | - | |
| 百度/ | 2026-03-28 18:09 | - | |
| 百科/ | 2026-03-28 18:09 | - | |
| 百花繚乱/ | 2026-03-28 18:09 | - | |
| 直播/ | 2026-03-28 18:10 | - | |
| 知识库/ | 2026-03-28 18:09 | - | |
| 知识/ | 2026-03-28 18:09 | - | |
| 石墨文档/ | 2026-03-28 18:10 | - | |
| 硬件监控/ | 2026-03-28 18:09 | - | |
| 社区音游/ | 2026-03-28 18:10 | - | |
| 种子/ | 2026-03-28 18:10 | - | |
| 移除包/ | 2026-03-28 18:09 | - | |
| 端口/ | 2026-03-28 18:10 | - | |
| 笔记/ | 2026-03-28 18:09 | - | |
| 第五人格/ | 2026-03-28 18:09 | - | |
| 筆墨クミ/ | 2026-03-28 18:09 | - | |
| 管理器/ | 2026-03-28 18:09 | - | |
| 粤政易/ | 2026-03-28 18:09 | - | |
| 纪录片/ | 2026-03-28 18:10 | - | |
| 终端工具/ | 2026-03-28 18:09 | - | |
| 终端/ | 2026-03-28 18:09 | - | |
| 统计/ | 2026-03-28 18:09 | - | |
| 综艺/ | 2026-03-28 18:10 | - | |
| 编程学习/ | 2026-03-28 18:09 | - | |
| 编程猫/ | 2026-03-28 18:09 | - | |
| 编程语言/ | 2026-03-28 18:09 | - | |
| 编程/ | 2026-03-28 18:09 | - | |
| 编辑器/ | 2026-03-28 18:09 | - | |
| 编辑/ | 2026-03-28 18:09 | - | |
| 网易云音乐/ | 2026-03-28 18:10 | - | |
| 网盘/ | 2026-03-28 18:09 | - | |
| 网络/ | 2026-03-28 18:09 | - | |
| 网页/ | 2026-03-28 18:09 | - | |
| 翻译/ | 2026-03-28 18:09 | - | |
| 聊天机器人/ | 2026-03-28 18:09 | - | |
| 聊天记录备份/ | 2026-03-28 18:09 | - | |
| 聊天记录/ | 2026-03-28 18:09 | - | |
| 聊天/ | 2026-03-28 18:09 | - | |
| 股市/ | 2026-03-28 18:09 | - | |
| 股票/ | 2026-03-28 18:09 | - | |
| 脑图/ | 2026-03-28 18:09 | - | |
| 自主智能/ | 2026-03-28 18:09 | - | |
| 自动化/ | 2026-03-28 18:09 | - | |
| 自动技能/ | 2026-03-28 18:09 | - | |
| 自动拾取/ | 2026-03-28 18:09 | - | |
| 自动采集/ | 2026-03-28 18:09 | - | |
| 自动钓鱼/ | 2026-03-28 18:09 | - | |
| 臺灣/ | 2026-03-28 18:09 | - | |
| 舱单/ | 2026-03-28 18:09 | - | |
| 节奏游戏/ | 2026-03-28 18:09 | - | |
| 芙芙工具箱/ | 2026-03-28 18:09 | - | |
| 英文/ | 2026-03-28 18:09 | - | |
| 英语/ | 2026-03-28 18:09 | - | |
| 虚拟/ | 2026-03-28 18:09 | - | |
| 表单/ | 2026-03-28 18:10 | - | |
| 表格/ | 2026-03-28 18:09 | - | |
| 西班牙语/ | 2026-03-28 18:09 | - | |
| 西语/ | 2026-03-28 18:09 | - | |
| 视频会议/ | 2026-03-28 18:09 | - | |
| 视频编辑器/ | 2026-03-28 18:09 | - | |
| 视频编辑/ | 2026-03-28 18:09 | - | |
| 视频/ | 2026-03-28 18:09 | - | |
| 解压软件/ | 2026-03-28 18:09 | - | |
| 解压/ | 2026-03-28 18:09 | - | |
| 解析/ | 2026-03-28 18:09 | - | |
| 议程/ | 2026-03-28 18:09 | - | |
| 设计/ | 2026-03-28 18:09 | - | |
| 识别/ | 2026-03-28 18:09 | - | |
| 词典/ | 2026-03-28 18:09 | - | |
| 语言/ | 2026-03-28 18:09 | - | |
| 语音会议/ | 2026-03-28 18:09 | - | |
| 语音识别/ | 2026-03-28 18:09 | - | |
| 语音转文字/ | 2026-03-28 18:10 | - | |
| 语音/ | 2026-03-28 18:09 | - | |
| 请求/ | 2026-03-28 18:09 | - | |
| 课堂/ | 2026-03-28 18:10 | - | |
| 课程/ | 2026-03-28 18:09 | - | |
| 调试/ | 2026-03-28 18:09 | - | |
| 豆包/ | 2026-03-28 18:10 | - | |
| 财经/ | 2026-03-28 18:09 | - | |
| 资源/ | 2026-03-28 18:09 | - | |
| 赛事/ | 2026-03-28 18:09 | - | |
| 转写/ | 2026-03-28 18:10 | - | |
| 转录/ | 2026-03-28 18:10 | - | |
| 转换器/ | 2026-03-28 18:09 | - | |
| 转换/ | 2026-03-28 18:09 | - | |
| 输入法/ | 2026-03-28 18:09 | - | |
| 输入/ | 2026-03-28 18:09 | - | |
| 远程办公/ | 2026-03-28 18:09 | - | |
| 远程协助/ | 2026-03-28 18:09 | - | |
| 远程控制/ | 2026-03-28 18:09 | - | |
| 远程桌面/ | 2026-03-28 18:09 | - | |
| 远程访问/ | 2026-03-28 18:09 | - | |
| 远程连接/ | 2026-03-28 18:09 | - | |
| 远程/ | 2026-03-28 18:09 | - | |
| 连续剧/ | 2026-03-28 18:10 | - | |
| 通义千问/ | 2026-03-28 18:09 | - | |
| 通义灵码/ | 2026-03-28 18:09 | - | |
| 通话/ | 2026-03-28 18:09 | - | |
| 邮件/ | 2026-03-28 18:10 | - | |
| 邮箱/ | 2026-03-28 18:10 | - | |
| 酷我音乐/ | 2026-03-28 18:10 | - | |
| 酷狗音乐/ | 2026-03-28 18:10 | - | |
| 金融/ | 2026-03-28 18:09 | - | |
| 铁路/ | 2026-03-28 18:09 | - | |
| 镜像/ | 2026-03-28 18:09 | - | |
| 阿里云盘/ | 2026-03-28 18:09 | - | |
| 非商业/ | 2026-03-28 18:10 | - | |
| 音乐游戏/ | 2026-03-28 18:09 | - | |
| 音乐/ | 2026-03-28 18:09 | - | |
| 音游/ | 2026-03-28 18:09 | - | |
| 音频/ | 2026-03-28 18:09 | - | |
| 验证管道日志分析/ | 2026-03-28 18:09 | - | |
| 高性能/ | 2026-03-28 18:09 | - | |
| 高铁站/ | 2026-03-28 18:09 | - | |
| 高铁/ | 2026-03-28 18:09 | - | |
| 鸿蒙/ | 2026-03-28 18:09 | - | |
| 鼠标指针/ | 2026-03-28 18:09 | - | |
| 鼠标/ | 2026-03-28 18:09 | - | |
| 龙虾/ | 2026-03-28 18:09 | - | |
| 이북/ | 2026-03-28 18:09 | - | |
| 전자책/ | 2026-03-28 18:09 | - | |
| 0install/ | 2026-03-28 18:09 | - | |
| 1.1.1.1/ | 2026-03-28 18:09 | - | |
| 1ds/ | 2026-03-28 18:09 | - | |
| 1gbe/ | 2026-03-28 18:09 | - | |
| 1password/ | 2026-03-28 18:10 | - | |
| 2-stegsinloggning/ | 2026-03-28 18:09 | - | |
| 2.14.2/ | 2026-03-28 18:10 | - | |
| 2d-platforming/ | 2026-03-28 18:09 | - | |
| 2d/ | 2026-03-28 18:09 | - | |
| 2dgame/ | 2026-03-28 18:09 | - | |
| 2dplatformer/ | 2026-03-28 18:09 | - | |
| 2fa-client/ | 2026-03-28 18:09 | - | |
| 2fa-codes/ | 2026-03-28 18:09 | - | |
| 2fa-security/ | 2026-03-28 18:09 | - | |
| 2fa/ | 2026-03-28 18:09 | - | |
| 2factorauthentication/ | 2026-03-28 18:09 | - | |
| 3cx-cfd/ | 2026-03-28 18:09 | - | |
| 3cx/ | 2026-03-28 18:09 | - | |
| 3d打印机/ | 2026-03-28 18:09 | - | |
| 3d打印/ | 2026-03-28 18:09 | - | |
| 3d-audio/ | 2026-03-28 18:09 | - | |
| 3d-graphics/ | 2026-03-28 18:09 | - | |
| 3d-modeler/ | 2026-03-28 18:09 | - | |
| 3d-point-clouds/ | 2026-03-28 18:09 | - | |
| 3d-printer/ | 2026-03-28 18:09 | - | |
| 3d-printers/ | 2026-03-28 18:09 | - | |
| 3d-printing/ | 2026-03-28 18:09 | - | |
| 3d-viewer/ | 2026-03-28 18:09 | - | |
| 3d/ | 2026-03-28 18:09 | - | |
| 3dadventuregame/ | 2026-03-28 18:09 | - | |
| 3dcgi/ | 2026-03-28 18:10 | - | |
| 3deditor/ | 2026-03-28 18:09 | - | |
| 3dfx/ | 2026-03-28 18:09 | - | |
| 3dlut/ | 2026-03-28 18:09 | - | |
| 3dmark/ | 2026-03-28 18:09 | - | |
| 3dplatformer/ | 2026-03-28 18:10 | - | |
| 3d print/ | 2026-03-28 18:09 | - | |
| 3dprinters/ | 2026-03-28 18:09 | - | |
| 3dprinting/ | 2026-03-28 18:09 | - | |
| 3ds/ | 2026-03-28 18:09 | - | |
| 3dsmax/ | 2026-03-28 18:09 | - | |
| 3dtv/ | 2026-03-28 18:09 | - | |
| 3dxhid.inf/ | 2026-03-28 18:09 | - | |
| 3dxkmj.inf/ | 2026-03-28 18:09 | - | |
| 4gb/ | 2026-03-28 18:09 | - | |
| 4gib/ | 2026-03-28 18:09 | - | |
| 4k/ | 2026-03-28 18:09 | - | |
| 4k60pro/ | 2026-03-28 18:09 | - | |
| 4kx/ | 2026-03-28 18:09 | - | |
| 4x/ | 2026-03-28 18:09 | - | |
| 7-zip/ | 2026-03-28 18:09 | - | |
| 7-zipextra/ | 2026-03-28 18:09 | - | |
| 7max/ | 2026-03-28 18:09 | - | |
| 7z/ | 2026-03-28 18:09 | - | |
| 7zfiles/ | 2026-03-28 18:09 | - | |
| 7zip/ | 2026-03-28 18:09 | - | |
| 7zipextra/ | 2026-03-28 18:09 | - | |
| 8-Bit/ | 2026-03-28 18:10 | - | |
| 9n5lw3jbcxkf/ | 2026-03-28 18:09 | - | |
| 9n80q5m0qxw6/ | 2026-03-28 18:09 | - | |
| 9nblggh4z1jc/ | 2026-03-28 18:09 | - | |
| 9nblggh6j7vv/ | 2026-03-28 18:09 | - | |
| 9nblggh35mpc/ | 2026-03-28 18:09 | - | |
| 9nh4f7j77cpd/ | 2026-03-28 18:09 | - | |
| 9nncb5bs59ph/ | 2026-03-28 18:09 | - | |
| 9nqpsl29bfff/ | 2026-03-28 18:09 | - | |
| 9p9tqf7mrm4r/ | 2026-03-28 18:09 | - | |
| 9pb2mz1zmb1s/ | 2026-03-28 18:09 | - | |
| 9pd9bhglfc7h/ | 2026-03-28 18:09 | - | |
| 9pgw18npbzv5/ | 2026-03-28 18:09 | - | |
| 9pmpg267sl5q/ | 2026-03-28 18:10 | - | |
| 9wzdncrfjb8p/ | 2026-03-28 18:09 | - | |
| 10-bit/ | 2026-03-28 18:09 | - | |
| 10bit/ | 2026-03-28 18:09 | - | |
| 10gbe/ | 2026-03-28 18:10 | - | |
| 10gbit/ | 2026-03-28 18:10 | - | |
| 10gigabit/ | 2026-03-28 18:10 | - | |
| 20-20-20/ | 2026-03-28 18:10 | - | |
| 20h2/ | 2026-03-28 18:09 | - | |
| 22h2/ | 2026-03-28 18:09 | - | |
| 23andme/ | 2026-03-28 18:09 | - | |
| 32-million-rows/ | 2026-03-28 18:09 | - | |
| 64dd/ | 2026-03-28 18:10 | - | |
| 86box/ | 2026-03-28 18:09 | - | |
| 86manager/ | 2026-03-28 18:09 | - | |
| 125khz/ | 2026-03-28 18:10 | - | |
| 163music/ | 2026-03-28 18:09 | - | |
| 180/ | 2026-03-28 18:09 | - | |
| 433mhz/ | 2026-03-28 18:09 | - | |
| 600-series/ | 2026-03-28 18:09 | - | |
| 600series/ | 2026-03-28 18:09 | - | |
| 1080p/ | 2026-03-28 18:09 | - | |
| 1394-ohci-compliant-host-controller/ | 2026-03-28 18:09 | - | |
| 1394ohcicomplianthostcontrollerlegacy/ | 2026-03-28 18:09 | - | |
| 1688/ | 2026-03-28 18:10 | - | |
| 6502/ | 2026-03-28 18:09 | - | |
| 12306/ | 2026-03-28 18:09 | - | |
| 202020-rule/ | 2026-03-28 18:10 | - | |
| 202020/ | 2026-03-28 18:10 | - | |
| ADA/ | 2026-03-28 18:09 | - | |
| AI-powered/ | 2026-03-28 18:09 | - | |
| AMR/ | 2026-03-28 18:09 | - | |
| ANI/ | 2026-03-28 18:09 | - | |
| APIs/ | 2026-03-28 18:10 | - | |
| AWAKENINGS-BIORHYTHMS/ | 2026-03-28 18:09 | - | |
| ActiveMQ/ | 2026-03-28 18:09 | - | |
| AddressBook/ | 2026-03-28 18:09 | - | |
| Agent/ | 2026-03-28 18:09 | - | |
| AirDrop/ | 2026-03-28 18:10 | - | |
| Alarmer/ | 2026-03-28 18:10 | - | |
| Amateur Radio/ | 2026-03-28 18:09 | - | |
| Analiser/ | 2026-03-28 18:10 | - | |
| Analizer/ | 2026-03-28 18:09 | - | |
| Analyse/ | 2026-03-28 18:10 | - | |
| AncestryDNA/ | 2026-03-28 18:09 | - | |
| Anti-Twin Classic/ | 2026-03-28 18:09 | - | |
| Anti-bot/ | 2026-03-28 18:09 | - | |
| Antibiotics/ | 2026-03-28 18:09 | - | |
| Antidetect/ | 2026-03-28 18:09 | - | |
| Antispy tool/ | 2026-03-28 18:10 | - | |
| AnyTLS/ | 2026-03-28 18:10 | - | |
| Appeon/ | 2026-03-28 18:09 | - | |
| App remover/ | 2026-03-28 18:10 | - | |
| Architecture/ | 2026-03-28 18:09 | - | |
| Argos/ | 2026-03-28 18:09 | - | |
| Audinate/ | 2026-03-28 18:10 | - | |
| Audit/ | 2026-03-28 18:09 | - | |
| Aurora/ | 2026-03-28 18:10 | - | |
| Autologon/ | 2026-03-28 18:10 | - | |
| Automatic/ | 2026-03-28 18:09 | - | |
| Automatic Backup/ | 2026-03-28 18:09 | - | |
| Automox/ | 2026-03-28 18:09 | - | |
| Autoruns/ | 2026-03-28 18:09 | - | |
| B-Trust/ | 2026-03-28 18:09 | - | |
| BI/ | 2026-03-28 18:10 | - | |
| BNB/ | 2026-03-28 18:10 | - | |
| BOOTP/ | 2026-03-28 18:09 | - | |
| BacLink/ | 2026-03-28 18:10 | - | |
| Bacteriology/ | 2026-03-28 18:09 | - | |
| Banco Digital/ | 2026-03-28 18:10 | - | |
| Base16/ | 2026-03-28 18:10 | - | |
| Base64/ | 2026-03-28 18:09 | - | |
| Beautifier/ | 2026-03-28 18:09 | - | |
| Bit/ | 2026-03-28 18:10 | - | |
| BoostSpeed/ | 2026-03-28 18:09 | - | |
| Borica/ | 2026-03-28 18:09 | - | |
| Boxshot/ | 2026-03-28 18:10 | - | |
| BruteForce/ | 2026-03-28 18:10 | - | |
| Bus/ | 2026-03-28 18:09 | - | |
| CLSI/ | 2026-03-28 18:09 | - | |
| CNA/ | 2026-03-28 18:10 | - | |
| CPU usage/ | 2026-03-28 18:10 | - | |
| CRC-32/ | 2026-03-28 18:10 | - | |
| CSV2JSON/ | 2026-03-28 18:10 | - | |
| CSV2VCF/ | 2026-03-28 18:10 | - | |
| CUR/ | 2026-03-28 18:09 | - | |
| CWE/ | 2026-03-28 18:10 | - | |
| Calendars/ | 2026-03-28 18:09 | - | |
| Cargo/ | 2026-03-28 18:09 | - | |
| Centralized/ | 2026-03-28 18:09 | - | |
| Checker/ | 2026-03-28 18:09 | - | |
| Checks/ | 2026-03-28 18:10 | - | |
| Chillblast/ | 2026-03-28 18:09 | - | |
| Clicker/ | 2026-03-28 18:09 | - | |
| CloneBD/ | 2026-03-28 18:10 | - | |
| CloneDVD/ | 2026-03-28 18:10 | - | |
| Cmd-Pal/ | 2026-03-28 18:09 | - | |
| Collector/ | 2026-03-28 18:09 | - | |
| Combine/ | 2026-03-28 18:09 | - | |
| Combiner/ | 2026-03-28 18:09 | - | |
| Combines/ | 2026-03-28 18:10 | - | |
| Combining/ | 2026-03-28 18:10 | - | |
| Command-Palette/ | 2026-03-28 18:09 | - | |
| Command Palette/ | 2026-03-28 18:09 | - | |
| CommandPalette/ | 2026-03-28 18:09 | - | |
| CommonMark/ | 2026-03-28 18:10 | - | |
| Computer/ | 2026-03-28 18:10 | - | |
| Computer Shogi/ | 2026-03-28 18:10 | - | |
| Controladoria/ | 2026-03-28 18:10 | - | |
| Corsair/ | 2026-03-28 18:09 | - | |
| CosmosDB/ | 2026-03-28 18:10 | - | |
| Cover/ | 2026-03-28 18:10 | - | |
| Create/ | 2026-03-28 18:09 | - | |
| Creating/ | 2026-03-28 18:09 | - | |
| Creator/ | 2026-03-28 18:09 | - | |
| Cryo/ | 2026-03-28 18:09 | - | |
| Crypto Native App NG/ | 2026-03-28 18:10 | - | |
| Crypto Web Extension/ | 2026-03-28 18:10 | - | |
| Cryptographic/ | 2026-03-28 18:10 | - | |
| Current Flow/ | 2026-03-28 18:09 | - | |
| Customizable display/ | 2026-03-28 18:10 | - | |
| Custos/ | 2026-03-28 18:10 | - | |
| DCM/ | 2026-03-28 18:09 | - | |
| DDNS/ | 2026-03-28 18:09 | - | |
| DHCP/ | 2026-03-28 18:09 | - | |
| DIA/ | 2026-03-28 18:09 | - | |
| DVS/ | 2026-03-28 18:10 | - | |
| Dahua/ | 2026-03-28 18:09 | - | |
| Danish/ | 2026-03-28 18:09 | - | |
| Dante/ | 2026-03-28 18:09 | - | |
| DaringFireball/ | 2026-03-28 18:10 | - | |
| Dashcam/ | 2026-03-28 18:10 | - | |
| Data Collection/ | 2026-03-28 18:09 | - | |
| Data Recovery/ | 2026-03-28 18:10 | - | |
| Databases/ | 2026-03-28 18:09 | - | |
| Data protection/ | 2026-03-28 18:10 | - | |
| Demo/ | 2026-03-28 18:09 | - | |
| Detector/ | 2026-03-28 18:09 | - | |
| Device Management/ | 2026-03-28 18:09 | - | |
| Diagnostics/ | 2026-03-28 18:09 | - | |
| Digital Devices/ | 2026-03-28 18:09 | - | |
| Directories/ | 2026-03-28 18:09 | - | |
| Disaster Recovery/ | 2026-03-28 18:10 | - | |
| DiskEditor/ | 2026-03-28 18:10 | - | |
| Disks/ | 2026-03-28 18:09 | - | |
| DocuWare/ | 2026-03-28 18:09 | - | |
| Documents/ | 2026-03-28 18:09 | - | |
| Domain/ | 2026-03-28 18:09 | - | |
| Dotcode/ | 2026-03-28 18:10 | - | |
| Download, Download Manager, Manager/ | 2026-03-28 18:10 | - | |
| Downloads/ | 2026-03-28 18:10 | - | |
| Drives/ | 2026-03-28 18:09 | - | |
| DuckStudio/ | 2026-03-28 18:09 | - | |
| Dutch/ | 2026-03-28 18:09 | - | |
| DynDNS/ | 2026-03-28 18:09 | - | |
| Dynamic DNS/ | 2026-03-28 18:09 | - | |
| EDB/ | 2026-03-28 18:09 | - | |
| EFS/ | 2026-03-28 18:09 | - | |
| EML/ | 2026-03-28 18:09 | - | |
| EUCAST/ | 2026-03-28 18:09 | - | |
| EasyConnect/ | 2026-03-28 18:09 | - | |
| Electrostatics/ | 2026-03-28 18:09 | - | |
| Emails/ | 2026-03-28 18:10 | - | |
| Epson Photo +/ | 2026-03-28 18:09 | - | |
| Eraser/ | 2026-03-28 18:09 | - | |
| Espressif, IDF, EIM, ESP-IDF/ | 2026-03-28 18:09 | - | |
| Esteem/ | 2026-03-28 18:09 | - | |
| Ethereum/ | 2026-03-28 18:09 | - | |
| EverythingCP/ | 2026-03-28 18:09 | - | |
| EverythingCP3/ | 2026-03-28 18:09 | - | |
| EverythingCommandPalette/ | 2026-03-28 18:09 | - | |
| EverythingCommandPalette3/ | 2026-03-28 18:09 | - | |
| EverythingPT/ | 2026-03-28 18:09 | - | |
| EverythingPowerToys/ | 2026-03-28 18:09 | - | |
| Executable/ | 2026-03-28 18:09 | - | |
| FASTER/ | 2026-03-28 18:09 | - | |
| FIDO/ | 2026-03-28 18:09 | - | |
| FTDNA/ | 2026-03-28 18:09 | - | |
| Face/ | 2026-03-28 18:09 | - | |
| Family Tree DNA/ | 2026-03-28 18:09 | - | |
| FastGithub/ | 2026-03-28 18:09 | - | |
| File-Management/ | 2026-03-28 18:09 | - | |
| File Protection/ | 2026-03-28 18:09 | - | |
| Filename/ | 2026-03-28 18:09 | - | |
| Finanças/ | 2026-03-28 18:10 | - | |
| Fingerprint/ | 2026-03-28 18:09 | - | |
| Fluent/ | 2026-03-28 18:09 | - | |
| Freedesktop/ | 2026-03-28 18:09 | - | |
| Fun/ | 2026-03-28 18:10 | - | |
| GáborAStefanik/ | 2026-03-28 18:09 | - | |
| GED/ | 2026-03-28 18:10 | - | |
| GEDCOM/ | 2026-03-28 18:09 | - | |
| GLASS/ | 2026-03-28 18:10 | - | |
| GLM/ | 2026-03-28 18:09 | - | |
| GS-Calc/ | 2026-03-28 18:09 | - | |
| GaborAStefanik/ | 2026-03-28 18:09 | - | |
| Galleries/ | 2026-03-28 18:09 | - | |
| German/ | 2026-03-28 18:09 | - | |
| GoogleDrive/ | 2026-03-28 18:09 | - | |
| Group/ | 2026-03-28 18:09 | - | |
| HAMRS/ | 2026-03-28 18:09 | - | |
| HAM Radio/ | 2026-03-28 18:09 | - | |
| HDR Switching/ | 2026-03-28 18:09 | - | |
| HIIT/ | 2026-03-28 18:09 | - | |
| HIS/ | 2026-03-28 18:10 | - | |
| HTTP/ | 2026-03-28 18:09 | - | |
| HTTPS/ | 2026-03-28 18:09 | - | |
| HeadesetControl/ | 2026-03-28 18:09 | - | |
| Headless/ | 2026-03-28 18:09 | - | |
| Heat Flow/ | 2026-03-28 18:09 | - | |
| Hierarchical/ | 2026-03-28 18:09 | - | |
| HikVision/ | 2026-03-28 18:09 | - | |
| Hysteria/ | 2026-03-28 18:09 | - | |
| ICO/ | 2026-03-28 18:09 | - | |
| IPM/ | 2026-03-28 18:09 | - | |
| IPVMS/ | 2026-03-28 18:09 | - | |
| IP address/ | 2026-03-28 18:10 | - | |
| IT/ | 2026-03-28 18:10 | - | |
| Icon/ | 2026-03-28 18:09 | - | |
| Icons/ | 2026-03-28 18:09 | - | |
| Image Management/ | 2026-03-28 18:09 | - | |
| Image Manager/ | 2026-03-28 18:09 | - | |
| Image Organization/ | 2026-03-28 18:09 | - | |
| Image Organizer/ | 2026-03-28 18:09 | - | |
| Image Sorter/ | 2026-03-28 18:09 | - | |
| Image Sorting/ | 2026-03-28 18:09 | - | |
| Image Utility/ | 2026-03-28 18:09 | - | |
| Information Analysis/ | 2026-03-28 18:09 | - | |
| Infrastructure as Code/ | 2026-03-28 18:09 | - | |
| Instant/ | 2026-03-28 18:09 | - | |
| InstantMessaging/ | 2026-03-28 18:09 | - | |
| Inteligência Artificial/ | 2026-03-28 18:10 | - | |
| Italian/ | 2026-03-28 18:09 | - | |
| JBOD/ | 2026-03-28 18:09 | - | |
| JCAMP-DX jdx jcm dx/ | 2026-03-28 18:10 | - | |
| Joiner/ | 2026-03-28 18:10 | - | |
| Justin-Keys-WiinUPro/ | 2026-03-28 18:09 | - | |
| JustinKeysWiinUPro/ | 2026-03-28 18:09 | - | |
| Keyword/ | 2026-03-28 18:10 | - | |
| Kitten/ | 2026-03-28 18:09 | - | |
| LC-MS/ | 2026-03-28 18:09 | - | |
| LTC/ | 2026-03-28 18:10 | - | |
| Laboratory/ | 2026-03-28 18:10 | - | |
| Leds/ | 2026-03-28 18:09 | - | |
| Legacy/ | 2026-03-28 18:09 | - | |
| LibreOffice/ | 2026-03-28 18:09 | - | |
| LingDys/ | 2026-03-28 18:09 | - | |
| Lister/ | 2026-03-28 18:09 | - | |
| Lively/ | 2026-03-28 18:09 | - | |
| LivingDNA/ | 2026-03-28 18:09 | - | |
| Loading/ | 2026-03-28 18:10 | - | |
| LockScreen/ | 2026-03-28 18:10 | - | |
| Logcat/ | 2026-03-28 18:09 | - | |
| Logo/ | 2026-03-28 18:09 | - | |
| Logon/ | 2026-03-28 18:09 | - | |
| Lookup/ | 2026-03-28 18:09 | - | |
| MAC address/ | 2026-03-28 18:10 | - | |
| MAMP/ | 2026-03-28 18:09 | - | |
| MDM/ | 2026-03-28 18:09 | - | |
| MSI Authoring/ | 2026-03-28 18:09 | - | |
| MSI Builder/ | 2026-03-28 18:09 | - | |
| MSI Installer/ | 2026-03-28 18:09 | - | |
| MSI Package/ | 2026-03-28 18:09 | - | |
| MSI Package Creator/ | 2026-03-28 18:09 | - | |
| MSIX Authoring/ | 2026-03-28 18:09 | - | |
| MSIX Packaging/ | 2026-03-28 18:09 | - | |
| MSMQ/ | 2026-03-28 18:09 | - | |
| MWL/ | 2026-03-28 18:10 | - | |
| Machine/ | 2026-03-28 18:10 | - | |
| MacroAssembler/ | 2026-03-28 18:09 | - | |
| Magnetics/ | 2026-03-28 18:09 | - | |
| Maintenance/ | 2026-03-28 18:09 | - | |
| Manifests/ | 2026-03-28 18:09 | - | |
| Marketing/ | 2026-03-28 18:09 | - | |
| Mastadon, client, accessible/ | 2026-03-28 18:10 | - | |
| Mastadon/ | 2026-03-28 18:10 | - | |
| Materiais e Suprimentos/ | 2026-03-28 18:10 | - | |
| Maxicode/ | 2026-03-28 18:10 | - | |
| Memento/ | 2026-03-28 18:09 | - | |
| MementoDB/ | 2026-03-28 18:09 | - | |
| Memories/ | 2026-03-28 18:09 | - | |
| Memory usage/ | 2026-03-28 18:10 | - | |
| Merger/ | 2026-03-28 18:10 | - | |
| Merges/ | 2026-03-28 18:10 | - | |
| Microbiology/ | 2026-03-28 18:09 | - | |
| Microsoft.DeepDev.TokenizerLib/ | 2026-03-28 18:09 | - | |
| Microsoft.ML.Tokenizers/ | 2026-03-28 18:09 | - | |
| Mieru/ | 2026-03-28 18:10 | - | |
| MikroTik/ | 2026-03-28 18:09 | - | |
| Mood/ | 2026-03-28 18:09 | - | |
| Multiple/ | 2026-03-28 18:09 | - | |
| Multiplicity/ | 2026-03-28 18:09 | - | |
| MyDrive/ | 2026-03-28 18:09 | - | |
| MyDrive Connect/ | 2026-03-28 18:09 | - | |
| MyHeritage/ | 2026-03-28 18:09 | - | |
| NDI, TxNDI/ | 2026-03-28 18:09 | - | |
| NFS/ | 2026-03-28 18:09 | - | |
| NLE/ | 2026-03-28 18:09 | - | |
| NTBackup/ | 2026-03-28 18:09 | - | |
| NTP/ | 2026-03-28 18:09 | - | |
| Navdata Center/ | 2026-03-28 18:09 | - | |
| Navigraph/ | 2026-03-28 18:09 | - | |
| NavigraphHub/ | 2026-03-28 18:09 | - | |
| Nekoray/ | 2026-03-28 18:10 | - | |
| NetEase/ | 2026-03-28 18:09 | - | |
| Network-Interfaces/ | 2026-03-28 18:10 | - | |
| Network-Management/ | 2026-03-28 18:10 | - | |
| Network analysis/ | 2026-03-28 18:10 | - | |
| Network devices/ | 2026-03-28 18:10 | - | |
| Network information/ | 2026-03-28 18:10 | - | |
| Niconico Live Encoder/ | 2026-03-28 18:09 | - | |
| NoteHighlight 2016/ | 2026-03-28 18:10 | - | |
| NyameBox/ | 2026-03-28 18:10 | - | |
| OST/ | 2026-03-28 18:09 | - | |
| OTF/ | 2026-03-28 18:09 | - | |
| OpenDNS/ | 2026-03-28 18:09 | - | |
| Optimizer/ | 2026-03-28 18:09 | - | |
| Optimizers/ | 2026-03-28 18:10 | - | |
| PACS/ | 2026-03-28 18:09 | - | |
| PE32+/ | 2026-03-28 18:09 | - | |
| PE32/ | 2026-03-28 18:09 | - | |
| PIMS/ | 2026-03-28 18:09 | - | |
| PKCS/ | 2026-03-28 18:10 | - | |
| POTA/ | 2026-03-28 18:09 | - | |
| PS Remote Play/ | 2026-03-28 18:10 | - | |
| PST/ | 2026-03-28 18:09 | - | |
| Package Creation/ | 2026-03-28 18:09 | - | |
| Partition_Recovery/ | 2026-03-28 18:09 | - | |
| Password Reset/ | 2026-03-28 18:10 | - | |
| Peer-to-peer-chat-tool/ | 2026-03-28 18:10 | - | |
| Personal/ | 2026-03-28 18:10 | - | |
| Phigros/ | 2026-03-28 18:10 | - | |
| PlayStation Remote Play/ | 2026-03-28 18:10 | - | |
| Plotter/ | 2026-03-28 18:09 | - | |
| Pool/ | 2026-03-28 18:10 | - | |
| Port-Scanning/ | 2026-03-28 18:10 | - | |
| PortableApp/ | 2026-03-28 18:09 | - | |
| Portuguese/ | 2026-03-28 18:09 | - | |
| PowerBuilder-2025/ | 2026-03-28 18:09 | - | |
| PowerBuilder/ | 2026-03-28 18:09 | - | |
| PowerToysRun/ | 2026-03-28 18:09 | - | |
| PowerVR/ | 2026-03-28 18:09 | - | |
| Pre-installed apps/ | 2026-03-28 18:10 | - | |
| Privacy control/ | 2026-03-28 18:10 | - | |
| Produção/ | 2026-03-28 18:10 | - | |
| Producer/ | 2026-03-28 18:09 | - | |
| Profiler/ | 2026-03-28 18:09 | - | |
| Property/ | 2026-03-28 18:09 | - | |
| Puzzle/ | 2026-03-28 18:09 | - | |
| Python integration/ | 2026-03-28 18:09 | - | |
| QES/ | 2026-03-28 18:09 | - | |
| QR-Code/ | 2026-03-28 18:09 | - | |
| Qualidade/ | 2026-03-28 18:10 | - | |
| Query/ | 2026-03-28 18:09 | - | |
| Queue/ | 2026-03-28 18:09 | - | |
| QuickBooks/ | 2026-03-28 18:10 | - | |
| RAM-Disk/ | 2026-03-28 18:09 | - | |
| RAM-Disks/ | 2026-03-28 18:10 | - | |
| RDS/ | 2026-03-28 18:10 | - | |
| RH/ | 2026-03-28 18:10 | - | |
| RIS/ | 2026-03-28 18:10 | - | |
| RS232/ | 2026-03-28 18:09 | - | |
| RS485/ | 2026-03-28 18:09 | - | |
| Random/ | 2026-03-28 18:09 | - | |
| RandomData/ | 2026-03-28 18:09 | - | |
| Random Data Generator/ | 2026-03-28 18:09 | - | |
| Real-Time Sync/ | 2026-03-28 18:09 | - | |
| Real-time monitoring/ | 2026-03-28 18:10 | - | |
| Relocator/ | 2026-03-28 18:10 | - | |
| Replicate/ | 2026-03-28 18:10 | - | |
| Requester/ | 2026-03-28 18:09 | - | |
| Resistance/ | 2026-03-28 18:10 | - | |
| Restoration/ | 2026-03-28 18:09 | - | |
| Rickrack/ | 2026-03-28 18:09 | - | |
| Roaming/ | 2026-03-28 18:09 | - | |
| Run/ | 2026-03-28 18:09 | - | |
| SCU/ | 2026-03-28 18:09 | - | |
| SF2/ | 2026-03-28 18:09 | - | |
| SHA-1/ | 2026-03-28 18:09 | - | |
| SHA-256/ | 2026-03-28 18:09 | - | |
| SHA-512/ | 2026-03-28 18:10 | - | |
| SMBIOS/ | 2026-03-28 18:09 | - | |
| SOCKS/ | 2026-03-28 18:09 | - | |
| SOTA/ | 2026-03-28 18:09 | - | |
| SRT/ | 2026-03-28 18:09 | - | |
| Safety/ | 2026-03-28 18:09 | - | |
| Sangfor/ | 2026-03-28 18:09 | - | |
| Scraping/ | 2026-03-28 18:10 | - | |
| Scrum/ | 2026-03-28 18:10 | - | |
| Secure Deletion/ | 2026-03-28 18:10 | - | |
| SecureExchanges/ | 2026-03-28 18:10 | - | |
| Secured/ | 2026-03-28 18:10 | - | |
| Security settings/ | 2026-03-28 18:10 | - | |
| Servant Voice/ | 2026-03-28 18:10 | - | |
| Serviços/ | 2026-03-28 18:10 | - | |
| Service-Discovery/ | 2026-03-28 18:09 | - | |
| Sfondi/ | 2026-03-28 18:09 | - | |
| ShadowTLS/ | 2026-03-28 18:10 | - | |
| Shareware/ | 2026-03-28 18:09 | - | |
| Sidetone/ | 2026-03-28 18:09 | - | |
| Signing/ | 2026-03-28 18:09 | - | |
| Silence/ | 2026-03-28 18:10 | - | |
| Simulation/ | 2026-03-28 18:09 | - | |
| Sistema de Gestão Empresarial/ | 2026-03-28 18:10 | - | |
| Sitemap/ | 2026-03-28 18:09 | - | |
| Slate/ | 2026-03-28 18:09 | - | |
| Software Installer/ | 2026-03-28 18:09 | - | |
| Song Presentation/ | 2026-03-28 18:10 | - | |
| Sort Images/ | 2026-03-28 18:09 | - | |
| Soundboard/ | 2026-03-28 18:09 | - | |
| Soundfont/ | 2026-03-28 18:09 | - | |
| Spanish/ | 2026-03-28 18:09 | - | |
| Speech2Text/ | 2026-03-28 18:09 | - | |
| Speed Github/ | 2026-03-28 18:09 | - | |
| Splitter/ | 2026-03-28 18:09 | - | |
| Spy/ | 2026-03-28 18:09 | - | |
| Stealth/ | 2026-03-28 18:09 | - | |
| Steelseries/ | 2026-03-28 18:09 | - | |
| Sticky/ | 2026-03-28 18:09 | - | |
| Stripper/ | 2026-03-28 18:10 | - | |
| Stuff/ | 2026-03-28 18:09 | - | |
| Subnet-Scanner/ | 2026-03-28 18:10 | - | |
| Sucrose/ | 2026-03-28 18:09 | - | |
| Support tool/ | 2026-03-28 18:10 | - | |
| SurQL/ | 2026-03-28 18:09 | - | |
| SurrealDB/ | 2026-03-28 18:09 | - | |
| SurrealQL/ | 2026-03-28 18:09 | - | |
| Swedish/ | 2026-03-28 18:09 | - | |
| Switcher/ | 2026-03-28 18:09 | - | |
| Synchronize/ | 2026-03-28 18:10 | - | |
| Syncthing/ | 2026-03-28 18:09 | - | |
| Syslog/ | 2026-03-28 18:10 | - | |
| System-Utilities/ | 2026-03-28 18:10 | - | |
| System Maintenance/ | 2026-03-28 18:10 | - | |
| SystemUtilities/ | 2026-03-28 18:09 | - | |
| System information/ | 2026-03-28 18:10 | - | |
| TIFF/ | 2026-03-28 18:09 | - | |
| TLDs/ | 2026-03-28 18:09 | - | |
| TSW/ | 2026-03-28 18:10 | - | |
| TXT/ | 2026-03-28 18:09 | - | |
| Telemetry disable/ | 2026-03-28 18:10 | - | |
| Temporary/ | 2026-03-28 18:09 | - | |
| Terraform Wrapper/ | 2026-03-28 18:09 | - | |
| Text2MP3/ | 2026-03-28 18:10 | - | |
| TextToSpeech/ | 2026-03-28 18:09 | - | |
| TextTool/ | 2026-03-28 18:09 | - | |
| Texts/ | 2026-03-28 18:10 | - | |
| Texture/ | 2026-03-28 18:09 | - | |
| TheBat/ | 2026-03-28 18:09 | - | |
| Throne/ | 2026-03-28 18:10 | - | |
| Thumbnails/ | 2026-03-28 18:09 | - | |
| Tiling/ | 2026-03-28 18:09 | - | |
| Trace/ | 2026-03-28 18:09 | - | |
| Tracer/ | 2026-03-28 18:09 | - | |
| Trial/ | 2026-03-28 18:09 | - | |
| Trusted Platform/ | 2026-03-28 18:09 | - | |
| Tuner/ | 2026-03-28 18:09 | - | |
| TxtMark/ | 2026-03-28 18:10 | - | |
| UEFITool/ | 2026-03-28 18:09 | - | |
| UFS/ | 2026-03-28 18:10 | - | |
| URL/ | 2026-03-28 18:09 | - | |
| USB-over-Internet/ | 2026-03-28 18:09 | - | |
| USB-over-network/ | 2026-03-28 18:09 | - | |
| USB-to-IP/ | 2026-03-28 18:09 | - | |
| Umbrella/ | 2026-03-28 18:09 | - | |
| Unerase/ | 2026-03-28 18:10 | - | |
| Uneraser/ | 2026-03-28 18:09 | - | |
| Upscaler/ | 2026-03-28 18:09 | - | |
| Uptime/ | 2026-03-28 18:09 | - | |
| VCF/ | 2026-03-28 18:09 | - | |
| VLESS/ | 2026-03-28 18:09 | - | |
| VMDK/ | 2026-03-28 18:10 | - | |
| VMFS/ | 2026-03-28 18:10 | - | |
| VMware/ | 2026-03-28 18:09 | - | |
| VR180/ | 2026-03-28 18:09 | - | |
| Vector/ | 2026-03-28 18:09 | - | |
| Vendas/ | 2026-03-28 18:10 | - | |
| Via/ | 2026-03-28 18:09 | - | |
| Video2Photos/ | 2026-03-28 18:09 | - | |
| VideoSpeedConversionTool/ | 2026-03-28 18:09 | - | |
| View/ | 2026-03-28 18:09 | - | |
| Vinyl/ | 2026-03-28 18:09 | - | |
| Visualizer/ | 2026-03-28 18:10 | - | |
| Vmess/ | 2026-03-28 18:09 | - | |
| VxD/ | 2026-03-28 18:09 | - | |
| WAB/ | 2026-03-28 18:09 | - | |
| WHO/ | 2026-03-28 18:10 | - | |
| WIC/ | 2026-03-28 18:09 | - | |
| WK/ | 2026-03-28 18:10 | - | |
| Watcher/ | 2026-03-28 18:09 | - | |
| WebNFS/ | 2026-03-28 18:09 | - | |
| WiGUI/ | 2026-03-28 18:09 | - | |
| WiMP/ | 2026-03-28 18:09 | - | |
| Windows 10/ | 2026-03-28 18:10 | - | |
| WindowsBackup/ | 2026-03-28 18:09 | - | |
| Windows Defender/ | 2026-03-28 18:09 | - | |
| Windows HDR/ | 2026-03-28 18:09 | - | |
| Windows Installer/ | 2026-03-28 18:09 | - | |
| Wordlist/ | 2026-03-28 18:10 | - | |
| Words/ | 2026-03-28 18:10 | - | |
| WorkStation/ | 2026-03-28 18:09 | - | |
| Worklist/ | 2026-03-28 18:10 | - | |
| XLS/ | 2026-03-28 18:09 | - | |
| XRP/ | 2026-03-28 18:10 | - | |
| Z80/ | 2026-03-28 18:09 | - | |
| ZNotify/ | 2026-03-28 18:10 | - | |
| a6/ | 2026-03-28 18:09 | - | |
| a7800hawk atari7800 vectrexhawk/ | 2026-03-28 18:10 | - | |
| aab/ | 2026-03-28 18:09 | - | |
| aac-decoding/ | 2026-03-28 18:09 | - | |
| aac/ | 2026-03-28 18:09 | - | |
| aad/ | 2026-03-28 18:09 | - | |
| aadhaar/ | 2026-03-28 18:09 | - | |
| aadhar/ | 2026-03-28 18:09 | - | |
| aam/ | 2026-03-28 18:09 | - | |
| aarch32/ | 2026-03-28 18:09 | - | |
| aarch64/ | 2026-03-28 18:09 | - | |
| abac/ | 2026-03-28 18:09 | - | |
| abc/ | 2026-03-28 18:09 | - | |
| ableton-link/ | 2026-03-28 18:09 | - | |
| above/ | 2026-03-28 18:09 | - | |
| abricotine/ | 2026-03-28 18:09 | - | |
| ac/ | 2026-03-28 18:09 | - | |
| ac3/ | 2026-03-28 18:09 | - | |
| academics/ | 2026-03-28 18:09 | - | |
| accelerate/ | 2026-03-28 18:09 | - | |
| accelerator/ | 2026-03-28 18:09 | - | |
| accentedcharacters/ | 2026-03-28 18:09 | - | |
| access-control/ | 2026-03-28 18:09 | - | |
| access/ | 2026-03-28 18:09 | - | |
| accessability/ | 2026-03-28 18:10 | - | |
| accessibility/ | 2026-03-28 18:09 | - | |
| accessible-terminal/ | 2026-03-28 18:09 | - | |
| accessible/ | 2026-03-28 18:10 | - | |
| accompaniment/ | 2026-03-28 18:09 | - | |
| account-lockout-status/ | 2026-03-28 18:09 | - | |
| account-reset/ | 2026-03-28 18:09 | - | |
| account-switcher/ | 2026-03-28 18:09 | - | |
| account/ | 2026-03-28 18:09 | - | |
| accounting/ | 2026-03-28 18:09 | - | |
| acfun/ | 2026-03-28 18:10 | - | |
| achievement-tracker/ | 2026-03-28 18:09 | - | |
| achievement/ | 2026-03-28 18:09 | - | |
| achievements/ | 2026-03-28 18:10 | - | |
| acme-client/ | 2026-03-28 18:09 | - | |
| acme/ | 2026-03-28 18:09 | - | |
| acoustics/ | 2026-03-28 18:10 | - | |
| acoustid/ | 2026-03-28 18:09 | - | |
| acr/ | 2026-03-28 18:09 | - | |
| acrylic/ | 2026-03-28 18:09 | - | |
| acs/ | 2026-03-28 18:10 | - | |
| acsccid.inf/ | 2026-03-28 18:10 | - | |
| acsdrv.inf/ | 2026-03-28 18:09 | - | |
| act/ | 2026-03-28 18:09 | - | |
| action/ | 2026-03-28 18:10 | - | |
| actionreplay/ | 2026-03-28 18:09 | - | |
| actions/ | 2026-03-28 18:10 | - | |
| actionscript/ | 2026-03-28 18:09 | - | |
| active-data-burner/ | 2026-03-28 18:09 | - | |
| active-directory/ | 2026-03-28 18:09 | - | |
| active-disk-editor/ | 2026-03-28 18:09 | - | |
| active-dvd-eraser/ | 2026-03-28 18:09 | - | |
| active-iso-burner/ | 2026-03-28 18:09 | - | |
| active-iso-manager/ | 2026-03-28 18:10 | - | |
| active-killdisk/ | 2026-03-28 18:09 | - | |
| active-livecd/ | 2026-03-28 18:10 | - | |
| active-partition-recovery/ | 2026-03-28 18:09 | - | |
| active-uneraser/ | 2026-03-28 18:10 | - | |
| active-zdelete/ | 2026-03-28 18:09 | - | |
| active/ | 2026-03-28 18:09 | - | |
| active@-data-burner/ | 2026-03-28 18:09 | - | |
| active@-disk-editor/ | 2026-03-28 18:09 | - | |
| active@-dvd-eraser/ | 2026-03-28 18:09 | - | |
| active@-iso-burner/ | 2026-03-28 18:09 | - | |
| active@-iso-manager/ | 2026-03-28 18:10 | - | |
| active@-livecd/ | 2026-03-28 18:10 | - | |
| active@-partition-recovery/ | 2026-03-28 18:09 | - | |
| active@-uneraser/ | 2026-03-28 18:10 | - | |
| active@-zdelete/ | 2026-03-28 18:09 | - | |
| active@killdisk/ | 2026-03-28 18:09 | - | |
| activedirectory/ | 2026-03-28 18:09 | - | |
| activisionblizzard/ | 2026-03-28 18:09 | - | |
| activity-tracker/ | 2026-03-28 18:09 | - | |
| activity/ | 2026-03-28 18:09 | - | |
| ad-blocker/ | 2026-03-28 18:09 | - | |
| ad/ | 2026-03-28 18:09 | - | |
| ada-2012/ | 2026-03-28 18:09 | - | |
| adalight/ | 2026-03-28 18:09 | - | |
| adalm-pluto-sdr/ | 2026-03-28 18:09 | - | |
| adalm-pluto/ | 2026-03-28 18:09 | - | |
| adapter/ | 2026-03-28 18:09 | - | |
| adaptive-multi-rate/ | 2026-03-28 18:10 | - | |
| adata-ssd-toolbox/ | 2026-03-28 18:09 | - | |
| adb/ | 2026-03-28 18:09 | - | |
| adbc/ | 2026-03-28 18:09 | - | |
| adblock/ | 2026-03-28 18:09 | - | |
| adblocker/ | 2026-03-28 18:09 | - | |
| adblocking/ | 2026-03-28 18:09 | - | |
| adcleaner/ | 2026-03-28 18:09 | - | |
| add-in/ | 2026-03-28 18:09 | - | |
| add-on/ | 2026-03-28 18:09 | - | |
| add-overlay/ | 2026-03-28 18:09 | - | |
| add-watermark/ | 2026-03-28 18:09 | - | |
| addon/ | 2026-03-28 18:09 | - | |
| address/ | 2026-03-28 18:10 | - | |
| adguard/ | 2026-03-28 18:09 | - | |
| adguardsyntax/ | 2026-03-28 18:09 | - | |
| adhd/ | 2026-03-28 18:09 | - | |
| adk/ | 2026-03-28 18:09 | - | |
| adler32/ | 2026-03-28 18:10 | - | |
| admin/ | 2026-03-28 18:09 | - | |
| administration/ | 2026-03-28 18:09 | - | |
| administrator/ | 2026-03-28 18:09 | - | |
| ado/ | 2026-03-28 18:09 | - | |
| adobe-aftereffects/ | 2026-03-28 18:09 | - | |
| adobe-creative-cloud-desktop/ | 2026-03-28 18:09 | - | |
| adobe-premiere-pro/ | 2026-03-28 18:09 | - | |
| adobe-premiere-rush/ | 2026-03-28 18:09 | - | |
| adobeacrobat/ | 2026-03-28 18:09 | - | |
| adobeaftereffects/ | 2026-03-28 18:09 | - | |
| adobecreativeclouddesktop/ | 2026-03-28 18:09 | - | |
| adobemediaencoder/ | 2026-03-28 18:09 | - | |
| adobepremierepro/ | 2026-03-28 18:09 | - | |
| adobepremiererush/ | 2026-03-28 18:09 | - | |
| adobereader/ | 2026-03-28 18:09 | - | |
| adoc/ | 2026-03-28 18:09 | - | |
| adoptium/ | 2026-03-28 18:10 | - | |
| adrms/ | 2026-03-28 18:09 | - | |
| ads/ | 2026-03-28 18:09 | - | |
| advanced-combat-tracker/ | 2026-03-28 18:09 | - | |
| advancedcardsystems/ | 2026-03-28 18:09 | - | |
| adventure/ | 2026-03-28 18:09 | - | |
| adventuregame/ | 2026-03-28 18:10 | - | |
| advertisement/ | 2026-03-28 18:09 | - | |
| adx/ | 2026-03-28 18:09 | - | |
| aegis/ | 2026-03-28 18:09 | - | |
| aero/ | 2026-03-28 18:09 | - | |
| aeroglass/ | 2026-03-28 18:09 | - | |
| aes-256/ | 2026-03-28 18:09 | - | |
| aes/ | 2026-03-28 18:09 | - | |
| aether-gazer/ | 2026-03-28 18:10 | - | |
| affinity/ | 2026-03-28 18:09 | - | |
| after-sales/ | 2026-03-28 18:10 | - | |
| age-encryption/ | 2026-03-28 18:10 | - | |
| age-of-empires/ | 2026-03-28 18:09 | - | |
| age/ | 2026-03-28 18:09 | - | |
| agenda/ | 2026-03-28 18:09 | - | |
| agent-based/ | 2026-03-28 18:09 | - | |
| agent-based modelling/ | 2026-03-28 18:09 | - | |
| agent-bridge/ | 2026-03-28 18:09 | - | |
| agent-skills/ | 2026-03-28 18:09 | - | |
| agentic/ | 2026-03-28 18:09 | - | |
| agents/ | 2026-03-28 18:09 | - | |
| aggregation/ | 2026-03-28 18:10 | - | |
| aggregator/ | 2026-03-28 18:09 | - | |
| agh/ | 2026-03-28 18:09 | - | |
| agile/ | 2026-03-28 18:10 | - | |
| agilent/ | 2026-03-28 18:10 | - | |
| agnostic/ | 2026-03-28 18:09 | - | |
| agricultural-bank-of-china/ | 2026-03-28 18:09 | - | |
| agwapi/ | 2026-03-28 18:09 | - | |
| ahk/ | 2026-03-28 18:09 | - | |
| ai-agent/ | 2026-03-28 18:09 | - | |
| ai-agents/ | 2026-03-28 18:09 | - | |
| ai-app-builder/ | 2026-03-28 18:09 | - | |
| ai-chat/ | 2026-03-28 18:09 | - | |
| ai-infrastructure/ | 2026-03-28 18:10 | - | |
| ai-life/ | 2026-03-28 18:10 | - | |
| ai-singer/ | 2026-03-28 18:09 | - | |
| ai-subtitles/ | 2026-03-28 18:09 | - | |
| ai-tools/ | 2026-03-28 18:09 | - | |
| ai/ | 2026-03-28 18:09 | - | |
| aim/ | 2026-03-28 18:09 | - | |
| aimtunes/ | 2026-03-28 18:10 | - | |
| aiproject/ | 2026-03-28 18:09 | - | |
| air/ | 2026-03-28 18:09 | - | |
| airbus/ | 2026-03-28 18:09 | - | |
| aircraftbands/ | 2026-03-28 18:09 | - | |
| aircrafttracking/ | 2026-03-28 18:09 | - | |
| airflow-cli/ | 2026-03-28 18:10 | - | |
| airplane/ | 2026-03-28 18:09 | - | |
| airplanemap/ | 2026-03-28 18:09 | - | |
| airplay/ | 2026-03-28 18:09 | - | |
| airpods/ | 2026-03-28 18:10 | - | |
| airportbasestation/ | 2026-03-28 18:09 | - | |
| airportdisk/ | 2026-03-28 18:09 | - | |
| airportexpress/ | 2026-03-28 18:09 | - | |
| airportextremebasestation/ | 2026-03-28 18:09 | - | |
| airporttimecapsule/ | 2026-03-28 18:09 | - | |
| airportutility/ | 2026-03-28 18:09 | - | |
| airprint/ | 2026-03-28 18:09 | - | |
| airsonic/ | 2026-03-28 18:09 | - | |
| airspy/ | 2026-03-28 18:09 | - | |
| airspyhf/ | 2026-03-28 18:09 | - | |
| airspyhfplus/ | 2026-03-28 18:09 | - | |
| airspymini/ | 2026-03-28 18:09 | - | |
| airspyr0/ | 2026-03-28 18:09 | - | |
| airspyr2/ | 2026-03-28 18:09 | - | |
| airvpn/ | 2026-03-28 18:09 | - | |
| ais/ | 2026-03-28 18:10 | - | |
| akg/ | 2026-03-28 18:09 | - | |
| akkoma/ | 2026-03-28 18:09 | - | |
| akregator/ | 2026-03-28 18:09 | - | |
| aks/ | 2026-03-28 18:09 | - | |
| alac/ | 2026-03-28 18:09 | - | |
| alarm-clock/ | 2026-03-28 18:10 | - | |
| alarm/ | 2026-03-28 18:09 | - | |
| albiruni/ | 2026-03-28 18:09 | - | |
| album/ | 2026-03-28 18:09 | - | |
| albums/ | 2026-03-28 18:09 | - | |
| alderlake/ | 2026-03-28 18:09 | - | |
| alert/ | 2026-03-28 18:09 | - | |
| alerting/ | 2026-03-28 18:09 | - | |
| aleth/ | 2026-03-28 18:09 | - | |
| alexandruavadanii/ | 2026-03-28 18:10 | - | |
| alf/ | 2026-03-28 18:09 | - | |
| alfred/ | 2026-03-28 18:09 | - | |
| algebra/ | 2026-03-28 18:09 | - | |
| algernon/ | 2026-03-28 18:10 | - | |
| algokit/ | 2026-03-28 18:09 | - | |
| algorithm/ | 2026-03-28 18:09 | - | |
| aliae/ | 2026-03-28 18:09 | - | |
| alibaba-cloud/ | 2026-03-28 18:09 | - | |
| alibata/ | 2026-03-28 18:09 | - | |
| alienfx-usb-controller/ | 2026-03-28 18:09 | - | |
| alienfx/ | 2026-03-28 18:09 | - | |
| alienware-computer/ | 2026-03-28 18:09 | - | |
| alienware-fans/ | 2026-03-28 18:09 | - | |
| alienware/ | 2026-03-28 18:09 | - | |
| alignment/ | 2026-03-28 18:09 | - | |
| alipay/ | 2026-03-28 18:09 | - | |
| alist/ | 2026-03-28 18:10 | - | |
| aliyun/ | 2026-03-28 18:09 | - | |
| aliyundrive/ | 2026-03-28 18:10 | - | |
| all-dll-deps/ | 2026-03-28 18:09 | - | |
| all-dlls-dependencies/ | 2026-03-28 18:09 | - | |
| all-in-one/ | 2026-03-28 18:09 | - | |
| alldlldeps/ | 2026-03-28 18:09 | - | |
| alloy/ | 2026-03-28 18:09 | - | |
| allround/ | 2026-03-28 18:09 | - | |
| alm/ | 2026-03-28 18:09 | - | |
| alpaca/ | 2026-03-28 18:09 | - | |
| alpine/ | 2026-03-28 18:09 | - | |
| alquran/ | 2026-03-28 18:10 | - | |
| alsa/ | 2026-03-28 18:09 | - | |
| alt-key/ | 2026-03-28 18:10 | - | |
| alt-tab-switcher/ | 2026-03-28 18:09 | - | |
| alt-tab-terminator/ | 2026-03-28 18:09 | - | |
| alt-tab/ | 2026-03-28 18:09 | - | |
| altdrag/ | 2026-03-28 18:09 | - | |
| altsnap/ | 2026-03-28 18:09 | - | |
| altstore/ | 2026-03-28 18:09 | - | |
| always-on-top/ | 2026-03-28 18:09 | - | |
| ama/ | 2026-03-28 18:09 | - | |
| amateur-radio/ | 2026-03-28 18:09 | - | |
| amateurradio/ | 2026-03-28 18:10 | - | |
| amazon-aurora/ | 2026-03-28 18:09 | - | |
| amazon-rds/ | 2026-03-28 18:09 | - | |
| amazon-redshift/ | 2026-03-28 18:09 | - | |
| amazon-web-services/ | 2026-03-28 18:09 | - | |
| amazon/ | 2026-03-28 18:09 | - | |
| ambient-light/ | 2026-03-28 18:09 | - | |
| ambient-lighting/ | 2026-03-28 18:09 | - | |
| ambient/ | 2026-03-28 18:09 | - | |
| ambilight/ | 2026-03-28 18:09 | - | |
| amd-cpu/ | 2026-03-28 18:09 | - | |
| amd/ | 2026-03-28 18:09 | - | |
| amd64/ | 2026-03-28 18:09 | - | |
| amds/ | 2026-03-28 18:09 | - | |
| america-online/ | 2026-03-28 18:10 | - | |
| americaonline/ | 2026-03-28 18:10 | - | |
| amiga/ | 2026-03-28 18:10 | - | |
| amiibo/ | 2026-03-28 18:09 | - | |
| amira/ | 2026-03-28 18:09 | - | |
| amongus/ | 2026-03-28 18:09 | - | |
| amradio/ | 2026-03-28 18:09 | - | |
| anaconda/ | 2026-03-28 18:09 | - | |
| analogue-pocket-sync/ | 2026-03-28 18:09 | - | |
| analyser/ | 2026-03-28 18:10 | - | |
| analysing/ | 2026-03-28 18:10 | - | |
| analysis-framework/ | 2026-03-28 18:09 | - | |
| analysis-tool/ | 2026-03-28 18:09 | - | |
| analysis/ | 2026-03-28 18:09 | - | |
| analytics/ | 2026-03-28 18:09 | - | |
| analyzer/ | 2026-03-28 18:09 | - | |
| analyzing/ | 2026-03-28 18:09 | - | |
| ancestry/ | 2026-03-28 18:09 | - | |
| anchor/ | 2026-03-28 18:09 | - | |
| android-app/ | 2026-03-28 18:09 | - | |
| android-application/ | 2026-03-28 18:09 | - | |
| android-input/ | 2026-03-28 18:09 | - | |
| android-keyboard/ | 2026-03-28 18:09 | - | |
| android-sdk/ | 2026-03-28 18:09 | - | |
| android/ | 2026-03-28 18:09 | - | |
| android_winusb2.inf/ | 2026-03-28 18:09 | - | |
| androidapps/ | 2026-03-28 18:09 | - | |
| androidsmartphones/ | 2026-03-28 18:09 | - | |
| androidstudio/ | 2026-03-28 18:09 | - | |
| andromeda/ | 2026-03-28 18:09 | - | |
| angle/ | 2026-03-28 18:09 | - | |
| angrymiao/ | 2026-03-28 18:09 | - | |
| angular/ | 2026-03-28 18:09 | - | |
| angularjs/ | 2026-03-28 18:09 | - | |
| anilist/ | 2026-03-28 18:09 | - | |
| animalcrossing/ | 2026-03-28 18:09 | - | |
| animate/ | 2026-03-28 18:10 | - | |
| animated-gif/ | 2026-03-28 18:09 | - | |
| animated-images/ | 2026-03-28 18:09 | - | |
| animated/ | 2026-03-28 18:09 | - | |
| animation/ | 2026-03-28 18:09 | - | |
| animations/ | 2026-03-28 18:09 | - | |
| anime-downloader/ | 2026-03-28 18:09 | - | |
| anime-library/ | 2026-03-28 18:09 | - | |
| anime-streaming/ | 2026-03-28 18:09 | - | |
| anime-watchlist.-anime-browser/ | 2026-03-28 18:09 | - | |
| anime/ | 2026-03-28 18:09 | - | |
| anime4k/ | 2026-03-28 18:09 | - | |
| anireel/ | 2026-03-28 18:09 | - | |
| anker/ | 2026-03-28 18:09 | - | |
| annotate/ | 2026-03-28 18:09 | - | |
| annotation/ | 2026-03-28 18:09 | - | |
| annotations/ | 2026-03-28 18:09 | - | |
| anonymity/ | 2026-03-28 18:09 | - | |
| anonymizer/ | 2026-03-28 18:09 | - | |
| anonymous-chat/ | 2026-03-28 18:09 | - | |
| anonymous-messenge/ | 2026-03-28 18:09 | - | |
| anonymous/ | 2026-03-28 18:09 | - | |
| ansi-codes/ | 2026-03-28 18:10 | - | |
| ansi/ | 2026-03-28 18:09 | - | |
| ant-design/ | 2026-03-28 18:10 | - | |
| antenna/ | 2026-03-28 18:10 | - | |
| anthropic-api/ | 2026-03-28 18:10 | - | |
| anthropic/ | 2026-03-28 18:09 | - | |
| anti-ad/ | 2026-03-28 18:09 | - | |
| anti-censorship/ | 2026-03-28 18:10 | - | |
| anti-cheat/ | 2026-03-28 18:10 | - | |
| anti-copilot/ | 2026-03-28 18:09 | - | |
| anti-dns-poisoning/ | 2026-03-28 18:10 | - | |
| anti-edgebrowser/ | 2026-03-28 18:09 | - | |
| anti-malware/ | 2026-03-28 18:09 | - | |
| anti-microsoftedge/ | 2026-03-28 18:09 | - | |
| anti-msedge/ | 2026-03-28 18:09 | - | |
| anti-pop-ups/ | 2026-03-28 18:09 | - | |
| anti-recall/ | 2026-03-28 18:09 | - | |
| anti-revoke/ | 2026-03-28 18:09 | - | |
| anti-theft/ | 2026-03-28 18:10 | - | |
| anti-throttling/ | 2026-03-28 18:09 | - | |
| anti-virus/ | 2026-03-28 18:09 | - | |
| antiadvertisements/ | 2026-03-28 18:09 | - | |
| antibloatware/ | 2026-03-28 18:09 | - | |
| anticensorship/ | 2026-03-28 18:09 | - | |
| anticheat/ | 2026-03-28 18:09 | - | |
| antigravity/ | 2026-03-28 18:09 | - | |
| antimalware/ | 2026-03-28 18:09 | - | |
| antipopups/ | 2026-03-28 18:09 | - | |
| antispam/ | 2026-03-28 18:09 | - | |
| antithreat/ | 2026-03-28 18:09 | - | |
| antitracker/ | 2026-03-28 18:10 | - | |
| antitrackers/ | 2026-03-28 18:09 | - | |
| antitracking/ | 2026-03-28 18:09 | - | |
| antivirus/ | 2026-03-28 18:09 | - | |
| antlr/ | 2026-03-28 18:09 | - | |
| anydesk/ | 2026-03-28 18:09 | - | |
| anyglobechanger/ | 2026-03-28 18:10 | - | |
| anyquery/ | 2026-03-28 18:09 | - | |
| ao10003/ | 2026-03-28 18:09 | - | |
| aoe/ | 2026-03-28 18:09 | - | |
| aol-removal-tool/ | 2026-03-28 18:10 | - | |
| aorus/ | 2026-03-28 18:09 | - | |
| ap7capture/ | 2026-03-28 18:09 | - | |
| apa102/ | 2026-03-28 18:09 | - | |
| apache-arrow/ | 2026-03-28 18:09 | - | |
| apache-hive/ | 2026-03-28 18:09 | - | |
| apache/ | 2026-03-28 18:09 | - | |
| apache kafka/ | 2026-03-28 18:09 | - | |
| apap/ | 2026-03-28 18:09 | - | |
| ape/ | 2026-03-28 18:09 | - | |
| apex-legends/ | 2026-03-28 18:09 | - | |
| apex/ | 2026-03-28 18:09 | - | |
| apexlegends/ | 2026-03-28 18:09 | - | |
| apfs/ | 2026-03-28 18:09 | - | |
| api-client/ | 2026-03-28 18:09 | - | |
| api-documentation/ | 2026-03-28 18:09 | - | |
| api-gateway/ | 2026-03-28 18:09 | - | |
| api-management/ | 2026-03-28 18:09 | - | |
| api-testing/ | 2026-03-28 18:09 | - | |
| api/ | 2026-03-28 18:09 | - | |
| apk-decompiler/ | 2026-03-28 18:09 | - | |
| apk-editor/ | 2026-03-28 18:09 | - | |
| apk-installer/ | 2026-03-28 18:09 | - | |
| apk/ | 2026-03-28 18:09 | - | |
| apksigner/ | 2026-03-28 18:09 | - | |
| apksignergui/ | 2026-03-28 18:09 | - | |
| apktool/ | 2026-03-28 18:09 | - | |
| apm/ | 2026-03-28 18:09 | - | |
| apng/ | 2026-03-28 18:09 | - | |
| apogee/ | 2026-03-28 18:09 | - | |
| app-control-policies/ | 2026-03-28 18:09 | - | |
| app-engine/ | 2026-03-28 18:09 | - | |
| app-finder/ | 2026-03-28 18:09 | - | |
| app-installer-file-builder/ | 2026-03-28 18:09 | - | |
| app-launcher/ | 2026-03-28 18:09 | - | |
| app-management/ | 2026-03-28 18:09 | - | |
| app-store/ | 2026-03-28 18:10 | - | |
| app/ | 2026-03-28 18:09 | - | |
| appbar/ | 2026-03-28 18:09 | - | |
| appbase/ | 2026-03-28 18:10 | - | |
| appcontrolpolicies/ | 2026-03-28 18:09 | - | |
| appimage/ | 2026-03-28 18:09 | - | |
| appinstaller-file-builder/ | 2026-03-28 18:09 | - | |
| appinstaller/ | 2026-03-28 18:09 | - | |
| appium/ | 2026-03-28 18:09 | - | |
| apple-airport/ | 2026-03-28 18:09 | - | |
| apple-design/ | 2026-03-28 18:10 | - | |
| apple-mobile-device-service/ | 2026-03-28 18:09 | - | |
| apple-mobile-device-sub-driver/ | 2026-03-28 18:09 | - | |
| apple-mobile-device-support/ | 2026-03-28 18:09 | - | |
| apple-music-downloader/ | 2026-03-28 18:09 | - | |
| apple-music/ | 2026-03-28 18:10 | - | |
| apple-tv/ | 2026-03-28 18:09 | - | |
| apple/ | 2026-03-28 18:09 | - | |
| appleairport/ | 2026-03-28 18:09 | - | |
| appleii/ | 2026-03-28 18:09 | - | |
| applemobiledevicehelper/ | 2026-03-28 18:09 | - | |
| applemobiledeviceservice/ | 2026-03-28 18:09 | - | |
| applemobiledevicesubdriver/ | 2026-03-28 18:09 | - | |
| applesafari/ | 2026-03-28 18:09 | - | |
| applesyncmapiinterfacehelper/ | 2026-03-28 18:09 | - | |
| applet/ | 2026-03-28 18:09 | - | |
| appletv/ | 2026-03-28 18:09 | - | |
| application-control-for-business/ | 2026-03-28 18:09 | - | |
| application-development/ | 2026-03-28 18:09 | - | |
| application-launcher/ | 2026-03-28 18:09 | - | |
| application-manager/ | 2026-03-28 18:09 | - | |
| application-packaging/ | 2026-03-28 18:09 | - | |
| application-recorder/ | 2026-03-28 18:09 | - | |
| application-uninstaller/ | 2026-03-28 18:09 | - | |
| application/ | 2026-03-28 18:09 | - | |
| applicationcontrolforbusiness/ | 2026-03-28 18:09 | - | |
| applicationrecorder/ | 2026-03-28 18:09 | - | |
| apps/ | 2026-03-28 18:09 | - | |
| appstream/ | 2026-03-28 18:09 | - | |
| appv-to-msix/ | 2026-03-28 18:09 | - | |
| appx/ | 2026-03-28 18:09 | - | |
| appxmanifest/ | 2026-03-28 18:09 | - | |
| appxpackaging/ | 2026-03-28 18:09 | - | |
| apt/ | 2026-03-28 18:09 | - | |
| aptos/ | 2026-03-28 18:09 | - | |
| aputil/ | 2026-03-28 18:09 | - | |
| aqc/ | 2026-03-28 18:10 | - | |
| aqnic650.inf/ | 2026-03-28 18:10 | - | |
| aquantia/ | 2026-03-28 18:10 | - | |
| aquashell/ | 2026-03-28 18:09 | - | |
| ar/ | 2026-03-28 18:09 | - | |
| arazzo/ | 2026-03-28 18:10 | - | |
| arc-browser/ | 2026-03-28 18:09 | - | |
| arc/ | 2026-03-28 18:09 | - | |
| arcade/ | 2026-03-28 18:09 | - | |
| arch/ | 2026-03-28 18:09 | - | |
| archimate/ | 2026-03-28 18:09 | - | |
| architect/ | 2026-03-28 18:09 | - | |
| architecture-detector/ | 2026-03-28 18:09 | - | |
| archive-thumbnails/ | 2026-03-28 18:09 | - | |
| archive/ | 2026-03-28 18:09 | - | |
| archivefiles/ | 2026-03-28 18:09 | - | |
| archiveofourown/ | 2026-03-28 18:09 | - | |
| archiver/ | 2026-03-28 18:09 | - | |
| archives/ | 2026-03-28 18:09 | - | |
| archivethumbnails/ | 2026-03-28 18:09 | - | |
| archiving/ | 2026-03-28 18:09 | - | |
| archlinux/ | 2026-03-28 18:10 | - | |
| archos/ | 2026-03-28 18:10 | - | |
| archpr/ | 2026-03-28 18:10 | - | |
| arctis/ | 2026-03-28 18:09 | - | |
| arduino/ | 2026-03-28 18:09 | - | |
| ardulight/ | 2026-03-28 18:10 | - | |
| arena/ | 2026-03-28 18:10 | - | |
| ares/ | 2026-03-28 18:09 | - | |
| ares64 nintendo64 n64/ | 2026-03-28 18:10 | - | |
| argo-tunnel/ | 2026-03-28 18:09 | - | |
| argocd/ | 2026-03-28 18:09 | - | |
| argon2/ | 2026-03-28 18:09 | - | |
| aria2/ | 2026-03-28 18:09 | - | |
| arj/ | 2026-03-28 18:09 | - | |
| arknights/ | 2026-03-28 18:09 | - | |
| arkts/ | 2026-03-28 18:09 | - | |
| arm-template/ | 2026-03-28 18:09 | - | |
| arm/ | 2026-03-28 18:09 | - | |
| arm64/ | 2026-03-28 18:09 | - | |
| arma/ | 2026-03-28 18:09 | - | |
| arma3/ | 2026-03-28 18:09 | - | |
| armbian/ | 2026-03-28 18:09 | - | |
| armcord/ | 2026-03-28 18:09 | - | |
| armor/ | 2026-03-28 18:09 | - | |
| armoury-crate/ | 2026-03-28 18:10 | - | |
| arrange/ | 2026-03-28 18:09 | - | |
| arrangement/ | 2026-03-28 18:09 | - | |
| arrangerworkstations/ | 2026-03-28 18:10 | - | |
| array-language/ | 2026-03-28 18:09 | - | |
| art/ | 2026-03-28 18:09 | - | |
| artha/ | 2026-03-28 18:09 | - | |
| article/ | 2026-03-28 18:09 | - | |
| artifactory/ | 2026-03-28 18:09 | - | |
| artifical-intelligence/ | 2026-03-28 18:09 | - | |
| artificial-intelligence/ | 2026-03-28 18:09 | - | |
| artificialintelligence/ | 2026-03-28 18:09 | - | |
| artikelverwaltung/ | 2026-03-28 18:09 | - | |
| artillery/ | 2026-03-28 18:09 | - | |
| artist/ | 2026-03-28 18:09 | - | |
| artists/ | 2026-03-28 18:09 | - | |
| artnet/ | 2026-03-28 18:09 | - | |
| arturo/ | 2026-03-28 18:09 | - | |
| arw/ | 2026-03-28 18:09 | - | |
| as-path/ | 2026-03-28 18:09 | - | |
| asc-files/ | 2026-03-28 18:10 | - | |
| ascend/ | 2026-03-28 18:10 | - | |
| ascii-art/ | 2026-03-28 18:09 | - | |
| ascii-image-converter/ | 2026-03-28 18:10 | - | |
| ascii-image/ | 2026-03-28 18:10 | - | |
| ascii/ | 2026-03-28 18:09 | - | |
| asciicast/ | 2026-03-28 18:09 | - | |
| asciicast2gif/ | 2026-03-28 18:09 | - | |
| asciidoc/ | 2026-03-28 18:09 | - | |
| asciinema/ | 2026-03-28 18:09 | - | |
| asdf/ | 2026-03-28 18:10 | - | |
| asio/ | 2026-03-28 18:09 | - | |
| askpass/ | 2026-03-28 18:09 | - | |
| asn-lookup/ | 2026-03-28 18:09 | - | |
| asp-net-core/ | 2026-03-28 18:09 | - | |
| asp.net/ | 2026-03-28 18:10 | - | |
| asp/ | 2026-03-28 18:09 | - | |
| aspire/ | 2026-03-28 18:09 | - | |
| aspiro/ | 2026-03-28 18:09 | - | |
| aspnet/ | 2026-03-28 18:09 | - | |
| aspnetcore/ | 2026-03-28 18:09 | - | |
| asr-model/ | 2026-03-28 18:09 | - | |
| asr/ | 2026-03-28 18:09 | - | |
| assembler/ | 2026-03-28 18:09 | - | |
| assembly-binding/ | 2026-03-28 18:09 | - | |
| assembly-language/ | 2026-03-28 18:09 | - | |
| assembly/ | 2026-03-28 18:09 | - | |
| assemblyai/ | 2026-03-28 18:09 | - | |
| assessment-disaggregation/ | 2026-03-28 18:10 | - | |
| assessment/ | 2026-03-28 18:09 | - | |
| asset/ | 2026-03-28 18:09 | - | |
| assignment/ | 2026-03-28 18:09 | - | |
| assistant-2/ | 2026-03-28 18:09 | - | |
| assistant/ | 2026-03-28 18:09 | - | |
| ast/ | 2026-03-28 18:09 | - | |
| astral/ | 2026-03-28 18:09 | - | |
| astro-cli/ | 2026-03-28 18:10 | - | |
| astronomer-cli/ | 2026-03-28 18:10 | - | |
| astronomy/ | 2026-03-28 18:09 | - | |
| asus-display-settings/ | 2026-03-28 18:10 | - | |
| asus-display-widget-center/ | 2026-03-28 18:10 | - | |
| asus-monitor-settings/ | 2026-03-28 18:10 | - | |
| asus-screen-settings/ | 2026-03-28 18:10 | - | |
| asus-zephyrus/ | 2026-03-28 18:09 | - | |
| asus/ | 2026-03-28 18:09 | - | |
| asusdisplaysettings/ | 2026-03-28 18:10 | - | |
| asusmonitorsettings/ | 2026-03-28 18:10 | - | |
| asusscreensettings/ | 2026-03-28 18:10 | - | |
| async/ | 2026-03-28 18:10 | - | |
| asyncio/ | 2026-03-28 18:09 | - | |
| atc/ | 2026-03-28 18:10 | - | |
| atlas/ | 2026-03-28 18:09 | - | |
| atlassian/ | 2026-03-28 18:09 | - | |
| atmega/ | 2026-03-28 18:09 | - | |
| atmel/ | 2026-03-28 18:09 | - | |
| atmos/ | 2026-03-28 18:10 | - | |
| atom/ | 2026-03-28 18:09 | - | |
| atomic-swap/ | 2026-03-28 18:09 | - | |
| atsc/ | 2026-03-28 18:10 | - | |
| attacks-prevention/ | 2026-03-28 18:09 | - | |
| attendance/ | 2026-03-28 18:09 | - | |
| attiny/ | 2026-03-28 18:09 | - | |
| atvremote/ | 2026-03-28 18:09 | - | |
| audacity/ | 2026-03-28 18:10 | - | |
| audacium/ | 2026-03-28 18:10 | - | |
| audible/ | 2026-03-28 18:09 | - | |
| audient/ | 2026-03-28 18:09 | - | |
| audientusbaudio.inf/ | 2026-03-28 18:09 | - | |
| audientusbaudioks.inf/ | 2026-03-28 18:09 | - | |
| audio-analysis/ | 2026-03-28 18:09 | - | |
| audio-balance/ | 2026-03-28 18:10 | - | |
| audio-capture/ | 2026-03-28 18:09 | - | |
| audio-codec/ | 2026-03-28 18:09 | - | |
| audio-conversion/ | 2026-03-28 18:09 | - | |
| audio-converter/ | 2026-03-28 18:09 | - | |
| audio-downloader/ | 2026-03-28 18:09 | - | |
| audio-editing/ | 2026-03-28 18:09 | - | |
| audio-editor/ | 2026-03-28 18:09 | - | |
| audio-files/ | 2026-03-28 18:09 | - | |
| audio-fingerprinting/ | 2026-03-28 18:09 | - | |
| audio-interface/ | 2026-03-28 18:09 | - | |
| audio-mixer/ | 2026-03-28 18:09 | - | |
| audio-playback/ | 2026-03-28 18:09 | - | |
| audio-player/ | 2026-03-28 18:09 | - | |
| audio-plugin/ | 2026-03-28 18:09 | - | |
| audio-processing/ | 2026-03-28 18:09 | - | |
| audio-reactive/ | 2026-03-28 18:09 | - | |
| audio-recording/ | 2026-03-28 18:09 | - | |
| audio-sharing/ | 2026-03-28 18:10 | - | |
| audio-stream/ | 2026-03-28 18:09 | - | |
| audio-streamer/ | 2026-03-28 18:09 | - | |
| audio-tagger/ | 2026-03-28 18:10 | - | |
| audio-thumbnails/ | 2026-03-28 18:10 | - | |
| audio-unit/ | 2026-03-28 18:09 | - | |
| audio-video/ | 2026-03-28 18:09 | - | |
| audio-visualizer/ | 2026-03-28 18:09 | - | |
| audio/ | 2026-03-28 18:09 | - | |
| audiobalance/ | 2026-03-28 18:10 | - | |
| audiobook/ | 2026-03-28 18:09 | - | |
| audiobooks/ | 2026-03-28 18:09 | - | |
| audiocodec/ | 2026-03-28 18:09 | - | |
| audiodevices/ | 2026-03-28 18:09 | - | |
| audioediting/ | 2026-03-28 18:09 | - | |
| audioeditor/ | 2026-03-28 18:09 | - | |
| audiofiles/ | 2026-03-28 18:09 | - | |
| audiofiltering/ | 2026-03-28 18:09 | - | |
| audiointerface/ | 2026-03-28 18:10 | - | |
| audiolistening/ | 2026-03-28 18:09 | - | |
| audiorecording/ | 2026-03-28 18:09 | - | |
| audiosettings/ | 2026-03-28 18:10 | - | |
| audiosystem/ | 2026-03-28 18:09 | - | |
| audiothumbnails/ | 2026-03-28 18:10 | - | |
| audius/ | 2026-03-28 18:10 | - | |
| augmentation/ | 2026-03-28 18:09 | - | |
| ausweis/ | 2026-03-28 18:09 | - | |
| auth/ | 2026-03-28 18:10 | - | |
| authentication/ | 2026-03-28 18:09 | - | |
| authenticator/ | 2026-03-28 18:09 | - | |
| authlib-injector/ | 2026-03-28 18:09 | - | |
| authorization/ | 2026-03-28 18:09 | - | |
| authpass/ | 2026-03-28 18:09 | - | |
| authy/ | 2026-03-28 18:09 | - | |
| auto-accept/ | 2026-03-28 18:09 | - | |
| auto-adjust/ | 2026-03-28 18:09 | - | |
| auto-buy/ | 2026-03-28 18:09 | - | |
| auto-clicker/ | 2026-03-28 18:09 | - | |
| auto-copy/ | 2026-03-28 18:09 | - | |
| auto-crop/ | 2026-03-28 18:09 | - | |
| auto-dark-mode/ | 2026-03-28 18:09 | - | |
| auto-detect/ | 2026-03-28 18:09 | - | |
| auto-hdr/ | 2026-03-28 18:09 | - | |
| auto-install/ | 2026-03-28 18:10 | - | |
| auto-reload/ | 2026-03-28 18:09 | - | |
| auto-rotate/ | 2026-03-28 18:09 | - | |
| auto-updater/ | 2026-03-28 18:09 | - | |
| auto/ | 2026-03-28 18:09 | - | |
| autoaccept-match/ | 2026-03-28 18:09 | - | |
| autoaccept/ | 2026-03-28 18:09 | - | |
| autobuy/ | 2026-03-28 18:09 | - | |
| autoclicker/ | 2026-03-28 18:09 | - | |
| autodesk/ | 2026-03-28 18:09 | - | |
| autohdr/ | 2026-03-28 18:09 | - | |
| autohotkey/ | 2026-03-28 18:09 | - | |
| autoit-ide/ | 2026-03-28 18:09 | - | |
| autoit/ | 2026-03-28 18:09 | - | |
| autojump/ | 2026-03-28 18:10 | - | |
| automate/ | 2026-03-28 18:09 | - | |
| automated-deployment/ | 2026-03-28 18:09 | - | |
| automatic-https/ | 2026-03-28 18:09 | - | |
| automatic alarm/ | 2026-03-28 18:10 | - | |
| automation/ | 2026-03-28 18:09 | - | |
| autonightmode/ | 2026-03-28 18:09 | - | |
| autonomous-agent/ | 2026-03-28 18:09 | - | |
| autopep8/ | 2026-03-28 18:10 | - | |
| autopilot/ | 2026-03-28 18:10 | - | |
| autopsy/ | 2026-03-28 18:09 | - | |
| autosync/ | 2026-03-28 18:09 | - | |
| av/ | 2026-03-28 18:09 | - | |
| av1/ | 2026-03-28 18:09 | - | |
| availability/ | 2026-03-28 18:10 | - | |
| available-harddisk/ | 2026-03-28 18:10 | - | |
| avalonia-ui/ | 2026-03-28 18:10 | - | |
| avalonia/ | 2026-03-28 18:09 | - | |
| avaloniaui/ | 2026-03-28 18:10 | - | |
| avatar/ | 2026-03-28 18:10 | - | |
| avatarawards/ | 2026-03-28 18:10 | - | |
| avd/ | 2026-03-28 18:10 | - | |
| avi/ | 2026-03-28 18:09 | - | |
| avif/ | 2026-03-28 18:09 | - | |
| avisynth/ | 2026-03-28 18:10 | - | |
| aviutl/ | 2026-03-28 18:09 | - | |
| aviutl2/ | 2026-03-28 18:09 | - | |
| avizo/ | 2026-03-28 18:09 | - | |
| avogadro/ | 2026-03-28 18:10 | - | |
| avr/ | 2026-03-28 18:09 | - | |
| avrdude/ | 2026-03-28 18:09 | - | |
| avs+/ | 2026-03-28 18:10 | - | |
| avs/ | 2026-03-28 18:10 | - | |
| avx-instructions/ | 2026-03-28 18:09 | - | |
| avx/ | 2026-03-28 18:09 | - | |
| awaescher/ | 2026-03-28 18:09 | - | |
| awake/ | 2026-03-28 18:10 | - | |
| awb/ | 2026-03-28 18:10 | - | |
| aws-apprunner/ | 2026-03-28 18:09 | - | |
| aws-cli/ | 2026-03-28 18:09 | - | |
| aws-cloudformation/ | 2026-03-28 18:09 | - | |
| aws-cred-cli/ | 2026-03-28 18:09 | - | |
| aws-cred-manager/ | 2026-03-28 18:09 | - | |
| aws-cred-mgr/ | 2026-03-28 18:09 | - | |
| aws-credentials/ | 2026-03-28 18:09 | - | |
| aws-ec2/ | 2026-03-28 18:09 | - | |
| aws-ecs/ | 2026-03-28 18:09 | - | |
| aws-eks/ | 2026-03-28 18:09 | - | |
| aws-fargate/ | 2026-03-28 18:09 | - | |
| aws-lambda/ | 2026-03-28 18:09 | - | |
| aws-s3/ | 2026-03-28 18:09 | - | |
| aws-vault/ | 2026-03-28 18:09 | - | |
| aws/ | 2026-03-28 18:09 | - | |
| awscli/ | 2026-03-28 18:10 | - | |
| ax1800/ | 2026-03-28 18:09 | - | |
| axusbeth.inf/ | 2026-03-28 18:09 | - | |
| azure-arc/ | 2026-03-28 18:10 | - | |
| azure-blob/ | 2026-03-28 18:09 | - | |
| azure-cli/ | 2026-03-28 18:10 | - | |
| azure-data-explorer/ | 2026-03-28 18:09 | - | |
| azure-devops-extension/ | 2026-03-28 18:10 | - | |
| azure-devops-migrtation/ | 2026-03-28 18:10 | - | |
| azure-devops-services/ | 2026-03-28 18:10 | - | |
| azure-devops/ | 2026-03-28 18:09 | - | |
| azure-event-hub/ | 2026-03-28 18:10 | - | |
| azure-event-hubs/ | 2026-03-28 18:10 | - | |
| azure-eventhub/ | 2026-03-28 18:10 | - | |
| azure-functions/ | 2026-03-28 18:10 | - | |
| azure-information-protection/ | 2026-03-28 18:09 | - | |
| azure-monitor-agent/ | 2026-03-28 18:09 | - | |
| azure-notification-hubs/ | 2026-03-28 18:10 | - | |
| azure-notificationhub/ | 2026-03-28 18:10 | - | |
| azure-relay/ | 2026-03-28 18:10 | - | |
| azure-repos/ | 2026-03-28 18:09 | - | |
| azure-service-bus/ | 2026-03-28 18:10 | - | |
| azure-servicebus/ | 2026-03-28 18:10 | - | |
| azure-virtual-desktop/ | 2026-03-28 18:10 | - | |
| azure/ | 2026-03-28 18:09 | - | |
| azurearc/ | 2026-03-28 18:10 | - | |
| azuredatafactory/ | 2026-03-28 18:09 | - | |
| azuredevops/ | 2026-03-28 18:09 | - | |
| azureinformationprotection/ | 2026-03-28 18:09 | - | |
| azuresynapseanalytics/ | 2026-03-28 18:09 | - | |
| azw3/ | 2026-03-28 18:09 | - | |
| b站视频下载/ | 2026-03-28 18:10 | - | |
| b站/ | 2026-03-28 18:09 | - | |
| b3d/ | 2026-03-28 18:10 | - | |
| babashka/ | 2026-03-28 18:09 | - | |
| babel/ | 2026-03-28 18:09 | - | |
| babylon/ | 2026-03-28 18:09 | - | |
| babylonjs/ | 2026-03-28 18:10 | - | |
| backdrop/ | 2026-03-28 18:09 | - | |
| backend-as-a-service/ | 2026-03-28 18:10 | - | |
| backend-development/ | 2026-03-28 18:09 | - | |
| backend/ | 2026-03-28 18:09 | - | |
| backgammon/ | 2026-03-28 18:10 | - | |
| background-changer/ | 2026-03-28 18:10 | - | |
| background-service/ | 2026-03-28 18:09 | - | |
| background/ | 2026-03-28 18:09 | - | |
| backlight/ | 2026-03-28 18:10 | - | |
| backlink/ | 2026-03-28 18:09 | - | |
| backscene/ | 2026-03-28 18:10 | - | |
| backtick/ | 2026-03-28 18:10 | - | |
| backup-explorer/ | 2026-03-28 18:09 | - | |
| backup-extractor/ | 2026-03-28 18:09 | - | |
| backup-viewer/ | 2026-03-28 18:09 | - | |
| backup/ | 2026-03-28 18:09 | - | |
| backups/ | 2026-03-28 18:09 | - | |
| bacnet/ | 2026-03-28 18:09 | - | |
| bad-hands/ | 2026-03-28 18:09 | - | |
| badge/ | 2026-03-28 18:10 | - | |
| baduk/ | 2026-03-28 18:10 | - | |
| baidu/ | 2026-03-28 18:09 | - | |
| baidunetdisk/ | 2026-03-28 18:10 | - | |
| balatro/ | 2026-03-28 18:10 | - | |
| balena-io/ | 2026-03-28 18:10 | - | |
| balloon.inf/ | 2026-03-28 18:09 | - | |
| ban/ | 2026-03-28 18:09 | - | |
| bandcamp-downloader/ | 2026-03-28 18:09 | - | |
| bandcamp/ | 2026-03-28 18:09 | - | |
| bandicam/ | 2026-03-28 18:09 | - | |
| bandwidth-monitor/ | 2026-03-28 18:09 | - | |
| bandwidth-saver/ | 2026-03-28 18:09 | - | |
| bandwidth/ | 2026-03-28 18:09 | - | |
| bangla/ | 2026-03-28 18:10 | - | |
| bangumi/ | 2026-03-28 18:09 | - | |
| banjo/ | 2026-03-28 18:09 | - | |
| bank-of-china/ | 2026-03-28 18:09 | - | |
| bank-of-communications/ | 2026-03-28 18:09 | - | |
| bank/ | 2026-03-28 18:09 | - | |
| banken/ | 2026-03-28 18:09 | - | |
| banking/ | 2026-03-28 18:09 | - | |
| banner/ | 2026-03-28 18:09 | - | |
| bar/ | 2026-03-28 18:09 | - | |
| barcode/ | 2026-03-28 18:09 | - | |
| bard/ | 2026-03-28 18:09 | - | |
| bare-metal/ | 2026-03-28 18:10 | - | |
| barrier/ | 2026-03-28 18:09 | - | |
| baseband/ | 2026-03-28 18:09 | - | |
| base converter/ | 2026-03-28 18:09 | - | |
| bash/ | 2026-03-28 18:09 | - | |
| bass/ | 2026-03-28 18:09 | - | |
| bat-to-msix/ | 2026-03-28 18:09 | - | |
| batch-convert/ | 2026-03-28 18:09 | - | |
| batch-copy/ | 2026-03-28 18:09 | - | |
| batch-decrypt/ | 2026-03-28 18:09 | - | |
| batch-editor/ | 2026-03-28 18:09 | - | |
| batch-encrypt/ | 2026-03-28 18:09 | - | |
| batch-files/ | 2026-03-28 18:09 | - | |
| batch-hash/ | 2026-03-28 18:09 | - | |
| batch-image-processor/ | 2026-03-28 18:09 | - | |
| batch-image/ | 2026-03-28 18:09 | - | |
| batch-photo/ | 2026-03-28 18:09 | - | |
| batch-process/ | 2026-03-28 18:09 | - | |
| batch-processing/ | 2026-03-28 18:10 | - | |
| batch-regex/ | 2026-03-28 18:09 | - | |
| batch-rename/ | 2026-03-28 18:09 | - | |
| batch-replace/ | 2026-03-28 18:09 | - | |
| batch-resize/ | 2026-03-28 18:09 | - | |
| batch-script/ | 2026-03-28 18:09 | - | |
| batch-search/ | 2026-03-28 18:09 | - | |
| batch-slice/ | 2026-03-28 18:09 | - | |
| batch-split/ | 2026-03-28 18:09 | - | |
| batch-text/ | 2026-03-28 18:09 | - | |
| batch-watermark/ | 2026-03-28 18:09 | - | |
| batch/ | 2026-03-28 18:09 | - | |
| batcminitiouner/ | 2026-03-28 18:10 | - | |
| batfile/ | 2026-03-28 18:09 | - | |
| battery-life/ | 2026-03-28 18:10 | - | |
| battery/ | 2026-03-28 18:09 | - | |
| batterymeter/ | 2026-03-28 18:10 | - | |
| battle.net/ | 2026-03-28 18:09 | - | |
| battle/ | 2026-03-28 18:09 | - | |
| battledotnet/ | 2026-03-28 18:09 | - | |
| battlefield/ | 2026-03-28 18:09 | - | |
| battlenet/ | 2026-03-28 18:09 | - | |
| bay/ | 2026-03-28 18:09 | - | |
| baybayin/ | 2026-03-28 18:09 | - | |
| bayes/ | 2026-03-28 18:09 | - | |
| bayesian/ | 2026-03-28 18:09 | - | |
| bazarr/ | 2026-03-28 18:09 | - | |
| bazel/ | 2026-03-28 18:09 | - | |
| bazqux/ | 2026-03-28 18:09 | - | |
| bbs/ | 2026-03-28 18:09 | - | |
| bcdr/ | 2026-03-28 18:09 | - | |
| bcm/ | 2026-03-28 18:09 | - | |
| bd/ | 2026-03-28 18:09 | - | |
| beach/ | 2026-03-28 18:09 | - | |
| beam/ | 2026-03-28 18:09 | - | |
| beamer/ | 2026-03-28 18:09 | - | |
| bearparser/ | 2026-03-28 18:09 | - | |
| beatmap-parser/ | 2026-03-28 18:10 | - | |
| beats/ | 2026-03-28 18:09 | - | |
| beatsaber-mods/ | 2026-03-28 18:09 | - | |
| beatsaber/ | 2026-03-28 18:09 | - | |
| beautify/ | 2026-03-28 18:09 | - | |
| bech32/ | 2026-03-28 18:09 | - | |
| beckhoff-ads/ | 2026-03-28 18:09 | - | |
| bedrock-addons/ | 2026-03-28 18:09 | - | |
| bedrock-edition/ | 2026-03-28 18:09 | - | |
| behavior/ | 2026-03-28 18:10 | - | |
| beidawangguan/ | 2026-03-28 18:10 | - | |
| benchmark/ | 2026-03-28 18:09 | - | |
| benchmarking/ | 2026-03-28 18:09 | - | |
| benghuai/ | 2026-03-28 18:09 | - | |
| benjamin-smedberg/ | 2026-03-28 18:09 | - | |
| benjaminsmedberg/ | 2026-03-28 18:09 | - | |
| bepinex/ | 2026-03-28 18:09 | - | |
| best-practice/ | 2026-03-28 18:09 | - | |
| bestellverwaltung/ | 2026-03-28 18:09 | - | |
| best remote/ | 2026-03-28 18:09 | - | |
| beta/ | 2026-03-28 18:10 | - | |
| betaflight/ | 2026-03-28 18:10 | - | |
| bethesda/ | 2026-03-28 18:09 | - | |
| betterdiscord/ | 2026-03-28 18:09 | - | |
| bettertrumpet/ | 2026-03-28 18:10 | - | |
| beyondatc/ | 2026-03-28 18:09 | - | |
| bforartists/ | 2026-03-28 18:09 | - | |
| bgp-files/ | 2026-03-28 18:10 | - | |
| bgp/ | 2026-03-28 18:10 | - | |
| bi-directional-link/ | 2026-03-28 18:09 | - | |
| bias-lighting/ | 2026-03-28 18:09 | - | |
| biblatex/ | 2026-03-28 18:09 | - | |
| bible/ | 2026-03-28 18:09 | - | |
| biblia/ | 2026-03-28 18:10 | - | |
| bibliography/ | 2026-03-28 18:09 | - | |
| bibtex/ | 2026-03-28 18:09 | - | |
| big-data/ | 2026-03-28 18:09 | - | |
| bigquery/ | 2026-03-28 18:09 | - | |
| bik/ | 2026-03-28 18:10 | - | |
| bildung/ | 2026-03-28 18:09 | - | |
| bilibili-live/ | 2026-03-28 18:09 | - | |
| bilibili/ | 2026-03-28 18:09 | - | |
| billboard/ | 2026-03-28 18:09 | - | |
| bim/ | 2026-03-28 18:09 | - | |
| bin-packing/ | 2026-03-28 18:09 | - | |
| binaries/ | 2026-03-28 18:10 | - | |
| binary-analysis/ | 2026-03-28 18:09 | - | |
| binary-data/ | 2026-03-28 18:10 | - | |
| binary-editor/ | 2026-03-28 18:09 | - | |
| binary-newsreader/ | 2026-03-28 18:09 | - | |
| binary-replace/ | 2026-03-28 18:09 | - | |
| binary-search/ | 2026-03-28 18:09 | - | |
| binary-space-partition/ | 2026-03-28 18:09 | - | |
| binary/ | 2026-03-28 18:09 | - | |
| binaryeditor/ | 2026-03-28 18:10 | - | |
| binaural/ | 2026-03-28 18:10 | - | |
| bindings/ | 2026-03-28 18:10 | - | |
| bing-wallpaper/ | 2026-03-28 18:09 | - | |
| bing/ | 2026-03-28 18:09 | - | |
| binjr/ | 2026-03-28 18:09 | - | |
| bink/ | 2026-03-28 18:10 | - | |
| binutils/ | 2026-03-28 18:09 | - | |
| binwalk/ | 2026-03-28 18:09 | - | |
| biochemical/ | 2026-03-28 18:09 | - | |
| biochemistry/ | 2026-03-28 18:09 | - | |
| bioimage-analsis/ | 2026-03-28 18:09 | - | |
| bioimage/ | 2026-03-28 18:09 | - | |
| bioinformatics/ | 2026-03-28 18:09 | - | |
| biolib/ | 2026-03-28 18:09 | - | |
| biology/ | 2026-03-28 18:09 | - | |
| biometric/ | 2026-03-28 18:09 | - | |
| biophotonics/ | 2026-03-28 18:09 | - | |
| biorhythm-chart/ | 2026-03-28 18:09 | - | |
| biorhythm-compatibility/ | 2026-03-28 18:09 | - | |
| biorhythm-cycles/ | 2026-03-28 18:09 | - | |
| biorhythm-program/ | 2026-03-28 18:09 | - | |
| biorhythm-software/ | 2026-03-28 18:09 | - | |
| biorhythm/ | 2026-03-28 18:09 | - | |
| biorhythms-app/ | 2026-03-28 18:09 | - | |
| biorhythms-calculator/ | 2026-03-28 18:09 | - | |
| biorhythms-charts/ | 2026-03-28 18:09 | - | |
| biorhythms-online/ | 2026-03-28 18:09 | - | |
| biorhythms/ | 2026-03-28 18:09 | - | |
| biorythms/ | 2026-03-28 18:09 | - | |
| bios/ | 2026-03-28 18:09 | - | |
| bipap/ | 2026-03-28 18:09 | - | |
| bird/ | 2026-03-28 18:10 | - | |
| birddog/ | 2026-03-28 18:09 | - | |
| bitbucket-server/ | 2026-03-28 18:09 | - | |
| bitbucket/ | 2026-03-28 18:09 | - | |
| bitbucketserver/ | 2026-03-28 18:09 | - | |
| bitchute/ | 2026-03-28 18:09 | - | |
| bitcoin-wallet/ | 2026-03-28 18:09 | - | |
| bitcoin/ | 2026-03-28 18:09 | - | |
| bitlocker/ | 2026-03-28 18:09 | - | |
| bitmap/ | 2026-03-28 18:10 | - | |
| bits/ | 2026-03-28 18:09 | - | |
| bittorrent-client/ | 2026-03-28 18:09 | - | |
| bittorrent/ | 2026-03-28 18:09 | - | |
| bitwarden-directory-connector/ | 2026-03-28 18:09 | - | |
| bitwarden-for-enterprise/ | 2026-03-28 18:09 | - | |
| bitwardendirectoryconnector/ | 2026-03-28 18:09 | - | |
| blackboard/ | 2026-03-28 18:10 | - | |
| bladerf/ | 2026-03-28 18:09 | - | |
| blake2b-512 blake2s-256/ | 2026-03-28 18:09 | - | |
| blake2b/ | 2026-03-28 18:09 | - | |
| blake2b blake2bp blake2s blake2sp/ | 2026-03-28 18:10 | - | |
| blake2s/ | 2026-03-28 18:09 | - | |
| blake3/ | 2026-03-28 18:09 | - | |
| blast/ | 2026-03-28 18:10 | - | |
| blazor/ | 2026-03-28 18:10 | - | |
| blend-mode/ | 2026-03-28 18:09 | - | |
| blender-addon/ | 2026-03-28 18:10 | - | |
| blender-launcher/ | 2026-03-28 18:10 | - | |
| blender/ | 2026-03-28 18:09 | - | |
| blender3d/ | 2026-03-28 18:10 | - | |
| blind/ | 2026-03-28 18:09 | - | |
| blink/ | 2026-03-28 18:09 | - | |
| blizzardentertainment/ | 2026-03-28 18:09 | - | |
| bloatware-list/ | 2026-03-28 18:10 | - | |
| bloatware-removal/ | 2026-03-28 18:09 | - | |
| bloatware/ | 2026-03-28 18:09 | - | |
| blobs/ | 2026-03-28 18:09 | - | |
| block/ | 2026-03-28 18:09 | - | |
| blockbench/ | 2026-03-28 18:09 | - | |
| blockchain-network/ | 2026-03-28 18:09 | - | |
| blockchain-protocol/ | 2026-03-28 18:09 | - | |
| blockchain/ | 2026-03-28 18:09 | - | |
| blocker/ | 2026-03-28 18:09 | - | |
| blockinc/ | 2026-03-28 18:09 | - | |
| blog-engine/ | 2026-03-28 18:09 | - | |
| blog/ | 2026-03-28 18:09 | - | |
| bloret/ | 2026-03-28 18:09 | - | |
| bloxstrap/ | 2026-03-28 18:09 | - | |
| blu-ray/ | 2026-03-28 18:09 | - | |
| blue-filter/ | 2026-03-28 18:10 | - | |
| bluebubbles/ | 2026-03-28 18:09 | - | |
| bluej/ | 2026-03-28 18:10 | - | |
| blueprint/ | 2026-03-28 18:09 | - | |
| bluescreen/ | 2026-03-28 18:10 | - | |
| bluetooth-classic/ | 2026-03-28 18:09 | - | |
| bluetooth-connection/ | 2026-03-28 18:10 | - | |
| bluetooth-controller/ | 2026-03-28 18:09 | - | |
| bluetooth-hid/ | 2026-03-28 18:09 | - | |
| bluetooth/ | 2026-03-28 18:09 | - | |
| bluetoothconnection/ | 2026-03-28 18:09 | - | |
| blupi/ | 2026-03-28 18:09 | - | |
| bluray/ | 2026-03-28 18:09 | - | |
| bmp/ | 2026-03-28 18:09 | - | |
| boardgame/ | 2026-03-28 18:09 | - | |
| boardgames/ | 2026-03-28 18:09 | - | |
| boating/ | 2026-03-28 18:10 | - | |
| boc/ | 2026-03-28 18:09 | - | |
| body-weight/ | 2026-03-28 18:09 | - | |
| bodyweight/ | 2026-03-28 18:09 | - | |
| boekhouden/ | 2026-03-28 18:09 | - | |
| boekhouding/ | 2026-03-28 18:10 | - | |
| bogo/ | 2026-03-28 18:10 | - | |
| boilerplate-generation/ | 2026-03-28 18:09 | - | |
| boilerplate/ | 2026-03-28 18:10 | - | |
| boinc/ | 2026-03-28 18:09 | - | |
| bolt/ | 2026-03-28 18:09 | - | |
| bom/ | 2026-03-28 18:09 | - | |
| bomberman/ | 2026-03-28 18:09 | - | |
| bonfire/ | 2026-03-28 18:09 | - | |
| bonjour-print-services/ | 2026-03-28 18:09 | - | |
| bonjour-printer-wizard/ | 2026-03-28 18:09 | - | |
| bonjour/ | 2026-03-28 18:09 | - | |
| bonjourprinterwizard/ | 2026-03-28 18:09 | - | |
| bonjourprintservices/ | 2026-03-28 18:09 | - | |
| bonsai/ | 2026-03-28 18:09 | - | |
| book-generator/ | 2026-03-28 18:09 | - | |
| book/ | 2026-03-28 18:09 | - | |
| booking/ | 2026-03-28 18:09 | - | |
| bookkeeping/ | 2026-03-28 18:09 | - | |
| bookmark/ | 2026-03-28 18:09 | - | |
| bookmarks/ | 2026-03-28 18:09 | - | |
| bookreader/ | 2026-03-28 18:09 | - | |
| books/ | 2026-03-28 18:09 | - | |
| booru/ | 2026-03-28 18:09 | - | |
| booster/ | 2026-03-28 18:09 | - | |
| boot-manager/ | 2026-03-28 18:09 | - | |
| boot/ | 2026-03-28 18:09 | - | |
| bootable-drives/ | 2026-03-28 18:09 | - | |
| bootable-usb/ | 2026-03-28 18:09 | - | |
| bootable/ | 2026-03-28 18:09 | - | |
| bootableusb/ | 2026-03-28 18:09 | - | |
| bootcamp/ | 2026-03-28 18:09 | - | |
| bootstrap/ | 2026-03-28 18:09 | - | |
| bootstrapper/ | 2026-03-28 18:09 | - | |
| border/ | 2026-03-28 18:09 | - | |
| bosskey/ | 2026-03-28 18:09 | - | |
| bot/ | 2026-03-28 18:09 | - | |
| botc/ | 2026-03-28 18:10 | - | |
| bouffalo-labs/ | 2026-03-28 18:10 | - | |
| boulder-dash/ | 2026-03-28 18:09 | - | |
| bounties/ | 2026-03-28 18:10 | - | |
| bounty/ | 2026-03-28 18:10 | - | |
| bowling/ | 2026-03-28 18:09 | - | |
| bowling tournament software/ | 2026-03-28 18:09 | - | |
| box/ | 2026-03-28 18:09 | - | |
| bpm/ | 2026-03-28 18:10 | - | |
| bpmn-support/ | 2026-03-28 18:09 | - | |
| bpmn/ | 2026-03-28 18:09 | - | |
| bqn/ | 2026-03-28 18:09 | - | |
| bqp32/ | 2026-03-28 18:09 | - | |
| brackets/ | 2026-03-28 18:09 | - | |
| braille-art/ | 2026-03-28 18:10 | - | |
| braille-translator/ | 2026-03-28 18:09 | - | |
| braille/ | 2026-03-28 18:09 | - | |
| brainwave/ | 2026-03-28 18:10 | - | |
| branching/ | 2026-03-28 18:10 | - | |
| brave/ | 2026-03-28 18:09 | - | |
| brawl/ | 2026-03-28 18:10 | - | |
| breadcrumb/ | 2026-03-28 18:09 | - | |
| break-reminder/ | 2026-03-28 18:09 | - | |
| break/ | 2026-03-28 18:09 | - | |
| breakout/ | 2026-03-28 18:09 | - | |
| breaktime/ | 2026-03-28 18:09 | - | |
| brew/ | 2026-03-28 18:09 | - | |
| brewing/ | 2026-03-28 18:09 | - | |
| brick/ | 2026-03-28 18:09 | - | |
| bricklink/ | 2026-03-28 18:09 | - | |
| bridge/ | 2026-03-28 18:09 | - | |
| brightness-contrast/ | 2026-03-28 18:10 | - | |
| brightness/ | 2026-03-28 18:09 | - | |
| brio/ | 2026-03-28 18:09 | - | |
| broadcast/ | 2026-03-28 18:09 | - | |
| broadcasting/ | 2026-03-28 18:09 | - | |
| broadcastrecordings/ | 2026-03-28 18:10 | - | |
| broken-links/ | 2026-03-28 18:09 | - | |
| brotherindustries/ | 2026-03-28 18:09 | - | |
| brotli/ | 2026-03-28 18:09 | - | |
| browser-chooser/ | 2026-03-28 18:09 | - | |
| browser-extension-helper/ | 2026-03-28 18:09 | - | |
| browser-profiles/ | 2026-03-28 18:09 | - | |
| browser/ | 2026-03-28 18:09 | - | |
| browserinjecting/ | 2026-03-28 18:10 | - | |
| browserprofiles/ | 2026-03-28 18:09 | - | |
| browserworks/ | 2026-03-28 18:10 | - | |
| browsing-history/ | 2026-03-28 18:09 | - | |
| brsis/ | 2026-03-28 18:09 | - | |
| bsd/ | 2026-03-28 18:09 | - | |
| bsdiff/ | 2026-03-28 18:10 | - | |
| bsmedberg/ | 2026-03-28 18:09 | - | |
| bsnes superfamicom sgb dosbox-x/ | 2026-03-28 18:10 | - | |
| bsod/ | 2026-03-28 18:10 | - | |
| bsondump/ | 2026-03-28 18:09 | - | |
| bt/ | 2026-03-28 18:09 | - | |
| btetlparse/ | 2026-03-28 18:09 | - | |
| btop/ | 2026-03-28 18:09 | - | |
| btp/ | 2026-03-28 18:09 | - | |
| btrfs-convert/ | 2026-03-28 18:09 | - | |
| btrfs/ | 2026-03-28 18:09 | - | |
| bubbletea/ | 2026-03-28 18:09 | - | |
| buchhaltung/ | 2026-03-28 18:09 | - | |
| buddism/ | 2026-03-28 18:09 | - | |
| budget-manager/ | 2026-03-28 18:09 | - | |
| budget/ | 2026-03-28 18:09 | - | |
| budgeting/ | 2026-03-28 18:09 | - | |
| buf-cli/ | 2026-03-28 18:09 | - | |
| buf-schema-registry/ | 2026-03-28 18:09 | - | |
| bug/ | 2026-03-28 18:10 | - | |
| bugbounty/ | 2026-03-28 18:10 | - | |
| build-system/ | 2026-03-28 18:09 | - | |
| build-tool/ | 2026-03-28 18:09 | - | |
| build-tools/ | 2026-03-28 18:09 | - | |
| build/ | 2026-03-28 18:09 | - | |
| builder/ | 2026-03-28 18:09 | - | |
| building/ | 2026-03-28 18:09 | - | |
| buildpacks/ | 2026-03-28 18:09 | - | |
| bukkit/ | 2026-03-28 18:09 | - | |
| bulk-actions/ | 2026-03-28 18:09 | - | |
| bulk-copy/ | 2026-03-28 18:09 | - | |
| bulk-crap-uninstaller/ | 2026-03-28 18:09 | - | |
| bulk-editing/ | 2026-03-28 18:10 | - | |
| bulk-editor/ | 2026-03-28 18:09 | - | |
| bulk-in/ | 2026-03-28 18:09 | - | |
| bulk-join/ | 2026-03-28 18:09 | - | |
| bulk-operation/ | 2026-03-28 18:09 | - | |
| bulk-replace/ | 2026-03-28 18:09 | - | |
| bulk/ | 2026-03-28 18:09 | - | |
| bulkin/ | 2026-03-28 18:09 | - | |
| bullet-hell/ | 2026-03-28 18:09 | - | |
| bullethell/ | 2026-03-28 18:09 | - | |
| bullyscholarshipedition/ | 2026-03-28 18:09 | - | |
| bun/ | 2026-03-28 18:09 | - | |
| bundle/ | 2026-03-28 18:09 | - | |
| bundler/ | 2026-03-28 18:09 | - | |
| burn-cd/ | 2026-03-28 18:09 | - | |
| burn-iso/ | 2026-03-28 18:09 | - | |
| burn/ | 2026-03-28 18:09 | - | |
| burning/ | 2026-03-28 18:09 | - | |
| bus-driver/ | 2026-03-28 18:09 | - | |
| bus-simulation/ | 2026-03-28 18:10 | - | |
| bus-simulator/ | 2026-03-28 18:10 | - | |
| business-intelligence/ | 2026-03-28 18:09 | - | |
| business-phone/ | 2026-03-28 18:09 | - | |
| business-tool/ | 2026-03-28 18:09 | - | |
| business/ | 2026-03-28 18:09 | - | |
| business softphone/ | 2026-03-28 18:10 | - | |
| bussiness/ | 2026-03-28 18:09 | - | |
| busybox/ | 2026-03-28 18:09 | - | |
| butterflow/ | 2026-03-28 18:10 | - | |
| button/ | 2026-03-28 18:10 | - | |
| buttonbindings/ | 2026-03-28 18:10 | - | |
| bvterm/ | 2026-03-28 18:10 | - | |
| bxfcoe.inf/ | 2026-03-28 18:09 | - | |
| bxnd.inf/ | 2026-03-28 18:09 | - | |
| bxois.inf/ | 2026-03-28 18:09 | - | |
| bxvbd.inf/ | 2026-03-28 18:09 | - | |
| byod/ | 2026-03-28 18:09 | - | |
| bypass/ | 2026-03-28 18:10 | - | |
| byte-replace/ | 2026-03-28 18:09 | - | |
| byte-search/ | 2026-03-28 18:09 | - | |
| bytecode/ | 2026-03-28 18:09 | - | |
| bytedance/ | 2026-03-28 18:09 | - | |
| bytes/ | 2026-03-28 18:09 | - | |
| bz2/ | 2026-03-28 18:09 | - | |
| c++-interface/ | 2026-03-28 18:09 | - | |
| c++/ | 2026-03-28 18:09 | - | |
| c++interface/ | 2026-03-28 18:09 | - | |
| c++library/ | 2026-03-28 18:09 | - | |
| c++runtimes/ | 2026-03-28 18:10 | - | |
| c-bios/ | 2026-03-28 18:10 | - | |
| c-language/ | 2026-03-28 18:10 | - | |
| c-media/ | 2026-03-28 18:09 | - | |
| c-plus-plus-17/ | 2026-03-28 18:09 | - | |
| c-plus-plus/ | 2026-03-28 18:09 | - | |
| c-sharp/ | 2026-03-28 18:09 | - | |
| c/ | 2026-03-28 18:09 | - | |
| c2x/ | 2026-03-28 18:09 | - | |
| c99/ | 2026-03-28 18:10 | - | |
| cab/ | 2026-03-28 18:09 | - | |
| cabal-build/ | 2026-03-28 18:09 | - | |
| cabdrivers/ | 2026-03-28 18:09 | - | |
| cabfileformat/ | 2026-03-28 18:09 | - | |
| cabinetarchivefiletype/ | 2026-03-28 18:09 | - | |
| cabinetry/ | 2026-03-28 18:09 | - | |
| cabinstalling/ | 2026-03-28 18:09 | - | |
| cabmaker/ | 2026-03-28 18:09 | - | |
| cac/ | 2026-03-28 18:10 | - | |
| cacerts/ | 2026-03-28 18:10 | - | |
| cache-simulator/ | 2026-03-28 18:09 | - | |
| cache/ | 2026-03-28 18:09 | - | |
| cacher/ | 2026-03-28 18:10 | - | |
| cactus-blockchain/ | 2026-03-28 18:09 | - | |
| cad/ | 2026-03-28 18:09 | - | |
| caddy/ | 2026-03-28 18:09 | - | |
| caddyfile/ | 2026-03-28 18:09 | - | |
| cadmouse/ | 2026-03-28 18:09 | - | |
| caffeinate/ | 2026-03-28 18:09 | - | |
| caffeine/ | 2026-03-28 18:09 | - | |
| caiyun/ | 2026-03-28 18:09 | - | |
| calculate/ | 2026-03-28 18:09 | - | |
| calculating/ | 2026-03-28 18:09 | - | |
| calculation/ | 2026-03-28 18:09 | - | |
| calculations/ | 2026-03-28 18:09 | - | |
| calculator-application/ | 2026-03-28 18:09 | - | |
| calculator-python/ | 2026-03-28 18:09 | - | |
| calculator/ | 2026-03-28 18:09 | - | |
| calculus/ | 2026-03-28 18:09 | - | |
| caldav/ | 2026-03-28 18:09 | - | |
| calendar/ | 2026-03-28 18:09 | - | |
| calendso/ | 2026-03-28 18:09 | - | |
| calibrate/ | 2026-03-28 18:09 | - | |
| calibration/ | 2026-03-28 18:09 | - | |
| call/ | 2026-03-28 18:09 | - | |
| calling/ | 2026-03-28 18:09 | - | |
| calls/ | 2026-03-28 18:10 | - | |
| cam-link/ | 2026-03-28 18:10 | - | |
| cam/ | 2026-03-28 18:09 | - | |
| camera/ | 2026-03-28 18:09 | - | |
| campus-network/ | 2026-03-28 18:09 | - | |
| campus/ | 2026-03-28 18:09 | - | |
| campushoy/ | 2026-03-28 18:10 | - | |
| camunda/ | 2026-03-28 18:09 | - | |
| can/ | 2026-03-28 18:09 | - | |
| canon-raw/ | 2026-03-28 18:10 | - | |
| canon/ | 2026-03-28 18:10 | - | |
| canonical/ | 2026-03-28 18:09 | - | |
| cansat/ | 2026-03-28 18:09 | - | |
| cantab/ | 2026-03-28 18:09 | - | |
| canvas/ | 2026-03-28 18:09 | - | |
| canyon/ | 2026-03-28 18:09 | - | |
| capabilities/ | 2026-03-28 18:09 | - | |
| capi/ | 2026-03-28 18:10 | - | |
| caps-lock/ | 2026-03-28 18:09 | - | |
| capslock-key/ | 2026-03-28 18:09 | - | |
| caption/ | 2026-03-28 18:09 | - | |
| captions/ | 2026-03-28 18:09 | - | |
| capture-one/ | 2026-03-28 18:09 | - | |
| capture-video/ | 2026-03-28 18:09 | - | |
| capture/ | 2026-03-28 18:09 | - | |
| car-stereo/ | 2026-03-28 18:10 | - | |
| car/ | 2026-03-28 18:09 | - | |
| carapace/ | 2026-03-28 18:10 | - | |
| card-game/ | 2026-03-28 18:09 | - | |
| card-storage/ | 2026-03-28 18:09 | - | |
| card/ | 2026-03-28 18:09 | - | |
| carddav/ | 2026-03-28 18:09 | - | |
| card reader/ | 2026-03-28 18:09 | - | |
| cards/ | 2026-03-28 18:09 | - | |
| caresuiteconnectivity.inf/ | 2026-03-28 18:10 | - | |
| car general assembly main manifest/ | 2026-03-28 18:10 | - | |
| cargo-plugin/ | 2026-03-28 18:10 | - | |
| cargo-subcommand/ | 2026-03-28 18:10 | - | |
| car obd emission printing module/ | 2026-03-28 18:10 | - | |
| car right door loading slip printing/ | 2026-03-28 18:10 | - | |
| carstereo/ | 2026-03-28 18:10 | - | |
| car tire pressure label printing/ | 2026-03-28 18:10 | - | |
| cartoon/ | 2026-03-28 18:09 | - | |
| carvel/ | 2026-03-28 18:09 | - | |
| cas/ | 2026-03-28 18:09 | - | |
| cash-flow/ | 2026-03-28 18:09 | - | |
| cassandra/ | 2026-03-28 18:09 | - | |
| cast/ | 2026-03-28 18:09 | - | |
| casting/ | 2026-03-28 18:09 | - | |
| cat/ | 2026-03-28 18:09 | - | |
| cataclysm-dark-days-ahead/ | 2026-03-28 18:09 | - | |
| cataclysm-dda/ | 2026-03-28 18:09 | - | |
| catalog/ | 2026-03-28 18:09 | - | |
| catapult/ | 2026-03-28 18:10 | - | |
| category/ | 2026-03-28 18:09 | - | |
| causal-discovery/ | 2026-03-28 18:09 | - | |
| causal-inference/ | 2026-03-28 18:09 | - | |
| causality/ | 2026-03-28 18:09 | - | |
| cbios/ | 2026-03-28 18:10 | - | |
| cbom/ | 2026-03-28 18:09 | - | |
| cbr/ | 2026-03-28 18:09 | - | |
| cbz/ | 2026-03-28 18:09 | - | |
| cc/ | 2026-03-28 18:09 | - | |
| ccache/ | 2026-03-28 18:09 | - | |
| ccleaner-alternative/ | 2026-03-28 18:09 | - | |
| ccleaner/ | 2026-03-28 18:10 | - | |
| ccp/ | 2026-03-28 18:09 | - | |
| ccsds/ | 2026-03-28 18:09 | - | |
| cctv/ | 2026-03-28 18:09 | - | |
| cd-ripper/ | 2026-03-28 18:09 | - | |
| cd-rom/ | 2026-03-28 18:09 | - | |
| cd/ | 2026-03-28 18:09 | - | |
| cdn/ | 2026-03-28 18:10 | - | |
| cdparanoia/ | 2026-03-28 18:09 | - | |
| cdr/ | 2026-03-28 18:09 | - | |
| cds/ | 2026-03-28 18:09 | - | |
| ceb/ | 2026-03-28 18:09 | - | |
| ceefax/ | 2026-03-28 18:10 | - | |
| cefsharp/ | 2026-03-28 18:10 | - | |
| celestia/ | 2026-03-28 18:09 | - | |
| celestial/ | 2026-03-28 18:09 | - | |
| cell-count/ | 2026-03-28 18:09 | - | |
| cell/ | 2026-03-28 18:09 | - | |
| cellphones/ | 2026-03-28 18:09 | - | |
| cem/ | 2026-03-28 18:09 | - | |
| cemu-emulator/ | 2026-03-28 18:09 | - | |
| cemu/ | 2026-03-28 18:09 | - | |
| centralized monitoring of printing/ | 2026-03-28 18:10 | - | |
| centreon/ | 2026-03-28 18:09 | - | |
| cert/ | 2026-03-28 18:09 | - | |
| certbot/ | 2026-03-28 18:09 | - | |
| certificado/ | 2026-03-28 18:09 | - | |
| certificate/ | 2026-03-28 18:09 | - | |
| certificates/ | 2026-03-28 18:09 | - | |
| certificatesigningrequest/ | 2026-03-28 18:09 | - | |
| certs/ | 2026-03-28 18:09 | - | |
| cesu/ | 2026-03-28 18:09 | - | |
| cevio/ | 2026-03-28 18:10 | - | |
| cf-cli/ | 2026-03-28 18:09 | - | |
| cf/ | 2026-03-28 18:10 | - | |
| cfd/ | 2026-03-28 18:09 | - | |
| cgm/ | 2026-03-28 18:09 | - | |
| cgss/ | 2026-03-28 18:10 | - | |
| chaia/ | 2026-03-28 18:09 | - | |
| chainguard/ | 2026-03-28 18:09 | - | |
| chameleon/ | 2026-03-28 18:10 | - | |
| chameleonultra/ | 2026-03-28 18:10 | - | |
| change/ | 2026-03-28 18:09 | - | |
| changelog-generator/ | 2026-03-28 18:10 | - | |
| changelog/ | 2026-03-28 18:09 | - | |
| changer/ | 2026-03-28 18:09 | - | |
| channel/ | 2026-03-28 18:10 | - | |
| channelpatching/ | 2026-03-28 18:10 | - | |
| chappee/ | 2026-03-28 18:09 | - | |
| character-encoding/ | 2026-03-28 18:09 | - | |
| character-set/ | 2026-03-28 18:09 | - | |
| character/ | 2026-03-28 18:09 | - | |
| charactercreator/ | 2026-03-28 18:10 | - | |
| characters/ | 2026-03-28 18:09 | - | |
| charge/ | 2026-03-28 18:10 | - | |
| charm/ | 2026-03-28 18:09 | - | |
| charmbracelet/ | 2026-03-28 18:09 | - | |
| chart/ | 2026-03-28 18:09 | - | |
| charts/ | 2026-03-28 18:09 | - | |
| chash/ | 2026-03-28 18:09 | - | |
| chat-ai/ | 2026-03-28 18:09 | - | |
| chat-application/ | 2026-03-28 18:09 | - | |
| chat-records/ | 2026-03-28 18:09 | - | |
| chat/ | 2026-03-28 18:09 | - | |
| chatbot/ | 2026-03-28 18:09 | - | |
| chatgpt-api/ | 2026-03-28 18:09 | - | |
| chatgpt-app/ | 2026-03-28 18:09 | - | |
| chatgpt-desktop-app/ | 2026-03-28 18:10 | - | |
| chatgpt-desktop/ | 2026-03-28 18:10 | - | |
| chatgpt/ | 2026-03-28 18:09 | - | |
| cheatsheets/ | 2026-03-28 18:09 | - | |
| check-in/ | 2026-03-28 18:09 | - | |
| check/ | 2026-03-28 18:09 | - | |
| checklist/ | 2026-03-28 18:09 | - | |
| checkmk/ | 2026-03-28 18:09 | - | |
| checksum-calculation/ | 2026-03-28 18:10 | - | |
| checksum-validator/ | 2026-03-28 18:10 | - | |
| checksum/ | 2026-03-28 18:09 | - | |
| checksums/ | 2026-03-28 18:09 | - | |
| chef/ | 2026-03-28 18:09 | - | |
| chem/ | 2026-03-28 18:09 | - | |
| chemdraw/ | 2026-03-28 18:09 | - | |
| chemical/ | 2026-03-28 18:10 | - | |
| chemistry/ | 2026-03-28 18:09 | - | |
| cherry/ | 2026-03-28 18:09 | - | |
| chess-database/ | 2026-03-28 18:09 | - | |
| chess/ | 2026-03-28 18:09 | - | |
| chia-blockchain/ | 2026-03-28 18:09 | - | |
| chiba/ | 2026-03-28 18:10 | - | |
| chickens/ | 2026-03-28 18:09 | - | |
| child/ | 2026-03-28 18:09 | - | |
| children/ | 2026-03-28 18:09 | - | |
| chillibits/ | 2026-03-28 18:09 | - | |
| chillicream.nitro.app/ | 2026-03-28 18:09 | - | |
| china-everbright-bank/ | 2026-03-28 18:09 | - | |
| china/ | 2026-03-28 18:09 | - | |
| chinese/ | 2026-03-28 18:09 | - | |
| chip card/ | 2026-03-28 18:09 | - | |
| chiptune-tracker/ | 2026-03-28 18:09 | - | |
| chiptune/ | 2026-03-28 18:09 | - | |
| chm/ | 2026-03-28 18:09 | - | |
| choco/ | 2026-03-28 18:09 | - | |
| chocolatey/ | 2026-03-28 18:09 | - | |
| chord/ | 2026-03-28 18:09 | - | |
| chromaprint/ | 2026-03-28 18:09 | - | |
| chromatogram/ | 2026-03-28 18:10 | - | |
| chromatography/ | 2026-03-28 18:09 | - | |
| chrome-extension/ | 2026-03-28 18:10 | - | |
| chrome/ | 2026-03-28 18:09 | - | |
| chromeos/ | 2026-03-28 18:10 | - | |
| chromium/ | 2026-03-28 18:09 | - | |
| chromosome/ | 2026-03-28 18:09 | - | |
| chromoting/ | 2026-03-28 18:09 | - | |
| chronograf/ | 2026-03-28 18:09 | - | |
| church/ | 2026-03-28 18:09 | - | |
| ci-cd/ | 2026-03-28 18:09 | - | |
| ci/ | 2026-03-28 18:09 | - | |
| cicd/ | 2026-03-28 18:09 | - | |
| cicp/ | 2026-03-28 18:10 | - | |
| cie/ | 2026-03-28 18:10 | - | |
| cilium/ | 2026-03-28 18:09 | - | |
| cinderella-girls/ | 2026-03-28 18:10 | - | |
| cinderella/ | 2026-03-28 18:10 | - | |
| cinema/ | 2026-03-28 18:09 | - | |
| cinny/ | 2026-03-28 18:09 | - | |
| cinnyapp/ | 2026-03-28 18:09 | - | |
| circle-ci/ | 2026-03-28 18:09 | - | |
| circleci/ | 2026-03-28 18:09 | - | |
| circuit-board/ | 2026-03-28 18:09 | - | |
| circuit-breaker/ | 2026-03-28 18:09 | - | |
| circuit-diagram/ | 2026-03-28 18:09 | - | |
| circuit/ | 2026-03-28 18:09 | - | |
| cisco-webex/ | 2026-03-28 18:09 | - | |
| cisco/ | 2026-03-28 18:09 | - | |
| ciscowebex/ | 2026-03-28 18:09 | - | |
| cisigner/ | 2026-03-28 18:09 | - | |
| ciso/ | 2026-03-28 18:10 | - | |
| citation/ | 2026-03-28 18:09 | - | |
| cite/ | 2026-03-28 18:09 | - | |
| citizen-science/ | 2026-03-28 18:09 | - | |
| citrixfiles/ | 2026-03-28 18:10 | - | |
| citycraft/ | 2026-03-28 18:10 | - | |
| civilization/ | 2026-03-28 18:09 | - | |
| cjxl/ | 2026-03-28 18:09 | - | |
| ck3/ | 2026-03-28 18:09 | - | |
| ckaiser/ | 2026-03-28 18:09 | - | |
| cl-on-12-compiler/ | 2026-03-28 18:09 | - | |
| clamav/ | 2026-03-28 18:09 | - | |
| clang/ | 2026-03-28 18:09 | - | |
| clap/ | 2026-03-28 18:09 | - | |
| clarinet/ | 2026-03-28 18:09 | - | |
| clarity/ | 2026-03-28 18:09 | - | |
| clash-meta/ | 2026-03-28 18:09 | - | |
| clash-nyanpasu/ | 2026-03-28 18:09 | - | |
| clash-rs/ | 2026-03-28 18:09 | - | |
| clash-verge/ | 2026-03-28 18:09 | - | |
| clash/ | 2026-03-28 18:09 | - | |
| class/ | 2026-03-28 18:09 | - | |
| classic-menu/ | 2026-03-28 18:09 | - | |
| classic-shell/ | 2026-03-28 18:09 | - | |
| classic-start-menu/ | 2026-03-28 18:09 | - | |
| classic-start/ | 2026-03-28 18:09 | - | |
| classic/ | 2026-03-28 18:09 | - | |
| classicfastlinqethernetnic/ | 2026-03-28 18:09 | - | |
| classification-banner/ | 2026-03-28 18:09 | - | |
| classification/ | 2026-03-28 18:09 | - | |
| classified/ | 2026-03-28 18:09 | - | |
| classify/ | 2026-03-28 18:09 | - | |
| classroom/ | 2026-03-28 18:09 | - | |
| claude-code/ | 2026-03-28 18:09 | - | |
| claude/ | 2026-03-28 18:09 | - | |
| clavinova/ | 2026-03-28 18:10 | - | |
| claw/ | 2026-03-28 18:09 | - | |
| clean-code/ | 2026-03-28 18:09 | - | |
| clean-up/ | 2026-03-28 18:09 | - | |
| clean/ | 2026-03-28 18:09 | - | |
| cleancode/ | 2026-03-28 18:09 | - | |
| cleaner/ | 2026-03-28 18:09 | - | |
| cleanup-ram/ | 2026-03-28 18:09 | - | |
| cleanup/ | 2026-03-28 18:09 | - | |
| clear/ | 2026-03-28 18:09 | - | |
| cleartype/ | 2026-03-28 18:09 | - | |
| clef/ | 2026-03-28 18:09 | - | |
| cli-app/ | 2026-03-28 18:09 | - | |
| cli-tool/ | 2026-03-28 18:09 | - | |
| cli/ | 2026-03-28 18:09 | - | |
| click/ | 2026-03-28 18:09 | - | |
| clickhouse/ | 2026-03-28 18:09 | - | |
| clickteam-install-creator/ | 2026-03-28 18:09 | - | |
| clickteaminstallcreator/ | 2026-03-28 18:09 | - | |
| client/ | 2026-03-28 18:09 | - | |
| clienttroubleshootingtool/ | 2026-03-28 18:09 | - | |
| climate/ | 2026-03-28 18:09 | - | |
| clip/ | 2026-03-28 18:09 | - | |
| clipboard-copy/ | 2026-03-28 18:10 | - | |
| clipboard-history/ | 2026-03-28 18:10 | - | |
| clipboard-manager/ | 2026-03-28 18:09 | - | |
| clipboard-save/ | 2026-03-28 18:09 | - | |
| clipboard-sync/ | 2026-03-28 18:09 | - | |
| clipboard/ | 2026-03-28 18:09 | - | |
| clipping/ | 2026-03-28 18:09 | - | |
| clips/ | 2026-03-28 18:10 | - | |
| clipstudio/ | 2026-03-28 18:09 | - | |
| cloak/ | 2026-03-28 18:09 | - | |
| cloc/ | 2026-03-28 18:09 | - | |
| clock/ | 2026-03-28 18:09 | - | |
| clockserver/ | 2026-03-28 18:09 | - | |
| clocksynchronise/ | 2026-03-28 18:09 | - | |
| clocksynchronize/ | 2026-03-28 18:09 | - | |
| clocktower/ | 2026-03-28 18:10 | - | |
| clojure/ | 2026-03-28 18:09 | - | |
| clon12compiler/ | 2026-03-28 18:09 | - | |
| clone/ | 2026-03-28 18:09 | - | |
| clonespy/ | 2026-03-28 18:09 | - | |
| closed-captions/ | 2026-03-28 18:09 | - | |
| cloud-backup/ | 2026-03-28 18:09 | - | |
| cloud-computer/ | 2026-03-28 18:09 | - | |
| cloud-computing/ | 2026-03-28 18:09 | - | |
| cloud-database/ | 2026-03-28 18:10 | - | |
| cloud-drive/ | 2026-03-28 18:09 | - | |
| cloud-foundry-cli/ | 2026-03-28 18:09 | - | |
| cloud-foundry/ | 2026-03-28 18:09 | - | |
| cloud-gaming/ | 2026-03-28 18:09 | - | |
| cloud-management/ | 2026-03-28 18:09 | - | |
| cloud-native-buildpacks/ | 2026-03-28 18:09 | - | |
| cloud-native-developers/ | 2026-03-28 18:10 | - | |
| cloud-native/ | 2026-03-28 18:09 | - | |
| cloud-sdk/ | 2026-03-28 18:09 | - | |
| cloud-servers/ | 2026-03-28 18:09 | - | |
| cloud-services/ | 2026-03-28 18:09 | - | |
| cloud-sql/ | 2026-03-28 18:09 | - | |
| cloud-storage/ | 2026-03-28 18:09 | - | |
| cloud-sync/ | 2026-03-28 18:09 | - | |
| cloud/ | 2026-03-28 18:09 | - | |
| cloud189/ | 2026-03-28 18:10 | - | |
| cloudapp/ | 2026-03-28 18:10 | - | |
| cloudflare-r2/ | 2026-03-28 18:09 | - | |
| cloudflare-tunnel/ | 2026-03-28 18:09 | - | |
| cloudflare-zero-trust/ | 2026-03-28 18:09 | - | |
| cloudflare/ | 2026-03-28 18:09 | - | |
| cloudfoundry/ | 2026-03-28 18:10 | - | |
| cloudfront/ | 2026-03-28 18:09 | - | |
| cloudmusic/ | 2026-03-28 18:09 | - | |
| cloudprint/ | 2026-03-28 18:10 | - | |
| cloudreve/ | 2026-03-28 18:09 | - | |
| cloudservers/ | 2026-03-28 18:09 | - | |
| cloudservice/ | 2026-03-28 18:09 | - | |
| cloudwatch/ | 2026-03-28 18:09 | - | |
| clover/ | 2026-03-28 18:09 | - | |
| cluster-management/ | 2026-03-28 18:09 | - | |
| cluster/ | 2026-03-28 18:09 | - | |
| clustering/ | 2026-03-28 18:09 | - | |
| cmake-format/ | 2026-03-28 18:09 | - | |
| cmake-language/ | 2026-03-28 18:09 | - | |
| cmake/ | 2026-03-28 18:09 | - | |
| cmakelists/ | 2026-03-28 18:09 | - | |
| cmatrix/ | 2026-03-28 18:09 | - | |
| cmd/ | 2026-03-28 18:09 | - | |
| cmdemo/ | 2026-03-28 18:09 | - | |
| cmdpal-extension/ | 2026-03-28 18:09 | - | |
| cmdpal/ | 2026-03-28 18:09 | - | |
| cmedia/ | 2026-03-28 18:09 | - | |
| cmmc/ | 2026-03-28 18:09 | - | |
| cmp/ | 2026-03-28 18:09 | - | |
| cms/ | 2026-03-28 18:09 | - | |
| cmtrace/ | 2026-03-28 18:09 | - | |
| cmyk/ | 2026-03-28 18:09 | - | |
| cnc/ | 2026-03-28 18:09 | - | |
| cncf/ | 2026-03-28 18:09 | - | |
| cni/ | 2026-03-28 18:09 | - | |
| cntmou.inf/ | 2026-03-28 18:10 | - | |
| cntmouhidbtdriver.inf/ | 2026-03-28 18:10 | - | |
| cntmouinternalbtdriver.inf/ | 2026-03-28 18:10 | - | |
| cntmoukeyinternalbtdriver.inf/ | 2026-03-28 18:10 | - | |
| co-op/ | 2026-03-28 18:09 | - | |
| co2/ | 2026-03-28 18:09 | - | |
| coast/ | 2026-03-28 18:09 | - | |
| cobalt/ | 2026-03-28 18:09 | - | |
| cobertura/ | 2026-03-28 18:09 | - | |
| cobra/ | 2026-03-28 18:10 | - | |
| cockroachdb/ | 2026-03-28 18:09 | - | |
| cocos-creator/ | 2026-03-28 18:10 | - | |
| cocos2d/ | 2026-03-28 18:10 | - | |
| code-analysis/ | 2026-03-28 18:09 | - | |
| code-completion/ | 2026-03-28 18:09 | - | |
| code-editing/ | 2026-03-28 18:09 | - | |
| code-editor/ | 2026-03-28 18:09 | - | |
| code-generation/ | 2026-03-28 18:09 | - | |
| code-highlight/ | 2026-03-28 18:10 | - | |
| code-oss/ | 2026-03-28 18:09 | - | |
| code-page/ | 2026-03-28 18:09 | - | |
| code-quality/ | 2026-03-28 18:09 | - | |
| code-scanning/ | 2026-03-28 18:09 | - | |
| code-search/ | 2026-03-28 18:09 | - | |
| code-snippet/ | 2026-03-28 18:10 | - | |
| code-snippets/ | 2026-03-28 18:09 | - | |
| code-style/ | 2026-03-28 18:10 | - | |
| code/ | 2026-03-28 18:09 | - | |
| codebase/ | 2026-03-28 18:09 | - | |
| codec/ | 2026-03-28 18:09 | - | |
| codeeditor/ | 2026-03-28 18:09 | - | |
| codeformatter/ | 2026-03-28 18:09 | - | |
| codegen/ | 2026-03-28 18:09 | - | |
| codemao/ | 2026-03-28 18:10 | - | |
| codemod/ | 2026-03-28 18:09 | - | |
| codequality/ | 2026-03-28 18:09 | - | |
| coder/ | 2026-03-28 18:09 | - | |
| codereview/ | 2026-03-28 18:09 | - | |
| codesign/ | 2026-03-28 18:09 | - | |
| codesigning/ | 2026-03-28 18:09 | - | |
| codex-cli/ | 2026-03-28 18:09 | - | |
| codex/ | 2026-03-28 18:09 | - | |
| coding-agents/ | 2026-03-28 18:10 | - | |
| coding-assistant/ | 2026-03-28 18:10 | - | |
| coding-language/ | 2026-03-28 18:10 | - | |
| coding/ | 2026-03-28 18:09 | - | |
| codium/ | 2026-03-28 18:09 | - | |
| coffee/ | 2026-03-28 18:09 | - | |
| coin/ | 2026-03-28 18:09 | - | |
| coinjoin/ | 2026-03-28 18:09 | - | |
| collabfs/ | 2026-03-28 18:09 | - | |
| collaborate/ | 2026-03-28 18:09 | - | |
| collaboration/ | 2026-03-28 18:09 | - | |
| collaborative/ | 2026-03-28 18:09 | - | |
| collage/ | 2026-03-28 18:09 | - | |
| collapse/ | 2026-03-28 18:09 | - | |
| collect/ | 2026-03-28 18:09 | - | |
| collection/ | 2026-03-28 18:09 | - | |
| collections/ | 2026-03-28 18:09 | - | |
| colledge/ | 2026-03-28 18:10 | - | |
| color-blindness/ | 2026-03-28 18:10 | - | |
| color-capture/ | 2026-03-28 18:09 | - | |
| color-converter/ | 2026-03-28 18:09 | - | |
| color-correction/ | 2026-03-28 18:09 | - | |
| color-depth/ | 2026-03-28 18:09 | - | |
| color-editor/ | 2026-03-28 18:09 | - | |
| color-generator/ | 2026-03-28 18:09 | - | |
| color-grabber/ | 2026-03-28 18:09 | - | |
| color-grading/ | 2026-03-28 18:10 | - | |
| color-management/ | 2026-03-28 18:09 | - | |
| color-palette/ | 2026-03-28 18:09 | - | |
| color-picker/ | 2026-03-28 18:09 | - | |
| color-profile/ | 2026-03-28 18:09 | - | |
| color-space/ | 2026-03-28 18:10 | - | |
| color-temperature/ | 2026-03-28 18:09 | - | |
| color-theme/ | 2026-03-28 18:10 | - | |
| color-wheel/ | 2026-03-28 18:09 | - | |
| color/ | 2026-03-28 18:09 | - | |
| coloradjustments/ | 2026-03-28 18:10 | - | |
| colorfulclouds/ | 2026-03-28 18:09 | - | |
| colorpicker/ | 2026-03-28 18:09 | - | |
| colors/ | 2026-03-28 18:09 | - | |
| colour-picker/ | 2026-03-28 18:09 | - | |
| colourpicker/ | 2026-03-28 18:09 | - | |
| columnizer/ | 2026-03-28 18:10 | - | |
| columns/ | 2026-03-28 18:10 | - | |
| com/ | 2026-03-28 18:09 | - | |
| combat/ | 2026-03-28 18:09 | - | |
| combine-files/ | 2026-03-28 18:09 | - | |
| combine-tabs/ | 2026-03-28 18:10 | - | |
| combinetabs/ | 2026-03-28 18:10 | - | |
| come-and-take-it/ | 2026-03-28 18:10 | - | |
| comfy/ | 2026-03-28 18:09 | - | |
| comfyui/ | 2026-03-28 18:09 | - | |
| comic-viewer/ | 2026-03-28 18:10 | - | |
| comic/ | 2026-03-28 18:09 | - | |
| comicrack/ | 2026-03-28 18:09 | - | |
| comics-reader/ | 2026-03-28 18:10 | - | |
| comics/ | 2026-03-28 18:09 | - | |
| comix/ | 2026-03-28 18:09 | - | |
| command-configure/ | 2026-03-28 18:09 | - | |
| command-history/ | 2026-03-28 18:09 | - | |
| command-line-aliases/ | 2026-03-28 18:09 | - | |
| command-line-interface/ | 2026-03-28 18:09 | - | |
| command-line-tool/ | 2026-03-28 18:09 | - | |
| command-line/ | 2026-03-28 18:09 | - | |
| command-line cross-platform foss/ | 2026-03-28 18:09 | - | |
| command-prompt/ | 2026-03-28 18:09 | - | |
| command-runner/ | 2026-03-28 18:09 | - | |
| command/ | 2026-03-28 18:09 | - | |
| commandandconquer/ | 2026-03-28 18:10 | - | |
| commander/ | 2026-03-28 18:09 | - | |
| commandline-interface/ | 2026-03-28 18:09 | - | |
| commandline-tool/ | 2026-03-28 18:09 | - | |
| commandline/ | 2026-03-28 18:09 | - | |
| commandlinealiases/ | 2026-03-28 18:09 | - | |
| commandlineparser/ | 2026-03-28 18:09 | - | |
| comment/ | 2026-03-28 18:09 | - | |
| commit/ | 2026-03-28 18:09 | - | |
| commitizen-go/ | 2026-03-28 18:10 | - | |
| commitizen/ | 2026-03-28 18:10 | - | |
| commport/ | 2026-03-28 18:09 | - | |
| communicate/ | 2026-03-28 18:09 | - | |
| communication/ | 2026-03-28 18:09 | - | |
| community-edition/ | 2026-03-28 18:10 | - | |
| community/ | 2026-03-28 18:09 | - | |
| companion/ | 2026-03-28 18:10 | - | |
| company/ | 2026-03-28 18:09 | - | |
| compare-files/ | 2026-03-28 18:09 | - | |
| compare-text/ | 2026-03-28 18:10 | - | |
| compare-tool/ | 2026-03-28 18:10 | - | |
| compare/ | 2026-03-28 18:09 | - | |
| comparepackage/ | 2026-03-28 18:09 | - | |
| comparing/ | 2026-03-28 18:09 | - | |
| comparison-tool/ | 2026-03-28 18:10 | - | |
| comparison/ | 2026-03-28 18:09 | - | |
| compatibility/ | 2026-03-28 18:09 | - | |
| compchem/ | 2026-03-28 18:10 | - | |
| competition/ | 2026-03-28 18:09 | - | |
| competitive/ | 2026-03-28 18:09 | - | |
| compilation/ | 2026-03-28 18:09 | - | |
| compile/ | 2026-03-28 18:09 | - | |
| compiler-optimization/ | 2026-03-28 18:09 | - | |
| compiler/ | 2026-03-28 18:09 | - | |
| completion/ | 2026-03-28 18:10 | - | |
| complexity/ | 2026-03-28 18:09 | - | |
| compliance/ | 2026-03-28 18:09 | - | |
| components/ | 2026-03-28 18:10 | - | |
| comport/ | 2026-03-28 18:09 | - | |
| compose-multiplatform/ | 2026-03-28 18:09 | - | |
| compose/ | 2026-03-28 18:09 | - | |
| composer/ | 2026-03-28 18:09 | - | |
| composition/ | 2026-03-28 18:10 | - | |
| compress-images/ | 2026-03-28 18:09 | - | |
| compress-pdf/ | 2026-03-28 18:09 | - | |
| compress/ | 2026-03-28 18:09 | - | |
| compressedfiles/ | 2026-03-28 18:10 | - | |
| compression/ | 2026-03-28 18:09 | - | |
| compressor/ | 2026-03-28 18:09 | - | |
| computation/ | 2026-03-28 18:09 | - | |
| compute-checksum/ | 2026-03-28 18:09 | - | |
| compute-engine/ | 2026-03-28 18:09 | - | |
| compute/ | 2026-03-28 18:09 | - | |
| computer-architecture/ | 2026-03-28 18:09 | - | |
| computer-kasse/ | 2026-03-28 18:09 | - | |
| computer-vision/ | 2026-03-28 18:10 | - | |
| computerkasse/ | 2026-03-28 18:09 | - | |
| computerscanning/ | 2026-03-28 18:09 | - | |
| comtrade/ | 2026-03-28 18:10 | - | |
| comunicate/ | 2026-03-28 18:09 | - | |
| comunication/ | 2026-03-28 18:09 | - | |
| conancenter/ | 2026-03-28 18:09 | - | |
| concentration/ | 2026-03-28 18:09 | - | |
| concordance/ | 2026-03-28 18:10 | - | |
| concourse/ | 2026-03-28 18:09 | - | |
| concrete/ | 2026-03-28 18:09 | - | |
| concurrency/ | 2026-03-28 18:10 | - | |
| conda-environment/ | 2026-03-28 18:10 | - | |
| conda-packages/ | 2026-03-28 18:10 | - | |
| conda/ | 2026-03-28 18:09 | - | |
| condition-monitoring/ | 2026-03-28 18:09 | - | |
| condition/ | 2026-03-28 18:09 | - | |
| conference/ | 2026-03-28 18:09 | - | |
| conferencing/ | 2026-03-28 18:09 | - | |
| confidential/ | 2026-03-28 18:09 | - | |
| config-as-code/ | 2026-03-28 18:09 | - | |
| config/ | 2026-03-28 18:09 | - | |
| configurable/ | 2026-03-28 18:09 | - | |
| configuration-as-code/ | 2026-03-28 18:09 | - | |
| configuration-files/ | 2026-03-28 18:09 | - | |
| configuration-management/ | 2026-03-28 18:09 | - | |
| configuration-profile/ | 2026-03-28 18:09 | - | |
| configuration/ | 2026-03-28 18:09 | - | |
| configurator/ | 2026-03-28 18:09 | - | |
| confluence/ | 2026-03-28 18:10 | - | |
| confluent cli/ | 2026-03-28 18:09 | - | |
| confluent cloud/ | 2026-03-28 18:09 | - | |
| conjur/ | 2026-03-28 18:09 | - | |
| connect/ | 2026-03-28 18:09 | - | |
| connection-quality/ | 2026-03-28 18:10 | - | |
| connection/ | 2026-03-28 18:09 | - | |
| connectionutility/ | 2026-03-28 18:09 | - | |
| conpty/ | 2026-03-28 18:09 | - | |
| conquer/ | 2026-03-28 18:09 | - | |
| consensus/ | 2026-03-28 18:09 | - | |
| console-app/ | 2026-03-28 18:09 | - | |
| console-application/ | 2026-03-28 18:09 | - | |
| console/ | 2026-03-28 18:09 | - | |
| constraint-programming/ | 2026-03-28 18:09 | - | |
| constraint/ | 2026-03-28 18:09 | - | |
| constrast/ | 2026-03-28 18:09 | - | |
| construction/ | 2026-03-28 18:09 | - | |
| consul/ | 2026-03-28 18:09 | - | |
| contact/ | 2026-03-28 18:09 | - | |
| contacts/ | 2026-03-28 18:09 | - | |
| container-image/ | 2026-03-28 18:09 | - | |
| container-images/ | 2026-03-28 18:09 | - | |
| container-tabs/ | 2026-03-28 18:09 | - | |
| container/ | 2026-03-28 18:09 | - | |
| containerd/ | 2026-03-28 18:10 | - | |
| containerfile/ | 2026-03-28 18:10 | - | |
| containerization/ | 2026-03-28 18:09 | - | |
| containers/ | 2026-03-28 18:09 | - | |
| content-delivery/ | 2026-03-28 18:09 | - | |
| content-discovery/ | 2026-03-28 18:09 | - | |
| content-management-system/ | 2026-03-28 18:09 | - | |
| content-management/ | 2026-03-28 18:09 | - | |
| content-services/ | 2026-03-28 18:09 | - | |
| content-type/ | 2026-03-28 18:09 | - | |
| content/ | 2026-03-28 18:09 | - | |
| contentdm/ | 2026-03-28 18:10 | - | |
| context-awareness/ | 2026-03-28 18:09 | - | |
| context-engineering/ | 2026-03-28 18:09 | - | |
| context-menu/ | 2026-03-28 18:09 | - | |
| context/ | 2026-03-28 18:09 | - | |
| continuous-delivery/ | 2026-03-28 18:09 | - | |
| continuous-integration/ | 2026-03-28 18:09 | - | |
| continuous/ | 2026-03-28 18:10 | - | |
| contour/ | 2026-03-28 18:09 | - | |
| contrast/ | 2026-03-28 18:09 | - | |
| control/ | 2026-03-28 18:09 | - | |
| controller/ | 2026-03-28 18:09 | - | |
| controllerfirmware/ | 2026-03-28 18:10 | - | |
| controlrr/ | 2026-03-28 18:09 | - | |
| conventional-changelog/ | 2026-03-28 18:10 | - | |
| conventional-commit/ | 2026-03-28 18:10 | - | |
| conventional-commits/ | 2026-03-28 18:10 | - | |
| converged-security-and-management/ | 2026-03-28 18:09 | - | |
| convergednetworkadapters/ | 2026-03-28 18:09 | - | |
| convergedsecurityandmanagementengine/ | 2026-03-28 18:09 | - | |
| conversation/ | 2026-03-28 18:09 | - | |
| conversational-ai/ | 2026-03-28 18:09 | - | |
| conversion/ | 2026-03-28 18:09 | - | |
| convert-currencies/ | 2026-03-28 18:09 | - | |
| convert-encoding/ | 2026-03-28 18:09 | - | |
| convert-images/ | 2026-03-28 18:09 | - | |
| convert/ | 2026-03-28 18:09 | - | |
| converter/ | 2026-03-28 18:09 | - | |
| converting/ | 2026-03-28 18:09 | - | |
| converts-images/ | 2026-03-28 18:10 | - | |
| cookies/ | 2026-03-28 18:09 | - | |
| coolq-http-api/ | 2026-03-28 18:09 | - | |
| coolq/ | 2026-03-28 18:09 | - | |
| coordinates/ | 2026-03-28 18:10 | - | |
| copier/ | 2026-03-28 18:09 | - | |
| copilot-replacement/ | 2026-03-28 18:09 | - | |
| copilot/ | 2026-03-28 18:09 | - | |
| copy-files/ | 2026-03-28 18:09 | - | |
| copy-paste/ | 2026-03-28 18:09 | - | |
| copy-protection/ | 2026-03-28 18:09 | - | |
| copy/ | 2026-03-28 18:09 | - | |
| copyparty/ | 2026-03-28 18:09 | - | |
![[DIR]](/icons/bomb.gif) | core/ | 2026-03-28 18:09 | - | |
| coreutils/ | 2026-03-28 18:10 | - | |
| corporate-resources/ | 2026-03-28 18:09 | - | |
| corporateresources/ | 2026-03-28 18:09 | - | |
| corpus-analysis/ | 2026-03-28 18:10 | - | |
| corpus/ | 2026-03-28 18:10 | - | |
| correct/ | 2026-03-28 18:09 | - | |
| correcteur-orthographique/ | 2026-03-28 18:09 | - | |
| corsairhidcoinstaller.inf/ | 2026-03-28 18:09 | - | |
| corsairlinkdigital/ | 2026-03-28 18:09 | - | |
| corsairsiusbxp.inf/ | 2026-03-28 18:09 | - | |
| corsinvest/ | 2026-03-28 18:09 | - | |
| cortana/ | 2026-03-28 18:09 | - | |
| cortex/ | 2026-03-28 18:10 | - | |
| cos/ | 2026-03-28 18:09 | - | |
| couchbase/ | 2026-03-28 18:09 | - | |
| counselor/ | 2026-03-28 18:10 | - | |
| count-lines/ | 2026-03-28 18:09 | - | |
| countdown/ | 2026-03-28 18:09 | - | |
| counter-strike-2/ | 2026-03-28 18:09 | - | |
| counter-strike-global-offensive/ | 2026-03-28 18:09 | - | |
| counter-strike/ | 2026-03-28 18:09 | - | |
| course/ | 2026-03-28 18:09 | - | |
| coverage-report-converter/ | 2026-03-28 18:09 | - | |
| coverage-report/ | 2026-03-28 18:09 | - | |
| coveragereportconverter/ | 2026-03-28 18:09 | - | |
| coverlet/ | 2026-03-28 18:09 | - | |
| cow/ | 2026-03-28 18:09 | - | |
| cowfile/ | 2026-03-28 18:09 | - | |
| cowsay/ | 2026-03-28 18:09 | - | |
| cowthink/ | 2026-03-28 18:09 | - | |
| cp437/ | 2026-03-28 18:09 | - | |
| cpan/ | 2026-03-28 18:10 | - | |
| cpap/ | 2026-03-28 18:09 | - | |
| cpd/ | 2026-03-28 18:09 | - | |
| cpio/ | 2026-03-28 18:09 | - | |
| cplusplus-interface/ | 2026-03-28 18:09 | - | |
| cplusplus/ | 2026-03-28 18:09 | - | |
| cplusplusinterface/ | 2026-03-28 18:09 | - | |
| cpluspluslibrary/ | 2026-03-28 18:09 | - | |
| cpp/ | 2026-03-28 18:09 | - | |
| cpp11/ | 2026-03-28 18:09 | - | |
| cpp17/ | 2026-03-28 18:09 | - | |
| cppcryptfs/ | 2026-03-28 18:09 | - | |
| cppwinrt/ | 2026-03-28 18:09 | - | |
| cpq/ | 2026-03-28 18:09 | - | |
| cpu-affinity/ | 2026-03-28 18:09 | - | |
| cpu-benchmark/ | 2026-03-28 18:10 | - | |
| cpu-emulator/ | 2026-03-28 18:09 | - | |
| cpu-encoding/ | 2026-03-28 18:09 | - | |
| cpu-fans/ | 2026-03-28 18:09 | - | |
| cpu/ | 2026-03-28 18:09 | - | |
| cpuid/ | 2026-03-28 18:09 | - | |
| cpuregisters/ | 2026-03-28 18:10 | - | |
| cpus/ | 2026-03-28 18:09 | - | |
| cpuz/ | 2026-03-28 18:09 | - | |
| cr2/ | 2026-03-28 18:09 | - | |
| cr95hf/ | 2026-03-28 18:10 | - | |
| crack/ | 2026-03-28 18:10 | - | |
| cracker/ | 2026-03-28 18:10 | - | |
| craftcms/ | 2026-03-28 18:09 | - | |
| cranelift/ | 2026-03-28 18:10 | - | |
| crash-reporter/ | 2026-03-28 18:09 | - | |
| crash/ | 2026-03-28 18:09 | - | |
| crashdumps/ | 2026-03-28 18:10 | - | |
| crashreporter/ | 2026-03-28 18:09 | - | |
| crawler/ | 2026-03-28 18:09 | - | |
| crazyflie/ | 2026-03-28 18:09 | - | |
| crc/ | 2026-03-28 18:09 | - | |
| crc32/ | 2026-03-28 18:09 | - | |
| crc32 crc64/ | 2026-03-28 18:10 | - | |
| create-iso/ | 2026-03-28 18:10 | - | |
| create-mst/ | 2026-03-28 18:09 | - | |
| creative-coding/ | 2026-03-28 18:10 | - | |
| creative/ | 2026-03-28 18:09 | - | |
| creativity/ | 2026-03-28 18:09 | - | |
| credential/ | 2026-03-28 18:09 | - | |
| credentials/ | 2026-03-28 18:09 | - | |
| crm/ | 2026-03-28 18:09 | - | |
| cron/ | 2026-03-28 18:09 | - | |
| crop-face/ | 2026-03-28 18:09 | - | |
| crop-images/ | 2026-03-28 18:09 | - | |
| crop-photos/ | 2026-03-28 18:09 | - | |
| crop/ | 2026-03-28 18:09 | - | |
| cross-platfork/ | 2026-03-28 18:09 | - | |
| cross-platform-gui/ | 2026-03-28 18:09 | - | |
| cross-platform/ | 2026-03-28 18:09 | - | |
| cross-view/ | 2026-03-28 18:09 | - | |
| crosshair-overlay/ | 2026-03-28 18:09 | - | |
| crosshair/ | 2026-03-28 18:09 | - | |
| crosshairs/ | 2026-03-28 18:10 | - | |
| crossmacro/ | 2026-03-28 18:09 | - | |
| crossover/ | 2026-03-28 18:09 | - | |
| crossterm/ | 2026-03-28 18:09 | - | |
| crowdin/ | 2026-03-28 18:09 | - | |
| cru/ | 2026-03-28 18:10 | - | |
| crucial-portable-ssd-utility/ | 2026-03-28 18:09 | - | |
| crucial/ | 2026-03-28 18:09 | - | |
| crucialportablessdutility/ | 2026-03-28 18:09 | - | |
| crunchyroll-downloader/ | 2026-03-28 18:09 | - | |
| crusader-kings-3/ | 2026-03-28 18:09 | - | |
| crusader-kings-iii/ | 2026-03-28 18:09 | - | |
| crw/ | 2026-03-28 18:09 | - | |
| cryfs/ | 2026-03-28 18:09 | - | |
| crypted/ | 2026-03-28 18:09 | - | |
| cryptlib/ | 2026-03-28 18:09 | - | |
| crypto-currency/ | 2026-03-28 18:09 | - | |
| crypto-rng/ | 2026-03-28 18:09 | - | |
| crypto-wallet/ | 2026-03-28 18:09 | - | |
| crypto/ | 2026-03-28 18:09 | - | |
| cryptocurrencies/ | 2026-03-28 18:09 | - | |
| cryptocurrency/ | 2026-03-28 18:09 | - | |
| cryptographic-function-library/ | 2026-03-28 18:09 | - | |
| cryptographicfunctionlibrary/ | 2026-03-28 18:09 | - | |
| cryptography/ | 2026-03-28 18:09 | - | |
| cryptology/ | 2026-03-28 18:09 | - | |
| cryptomator/ | 2026-03-28 18:10 | - | |
| cryptopro/ | 2026-03-28 18:09 | - | |
| cs/ | 2026-03-28 18:10 | - | |
| cs2-auto-accept/ | 2026-03-28 18:09 | - | |
| cs2/ | 2026-03-28 18:09 | - | |
| cs_go/ | 2026-03-28 18:09 | - | |
| csgo/ | 2026-03-28 18:09 | - | |
| csharp-app/ | 2026-03-28 18:10 | - | |
| csharp/ | 2026-03-28 18:09 | - | |
| csme-version-detection-tool/ | 2026-03-28 18:09 | - | |
| csmeversiondetectiontool/ | 2026-03-28 18:09 | - | |
| cso/ | 2026-03-28 18:10 | - | |
| csproj/ | 2026-03-28 18:10 | - | |
| css/ | 2026-03-28 18:09 | - | |
| csv-diff/ | 2026-03-28 18:09 | - | |
| csv-editor/ | 2026-03-28 18:09 | - | |
| csv-files/ | 2026-03-28 18:09 | - | |
| csv-format/ | 2026-03-28 18:09 | - | |
| csv-parser/ | 2026-03-28 18:09 | - | |
| csv/ | 2026-03-28 18:09 | - | |
| ctags/ | 2026-03-28 18:10 | - | |
| cube-engine/ | 2026-03-28 18:09 | - | |
| cube/ | 2026-03-28 18:09 | - | |
| cubeworld/ | 2026-03-28 18:09 | - | |
| cuda/ | 2026-03-28 18:09 | - | |
| cue/ | 2026-03-28 18:09 | - | |
| cuelang/ | 2026-03-28 18:09 | - | |
| cuesheet/ | 2026-03-28 18:09 | - | |
| cui/ | 2026-03-28 18:09 | - | |
| curation/ | 2026-03-28 18:09 | - | |
| curl/ | 2026-03-28 18:10 | - | |
| currencies/ | 2026-03-28 18:10 | - | |
| currency-conversion/ | 2026-03-28 18:09 | - | |
| currency-converter/ | 2026-03-28 18:09 | - | |
| currency/ | 2026-03-28 18:09 | - | |
| curseforge/ | 2026-03-28 18:09 | - | |
| cursor/ | 2026-03-28 18:09 | - | |
| cursors/ | 2026-03-28 18:09 | - | |
| curve25519/ | 2026-03-28 18:10 | - | |
| custom-minecraft-launcher/ | 2026-03-28 18:09 | - | |
| custom-wallpaper/ | 2026-03-28 18:10 | - | |
| custom-wsl-distro/ | 2026-03-28 18:10 | - | |
| customer-service/ | 2026-03-28 18:09 | - | |
| customer/ | 2026-03-28 18:09 | - | |
| customization/ | 2026-03-28 18:09 | - | |
| customize/ | 2026-03-28 18:09 | - | |
| customstatus/ | 2026-03-28 18:10 | - | |
| customtkinter/ | 2026-03-28 18:09 | - | |
| cut/ | 2026-03-28 18:09 | - | |
| cutomizable/ | 2026-03-28 18:09 | - | |
| cutter/ | 2026-03-28 18:09 | - | |
| cutting/ | 2026-03-28 18:09 | - | |
| cve-2025-42598/ | 2026-03-28 18:10 | - | |
| cve/ | 2026-03-28 18:09 | - | |
| cvp-709/ | 2026-03-28 18:10 | - | |
| cvp709/ | 2026-03-28 18:10 | - | |
| cyberark/ | 2026-03-28 18:09 | - | |
| cyberpocket/ | 2026-03-28 18:10 | - | |
| cyberpower/ | 2026-03-28 18:09 | - | |
| cyberpowerpanel/ | 2026-03-28 18:09 | - | |
| cyberpunk/ | 2026-03-28 18:09 | - | |
| cybersecurity/ | 2026-03-28 18:09 | - | |
| cycling/ | 2026-03-28 18:10 | - | |
| cyclonedx/ | 2026-03-28 18:09 | - | |
| cygwin/ | 2026-03-28 18:09 | - | |
| cypress/ | 2026-03-28 18:09 | - | |
| cytometry/ | 2026-03-28 18:09 | - | |
| cz-cli/ | 2026-03-28 18:10 | - | |
| cz/ | 2026-03-28 18:10 | - | |
| d-link-dwa-x1850-driver/ | 2026-03-28 18:09 | - | |
| d-logic/ | 2026-03-28 18:09 | - | |
| d-star/ | 2026-03-28 18:09 | - | |
| d3d-agility-sdk/ | 2026-03-28 18:09 | - | |
| d3d11/ | 2026-03-28 18:10 | - | |
| d3d12/ | 2026-03-28 18:09 | - | |
| d3dagilitysdk/ | 2026-03-28 18:09 | - | |
| d3dcompiler_43.dll/ | 2026-03-28 18:09 | - | |
| d3dcsx_43.dll/ | 2026-03-28 18:09 | - | |
| d3js/ | 2026-03-28 18:10 | - | |
| dab-decoder/ | 2026-03-28 18:09 | - | |
| dab/ | 2026-03-28 18:10 | - | |
| dabplus/ | 2026-03-28 18:09 | - | |
| dacpac/ | 2026-03-28 18:09 | - | |
| daemon/ | 2026-03-28 18:09 | - | |
| dagensnyheter/ | 2026-03-28 18:10 | - | |
| dagger/ | 2026-03-28 18:09 | - | |
| dailymotion/ | 2026-03-28 18:09 | - | |
| dam/ | 2026-03-28 18:09 | - | |
| damaged-disk/ | 2026-03-28 18:09 | - | |
| damaged-volume/ | 2026-03-28 18:09 | - | |
| daniel-palme/ | 2026-03-28 18:09 | - | |
| danmaku/ | 2026-03-28 18:09 | - | |
| danmu/ | 2026-03-28 18:09 | - | |
| dapp/ | 2026-03-28 18:09 | - | |
| dark-mode/ | 2026-03-28 18:09 | - | |
| dark-switch/ | 2026-03-28 18:09 | - | |
| dark-theme/ | 2026-03-28 18:09 | - | |
| dark/ | 2026-03-28 18:10 | - | |
| darkmode/ | 2026-03-28 18:09 | - | |
| darkroom/ | 2026-03-28 18:09 | - | |
| dart/ | 2026-03-28 18:09 | - | |
| dartlang/ | 2026-03-28 18:09 | - | |
| darwin/ | 2026-03-28 18:09 | - | |
| das/ | 2026-03-28 18:09 | - | |
| dash/ | 2026-03-28 18:09 | - | |
| dashboard/ | 2026-03-28 18:09 | - | |
| dashboarding/ | 2026-03-28 18:09 | - | |
| dashlane/ | 2026-03-28 18:09 | - | |
| dast/ | 2026-03-28 18:09 | - | |
| dat/ | 2026-03-28 18:09 | - | |
| data-analysis/ | 2026-03-28 18:09 | - | |
| data-analytics/ | 2026-03-28 18:09 | - | |
| data-at-rest-encryption/ | 2026-03-28 18:09 | - | |
| data-burner/ | 2026-03-28 18:09 | - | |
| data-cleaning/ | 2026-03-28 18:09 | - | |
| data-cleanup/ | 2026-03-28 18:09 | - | |
| data-comparison-tool/ | 2026-03-28 18:10 | - | |
| data-curation/ | 2026-03-28 18:10 | - | |
| data-decryption/ | 2026-03-28 18:09 | - | |
| data-encryption/ | 2026-03-28 18:09 | - | |
| data-engineering/ | 2026-03-28 18:09 | - | |
| data-extraction/ | 2026-03-28 18:10 | - | |
| data-harmonisation/ | 2026-03-28 18:10 | - | |
| data-loss/ | 2026-03-28 18:09 | - | |
| data-masking/ | 2026-03-28 18:09 | - | |
| data-mining/ | 2026-03-28 18:09 | - | |
| data-oriented-programming-language/ | 2026-03-28 18:10 | - | |
| data-pipeline/ | 2026-03-28 18:10 | - | |
| data-preparation/ | 2026-03-28 18:09 | - | |
| data-processing/ | 2026-03-28 18:09 | - | |
| data-processor/ | 2026-03-28 18:09 | - | |
| data-recovery/ | 2026-03-28 18:09 | - | |
| data-reduction/ | 2026-03-28 18:09 | - | |
| data-regression/ | 2026-03-28 18:09 | - | |
| data-removal/ | 2026-03-28 18:09 | - | |
| data-rescue/ | 2026-03-28 18:09 | - | |
| data-science/ | 2026-03-28 18:09 | - | |
| data-structures/ | 2026-03-28 18:09 | - | |
| data-testing/ | 2026-03-28 18:09 | - | |
| data-transformation/ | 2026-03-28 18:09 | - | |
| data-usage/ | 2026-03-28 18:09 | - | |
| data-visualisation/ | 2026-03-28 18:09 | - | |
| data-visualization/ | 2026-03-28 18:09 | - | |
| data-viz/ | 2026-03-28 18:09 | - | |
| data-wrangling/ | 2026-03-28 18:09 | - | |
| data/ | 2026-03-28 18:09 | - | |
| data analysis/ | 2026-03-28 18:10 | - | |
| database-as-a-service/ | 2026-03-28 18:10 | - | |
| database-browser/ | 2026-03-28 18:10 | - | |
| database-client/ | 2026-03-28 18:09 | - | |
| database-connector/ | 2026-03-28 18:09 | - | |
| database-editor/ | 2026-03-28 18:09 | - | |
| database-gui/ | 2026-03-28 18:09 | - | |
| database-management/ | 2026-03-28 18:09 | - | |
| database-manager/ | 2026-03-28 18:09 | - | |
| database-migrations/ | 2026-03-28 18:09 | - | |
| database-modeler/ | 2026-03-28 18:09 | - | |
| database-schema/ | 2026-03-28 18:09 | - | |
| database-tool/ | 2026-03-28 18:09 | - | |
| database/ | 2026-03-28 18:09 | - | |
| databricks/ | 2026-03-28 18:09 | - | |
| datacenter/ | 2026-03-28 18:10 | - | |
| datadog-agent/ | 2026-03-28 18:09 | - | |
| datadog/ | 2026-03-28 18:09 | - | |
| dataextraction/ | 2026-03-28 18:10 | - | |
| data integration/ | 2026-03-28 18:10 | - | |
| datalake/ | 2026-03-28 18:09 | - | |
| datamask/ | 2026-03-28 18:10 | - | |
| data science/ | 2026-03-28 18:09 | - | |
| datascience/ | 2026-03-28 18:09 | - | |
| dataset/ | 2026-03-28 18:09 | - | |
| datatransfer/ | 2026-03-28 18:09 | - | |
| date/ | 2026-03-28 18:09 | - | |
| datto/ | 2026-03-28 18:09 | - | |
| datv/ | 2026-03-28 18:10 | - | |
| davinci/ | 2026-03-28 18:09 | - | |
| daw/ | 2026-03-28 18:09 | - | |
| dax/ | 2026-03-28 18:09 | - | |
| daxter/ | 2026-03-28 18:10 | - | |
| db-files/ | 2026-03-28 18:09 | - | |
| db/ | 2026-03-28 18:09 | - | |
| db2/ | 2026-03-28 18:09 | - | |
| dbt/ | 2026-03-28 18:09 | - | |
| dcc/ | 2026-03-28 18:09 | - | |
| dcma/ | 2026-03-28 18:09 | - | |
| dcpcrypt/ | 2026-03-28 18:10 | - | |
| dcs-world/ | 2026-03-28 18:09 | - | |
| dcs/ | 2026-03-28 18:09 | - | |
| dctl/ | 2026-03-28 18:09 | - | |
| dd/ | 2026-03-28 18:09 | - | |
| ddc-ci/ | 2026-03-28 18:10 | - | |
| ddev/ | 2026-03-28 18:09 | - | |
| dds-files/ | 2026-03-28 18:09 | - | |
| dds/ | 2026-03-28 18:09 | - | |
| de-bouncing/ | 2026-03-28 18:10 | - | |
| de/ | 2026-03-28 18:09 | - | |
| deadlock/ | 2026-03-28 18:10 | - | |
| deaf/ | 2026-03-28 18:09 | - | |
| deathmatch/ | 2026-03-28 18:09 | - | |
| deb/ | 2026-03-28 18:09 | - | |
| debian-packages/ | 2026-03-28 18:09 | - | |
| debian/ | 2026-03-28 18:09 | - | |
| debloat/ | 2026-03-28 18:09 | - | |
| debloater/ | 2026-03-28 18:09 | - | |
| debloating/ | 2026-03-28 18:09 | - | |
| debotnet/ | 2026-03-28 18:10 | - | |
| debouncer/ | 2026-03-28 18:10 | - | |
| debrid/ | 2026-03-28 18:09 | - | |
| debug/ | 2026-03-28 18:09 | - | |
| debugger/ | 2026-03-28 18:09 | - | |
| debuggers/ | 2026-03-28 18:10 | - | |
| debugging-tool/ | 2026-03-28 18:09 | - | |
| debugging-tools/ | 2026-03-28 18:10 | - | |
| debugging/ | 2026-03-28 18:09 | - | |
| deceive/ | 2026-03-28 18:09 | - | |
| decentralised/ | 2026-03-28 18:09 | - | |
| decentralization/ | 2026-03-28 18:09 | - | |
| decentralized-messenger/ | 2026-03-28 18:09 | - | |
| decentralized/ | 2026-03-28 18:09 | - | |
| decimal/ | 2026-03-28 18:09 | - | |
| deck-tracker/ | 2026-03-28 18:09 | - | |
| deck/ | 2026-03-28 18:09 | - | |
| deckmanforwindows/ | 2026-03-28 18:09 | - | |
| decode/ | 2026-03-28 18:09 | - | |
| decoder/ | 2026-03-28 18:09 | - | |
| decoding/ | 2026-03-28 18:09 | - | |
| decompilation/ | 2026-03-28 18:10 | - | |
| decompile/ | 2026-03-28 18:09 | - | |
| decompiler-engine/ | 2026-03-28 18:09 | - | |
| decompiler/ | 2026-03-28 18:09 | - | |
| decompress/ | 2026-03-28 18:09 | - | |
| decompressing/ | 2026-03-28 18:09 | - | |
| decompression/ | 2026-03-28 18:09 | - | |
| decoration/ | 2026-03-28 18:09 | - | |
| decrypt-files/ | 2026-03-28 18:09 | - | |
| decrypt/ | 2026-03-28 18:09 | - | |
| decrypter/ | 2026-03-28 18:09 | - | |
| decryption/ | 2026-03-28 18:09 | - | |
| dedicated-gameservers/ | 2026-03-28 18:10 | - | |
| dedicated-server/ | 2026-03-28 18:10 | - | |
| dedupe/ | 2026-03-28 18:10 | - | |
| deduplicate/ | 2026-03-28 18:09 | - | |
| deduplication/ | 2026-03-28 18:09 | - | |
| deep-learning/ | 2026-03-28 18:09 | - | |
| deep-packet-inspection/ | 2026-03-28 18:10 | - | |
| deep-scan/ | 2026-03-28 18:09 | - | |
| deep-search/ | 2026-03-28 18:09 | - | |
| deep-sky/ | 2026-03-28 18:09 | - | |
| deepcool/ | 2026-03-28 18:10 | - | |
| deepin/ | 2026-03-28 18:09 | - | |
| deepl/ | 2026-03-28 18:09 | - | |
| deeppacketinspection/ | 2026-03-28 18:10 | - | |
| deepseek-r1/ | 2026-03-28 18:09 | - | |
| deepseek/ | 2026-03-28 18:09 | - | |
| deepvocal/ | 2026-03-28 18:09 | - | |
| deepzoom/ | 2026-03-28 18:09 | - | |
| deezer-downloader/ | 2026-03-28 18:09 | - | |
| deezer/ | 2026-03-28 18:09 | - | |
| defaultapps/ | 2026-03-28 18:10 | - | |
| defender/ | 2026-03-28 18:09 | - | |
| defense/ | 2026-03-28 18:09 | - | |
| defi/ | 2026-03-28 18:09 | - | |
| defich/ | 2026-03-28 18:09 | - | |
| deflector/ | 2026-03-28 18:10 | - | |
| defrag/ | 2026-03-28 18:10 | - | |
| defragment/ | 2026-03-28 18:10 | - | |
| defragmentation/ | 2026-03-28 18:09 | - | |
| defragmenting/ | 2026-03-28 18:09 | - | |
| del after reboot/ | 2026-03-28 18:09 | - | |
| delete-broken-shortcut-links/ | 2026-03-28 18:10 | - | |
| delete-drivers/ | 2026-03-28 18:09 | - | |
| delete-text/ | 2026-03-28 18:09 | - | |
| delete/ | 2026-03-28 18:09 | - | |
| deletebrokenshortcutlinks/ | 2026-03-28 18:10 | - | |
| deletedrivers/ | 2026-03-28 18:09 | - | |
| deletion/ | 2026-03-28 18:10 | - | |
| delivery-station/ | 2026-03-28 18:09 | - | |
| dell/ | 2026-03-28 18:09 | - | |
| dellinstrumentation.inf/ | 2026-03-28 18:09 | - | |
| delphi/ | 2026-03-28 18:09 | - | |
| delta-compression/ | 2026-03-28 18:10 | - | |
| delta/ | 2026-03-28 18:09 | - | |
| deltarune/ | 2026-03-28 18:09 | - | |
| democreator/ | 2026-03-28 18:09 | - | |
| demodulation/ | 2026-03-28 18:10 | - | |
| demux/ | 2026-03-28 18:09 | - | |
| dendy/ | 2026-03-28 18:09 | - | |
| deno/ | 2026-03-28 18:09 | - | |
| denoise/ | 2026-03-28 18:09 | - | |
| denon-dj/ | 2026-03-28 18:10 | - | |
| deobfuscate/ | 2026-03-28 18:09 | - | |
| deobfuscating/ | 2026-03-28 18:09 | - | |
| deobfuscation/ | 2026-03-28 18:09 | - | |
| dependencies/ | 2026-03-28 18:10 | - | |
| dependency-manager/ | 2026-03-28 18:09 | - | |
| dependencymanager/ | 2026-03-28 18:09 | - | |
| deploy/ | 2026-03-28 18:09 | - | |
| deployment/ | 2026-03-28 18:09 | - | |
| depotdownloader/ | 2026-03-28 18:09 | - | |
| deprecated-repo/ | 2026-03-28 18:09 | - | |
| deresute/ | 2026-03-28 18:10 | - | |
| desert/ | 2026-03-28 18:09 | - | |
| design-maker/ | 2026-03-28 18:10 | - | |
| design/ | 2026-03-28 18:09 | - | |
| desired-state-configuration/ | 2026-03-28 18:09 | - | |
| deskln/ | 2026-03-28 18:10 | - | |
| desktop-app/ | 2026-03-28 18:09 | - | |
| desktop-application/ | 2026-03-28 18:09 | - | |
| desktop-apps/ | 2026-03-28 18:09 | - | |
| desktop-bridge/ | 2026-03-28 18:09 | - | |
| desktop-environment/ | 2026-03-28 18:09 | - | |
| desktop-shortcuts/ | 2026-03-28 18:09 | - | |
| desktop-utility/ | 2026-03-28 18:09 | - | |
| desktop-watchmaker/ | 2026-03-28 18:09 | - | |
| desktop/ | 2026-03-28 18:09 | - | |
| desktopapps/ | 2026-03-28 18:09 | - | |
| desktopbridge/ | 2026-03-28 18:09 | - | |
| desktopshortcuts/ | 2026-03-28 18:09 | - | |
| despeckle/ | 2026-03-28 18:09 | - | |
| destruction/ | 2026-03-28 18:09 | - | |
| detect-faces/ | 2026-03-28 18:09 | - | |
| detect-file-architecture/ | 2026-03-28 18:09 | - | |
| detectfilearchitecture/ | 2026-03-28 18:09 | - | |
| detection/ | 2026-03-28 18:09 | - | |
| determined-ai/ | 2026-03-28 18:09 | - | |
| dev-c++/ | 2026-03-28 18:10 | - | |
| dev-cpp/ | 2026-03-28 18:09 | - | |
| dev-ops/ | 2026-03-28 18:10 | - | |
| dev-server/ | 2026-03-28 18:10 | - | |
| dev-tools/ | 2026-03-28 18:09 | - | |
| dev/ | 2026-03-28 18:09 | - | |
| devc++/ | 2026-03-28 18:09 | - | |
| devcon/ | 2026-03-28 18:09 | - | |
| devcontainer/ | 2026-03-28 18:09 | - | |
| devcpp/ | 2026-03-28 18:09 | - | |
| devdocs/ | 2026-03-28 18:09 | - | |
| deveco/ | 2026-03-28 18:09 | - | |
| develop/ | 2026-03-28 18:09 | - | |
| developer-experience/ | 2026-03-28 18:10 | - | |
| developer-tool/ | 2026-03-28 18:09 | - | |
| developer-toolkit/ | 2026-03-28 18:09 | - | |
| developer-tools/ | 2026-03-28 18:09 | - | |
| developer/ | 2026-03-28 18:09 | - | |
| developerlibraries/ | 2026-03-28 18:09 | - | |
| developers/ | 2026-03-28 18:09 | - | |
| developing/ | 2026-03-28 18:09 | - | |
| development-debugging/ | 2026-03-28 18:09 | - | |
| development-environment/ | 2026-03-28 18:09 | - | |
| development/ | 2026-03-28 18:09 | - | |
| developmentdebugging/ | 2026-03-28 18:09 | - | |
| developmentlibrary/ | 2026-03-28 18:09 | - | |
| device-drivers/ | 2026-03-28 18:09 | - | |
| device-forwarding/ | 2026-03-28 18:09 | - | |
| device-manager/ | 2026-03-28 18:09 | - | |
| device-sharing/ | 2026-03-28 18:09 | - | |
| device/ | 2026-03-28 18:09 | - | |
| devicedrivers/ | 2026-03-28 18:09 | - | |
| deviceforwarding/ | 2026-03-28 18:09 | - | |
| devicemanager/ | 2026-03-28 18:09 | - | |
| devices/ | 2026-03-28 18:09 | - | |
| devicesharing/ | 2026-03-28 18:09 | - | |
| devolutions/ | 2026-03-28 18:09 | - | |
| devops-agents/ | 2026-03-28 18:09 | - | |
| devops-tools/ | 2026-03-28 18:09 | - | |
| devops/ | 2026-03-28 18:09 | - | |
| devsecops/ | 2026-03-28 18:09 | - | |
| devtool/ | 2026-03-28 18:09 | - | |
| devtools/ | 2026-03-28 18:09 | - | |
| devup-ui/ | 2026-03-28 18:09 | - | |
| devutil/ | 2026-03-28 18:09 | - | |
| dex/ | 2026-03-28 18:09 | - | |
| dezoomify/ | 2026-03-28 18:09 | - | |
| df/ | 2026-03-28 18:09 | - | |
| dfir/ | 2026-03-28 18:10 | - | |
| dgx-650/ | 2026-03-28 18:10 | - | |
| dgx650/ | 2026-03-28 18:10 | - | |
| dhl-label/ | 2026-03-28 18:09 | - | |
| dhl/ | 2026-03-28 18:09 | - | |
| diabetes/ | 2026-03-28 18:09 | - | |
| diagnostic/ | 2026-03-28 18:09 | - | |
| diagram-editor/ | 2026-03-28 18:09 | - | |
| diagram/ | 2026-03-28 18:09 | - | |
| diagrams/ | 2026-03-28 18:10 | - | |
| diamonds/ | 2026-03-28 18:09 | - | |
| diary/ | 2026-03-28 18:09 | - | |
| dice-game/ | 2026-03-28 18:09 | - | |
| dicegame/ | 2026-03-28 18:09 | - | |
| dicom-files/ | 2026-03-28 18:10 | - | |
| dicom-images/ | 2026-03-28 18:10 | - | |
| dicom-pr/ | 2026-03-28 18:10 | - | |
| dicom-rt/ | 2026-03-28 18:10 | - | |
| dicom-viewer/ | 2026-03-28 18:10 | - | |
| dicom-web-viewer/ | 2026-03-28 18:10 | - | |
| dicom/ | 2026-03-28 18:09 | - | |
| dicomizer/ | 2026-03-28 18:09 | - | |
| dict/ | 2026-03-28 18:09 | - | |
| dictaphone/ | 2026-03-28 18:09 | - | |
| dictate/ | 2026-03-28 18:09 | - | |
| dictation/ | 2026-03-28 18:09 | - | |
| dictionary/ | 2026-03-28 18:09 | - | |
| did/ | 2026-03-28 18:10 | - | |
| diff/ | 2026-03-28 18:09 | - | |
| diff3/ | 2026-03-28 18:09 | - | |
| difference/ | 2026-03-28 18:09 | - | |
| differential/ | 2026-03-28 18:10 | - | |
| diffs/ | 2026-03-28 18:10 | - | |
| diffusion/ | 2026-03-28 18:10 | - | |
| dig-dug/ | 2026-03-28 18:09 | - | |
| dig/ | 2026-03-28 18:09 | - | |
| digest/ | 2026-03-28 18:10 | - | |
| digital-art/ | 2026-03-28 18:10 | - | |
| digital-asset-management/ | 2026-03-28 18:09 | - | |
| digital-audio-editor/ | 2026-03-28 18:10 | - | |
| digital-audio-workstation/ | 2026-03-28 18:09 | - | |
| digital-estate-planning/ | 2026-03-28 18:09 | - | |
| digital-library/ | 2026-03-28 18:09 | - | |
| digital-microscope/ | 2026-03-28 18:10 | - | |
| digital-negative/ | 2026-03-28 18:09 | - | |
| digital-signal-processing/ | 2026-03-28 18:09 | - | |
| digital-signature/ | 2026-03-28 18:09 | - | |
| digital-storage-oscilloscope/ | 2026-03-28 18:10 | - | |
| digital-wellness/ | 2026-03-28 18:10 | - | |
| digital/ | 2026-03-28 18:09 | - | |
| digitalasignaturer/ | 2026-03-28 18:09 | - | |
| digitalestateplanning/ | 2026-03-28 18:09 | - | |
| digitalnetworklivingalliance/ | 2026-03-28 18:09 | - | |
| digitalocean/ | 2026-03-28 18:09 | - | |
| digitalrf/ | 2026-03-28 18:09 | - | |
| digitalsignalprocessing/ | 2026-03-28 18:10 | - | |
| digital signature/ | 2026-03-28 18:10 | - | |
| digitalsignatures/ | 2026-03-28 18:09 | - | |
| digitalsubtitles/ | 2026-03-28 18:10 | - | |
| digitaltv/ | 2026-03-28 18:10 | - | |
| dim/ | 2026-03-28 18:09 | - | |
| dimensions/ | 2026-03-28 18:09 | - | |
| dimmer/ | 2026-03-28 18:10 | - | |
| dimming/ | 2026-03-28 18:10 | - | |
| dinamo/ | 2026-03-28 18:09 | - | |
| dinamo networks/ | 2026-03-28 18:09 | - | |
| dingding/ | 2026-03-28 18:09 | - | |
| dingtalk/ | 2026-03-28 18:09 | - | |
| dir/ | 2026-03-28 18:10 | - | |
| directdraw-surface/ | 2026-03-28 18:09 | - | |
| directdraw/ | 2026-03-28 18:09 | - | |
| directdrawsurface/ | 2026-03-28 18:09 | - | |
| directing/ | 2026-03-28 18:10 | - | |
| directinput/ | 2026-03-28 18:09 | - | |
| director/ | 2026-03-28 18:09 | - | |
| directory/ | 2026-03-28 18:09 | - | |
| directory comparison/ | 2026-03-28 18:10 | - | |
| directory synchronization/ | 2026-03-28 18:10 | - | |
| directshow/ | 2026-03-28 18:09 | - | |
| directstorage/ | 2026-03-28 18:10 | - | |
| directx/ | 2026-03-28 18:09 | - | |
| directx9 dx9 d3dx9_43.dll/ | 2026-03-28 18:09 | - | |
| directx10 dx10 d3dx10_43.dll/ | 2026-03-28 18:09 | - | |
| directx11 dx11 d3dx11_43.dll/ | 2026-03-28 18:09 | - | |
| dirkböttcher/ | 2026-03-28 18:10 | - | |
| disable/ | 2026-03-28 18:10 | - | |
| disablenetworkthrottling/ | 2026-03-28 18:09 | - | |
| disassemble/ | 2026-03-28 18:09 | - | |
| disassembler/ | 2026-03-28 18:09 | - | |
| disassembly/ | 2026-03-28 18:10 | - | |
| disc/ | 2026-03-28 18:10 | - | |
| discharge/ | 2026-03-28 18:10 | - | |
| disco/ | 2026-03-28 18:09 | - | |
| discord-api/ | 2026-03-28 18:09 | - | |
| discord-bot-client/ | 2026-03-28 18:09 | - | |
| discord-bot/ | 2026-03-28 18:09 | - | |
| discord-client-mod/ | 2026-03-28 18:09 | - | |
| discord-client/ | 2026-03-28 18:09 | - | |
| discord-mod/ | 2026-03-28 18:09 | - | |
| discord-overlay/ | 2026-03-28 18:10 | - | |
| discord-plugin/ | 2026-03-28 18:09 | - | |
| discord-proxy/ | 2026-03-28 18:09 | - | |
| discord-qt/ | 2026-03-28 18:09 | - | |
| discord-rich-presence/ | 2026-03-28 18:09 | - | |
| discord-rpc/ | 2026-03-28 18:09 | - | |
| discord-theme/ | 2026-03-28 18:09 | - | |
| discord/ | 2026-03-28 18:09 | - | |
| discordapp/ | 2026-03-28 18:09 | - | |
| discordmedialoader/ | 2026-03-28 18:10 | - | |
| discordrpc/ | 2026-03-28 18:10 | - | |
| discover/ | 2026-03-28 18:09 | - | |
| discovery-api/ | 2026-03-28 18:09 | - | |
| discovery/ | 2026-03-28 18:09 | - | |
| discrete-event/ | 2026-03-28 18:09 | - | |
| discripping/ | 2026-03-28 18:10 | - | |
| disk-analyzer/ | 2026-03-28 18:09 | - | |
| disk-backup/ | 2026-03-28 18:09 | - | |
| disk-cleanup/ | 2026-03-28 18:10 | - | |
| disk-clone/ | 2026-03-28 18:09 | - | |
| disk-defrag/ | 2026-03-28 18:09 | - | |
| disk-diagnostics/ | 2026-03-28 18:09 | - | |
| disk-editor/ | 2026-03-28 18:09 | - | |
| disk-imaging/ | 2026-03-28 18:09 | - | |
| disk-management/ | 2026-03-28 18:09 | - | |
| disk-monitoring/ | 2026-03-28 18:10 | - | |
| disk-recovery/ | 2026-03-28 18:09 | - | |
| disk-space-analyzer/ | 2026-03-28 18:09 | - | |
| disk-space-available/ | 2026-03-28 18:09 | - | |
| disk-space/ | 2026-03-28 18:09 | - | |
| disk-usage-analyzer/ | 2026-03-28 18:09 | - | |
| disk-usage/ | 2026-03-28 18:09 | - | |
| disk-utility/ | 2026-03-28 18:09 | - | |
| disk-wipe/ | 2026-03-28 18:09 | - | |
| disk/ | 2026-03-28 18:09 | - | |
| diskhealth/ | 2026-03-28 18:09 | - | |
| diskoptimization/ | 2026-03-28 18:10 | - | |
| diskspace/ | 2026-03-28 18:09 | - | |
| diskspaceanalysis/ | 2026-03-28 18:10 | - | |
| dism/ | 2026-03-28 18:09 | - | |
| disney/ | 2026-03-28 18:10 | - | |
| display-driver/ | 2026-03-28 18:09 | - | |
| display/ | 2026-03-28 18:09 | - | |
| displaylink/ | 2026-03-28 18:09 | - | |
| displaymonitorsound/ | 2026-03-28 18:09 | - | |
| displayportsound/ | 2026-03-28 18:09 | - | |
| displays/ | 2026-03-28 18:09 | - | |
| distnoted/ | 2026-03-28 18:09 | - | |
| distribute/ | 2026-03-28 18:09 | - | |
| distributed-computing/ | 2026-03-28 18:09 | - | |
| distributed-database/ | 2026-03-28 18:09 | - | |
| distributed-file-system/ | 2026-03-28 18:10 | - | |
| distributed-systems/ | 2026-03-28 18:09 | - | |
| distributed-tracing/ | 2026-03-28 18:09 | - | |
| distributed/ | 2026-03-28 18:09 | - | |
| distributing/ | 2026-03-28 18:09 | - | |
| distribution/ | 2026-03-28 18:09 | - | |
| distro/ | 2026-03-28 18:09 | - | |
| distroav/ | 2026-03-28 18:09 | - | |
| dithering-algorithms/ | 2026-03-28 18:09 | - | |
| dithering-images/ | 2026-03-28 18:09 | - | |
| divelog/ | 2026-03-28 18:10 | - | |
| diving/ | 2026-03-28 18:10 | - | |
| divoom/ | 2026-03-28 18:09 | - | |
| dj-application/ | 2026-03-28 18:09 | - | |
| dj-library/ | 2026-03-28 18:09 | - | |
| dj-link/ | 2026-03-28 18:09 | - | |
| dj-metadata/ | 2026-03-28 18:09 | - | |
| dj-mixing/ | 2026-03-28 18:09 | - | |
| dj/ | 2026-03-28 18:09 | - | |
| django/ | 2026-03-28 18:09 | - | |
| dji/ | 2026-03-28 18:09 | - | |
| djing/ | 2026-03-28 18:10 | - | |
| djv/ | 2026-03-28 18:10 | - | |
| djvu/ | 2026-03-28 18:09 | - | |
| djxl/ | 2026-03-28 18:09 | - | |
| dk/ | 2026-03-28 18:09 | - | |
| dl4yhf/ | 2026-03-28 18:10 | - | |
| dl533r/ | 2026-03-28 18:09 | - | |
| dlang/ | 2026-03-28 18:09 | - | |
| dlinkdwax1850driver/ | 2026-03-28 18:09 | - | |
| dll-injection/ | 2026-03-28 18:10 | - | |
| dll/ | 2026-03-28 18:09 | - | |
| dlna/ | 2026-03-28 18:09 | - | |
| dlogic/ | 2026-03-28 18:09 | - | |
| dlp/ | 2026-03-28 18:09 | - | |
| dlss/ | 2026-03-28 18:09 | - | |
| dma/ | 2026-03-28 18:09 | - | |
| dml/ | 2026-03-28 18:10 | - | |
| dmn/ | 2026-03-28 18:09 | - | |
| dmod/ | 2026-03-28 18:10 | - | |
| dmr/ | 2026-03-28 18:09 | - | |
| dmx/ | 2026-03-28 18:09 | - | |
| dmx512/ | 2026-03-28 18:10 | - | |
| dna-sequencing/ | 2026-03-28 18:10 | - | |
| dna/ | 2026-03-28 18:09 | - | |
| dng/ | 2026-03-28 18:09 | - | |
| dni/ | 2026-03-28 18:09 | - | |
| dnie/ | 2026-03-28 18:09 | - | |
| dnn/ | 2026-03-28 18:10 | - | |
| dns-client/ | 2026-03-28 18:09 | - | |
| dns-over-https/ | 2026-03-28 18:09 | - | |
| dns-over-quic/ | 2026-03-28 18:09 | - | |
| dns-over-tls/ | 2026-03-28 18:09 | - | |
| dns/ | 2026-03-28 18:09 | - | |
| dnscrypt-proxy/ | 2026-03-28 18:09 | - | |
| dnscrypt/ | 2026-03-28 18:09 | - | |
| dnspy/ | 2026-03-28 18:09 | - | |
| dnspyex/ | 2026-03-28 18:09 | - | |
| dnssec/ | 2026-03-28 18:09 | - | |
| doc-to-mp3/ | 2026-03-28 18:09 | - | |
| doc/ | 2026-03-28 18:09 | - | |
| dock/ | 2026-03-28 18:09 | - | |
| docker-compose/ | 2026-03-28 18:09 | - | |
| docker-container/ | 2026-03-28 18:10 | - | |
| docker-image/ | 2026-03-28 18:10 | - | |
| docker/ | 2026-03-28 18:09 | - | |
| dockerfile/ | 2026-03-28 18:09 | - | |
| docs/ | 2026-03-28 18:09 | - | |
| docset/ | 2026-03-28 18:09 | - | |
| doctl/ | 2026-03-28 18:09 | - | |
| document-converter/ | 2026-03-28 18:10 | - | |
| document-database/ | 2026-03-28 18:09 | - | |
| document-editor/ | 2026-03-28 18:09 | - | |
| document-management-system/ | 2026-03-28 18:10 | - | |
| document-management/ | 2026-03-28 18:10 | - | |
| document/ | 2026-03-28 18:09 | - | |
| documentary/ | 2026-03-28 18:09 | - | |
| documentation-library/ | 2026-03-28 18:10 | - | |
| documentation-sets/ | 2026-03-28 18:10 | - | |
| documentation-tool/ | 2026-03-28 18:09 | - | |
| documentation/ | 2026-03-28 18:09 | - | |
| documention/ | 2026-03-28 18:09 | - | |
| docx/ | 2026-03-28 18:09 | - | |
| dod/ | 2026-03-28 18:09 | - | |
| doge/ | 2026-03-28 18:09 | - | |
| dogecoin/ | 2026-03-28 18:09 | - | |
| doh/ | 2026-03-28 18:09 | - | |
| doit/ | 2026-03-28 18:09 | - | |
| dolby/ | 2026-03-28 18:09 | - | |
| dolphin/ | 2026-03-28 18:09 | - | |
| domain-controller/ | 2026-03-28 18:09 | - | |
| domain-driven-design/ | 2026-03-28 18:10 | - | |
| domainservicesforest/ | 2026-03-28 18:09 | - | |
| donghua/ | 2026-03-28 18:09 | - | |
| donkey/ | 2026-03-28 18:09 | - | |
| doom/ | 2026-03-28 18:09 | - | |
| doq/ | 2026-03-28 18:09 | - | |
| dos/ | 2026-03-28 18:09 | - | |
| dosbox-staging/ | 2026-03-28 18:09 | - | |
| dosbox/ | 2026-03-28 18:09 | - | |
| dosv/ | 2026-03-28 18:10 | - | |
| dot-browser/ | 2026-03-28 18:09 | - | |
| dot.browser/ | 2026-03-28 18:09 | - | |
| dot/ | 2026-03-28 18:09 | - | |
| dota2/ | 2026-03-28 18:09 | - | |
| dotbot/ | 2026-03-28 18:10 | - | |
| dotbrowser/ | 2026-03-28 18:09 | - | |
| dotcover/ | 2026-03-28 18:09 | - | |
| dotenv/ | 2026-03-28 18:09 | - | |
| dotenvx/ | 2026-03-28 18:09 | - | |
| dotfile-management/ | 2026-03-28 18:10 | - | |
| dotfile-manager/ | 2026-03-28 18:09 | - | |
| dotfile/ | 2026-03-28 18:09 | - | |
| dotfiles-manager/ | 2026-03-28 18:10 | - | |
| dotfiles/ | 2026-03-28 18:09 | - | |
| dotmemory/ | 2026-03-28 18:09 | - | |
| dotnet-core/ | 2026-03-28 18:09 | - | |
| dotnet-framework/ | 2026-03-28 18:09 | - | |
| dotnet-tool/ | 2026-03-28 18:09 | - | |
| dotnet-versions/ | 2026-03-28 18:09 | - | |
| dotnet/ | 2026-03-28 18:09 | - | |
| dotnet6/ | 2026-03-28 18:10 | - | |
| dotnet8/ | 2026-03-28 18:09 | - | |
| dotnetcore/ | 2026-03-28 18:09 | - | |
| dotnetlibraries/ | 2026-03-28 18:09 | - | |
| dotnetnuke/ | 2026-03-28 18:10 | - | |
| dotpeek/ | 2026-03-28 18:09 | - | |
| dots-and-boxes/ | 2026-03-28 18:09 | - | |
| dottrace/ | 2026-03-28 18:09 | - | |
| douban/ | 2026-03-28 18:09 | - | |
| doubao/ | 2026-03-28 18:09 | - | |
| double-ratchet/ | 2026-03-28 18:09 | - | |
| douyin/ | 2026-03-28 18:09 | - | |
| downgrade/ | 2026-03-28 18:09 | - | |
| download-manager/ | 2026-03-28 18:09 | - | |
| download-video/ | 2026-03-28 18:09 | - | |
| download/ | 2026-03-28 18:09 | - | |
| downloader/ | 2026-03-28 18:09 | - | |
| downloadhelper/ | 2026-03-28 18:10 | - | |
| downloadmanager/ | 2026-03-28 18:09 | - | |
| downloads-videos/ | 2026-03-28 18:10 | - | |
| downloadspeed/ | 2026-03-28 18:09 | - | |
| dozen-mesa/ | 2026-03-28 18:09 | - | |
| dpc/ | 2026-03-28 18:09 | - | |
| dpi/ | 2026-03-28 18:09 | - | |
| dpinst/ | 2026-03-28 18:09 | - | |
| dpmr/ | 2026-03-28 18:10 | - | |
| dpsound/ | 2026-03-28 18:09 | - | |
| dpumdf.inf/ | 2026-03-28 18:09 | - | |
| draw/ | 2026-03-28 18:09 | - | |
| drawing-exchange-format/ | 2026-03-28 18:10 | - | |
| drawing/ | 2026-03-28 18:09 | - | |
| drawingtablet/ | 2026-03-28 18:09 | - | |
| drawio/ | 2026-03-28 18:10 | - | |
| drbd/ | 2026-03-28 18:10 | - | |
| dreamcast/ | 2026-03-28 18:10 | - | |
| drill-view/ | 2026-03-28 18:09 | - | |
| drive-clone/ | 2026-03-28 18:09 | - | |
| drive-erase/ | 2026-03-28 18:09 | - | |
| drive-lock/ | 2026-03-28 18:09 | - | |
| drive-wipe/ | 2026-03-28 18:09 | - | |
| drive/ | 2026-03-28 18:09 | - | |
| drivelock/ | 2026-03-28 18:09 | - | |
| driver-downloader/ | 2026-03-28 18:09 | - | |
| driver-install/ | 2026-03-28 18:09 | - | |
| driver-installer/ | 2026-03-28 18:09 | - | |
| driver-store-explorer/ | 2026-03-28 18:09 | - | |
| driver-updater/ | 2026-03-28 18:09 | - | |
| driver/ | 2026-03-28 18:09 | - | |
| drivers-cloud/ | 2026-03-28 18:09 | - | |
| drivers/ | 2026-03-28 18:09 | - | |
| driverscanning/ | 2026-03-28 18:09 | - | |
| driverstore/ | 2026-03-28 18:09 | - | |
| drivewipe/ | 2026-03-28 18:09 | - | |
| driving/ | 2026-03-28 18:09 | - | |
| drivingsimulator/ | 2026-03-28 18:09 | - | |
| drm/ | 2026-03-28 18:09 | - | |
| drone/ | 2026-03-28 18:09 | - | |
| drop-zone/ | 2026-03-28 18:10 | - | |
| dropbox/ | 2026-03-28 18:09 | - | |
| drsreplicateverifyobjects/ | 2026-03-28 18:09 | - | |
| drtv/ | 2026-03-28 18:10 | - | |
| drum/ | 2026-03-28 18:09 | - | |
| drumlin/ | 2026-03-28 18:10 | - | |
| drums/ | 2026-03-28 18:09 | - | |
| drupal/ | 2026-03-28 18:09 | - | |
| dsa/ | 2026-03-28 18:09 | - | |
| dsc/ | 2026-03-28 18:09 | - | |
| dscv3/ | 2026-03-28 18:09 | - | |
| dse/ | 2026-03-28 18:09 | - | |
| dsgvo/ | 2026-03-28 18:10 | - | |
| dso/ | 2026-03-28 18:10 | - | |
| dsp/ | 2026-03-28 18:09 | - | |
| dssim/ | 2026-03-28 18:09 | - | |
| dsucontroller/ | 2026-03-28 18:09 | - | |
| dts-hd/ | 2026-03-28 18:09 | - | |
| dts/ | 2026-03-28 18:09 | - | |
| dtv/ | 2026-03-28 18:10 | - | |
| dualsense-edge/ | 2026-03-28 18:10 | - | |
| dualsense/ | 2026-03-28 18:09 | - | |
| dualsenseedge/ | 2026-03-28 18:10 | - | |
| dualshock/ | 2026-03-28 18:09 | - | |
| ducats/ | 2026-03-28 18:10 | - | |
| duckdb/ | 2026-03-28 18:09 | - | |
| duckdns-client/ | 2026-03-28 18:10 | - | |
| duckdns/ | 2026-03-28 18:09 | - | |
| duet/ | 2026-03-28 18:09 | - | |
| duke-nukem/ | 2026-03-28 18:09 | - | |
| duke/ | 2026-03-28 18:09 | - | |
| dummy-plug/ | 2026-03-28 18:09 | - | |
| dump/ | 2026-03-28 18:09 | - | |
| dune/ | 2026-03-28 18:09 | - | |
| dupe/ | 2026-03-28 18:10 | - | |
| duplicate-detection/ | 2026-03-28 18:09 | - | |
| duplicate/ | 2026-03-28 18:09 | - | |
| duplicatefiles/ | 2026-03-28 18:10 | - | |
| duplicate finder/ | 2026-03-28 18:09 | - | |
| duplicates/ | 2026-03-28 18:09 | - | |
| duplicati/ | 2026-03-28 18:09 | - | |
| dv-camcorders/ | 2026-03-28 18:10 | - | |
| dv-in/ | 2026-03-28 18:10 | - | |
| dv-videorecorders/ | 2026-03-28 18:10 | - | |
| dvb-t/ | 2026-03-28 18:10 | - | |
| dvb/ | 2026-03-28 18:09 | - | |
| dvbt/ | 2026-03-28 18:10 | - | |
| dvcs/ | 2026-03-28 18:09 | - | |
| dvd-eraser/ | 2026-03-28 18:09 | - | |
| dvd/ | 2026-03-28 18:09 | - | |
| dvdflick/ | 2026-03-28 18:09 | - | |
| dvpn/ | 2026-03-28 18:09 | - | |
| dvr/ | 2026-03-28 18:09 | - | |
| dweb/ | 2026-03-28 18:09 | - | |
| dwf/ | 2026-03-28 18:09 | - | |
| dwg/ | 2026-03-28 18:09 | - | |
| dwm/ | 2026-03-28 18:09 | - | |
| dxcluster/ | 2026-03-28 18:09 | - | |
| dxf/ | 2026-03-28 18:09 | - | |
| dxil.dll/ | 2026-03-28 18:09 | - | |
| dxr/ | 2026-03-28 18:10 | - | |
| dxwebsetup/ | 2026-03-28 18:09 | - | |
| dymo/ | 2026-03-28 18:10 | - | |
| dynamic-desktop/ | 2026-03-28 18:09 | - | |
| dynamic-ip/ | 2026-03-28 18:09 | - | |
| dynamodb/ | 2026-03-28 18:10 | - | |
| dynamorio/ | 2026-03-28 18:09 | - | |
| dynir/ | 2026-03-28 18:10 | - | |
| e-assessment/ | 2026-03-28 18:10 | - | |
| e-book/ | 2026-03-28 18:09 | - | |
| e-books/ | 2026-03-28 18:09 | - | |
| e-commerce/ | 2026-03-28 18:09 | - | |
| e-cores/ | 2026-03-28 18:09 | - | |
| e-government/ | 2026-03-28 18:10 | - | |
| e-hoarding/ | 2026-03-28 18:10 | - | |
| e-mail/ | 2026-03-28 18:09 | - | |
| e-reader/ | 2026-03-28 18:09 | - | |
| e-rechnung/ | 2026-03-28 18:10 | - | |
| e-signature/ | 2026-03-28 18:09 | - | |
| e2e-encryption/ | 2026-03-28 18:10 | - | |
| e2ee/ | 2026-03-28 18:09 | - | |
| eGov/ | 2026-03-28 18:09 | - | |
| ea-desktop/ | 2026-03-28 18:09 | - | |
| ea/ | 2026-03-28 18:09 | - | |
| eac/ | 2026-03-28 18:09 | - | |
| eac3/ | 2026-03-28 18:09 | - | |
| eac3to/ | 2026-03-28 18:09 | - | |
| eagle/ | 2026-03-28 18:09 | - | |
| ean/ | 2026-03-28 18:09 | - | |
| eaorigin/ | 2026-03-28 18:09 | - | |
| earbuds/ | 2026-03-28 18:09 | - | |
| earplugs/ | 2026-03-28 18:09 | - | |
| earth-science/ | 2026-03-28 18:09 | - | |
| earth/ | 2026-03-28 18:09 | - | |
| earthwork/ | 2026-03-28 18:09 | - | |
| eartrumpet/ | 2026-03-28 18:09 | - | |
| easeus/ | 2026-03-28 18:09 | - | |
| eassos-recovery/ | 2026-03-28 18:09 | - | |
| easy-deployment/ | 2026-03-28 18:10 | - | |
| easy-navigation/ | 2026-03-28 18:09 | - | |
| easy-tag/ | 2026-03-28 18:09 | - | |
| easy-to-use/ | 2026-03-28 18:09 | - | |
| easycodingteam/ | 2026-03-28 18:10 | - | |
| eax/ | 2026-03-28 18:09 | - | |
| ebank/ | 2026-03-28 18:09 | - | |
| ebay/ | 2026-03-28 18:09 | - | |
| ebbflow/ | 2026-03-28 18:09 | - | |
| ebics/ | 2026-03-28 18:09 | - | |
| ebook-editor/ | 2026-03-28 18:09 | - | |
| ebook-reader/ | 2026-03-28 18:09 | - | |
| ebook-thumbnails/ | 2026-03-28 18:09 | - | |
| ebook/ | 2026-03-28 18:09 | - | |
| ebooks-thumbnails/ | 2026-03-28 18:09 | - | |
| ebooks/ | 2026-03-28 18:09 | - | |
| ebooksthumbnails/ | 2026-03-28 18:09 | - | |
| ebookthumbnails/ | 2026-03-28 18:09 | - | |
| ecc/ | 2026-03-28 18:09 | - | |
| ecdh/ | 2026-03-28 18:09 | - | |
| ecdsa/ | 2026-03-28 18:09 | - | |
| eclipse-community/ | 2026-03-28 18:09 | - | |
| eclipse-rcp/ | 2026-03-28 18:10 | - | |
| eclipse/ | 2026-03-28 18:09 | - | |
| econometrics/ | 2026-03-28 18:09 | - | |
| economics/ | 2026-03-28 18:09 | - | |
| ecoqos/ | 2026-03-28 18:10 | - | |
| ecores/ | 2026-03-28 18:09 | - | |
| ecs/ | 2026-03-28 18:09 | - | |
| ed2k/ | 2026-03-28 18:09 | - | |
| ed25519/ | 2026-03-28 18:09 | - | |
| eda/ | 2026-03-28 18:09 | - | |
| eddn/ | 2026-03-28 18:09 | - | |
| edge-computing/ | 2026-03-28 18:09 | - | |
| edge-sucks/ | 2026-03-28 18:09 | - | |
| edge/ | 2026-03-28 18:09 | - | |
| edgewebview2/ | 2026-03-28 18:10 | - | |
| edid/ | 2026-03-28 18:10 | - | |
| edit-password/ | 2026-03-28 18:10 | - | |
| edit/ | 2026-03-28 18:09 | - | |
| editing/ | 2026-03-28 18:09 | - | |
| editor/ | 2026-03-28 18:09 | - | |
| editorconfig-checker/ | 2026-03-28 18:09 | - | |
| editorconfig/ | 2026-03-28 18:09 | - | |
| editors/ | 2026-03-28 18:09 | - | |
| edon-r-256 edon-r-384 edon-r-512/ | 2026-03-28 18:10 | - | |
| edu/ | 2026-03-28 18:10 | - | |
| educatief/ | 2026-03-28 18:09 | - | |
| education/ | 2026-03-28 18:09 | - | |
| educational-content/ | 2026-03-28 18:09 | - | |
| educational/ | 2026-03-28 18:09 | - | |
| eduvpn/ | 2026-03-28 18:09 | - | |
| effect/ | 2026-03-28 18:09 | - | |
| effects/ | 2026-03-28 18:09 | - | |
| efficiency/ | 2026-03-28 18:09 | - | |
| efficient/ | 2026-03-28 18:09 | - | |
| efi/ | 2026-03-28 18:09 | - | |
| efx/ | 2026-03-28 18:09 | - | |
| eggbert/ | 2026-03-28 18:09 | - | |
| egui/ | 2026-03-28 18:09 | - | |
| ehr/ | 2026-03-28 18:10 | - | |
| ehthumbs.db/ | 2026-03-28 18:09 | - | |
| ehthumbs_vista.db/ | 2026-03-28 18:09 | - | |
| eid/ | 2026-03-28 18:09 | - | |
| eink/ | 2026-03-28 18:09 | - | |
| eizo/ | 2026-03-28 18:10 | - | |
| eks/ | 2026-03-28 18:09 | - | |
| elasticsearch/ | 2026-03-28 18:09 | - | |
| elatectwn/ | 2026-03-28 18:10 | - | |
| electron-app/ | 2026-03-28 18:09 | - | |
| electron-application/ | 2026-03-28 18:09 | - | |
| electron-forge/ | 2026-03-28 18:09 | - | |
| electron-mail/ | 2026-03-28 18:10 | - | |
| electron-plugins/ | 2026-03-28 18:09 | - | |
| electron-ssr/ | 2026-03-28 18:10 | - | |
| electron-vue/ | 2026-03-28 18:09 | - | |
| electron/ | 2026-03-28 18:09 | - | |
| electronic-arts/ | 2026-03-28 18:10 | - | |
| electronic-design-automation/ | 2026-03-28 18:09 | - | |
| electronic-invoices/ | 2026-03-28 18:10 | - | |
| electronic/ | 2026-03-28 18:09 | - | |
| electronics/ | 2026-03-28 18:09 | - | |
| electronics circuits/ | 2026-03-28 18:10 | - | |
| electronjs/ | 2026-03-28 18:09 | - | |
| element-ui/ | 2026-03-28 18:09 | - | |
| elevate/ | 2026-03-28 18:09 | - | |
| elevation/ | 2026-03-28 18:09 | - | |
| elf/ | 2026-03-28 18:09 | - | |
| elgato/ | 2026-03-28 18:09 | - | |
| elisp-emacs/ | 2026-03-28 18:09 | - | |
| elite-dangerous/ | 2026-03-28 18:09 | - | |
| elite/ | 2026-03-28 18:10 | - | |
| elixir/ | 2026-03-28 18:09 | - | |
| elixr/ | 2026-03-28 18:09 | - | |
| ellosoft/ | 2026-03-28 18:09 | - | |
| elm/ | 2026-03-28 18:09 | - | |
| elster authenticator/ | 2026-03-28 18:09 | - | |
| elvish/ | 2026-03-28 18:10 | - | |
| elyby/ | 2026-03-28 18:09 | - | |
| emacs/ | 2026-03-28 18:09 | - | |
| email-client/ | 2026-03-28 18:09 | - | |
| email-keys/ | 2026-03-28 18:10 | - | |
| email-template/ | 2026-03-28 18:10 | - | |
| email/ | 2026-03-28 18:09 | - | |
| emailing/ | 2026-03-28 18:10 | - | |
| embedded-database/ | 2026-03-28 18:09 | - | |
| embedded-linux/ | 2026-03-28 18:09 | - | |
| embedded/ | 2026-03-28 18:09 | - | |
| emby/ | 2026-03-28 18:09 | - | |
| emergencydownload.inf/ | 2026-03-28 18:10 | - | |
| emoji-picker/ | 2026-03-28 18:09 | - | |
| emoji/ | 2026-03-28 18:09 | - | |
| emojis/ | 2026-03-28 18:09 | - | |
| emoticon/ | 2026-03-28 18:09 | - | |
| emotion-capture/ | 2026-03-28 18:09 | - | |
| empires/ | 2026-03-28 18:09 | - | |
| emu/ | 2026-03-28 18:09 | - | |
| emui/ | 2026-03-28 18:09 | - | |
| emulate/ | 2026-03-28 18:10 | - | |
| emulating/ | 2026-03-28 18:09 | - | |
| emulation/ | 2026-03-28 18:09 | - | |
| emulator/ | 2026-03-28 18:09 | - | |
| emule/ | 2026-03-28 18:10 | - | |
| encapsulated-postscript/ | 2026-03-28 18:10 | - | |
| encfs/ | 2026-03-28 18:09 | - | |
| encode/ | 2026-03-28 18:09 | - | |
| encoder/ | 2026-03-28 18:09 | - | |
| encoding/ | 2026-03-28 18:09 | - | |
| encrypt-decrypt/ | 2026-03-28 18:09 | - | |
| encrypt-files/ | 2026-03-28 18:09 | - | |
| encrypt/ | 2026-03-28 18:09 | - | |
| encrypted-backups/ | 2026-03-28 18:09 | - | |
| encrypted/ | 2026-03-28 18:09 | - | |
| encrypter/ | 2026-03-28 18:10 | - | |
| encryption-algorithm/ | 2026-03-28 18:09 | - | |
| encryption-decryption/ | 2026-03-28 18:09 | - | |
| encryption-tools/ | 2026-03-28 18:10 | - | |
| encryption/ | 2026-03-28 18:09 | - | |
| encryptionkeys/ | 2026-03-28 18:10 | - | |
| encryptor-decryptor/ | 2026-03-28 18:10 | - | |
| encryptor/ | 2026-03-28 18:10 | - | |
| encryptor decryptor/ | 2026-03-28 18:10 | - | |
| encyclopedia/ | 2026-03-28 18:09 | - | |
| encylopaedia/ | 2026-03-28 18:09 | - | |
| encylopedia/ | 2026-03-28 18:09 | - | |
| end-to-end-encryption/ | 2026-03-28 18:09 | - | |
| end-to-end/ | 2026-03-28 18:09 | - | |
| endianconverting/ | 2026-03-28 18:09 | - | |
| endpoint-management/ | 2026-03-28 18:09 | - | |
| enforce-policies/ | 2026-03-28 18:09 | - | |
| engine/ | 2026-03-28 18:09 | - | |
| engineer/ | 2026-03-28 18:09 | - | |
| engineering/ | 2026-03-28 18:09 | - | |
| engine origin label (laser) printing/ | 2026-03-28 18:10 | - | |
| english-language/ | 2026-03-28 18:09 | - | |
| english/ | 2026-03-28 18:09 | - | |
| englishise/ | 2026-03-28 18:10 | - | |
| engrave/ | 2026-03-28 18:09 | - | |
| enhance/ | 2026-03-28 18:09 | - | |
| enhanced/ | 2026-03-28 18:10 | - | |
| enhancements/ | 2026-03-28 18:10 | - | |
| enigma-virtual-box-unpacker/ | 2026-03-28 18:09 | - | |
| enigmavirtualboxunpacker/ | 2026-03-28 18:09 | - | |
| enlarge/ | 2026-03-28 18:09 | - | |
| enterprise-architecture/ | 2026-03-28 18:09 | - | |
| enterprise-state-classify/ | 2026-03-28 18:09 | - | |
| enterprise-tools/ | 2026-03-28 18:09 | - | |
| enterprise/ | 2026-03-28 18:09 | - | |
| entertainment/ | 2026-03-28 18:09 | - | |
| entity-framework/ | 2026-03-28 18:09 | - | |
| entropiq/ | 2026-03-28 18:09 | - | |
| entropy/ | 2026-03-28 18:09 | - | |
| enumeration/ | 2026-03-28 18:09 | - | |
| env/ | 2026-03-28 18:09 | - | |
| environment-variable/ | 2026-03-28 18:09 | - | |
| environment-variables/ | 2026-03-28 18:09 | - | |
| environment/ | 2026-03-28 18:09 | - | |
| envoy/ | 2026-03-28 18:09 | - | |
| epa/ | 2026-03-28 18:09 | - | |
| epa_iputilau.inf/ | 2026-03-28 18:09 | - | |
| epa_iputilidddriver.inf/ | 2026-03-28 18:09 | - | |
| epa_iputilvhid.inf/ | 2026-03-28 18:09 | - | |
| epd/ | 2026-03-28 18:09 | - | |
| epg/ | 2026-03-28 18:09 | - | |
| epic-games-launcher/ | 2026-03-28 18:09 | - | |
| epic-games-store/ | 2026-03-28 18:09 | - | |
| epic-games/ | 2026-03-28 18:09 | - | |
| epic-online-services/ | 2026-03-28 18:09 | - | |
| epic/ | 2026-03-28 18:09 | - | |
| epicgames/ | 2026-03-28 18:09 | - | |
| epigramx-wiimote-hook/ | 2026-03-28 18:09 | - | |
| epigramxwiimotehook/ | 2026-03-28 18:09 | - | |
| episode/ | 2026-03-28 18:09 | - | |
| epmpub/ | 2026-03-28 18:09 | - | |
| eps/ | 2026-03-28 18:09 | - | |
| epson-devices/ | 2026-03-28 18:09 | - | |
| epson-photo-+/ | 2026-03-28 18:09 | - | |
| epson-photo-plus/ | 2026-03-28 18:09 | - | |
| epson-printer-connection-checker/ | 2026-03-28 18:09 | - | |
| epson-printers/ | 2026-03-28 18:09 | - | |
| epson-software-updater/ | 2026-03-28 18:09 | - | |
| epsonphoto+/ | 2026-03-28 18:09 | - | |
| epsonphotoplus/ | 2026-03-28 18:09 | - | |
| epsonprinterconnectionchecker/ | 2026-03-28 18:09 | - | |
| epsonprinters/ | 2026-03-28 18:09 | - | |
| epsonscanners/ | 2026-03-28 18:09 | - | |
| epsonsoftwareupdater/ | 2026-03-28 18:09 | - | |
| epub-files/ | 2026-03-28 18:09 | - | |
| epub-reader/ | 2026-03-28 18:10 | - | |
| epub/ | 2026-03-28 18:09 | - | |
| eq/ | 2026-03-28 18:10 | - | |
| equalizer/ | 2026-03-28 18:09 | - | |
| equation/ | 2026-03-28 18:09 | - | |
| equicord/ | 2026-03-28 18:09 | - | |
| er-diagram/ | 2026-03-28 18:09 | - | |
| erase-disk/ | 2026-03-28 18:09 | - | |
| erase/ | 2026-03-28 18:09 | - | |
| eratosthenes/ | 2026-03-28 18:10 | - | |
| erc20/ | 2026-03-28 18:09 | - | |
| ereader/ | 2026-03-28 18:09 | - | |
| erecovery/ | 2026-03-28 18:09 | - | |
| ergdata/ | 2026-03-28 18:09 | - | |
| ergo/ | 2026-03-28 18:09 | - | |
| ergofakt/ | 2026-03-28 18:09 | - | |
| ergonomics/ | 2026-03-28 18:09 | - | |
| ergosoft/ | 2026-03-28 18:09 | - | |
| erista/ | 2026-03-28 18:09 | - | |
| erlang/ | 2026-03-28 18:09 | - | |
| erp/ | 2026-03-28 18:09 | - | |
| error-explanation/ | 2026-03-28 18:10 | - | |
| error-lookup/ | 2026-03-28 18:09 | - | |
| error-messages/ | 2026-03-28 18:09 | - | |
| error/ | 2026-03-28 18:09 | - | |
| escape-from-tarkov/ | 2026-03-28 18:09 | - | |
| esd/ | 2026-03-28 18:10 | - | |
| eset/ | 2026-03-28 18:09 | - | |
| esnet/ | 2026-03-28 18:09 | - | |
| esoteric/ | 2026-03-28 18:09 | - | |
| esp/ | 2026-03-28 18:09 | - | |
| esp32/ | 2026-03-28 18:09 | - | |
| esp8266/ | 2026-03-28 18:09 | - | |
| españa/ | 2026-03-28 18:09 | - | |
| espeak-ng/ | 2026-03-28 18:09 | - | |
| espeak/ | 2026-03-28 18:09 | - | |
| esxi/ | 2026-03-28 18:10 | - | |
| eszemelyi/ | 2026-03-28 18:10 | - | |
| eszig/ | 2026-03-28 18:10 | - | |
| etcd/ | 2026-03-28 18:09 | - | |
| etcher-alternative/ | 2026-03-28 18:09 | - | |
| ethernet-ip/ | 2026-03-28 18:09 | - | |
| ethernet/ | 2026-03-28 18:09 | - | |
| etl-files/ | 2026-03-28 18:09 | - | |
| etl-framework/ | 2026-03-28 18:10 | - | |
| etl/ | 2026-03-28 18:09 | - | |
| etlfiles/ | 2026-03-28 18:09 | - | |
| etpserver/ | 2026-03-28 18:10 | - | |
| ets/ | 2026-03-28 18:09 | - | |
| ets100/ | 2026-03-28 18:09 | - | |
| ett/ | 2026-03-28 18:09 | - | |
| ettus/ | 2026-03-28 18:09 | - | |
| etw-events/ | 2026-03-28 18:09 | - | |
| etw/ | 2026-03-28 18:09 | - | |
| etwevents/ | 2026-03-28 18:09 | - | |
| eu4/ | 2026-03-28 18:09 | - | |
| euc-jp euc-kr/ | 2026-03-28 18:09 | - | |
| europa-universalis-4/ | 2026-03-28 18:09 | - | |
| europa-universalis-iv/ | 2026-03-28 18:09 | - | |
| eurorack/ | 2026-03-28 18:09 | - | |
| evb-unpack/ | 2026-03-28 18:09 | - | |
| evbd.inf/ | 2026-03-28 18:09 | - | |
| eve-online/ | 2026-03-28 18:09 | - | |
| event-log-expert/ | 2026-03-28 18:09 | - | |
| event-tracing/ | 2026-03-28 18:09 | - | |
| event/ | 2026-03-28 18:09 | - | |
| eventlog/ | 2026-03-28 18:09 | - | |
| events/ | 2026-03-28 18:09 | - | |
| evernote/ | 2026-03-28 18:09 | - | |
| everything-search/ | 2026-03-28 18:09 | - | |
| everything/ | 2026-03-28 18:09 | - | |
| evm/ | 2026-03-28 18:09 | - | |
| evo/ | 2026-03-28 18:09 | - | |
| evoluent/ | 2026-03-28 18:09 | - | |
| evtx-files/ | 2026-03-28 18:09 | - | |
| ewasm/ | 2026-03-28 18:10 | - | |
| ewriter/ | 2026-03-28 18:09 | - | |
| exFAT/ | 2026-03-28 18:10 | - | |
| exam-format/ | 2026-03-28 18:10 | - | |
| exam-timer/ | 2026-03-28 18:09 | - | |
| exam/ | 2026-03-28 18:09 | - | |
| example/ | 2026-03-28 18:10 | - | |
| examples/ | 2026-03-28 18:10 | - | |
| exams/ | 2026-03-28 18:10 | - | |
| excel-report/ | 2026-03-28 18:10 | - | |
| excel/ | 2026-03-28 18:09 | - | |
| excellon/ | 2026-03-28 18:09 | - | |
| exception-logs/ | 2026-03-28 18:09 | - | |
| exceptionlogs/ | 2026-03-28 18:09 | - | |
| exchange-rate/ | 2026-03-28 18:09 | - | |
| exchange/ | 2026-03-28 18:09 | - | |
| exe-64-bit-detector/ | 2026-03-28 18:10 | - | |
| exe-64bit-detector/ | 2026-03-28 18:10 | - | |
| exe-explorer/ | 2026-03-28 18:09 | - | |
| exe-extractor/ | 2026-03-28 18:09 | - | |
| exe-info-checker/ | 2026-03-28 18:09 | - | |
| exe-information-viewer/ | 2026-03-28 18:09 | - | |
| exe-to-msix/ | 2026-03-28 18:09 | - | |
| exe-wrapper/ | 2026-03-28 18:09 | - | |
| exe/ | 2026-03-28 18:09 | - | |
| execommands/ | 2026-03-28 18:09 | - | |
| executable-patcher/ | 2026-03-28 18:09 | - | |
| executables/ | 2026-03-28 18:09 | - | |
| execution-plan/ | 2026-03-28 18:10 | - | |
| execution/ | 2026-03-28 18:09 | - | |
| exeinfochecker/ | 2026-03-28 18:09 | - | |
| exeinformationviewer/ | 2026-03-28 18:09 | - | |
| exelearning/ | 2026-03-28 18:09 | - | |
| exercism/ | 2026-03-28 18:09 | - | |
| exif-data-extraction/ | 2026-03-28 18:10 | - | |
| exif-metadata/ | 2026-03-28 18:10 | - | |
| exif-reader/ | 2026-03-28 18:10 | - | |
| exif/ | 2026-03-28 18:09 | - | |
| exiftool/ | 2026-03-28 18:10 | - | |
| expand/ | 2026-03-28 18:09 | - | |
| expander/ | 2026-03-28 18:09 | - | |
| expansion/ | 2026-03-28 18:10 | - | |
| expense-tracker/ | 2026-03-28 18:10 | - | |
| expenses/ | 2026-03-28 18:10 | - | |
| exploitation/ | 2026-03-28 18:10 | - | |
| exploration/ | 2026-03-28 18:09 | - | |
| explorer-extension/ | 2026-03-28 18:09 | - | |
| explorer-shell-extension/ | 2026-03-28 18:09 | - | |
| explorer-thumbnails/ | 2026-03-28 18:09 | - | |
| explorer/ | 2026-03-28 18:09 | - | |
| explorertab/ | 2026-03-28 18:10 | - | |
| explosives/ | 2026-03-28 18:09 | - | |
| expltab/ | 2026-03-28 18:10 | - | |
| export-dicom/ | 2026-03-28 18:10 | - | |
| export/ | 2026-03-28 18:09 | - | |
| exporter/ | 2026-03-28 18:09 | - | |
| expressen/ | 2026-03-28 18:10 | - | |
| exr/ | 2026-03-28 18:09 | - | |
| ext2/ | 2026-03-28 18:09 | - | |
| ext2 ext3 ext4/ | 2026-03-28 18:09 | - | |
| ext3/ | 2026-03-28 18:09 | - | |
| ext4/ | 2026-03-28 18:09 | - | |
| extensible-markup-language/ | 2026-03-28 18:10 | - | |
| extension-manager/ | 2026-03-28 18:10 | - | |
| extension/ | 2026-03-28 18:09 | - | |
| extensions/ | 2026-03-28 18:09 | - | |
| externaldisplay/ | 2026-03-28 18:09 | - | |
| extra-arm/ | 2026-03-28 18:09 | - | |
| extract-faces/ | 2026-03-28 18:09 | - | |
| extract-files/ | 2026-03-28 18:09 | - | |
| extract-frames/ | 2026-03-28 18:10 | - | |
| extract-icons/ | 2026-03-28 18:09 | - | |
| extract-text/ | 2026-03-28 18:09 | - | |
| extract-video-frames/ | 2026-03-28 18:10 | - | |
| extract/ | 2026-03-28 18:09 | - | |
| extracting/ | 2026-03-28 18:09 | - | |
| extraction/ | 2026-03-28 18:09 | - | |
| extractor/ | 2026-03-28 18:09 | - | |
| eye-care/ | 2026-03-28 18:10 | - | |
| eye-health/ | 2026-03-28 18:09 | - | |
| eye-saver/ | 2026-03-28 18:10 | - | |
| eye/ | 2026-03-28 18:10 | - | |
| eye care/ | 2026-03-28 18:09 | - | |
| eyedropper/ | 2026-03-28 18:09 | - | |
| eye protection/ | 2026-03-28 18:09 | - | |
| eyes/ | 2026-03-28 18:09 | - | |
| eye sight/ | 2026-03-28 18:09 | - | |
| ez80/ | 2026-03-28 18:09 | - | |
| faas/ | 2026-03-28 18:09 | - | |
| fabric/ | 2026-03-28 18:09 | - | |
| fabricmc/ | 2026-03-28 18:09 | - | |
| face-detection/ | 2026-03-28 18:09 | - | |
| face-processing/ | 2026-03-28 18:09 | - | |
| face-recognition/ | 2026-03-28 18:09 | - | |
| facebook/ | 2026-03-28 18:09 | - | |
| facecam/ | 2026-03-28 18:09 | - | |
| faceit/ | 2026-03-28 18:09 | - | |
| facial-capture/ | 2026-03-28 18:09 | - | |
| facial-expression-capture/ | 2026-03-28 18:09 | - | |
| facial-motion-capture/ | 2026-03-28 18:09 | - | |
| facsimile/ | 2026-03-28 18:09 | - | |
| fafa runner/ | 2026-03-28 18:09 | - | |
| fafarunner/ | 2026-03-28 18:09 | - | |
| fair/ | 2026-03-28 18:09 | - | |
| fairplay/ | 2026-03-28 18:10 | - | |
| fake/ | 2026-03-28 18:10 | - | |
| fallout-4/ | 2026-03-28 18:10 | - | |
| fallout-76/ | 2026-03-28 18:10 | - | |
| fallout/ | 2026-03-28 18:09 | - | |
| fallout4/ | 2026-03-28 18:10 | - | |
| fallout76/ | 2026-03-28 18:10 | - | |
| famicom/ | 2026-03-28 18:09 | - | |
| famicomdisksystem/ | 2026-03-28 18:09 | - | |
| family-tree/ | 2026-03-28 18:09 | - | |
| family/ | 2026-03-28 18:09 | - | |
| familycomputer/ | 2026-03-28 18:09 | - | |
| familysearch/ | 2026-03-28 18:09 | - | |
| familytree/ | 2026-03-28 18:10 | - | |
| fan-control/ | 2026-03-28 18:09 | - | |
| fan-rpm/ | 2026-03-28 18:09 | - | |
| fan-speed-curves/ | 2026-03-28 18:09 | - | |
| fan-speed/ | 2026-03-28 18:09 | - | |
| fan/ | 2026-03-28 18:09 | - | |
| fancontrol/ | 2026-03-28 18:10 | - | |
| fancyzones/ | 2026-03-28 18:09 | - | |
| fandom/ | 2026-03-28 18:10 | - | |
| fanficfare/ | 2026-03-28 18:09 | - | |
| fanfiction/ | 2026-03-28 18:09 | - | |
| fanmonitor/ | 2026-03-28 18:09 | - | |
| fanrotations/ | 2026-03-28 18:09 | - | |
| fanspeedcurves/ | 2026-03-28 18:09 | - | |
| fanspeeds/ | 2026-03-28 18:09 | - | |
| fantasy/ | 2026-03-28 18:09 | - | |
| faq/ | 2026-03-28 18:10 | - | |
| farcry/ | 2026-03-28 18:09 | - | |
| farmer/ | 2026-03-28 18:09 | - | |
| farming-vehicle-control/ | 2026-03-28 18:09 | - | |
| farmingvehiclecontrol/ | 2026-03-28 18:09 | - | |
| fasd/ | 2026-03-28 18:10 | - | |
| fasm/ | 2026-03-28 18:10 | - | |
| fast-search/ | 2026-03-28 18:09 | - | |
| fast/ | 2026-03-28 18:09 | - | |
| fastboot/ | 2026-03-28 18:09 | - | |
| fastbootd/ | 2026-03-28 18:09 | - | |
| fastershutdowns/ | 2026-03-28 18:09 | - | |
| fastfetch/ | 2026-03-28 18:09 | - | |
| fasthttp/ | 2026-03-28 18:10 | - | |
| fastmeeting/ | 2026-03-28 18:09 | - | |
| fat/ | 2026-03-28 18:09 | - | |
| fat32 exfat/ | 2026-03-28 18:09 | - | |
| fault-injection/ | 2026-03-28 18:09 | - | |
| favorite-files/ | 2026-03-28 18:09 | - | |
| favorite/ | 2026-03-28 18:09 | - | |
| fb2/ | 2026-03-28 18:09 | - | |
| fbbport/ | 2026-03-28 18:09 | - | |
| fbx/ | 2026-03-28 18:09 | - | |
| fdroid/ | 2026-03-28 18:09 | - | |
| fds/ | 2026-03-28 18:09 | - | |
| feature-detection/ | 2026-03-28 18:09 | - | |
| features/ | 2026-03-28 18:10 | - | |
| federal/ | 2026-03-28 18:09 | - | |
| federated/ | 2026-03-28 18:10 | - | |
| fediverse/ | 2026-03-28 18:09 | - | |
| fedora-media-writer/ | 2026-03-28 18:10 | - | |
| fedora/ | 2026-03-28 18:09 | - | |
| feed-reader/ | 2026-03-28 18:09 | - | |
| feed/ | 2026-03-28 18:09 | - | |
| feedly/ | 2026-03-28 18:09 | - | |
| female/ | 2026-03-28 18:09 | - | |
| fen/ | 2026-03-28 18:09 | - | |
| festival/ | 2026-03-28 18:09 | - | |
| fetch/ | 2026-03-28 18:09 | - | |
| ff7/ | 2026-03-28 18:09 | - | |
| ff14/ | 2026-03-28 18:09 | - | |
| ffi/ | 2026-03-28 18:09 | - | |
| ffmpeg-builds/ | 2026-03-28 18:10 | - | |
| ffmpeg-gui/ | 2026-03-28 18:09 | - | |
| ffmpeg-wrapper/ | 2026-03-28 18:09 | - | |
| ffmpeg/ | 2026-03-28 18:09 | - | |
| ffprobe/ | 2026-03-28 18:09 | - | |
| fft/ | 2026-03-28 18:09 | - | |
| ffuloaderdriver/ | 2026-03-28 18:10 | - | |
| ffxiv-act/ | 2026-03-28 18:09 | - | |
| ffxiv/ | 2026-03-28 18:09 | - | |
| ffxivlauncher/ | 2026-03-28 18:09 | - | |
| fics/ | 2026-03-28 18:09 | - | |
| fiction/ | 2026-03-28 18:09 | - | |
| fiddle/ | 2026-03-28 18:09 | - | |
| fiddler/ | 2026-03-28 18:10 | - | |
| fido2/ | 2026-03-28 18:10 | - | |
| fighting-commander-octa/ | 2026-03-28 18:09 | - | |
| fighting-game/ | 2026-03-28 18:09 | - | |
| fighting-stick-alpha/ | 2026-03-28 18:09 | - | |
| fightingcommanderocta/ | 2026-03-28 18:09 | - | |
| fightingstickalpha/ | 2026-03-28 18:09 | - | |
| figma/ | 2026-03-28 18:09 | - | |
| figure/ | 2026-03-28 18:09 | - | |
| figures/ | 2026-03-28 18:09 | - | |
| filament/ | 2026-03-28 18:10 | - | |
| file-analysis/ | 2026-03-28 18:09 | - | |
| file-attributes/ | 2026-03-28 18:09 | - | |
| file-browser/ | 2026-03-28 18:09 | - | |
| file-compare/ | 2026-03-28 18:10 | - | |
| file-compressing/ | 2026-03-28 18:10 | - | |
| file-compression/ | 2026-03-28 18:09 | - | |
| file-conversion/ | 2026-03-28 18:09 | - | |
| file-converter/ | 2026-03-28 18:09 | - | |
| file-date/ | 2026-03-28 18:09 | - | |
| file-downlaoder/ | 2026-03-28 18:09 | - | |
| file-encryption/ | 2026-03-28 18:09 | - | |
| file-explorer/ | 2026-03-28 18:09 | - | |
| file-extensions/ | 2026-03-28 18:09 | - | |
| file-hash/ | 2026-03-28 18:09 | - | |
| file-identifier/ | 2026-03-28 18:09 | - | |
| file-indexing/ | 2026-03-28 18:09 | - | |
| file-info-checker/ | 2026-03-28 18:09 | - | |
| file-information-viewer/ | 2026-03-28 18:09 | - | |
| file-information/ | 2026-03-28 18:09 | - | |
| file-inspection/ | 2026-03-28 18:09 | - | |
| file-listing/ | 2026-03-28 18:09 | - | |
| file-lock/ | 2026-03-28 18:10 | - | |
| file-manager/ | 2026-03-28 18:09 | - | |
| file-manger/ | 2026-03-28 18:09 | - | |
| file-mask/ | 2026-03-28 18:09 | - | |
| file-metadata-tagging/ | 2026-03-28 18:09 | - | |
| file-monitoring/ | 2026-03-28 18:10 | - | |
| file-name/ | 2026-03-28 18:09 | - | |
| file-properties/ | 2026-03-28 18:09 | - | |
| file-recovery/ | 2026-03-28 18:09 | - | |
| file-replication-service/ | 2026-03-28 18:09 | - | |
| file-scanner/ | 2026-03-28 18:09 | - | |
| file-search/ | 2026-03-28 18:09 | - | |
| file-server/ | 2026-03-28 18:09 | - | |
| file-sharing/ | 2026-03-28 18:09 | - | |
| file-size/ | 2026-03-28 18:09 | - | |
| file-sorting/ | 2026-03-28 18:09 | - | |
| file-storage/ | 2026-03-28 18:09 | - | |
| file-sync/ | 2026-03-28 18:09 | - | |
| file-synchronisation/ | 2026-03-28 18:09 | - | |
| file-synchronization/ | 2026-03-28 18:09 | - | |
| file-syncing/ | 2026-03-28 18:09 | - | |
| file-system/ | 2026-03-28 18:09 | - | |
| file-tagger/ | 2026-03-28 18:09 | - | |
| file-timestamps/ | 2026-03-28 18:09 | - | |
| file-transfer/ | 2026-03-28 18:09 | - | |
| file-type/ | 2026-03-28 18:09 | - | |
| file-unlock/ | 2026-03-28 18:10 | - | |
| file-upload-server/ | 2026-03-28 18:09 | - | |
| file-upload/ | 2026-03-28 18:10 | - | |
| file-uploading/ | 2026-03-28 18:10 | - | |
| file-uploads/ | 2026-03-28 18:09 | - | |
| file-viewer/ | 2026-03-28 18:09 | - | |
| file-xplorer/ | 2026-03-28 18:09 | - | |
| file/ | 2026-03-28 18:09 | - | |
| filearchives/ | 2026-03-28 18:10 | - | |
| filecleaning/ | 2026-03-28 18:09 | - | |
| filedialog/ | 2026-03-28 18:09 | - | |
| filedialogs/ | 2026-03-28 18:09 | - | |
| fileencodingchecker/ | 2026-03-28 18:09 | - | |
| fileexplorer/ | 2026-03-28 18:09 | - | |
| fileextensions/ | 2026-03-28 18:09 | - | |
| fileidentifier/ | 2026-03-28 18:09 | - | |
| fileinfochecker/ | 2026-03-28 18:09 | - | |
| fileinformation/ | 2026-03-28 18:09 | - | |
| fileinformationviewer/ | 2026-03-28 18:09 | - | |
| filemanager/ | 2026-03-28 18:09 | - | |
| filemetadatatagging/ | 2026-03-28 18:09 | - | |
| filen-cloud/ | 2026-03-28 18:09 | - | |
| filen-desktop/ | 2026-03-28 18:09 | - | |
| filen/ | 2026-03-28 18:09 | - | |
| fileopenencryptedsoftwares/ | 2026-03-28 18:09 | - | |
| filepreviews/ | 2026-03-28 18:09 | - | |
| filereader/ | 2026-03-28 18:09 | - | |
| filerecovery/ | 2026-03-28 18:09 | - | |
| filereplicationservice/ | 2026-03-28 18:09 | - | |
| files-editor/ | 2026-03-28 18:09 | - | |
| files/ | 2026-03-28 18:09 | - | |
| filesearch/ | 2026-03-28 18:10 | - | |
| fileserver/ | 2026-03-28 18:10 | - | |
| fileshare/ | 2026-03-28 18:09 | - | |
| filesharing/ | 2026-03-28 18:09 | - | |
| filesize/ | 2026-03-28 18:09 | - | |
| filesums/ | 2026-03-28 18:09 | - | |
| file synchronization/ | 2026-03-28 18:10 | - | |
| filesystem/ | 2026-03-28 18:09 | - | |
| filesystems/ | 2026-03-28 18:09 | - | |
| filetagger/ | 2026-03-28 18:09 | - | |
| film/ | 2026-03-28 18:09 | - | |
| filmii/ | 2026-03-28 18:09 | - | |
| filmora/ | 2026-03-28 18:09 | - | |
| filmorago/ | 2026-03-28 18:09 | - | |
| filter/ | 2026-03-28 18:09 | - | |
| filtering/ | 2026-03-28 18:09 | - | |
| filters/ | 2026-03-28 18:09 | - | |
| final-fantasy-vii/ | 2026-03-28 18:09 | - | |
| final-fantasy-xiv/ | 2026-03-28 18:09 | - | |
| finance/ | 2026-03-28 18:09 | - | |
| financiën/ | 2026-03-28 18:09 | - | |
| financial-markets/ | 2026-03-28 18:09 | - | |
| financial-planning/ | 2026-03-28 18:10 | - | |
| financial/ | 2026-03-28 18:09 | - | |
| financieel/ | 2026-03-28 18:09 | - | |
| finanz/ | 2026-03-28 18:09 | - | |
| find-and-replace/ | 2026-03-28 18:09 | - | |
| find-bytes/ | 2026-03-28 18:09 | - | |
| find-file-lock/ | 2026-03-28 18:10 | - | |
| find-files/ | 2026-03-28 18:09 | - | |
| find-in-files/ | 2026-03-28 18:09 | - | |
| find-regex/ | 2026-03-28 18:09 | - | |
| find-replace/ | 2026-03-28 18:09 | - | |
| find-text/ | 2026-03-28 18:09 | - | |
| find/ | 2026-03-28 18:09 | - | |
| finder/ | 2026-03-28 18:09 | - | |
| findfolders/ | 2026-03-28 18:09 | - | |
| finding/ | 2026-03-28 18:09 | - | |
| findstr/ | 2026-03-28 18:09 | - | |
| finetuning-llms/ | 2026-03-28 18:09 | - | |
| finite-element-analysis/ | 2026-03-28 18:09 | - | |
| finite-element-methods/ | 2026-03-28 18:09 | - | |
| finite-elements/ | 2026-03-28 18:09 | - | |
| finops/ | 2026-03-28 18:09 | - | |
| fints/ | 2026-03-28 18:09 | - | |
| fips/ | 2026-03-28 18:09 | - | |
| firebase-cli/ | 2026-03-28 18:09 | - | |
| firebase-tools/ | 2026-03-28 18:09 | - | |
| firebase/ | 2026-03-28 18:09 | - | |
| firebird/ | 2026-03-28 18:09 | - | |
| fireeye-labs-obfuscated-string-solver/ | 2026-03-28 18:09 | - | |
| fireeyelabsobfuscatedstringsolver/ | 2026-03-28 18:09 | - | |
| firefish/ | 2026-03-28 18:09 | - | |
| firefox-based/ | 2026-03-28 18:09 | - | |
| firefox-browser/ | 2026-03-28 18:09 | - | |
| firefox-fork/ | 2026-03-28 18:09 | - | |
| firefox-forking/ | 2026-03-28 18:09 | - | |
| firefox-send-client/ | 2026-03-28 18:10 | - | |
| firefox-send/ | 2026-03-28 18:10 | - | |
| firefox/ | 2026-03-28 18:09 | - | |
| firefoxfork/ | 2026-03-28 18:09 | - | |
| firestore/ | 2026-03-28 18:10 | - | |
| firewall-configuration/ | 2026-03-28 18:09 | - | |
| firewall-rules/ | 2026-03-28 18:09 | - | |
| firewall/ | 2026-03-28 18:09 | - | |
| firewire-400/ | 2026-03-28 18:09 | - | |
| firewire-800/ | 2026-03-28 18:09 | - | |
| firewire-digital-video/ | 2026-03-28 18:10 | - | |
| firewire-driver/ | 2026-03-28 18:09 | - | |
| firewire400/ | 2026-03-28 18:09 | - | |
| firewire800/ | 2026-03-28 18:09 | - | |
| firewiredigitalvideo/ | 2026-03-28 18:10 | - | |
| firewiredriver/ | 2026-03-28 18:09 | - | |
| firma/ | 2026-03-28 18:09 | - | |
| firma electrónica/ | 2026-03-28 18:09 | - | |
| firmware-updates/ | 2026-03-28 18:09 | - | |
| firmware/ | 2026-03-28 18:09 | - | |
| firmwareupdates/ | 2026-03-28 18:09 | - | |
| first-person-shooter/ | 2026-03-28 18:09 | - | |
| first-person/ | 2026-03-28 18:09 | - | |
| firstpersonshooter/ | 2026-03-28 18:09 | - | |
| fish-prompt/ | 2026-03-28 18:09 | - | |
| fish-theme/ | 2026-03-28 18:09 | - | |
| fish/ | 2026-03-28 18:09 | - | |
| fission/ | 2026-03-28 18:09 | - | |
| fissure-rewards/ | 2026-03-28 18:10 | - | |
| fitness/ | 2026-03-28 18:10 | - | |
| fitting/ | 2026-03-28 18:10 | - | |
| fix/ | 2026-03-28 18:09 | - | |
| fixed/ | 2026-03-28 18:09 | - | |
| flac/ | 2026-03-28 18:09 | - | |
| flaky-tests/ | 2026-03-28 18:10 | - | |
| flame/ | 2026-03-28 18:09 | - | |
| flamegraph-charts/ | 2026-03-28 18:10 | - | |
| flare-obfuscated-string-solver/ | 2026-03-28 18:09 | - | |
| flare/ | 2026-03-28 18:09 | - | |
| flareobfuscatedstringsolver/ | 2026-03-28 18:09 | - | |
| flash-card/ | 2026-03-28 18:10 | - | |
| flash/ | 2026-03-28 18:09 | - | |
| flashcard/ | 2026-03-28 18:09 | - | |
| flashing/ | 2026-03-28 18:09 | - | |
| flatbuffers/ | 2026-03-28 18:09 | - | |
| flathub/ | 2026-03-28 18:10 | - | |
| flatpak/ | 2026-03-28 18:09 | - | |
| flatten/ | 2026-03-28 18:09 | - | |
| fleet/ | 2026-03-28 18:09 | - | |
| flex/ | 2026-03-28 18:09 | - | |
| flight-controller/ | 2026-03-28 18:10 | - | |
| flight-simulator/ | 2026-03-28 18:09 | - | |
| flightradar/ | 2026-03-28 18:09 | - | |
| flightsim/ | 2026-03-28 18:09 | - | |
| flightsimulator/ | 2026-03-28 18:09 | - | |
| flightsimulator2020/ | 2026-03-28 18:09 | - | |
| flipbook/ | 2026-03-28 18:09 | - | |
| flipper-zero/ | 2026-03-28 18:09 | - | |
| flipperzero/ | 2026-03-28 18:09 | - | |
| float/ | 2026-03-28 18:09 | - | |
| float64/ | 2026-03-28 18:10 | - | |
| floating-point/ | 2026-03-28 18:09 | - | |
| floor-plans/ | 2026-03-28 18:09 | - | |
| floss/ | 2026-03-28 18:09 | - | |
| flourishing/ | 2026-03-28 18:09 | - | |
| flow-cytometry/ | 2026-03-28 18:09 | - | |
| flow/ | 2026-03-28 18:09 | - | |
| flowchart/ | 2026-03-28 18:09 | - | |
| floyd-steinberg/ | 2026-03-28 18:09 | - | |
| fluent-design/ | 2026-03-28 18:09 | - | |
| fluent-ui/ | 2026-03-28 18:10 | - | |
| fluentd/ | 2026-03-28 18:10 | - | |
| fluid-simulation/ | 2026-03-28 18:09 | - | |
| flutter-app/ | 2026-03-28 18:09 | - | |
| flutter-apps/ | 2026-03-28 18:09 | - | |
| flutter-examples/ | 2026-03-28 18:09 | - | |
| flutter-ui/ | 2026-03-28 18:09 | - | |
| flutter/ | 2026-03-28 18:09 | - | |
| fluxer/ | 2026-03-28 18:09 | - | |
| fluxerapp/ | 2026-03-28 18:09 | - | |
| flv-downloader/ | 2026-03-28 18:09 | - | |
| flv/ | 2026-03-28 18:09 | - | |
| fly/ | 2026-03-28 18:09 | - | |
| flying/ | 2026-03-28 18:10 | - | |
| flyouts/ | 2026-03-28 18:09 | - | |
| flywheel/ | 2026-03-28 18:10 | - | |
| flzma2/ | 2026-03-28 18:09 | - | |
| fm/ | 2026-03-28 18:09 | - | |
| fmcomms/ | 2026-03-28 18:09 | - | |
| fmradio/ | 2026-03-28 18:09 | - | |
| fmw/ | 2026-03-28 18:10 | - | |
| fn/ | 2026-03-28 18:10 | - | |
| fnmt/ | 2026-03-28 18:09 | - | |
| focus/ | 2026-03-28 18:09 | - | |
| folder-compare/ | 2026-03-28 18:10 | - | |
| folder-comparison/ | 2026-03-28 18:10 | - | |
| folder-lock/ | 2026-03-28 18:10 | - | |
| folder-merge/ | 2026-03-28 18:10 | - | |
| folder/ | 2026-03-28 18:09 | - | |
| folder comparison/ | 2026-03-28 18:10 | - | |
| folders/ | 2026-03-28 18:09 | - | |
| folder synchronization/ | 2026-03-28 18:10 | - | |
| folding/ | 2026-03-28 18:10 | - | |
| font-install/ | 2026-03-28 18:09 | - | |
| font-installation/ | 2026-03-28 18:09 | - | |
| font-installer/ | 2026-03-28 18:09 | - | |
| font-management/ | 2026-03-28 18:09 | - | |
| font-manager/ | 2026-03-28 18:09 | - | |
| font-previewing/ | 2026-03-28 18:10 | - | |
| font-tests/ | 2026-03-28 18:10 | - | |
| font-validation/ | 2026-03-28 18:09 | - | |
| font-view-ok/ | 2026-03-28 18:10 | - | |
| font/ | 2026-03-28 18:09 | - | |
| fontcomparison/ | 2026-03-28 18:10 | - | |
| fontoverview/ | 2026-03-28 18:10 | - | |
| fontpreviews/ | 2026-03-28 18:10 | - | |
| fonts-comparing/ | 2026-03-28 18:10 | - | |
| fonts/ | 2026-03-28 18:09 | - | |
| fonttesting/ | 2026-03-28 18:10 | - | |
| fontvalidation/ | 2026-03-28 18:09 | - | |
| fontvalidator/ | 2026-03-28 18:09 | - | |
| foobar2000/ | 2026-03-28 18:09 | - | |
| food/ | 2026-03-28 18:10 | - | |
| force-delete/ | 2026-03-28 18:09 | - | |
| forced-removal/ | 2026-03-28 18:09 | - | |
| forcedelete/ | 2026-03-28 18:09 | - | |
| forcedremoval/ | 2026-03-28 18:09 | - | |
| forecastchannel/ | 2026-03-28 18:10 | - | |
| forensic/ | 2026-03-28 18:09 | - | |
| forensics/ | 2026-03-28 18:09 | - | |
| forex/ | 2026-03-28 18:09 | - | |
| forge/ | 2026-03-28 18:09 | - | |
| fork/ | 2026-03-28 18:09 | - | |
| forkgram/ | 2026-03-28 18:09 | - | |
| form-685/ | 2026-03-28 18:10 | - | |
| form/ | 2026-03-28 18:09 | - | |
| format-text/ | 2026-03-28 18:09 | - | |
| format/ | 2026-03-28 18:09 | - | |
| formatter/ | 2026-03-28 18:09 | - | |
| formatters/ | 2026-03-28 18:09 | - | |
| formatting/ | 2026-03-28 18:09 | - | |
| formula/ | 2026-03-28 18:09 | - | |
| formula1/ | 2026-03-28 18:09 | - | |
| formulaone/ | 2026-03-28 18:09 | - | |
| forth/ | 2026-03-28 18:09 | - | |
| fortnite-launcher/ | 2026-03-28 18:09 | - | |
| fortnite/ | 2026-03-28 18:09 | - | |
| fortran/ | 2026-03-28 18:09 | - | |
| fortune/ | 2026-03-28 18:09 | - | |
| fortuneteller/ | 2026-03-28 18:09 | - | |
| forwarding/ | 2026-03-28 18:10 | - | |
| foss/ | 2026-03-28 18:09 | - | |
| fp12_x64_driver.inf/ | 2026-03-28 18:09 | - | |
| fpga/ | 2026-03-28 18:09 | - | |
| fps-overlay/ | 2026-03-28 18:10 | - | |
| fps/ | 2026-03-28 18:09 | - | |
| fpscounter/ | 2026-03-28 18:09 | - | |
| fpv-racing/ | 2026-03-28 18:10 | - | |
| fpv/ | 2026-03-28 18:09 | - | |
| fractals/ | 2026-03-28 18:09 | - | |
| fraction/ | 2026-03-28 18:09 | - | |
| fragmentation/ | 2026-03-28 18:09 | - | |
| fragmentednetworkpackets/ | 2026-03-28 18:09 | - | |
| frame-rate-monitor/ | 2026-03-28 18:09 | - | |
| frame/ | 2026-03-28 18:09 | - | |
| framegrabber/ | 2026-03-28 18:10 | - | |
| framerate-displaying/ | 2026-03-28 18:09 | - | |
| framerate-fixer/ | 2026-03-28 18:09 | - | |
| framerate/ | 2026-03-28 18:10 | - | |
| frameratecounter/ | 2026-03-28 18:09 | - | |
| framerates/ | 2026-03-28 18:09 | - | |
| frameserver/ | 2026-03-28 18:09 | - | |
| frametime/ | 2026-03-28 18:09 | - | |
| framework/ | 2026-03-28 18:09 | - | |
| free-and-open-source/ | 2026-03-28 18:10 | - | |
| free-coupons/ | 2026-03-28 18:09 | - | |
| free-to-play/ | 2026-03-28 18:09 | - | |
| free-version/ | 2026-03-28 18:10 | - | |
| free-virtual-keyboard/ | 2026-03-28 18:09 | - | |
| free-windows-registry-repair/ | 2026-03-28 18:10 | - | |
| free/ | 2026-03-28 18:09 | - | |
| freebsd/ | 2026-03-28 18:09 | - | |
| freebuds/ | 2026-03-28 18:10 | - | |
| freecodecamp/ | 2026-03-28 18:09 | - | |
| freefem-sources/ | 2026-03-28 18:09 | - | |
| freefem/ | 2026-03-28 18:09 | - | |
| freelancer/ | 2026-03-28 18:09 | - | |
| freeleech/ | 2026-03-28 18:09 | - | |
| freenode/ | 2026-03-28 18:10 | - | |
| freeorion/ | 2026-03-28 18:09 | - | |
| freetoair/ | 2026-03-28 18:10 | - | |
| freetube/ | 2026-03-28 18:10 | - | |
| freeviewing/ | 2026-03-28 18:09 | - | |
| freeware/ | 2026-03-28 18:09 | - | |
| freewindowsregistryrepair/ | 2026-03-28 18:10 | - | |
| french/ | 2026-03-28 18:09 | - | |
| freshrss/ | 2026-03-28 18:09 | - | |
| friendica/ | 2026-03-28 18:09 | - | |
| friends/ | 2026-03-28 18:09 | - | |
| front-end/ | 2026-03-28 18:09 | - | |
| frontend/ | 2026-03-28 18:09 | - | |
| frontier-api/ | 2026-03-28 18:09 | - | |
| frontier/ | 2026-03-28 18:10 | - | |
| frp-desktop/ | 2026-03-28 18:09 | - | |
| frp-linux/ | 2026-03-28 18:09 | - | |
| frp-macos/ | 2026-03-28 18:09 | - | |
| frp-window/ | 2026-03-28 18:09 | - | |
| frp/ | 2026-03-28 18:09 | - | |
| frpc/ | 2026-03-28 18:09 | - | |
| fs/ | 2026-03-28 18:09 | - | |
| fslogix/ | 2026-03-28 18:09 | - | |
| fsr/ | 2026-03-28 18:09 | - | |
| ftb/ | 2026-03-28 18:09 | - | |
| ftdi/ | 2026-03-28 18:10 | - | |
| ftp-client/ | 2026-03-28 18:09 | - | |
| ftp-server/ | 2026-03-28 18:09 | - | |
| ftp/ | 2026-03-28 18:09 | - | |
| ftps/ | 2026-03-28 18:09 | - | |
| ftpserver/ | 2026-03-28 18:10 | - | |
| fuel windshield label printing module/ | 2026-03-28 18:10 | - | |
| full-node/ | 2026-03-28 18:09 | - | |
| fullcontextmenus/ | 2026-03-28 18:09 | - | |
| fullfetch/ | 2026-03-28 18:09 | - | |
| fullscreen/ | 2026-03-28 18:09 | - | |
| func-e/ | 2026-03-28 18:10 | - | |
| functional-language/ | 2026-03-28 18:09 | - | |
| functional-programming/ | 2026-03-28 18:09 | - | |
| functional/ | 2026-03-28 18:09 | - | |
| functions-as-a-service/ | 2026-03-28 18:09 | - | |
| functions/ | 2026-03-28 18:09 | - | |
| funcube-dongle/ | 2026-03-28 18:09 | - | |
| funcubedongle/ | 2026-03-28 18:09 | - | |
| fund/ | 2026-03-28 18:09 | - | |
| funguloids/ | 2026-03-28 18:09 | - | |
| furcadia/ | 2026-03-28 18:09 | - | |
| fuse-filesystem/ | 2026-03-28 18:09 | - | |
| fuse/ | 2026-03-28 18:09 | - | |
| fusion/ | 2026-03-28 18:09 | - | |
| fusionlog/ | 2026-03-28 18:09 | - | |
| futurerestore-gui/ | 2026-03-28 18:09 | - | |
| futurerestore/ | 2026-03-28 18:09 | - | |
| fuzzer/ | 2026-03-28 18:09 | - | |
| fuzzy-matching/ | 2026-03-28 18:09 | - | |
| fuzzy-search/ | 2026-03-28 18:09 | - | |
| fuzzy/ | 2026-03-28 18:09 | - | |
| fuzzy comparison/ | 2026-03-28 18:09 | - | |
| fw-1.05-reva1/ | 2026-03-28 18:09 | - | |
| fwcfg.inf/ | 2026-03-28 18:09 | - | |
| fwupdmgr/ | 2026-03-28 18:09 | - | |
| fwupdtool/ | 2026-03-28 18:09 | - | |
| fyne/ | 2026-03-28 18:09 | - | |
| fzf/ | 2026-03-28 18:09 | - | |
| g-assist/ | 2026-03-28 18:09 | - | |
| g-code/ | 2026-03-28 18:09 | - | |
| g-suite/ | 2026-03-28 18:09 | - | |
| g-vim/ | 2026-03-28 18:09 | - | |
| g8bpq/ | 2026-03-28 18:09 | - | |
| g14/ | 2026-03-28 18:09 | - | |
| gacha/ | 2026-03-28 18:09 | - | |
| gadget/ | 2026-03-28 18:09 | - | |
| gain/ | 2026-03-28 18:09 | - | |
| galaxy/ | 2026-03-28 18:09 | - | |
| gallery/ | 2026-03-28 18:09 | - | |
| gam/ | 2026-03-28 18:09 | - | |
| gama/ | 2026-03-28 18:09 | - | |
| game-client/ | 2026-03-28 18:09 | - | |
| game-controller/ | 2026-03-28 18:10 | - | |
| game-controllers/ | 2026-03-28 18:09 | - | |
| game-development/ | 2026-03-28 18:09 | - | |
| game-engine/ | 2026-03-28 18:09 | - | |
| game-launcher/ | 2026-03-28 18:09 | - | |
| game-library/ | 2026-03-28 18:09 | - | |
| game-maker-studio-2/ | 2026-03-28 18:09 | - | |
| game-maker-studio/ | 2026-03-28 18:09 | - | |
| game-maker/ | 2026-03-28 18:09 | - | |
| game-management/ | 2026-03-28 18:10 | - | |
| game-manager/ | 2026-03-28 18:09 | - | |
| game-modding/ | 2026-03-28 18:09 | - | |
| game-mods/ | 2026-03-28 18:10 | - | |
| game-overlay/ | 2026-03-28 18:09 | - | |
| game-servers/ | 2026-03-28 18:10 | - | |
| game-state-integration/ | 2026-03-28 18:09 | - | |
| game-store/ | 2026-03-28 18:09 | - | |
| game-streaming/ | 2026-03-28 18:09 | - | |
| game/ | 2026-03-28 18:09 | - | |
| gameboy-color/ | 2026-03-28 18:09 | - | |
| gameboy/ | 2026-03-28 18:09 | - | |
| gameboyadvance/ | 2026-03-28 18:09 | - | |
| gameboycolor/ | 2026-03-28 18:09 | - | |
| gameboyplayer/ | 2026-03-28 18:10 | - | |
| gamecaptureneo/ | 2026-03-28 18:09 | - | |
| gamecontrollers/ | 2026-03-28 18:09 | - | |
| gamecube/ | 2026-03-28 18:09 | - | |
| gamedev-library/ | 2026-03-28 18:10 | - | |
| gamedev/ | 2026-03-28 18:09 | - | |
| gamedevelopment/ | 2026-03-28 18:09 | - | |
| gameengine/ | 2026-03-28 18:09 | - | |
| gamegear/ | 2026-03-28 18:09 | - | |
| gamehacking/ | 2026-03-28 18:10 | - | |
| gamelauncher/ | 2026-03-28 18:09 | - | |
| gamemaker/ | 2026-03-28 18:09 | - | |
| gamemaker8/ | 2026-03-28 18:09 | - | |
| gamemod/ | 2026-03-28 18:09 | - | |
| gamemodding/ | 2026-03-28 18:09 | - | |
| gamepad-api/ | 2026-03-28 18:09 | - | |
| gamepad/ | 2026-03-28 18:09 | - | |
| gameplayer/ | 2026-03-28 18:09 | - | |
| games-launcher/ | 2026-03-28 18:09 | - | |
| games-store/ | 2026-03-28 18:09 | - | |
| games-stream/ | 2026-03-28 18:09 | - | |
| games/ | 2026-03-28 18:09 | - | |
| game server, amp/ | 2026-03-28 18:10 | - | |
| gameserver/ | 2026-03-28 18:10 | - | |
| gameservers/ | 2026-03-28 18:10 | - | |
| gamesir/ | 2026-03-28 18:09 | - | |
| gamestore/ | 2026-03-28 18:09 | - | |
| gamestream/ | 2026-03-28 18:09 | - | |
| gamesystemmyvision/ | 2026-03-28 18:09 | - | |
| gaming-performance/ | 2026-03-28 18:09 | - | |
| gaming/ | 2026-03-28 18:09 | - | |
| gaming remote/ | 2026-03-28 18:09 | - | |
| gamma-adjustment/ | 2026-03-28 18:10 | - | |
| gamma/ | 2026-03-28 18:09 | - | |
| gantt/ | 2026-03-28 18:09 | - | |
| gaotie/ | 2026-03-28 18:09 | - | |
| gardener/ | 2026-03-28 18:09 | - | |
| garmin-connect/ | 2026-03-28 18:09 | - | |
| garmin-express/ | 2026-03-28 18:09 | - | |
| garmin/ | 2026-03-28 18:09 | - | |
| garnet/ | 2026-03-28 18:10 | - | |
| gas/ | 2026-03-28 18:10 | - | |
| gateway/ | 2026-03-28 18:09 | - | |
| gatoclient/ | 2026-03-28 18:09 | - | |
| gauge/ | 2026-03-28 18:09 | - | |
| gba/ | 2026-03-28 18:09 | - | |
| gbc/ | 2026-03-28 18:09 | - | |
| gbdt/ | 2026-03-28 18:09 | - | |
| gbrt/ | 2026-03-28 18:09 | - | |
| gbt/ | 2026-03-28 18:09 | - | |
| gcal/ | 2026-03-28 18:09 | - | |
| gcc-avr/ | 2026-03-28 18:10 | - | |
| gcc/ | 2026-03-28 18:09 | - | |
| gcloud-cli/ | 2026-03-28 18:09 | - | |
| gcloud/ | 2026-03-28 18:09 | - | |
| gcloudcli/ | 2026-03-28 18:09 | - | |
| gcloudsdk/ | 2026-03-28 18:09 | - | |
| gcn/ | 2026-03-28 18:09 | - | |
| gcode/ | 2026-03-28 18:09 | - | |
| gcontacts/ | 2026-03-28 18:09 | - | |
| gcov/ | 2026-03-28 18:09 | - | |
| gcp/ | 2026-03-28 18:09 | - | |
| gcs/ | 2026-03-28 18:09 | - | |
| gdal/ | 2026-03-28 18:09 | - | |
| gdb/ | 2026-03-28 18:09 | - | |
| gdpr/ | 2026-03-28 18:09 | - | |
| gdrive/ | 2026-03-28 18:09 | - | |
| gdscript/ | 2026-03-28 18:09 | - | |
| geant4/ | 2026-03-28 18:09 | - | |
| geany/ | 2026-03-28 18:09 | - | |
| gecko/ | 2026-03-28 18:09 | - | |
| geckoengine/ | 2026-03-28 18:09 | - | |
| geekbench-ai/ | 2026-03-28 18:09 | - | |
| geforce-now/ | 2026-03-28 18:09 | - | |
| geld/ | 2026-03-28 18:09 | - | |
| gem/ | 2026-03-28 18:10 | - | |
| gemini-cli-extension/ | 2026-03-28 18:09 | - | |
| gemini-cli/ | 2026-03-28 18:09 | - | |
| gemini/ | 2026-03-28 18:09 | - | |
| gemma/ | 2026-03-28 18:09 | - | |
| gen-ai/ | 2026-03-28 18:10 | - | |
| gene/ | 2026-03-28 18:10 | - | |
| genealogy/ | 2026-03-28 18:09 | - | |
| general-arcade/ | 2026-03-28 18:09 | - | |
| generate-hashes/ | 2026-03-28 18:09 | - | |
| generate-numbers/ | 2026-03-28 18:09 | - | |
| generate/ | 2026-03-28 18:09 | - | |
| generation/ | 2026-03-28 18:10 | - | |
| generative-ai/ | 2026-03-28 18:09 | - | |
| generator/ | 2026-03-28 18:09 | - | |
| generic-mapping-tools/ | 2026-03-28 18:09 | - | |
| genetics/ | 2026-03-28 18:09 | - | |
| geno/ | 2026-03-28 18:09 | - | |
| genomics/ | 2026-03-28 18:09 | - | |
| genos/ | 2026-03-28 18:10 | - | |
| genplusgx segamegadrive mastersystem/ | 2026-03-28 18:10 | - | |
| genre/ | 2026-03-28 18:09 | - | |
| genres/ | 2026-03-28 18:09 | - | |
| genshin-3dmigoto/ | 2026-03-28 18:10 | - | |
| genshin-fps-unlock/ | 2026-03-28 18:10 | - | |
| genshin-fps-unlocker/ | 2026-03-28 18:10 | - | |
| genshin-fps/ | 2026-03-28 18:10 | - | |
| genshin-impact-3dmigoto/ | 2026-03-28 18:10 | - | |
| genshin-impact-mod/ | 2026-03-28 18:10 | - | |
| genshin-impact-tcg/ | 2026-03-28 18:09 | - | |
| genshin-impact-unlock-fps/ | 2026-03-28 18:10 | - | |
| genshin-impact/ | 2026-03-28 18:09 | - | |
| genshin-mod/ | 2026-03-28 18:10 | - | |
| genshin-reshade/ | 2026-03-28 18:10 | - | |
| genshin-stella-mod/ | 2026-03-28 18:10 | - | |
| genshin/ | 2026-03-28 18:09 | - | |
| genshinfps/ | 2026-03-28 18:10 | - | |
| genshinmod/ | 2026-03-28 18:10 | - | |
| geo/ | 2026-03-28 18:09 | - | |
| geocache/ | 2026-03-28 18:09 | - | |
| geocaching-swiss-army-knife/ | 2026-03-28 18:09 | - | |
| geocaching/ | 2026-03-28 18:09 | - | |
| geode-sdk/ | 2026-03-28 18:09 | - | |
| geode/ | 2026-03-28 18:09 | - | |
| geographic/ | 2026-03-28 18:09 | - | |
| geography/ | 2026-03-28 18:10 | - | |
| geoip/ | 2026-03-28 18:09 | - | |
| geolocation/ | 2026-03-28 18:09 | - | |
| geometry-dash/ | 2026-03-28 18:09 | - | |
| geometry/ | 2026-03-28 18:09 | - | |
| geophysics/ | 2026-03-28 18:09 | - | |
| geospatial-data/ | 2026-03-28 18:10 | - | |
| geospatial/ | 2026-03-28 18:09 | - | |
| gerber/ | 2026-03-28 18:09 | - | |
| gesture/ | 2026-03-28 18:10 | - | |
| gestures/ | 2026-03-28 18:09 | - | |
| geth/ | 2026-03-28 18:09 | - | |
| getopt/ | 2026-03-28 18:09 | - | |
| getpublii/ | 2026-03-28 18:09 | - | |
| getscreen.me/ | 2026-03-28 18:09 | - | |
| gettext/ | 2026-03-28 18:09 | - | |
| getting-things-done/ | 2026-03-28 18:09 | - | |
| gfm/ | 2026-03-28 18:09 | - | |
| gforth/ | 2026-03-28 18:09 | - | |
| gfortran/ | 2026-03-28 18:09 | - | |
| gfw/ | 2026-03-28 18:09 | - | |
| gg/ | 2026-03-28 18:09 | - | |
| ggml/ | 2026-03-28 18:09 | - | |
| ghdl/ | 2026-03-28 18:09 | - | |
| ghost-mode/ | 2026-03-28 18:09 | - | |
| ghostrecon/ | 2026-03-28 18:09 | - | |
| ghostscript/ | 2026-03-28 18:10 | - | |
| ghub/ | 2026-03-28 18:09 | - | |
| giac/ | 2026-03-28 18:10 | - | |
| gibc/ | 2026-03-28 18:09 | - | |
| giddh/ | 2026-03-28 18:10 | - | |
| gif-animation/ | 2026-03-28 18:09 | - | |
| gif-creator/ | 2026-03-28 18:09 | - | |
| gif/ | 2026-03-28 18:09 | - | |
| gifencoder/ | 2026-03-28 18:09 | - | |
| gifski/ | 2026-03-28 18:09 | - | |
| giga-byte/ | 2026-03-28 18:09 | - | |
| gigabit/ | 2026-03-28 18:09 | - | |
| gigabyte/ | 2026-03-28 18:09 | - | |
| gigapixel/ | 2026-03-28 18:09 | - | |
| gimi/ | 2026-03-28 18:09 | - | |
| gimp/ | 2026-03-28 18:09 | - | |
| gims/ | 2026-03-28 18:09 | - | |
| gis/ | 2026-03-28 18:09 | - | |
| gist/ | 2026-03-28 18:09 | - | |
| git-absorb/ | 2026-03-28 18:10 | - | |
| git-addons/ | 2026-03-28 18:09 | - | |
| git-bash/ | 2026-03-28 18:09 | - | |
| git-client/ | 2026-03-28 18:09 | - | |
| git-cliff/ | 2026-03-28 18:10 | - | |
| git-cola/ | 2026-03-28 18:09 | - | |
| git-credential-helper/ | 2026-03-28 18:09 | - | |
| git-delta/ | 2026-03-28 18:09 | - | |
| git-flow-next/ | 2026-03-28 18:09 | - | |
| git-flow/ | 2026-03-28 18:09 | - | |
| git-for-data/ | 2026-03-28 18:09 | - | |
| git-gui/ | 2026-03-28 18:09 | - | |
| git-hooks/ | 2026-03-28 18:09 | - | |
| git-security/ | 2026-03-28 18:09 | - | |
| git-servers/ | 2026-03-28 18:09 | - | |
| git-tool/ | 2026-03-28 18:09 | - | |
| git-ui/ | 2026-03-28 18:10 | - | |
| git-worktree/ | 2026-03-28 18:09 | - | |
| git/ | 2026-03-28 18:09 | - | |
| gitea/ | 2026-03-28 18:09 | - | |
| gitflow/ | 2026-03-28 18:09 | - | |
| gitflowversion/ | 2026-03-28 18:09 | - | |
| github标签/ | 2026-03-28 18:09 | - | |
| github-actions/ | 2026-03-28 18:09 | - | |
| github-copilot/ | 2026-03-28 18:09 | - | |
| github-pages/ | 2026-03-28 18:09 | - | |
| github-releases/ | 2026-03-28 18:09 | - | |
| github/ | 2026-03-28 18:09 | - | |
| githubflow/ | 2026-03-28 18:09 | - | |
| githubio/ | 2026-03-28 18:09 | - | |
| gitignore/ | 2026-03-28 18:09 | - | |
| gitkraken/ | 2026-03-28 18:09 | - | |
| gitlab-ci/ | 2026-03-28 18:09 | - | |
| gitlab-cli/ | 2026-03-28 18:09 | - | |
| gitlab/ | 2026-03-28 18:09 | - | |
| gitleaks/ | 2026-03-28 18:09 | - | |
| gitops-toolkit/ | 2026-03-28 18:09 | - | |
| gitops/ | 2026-03-28 18:09 | - | |
| gitql-sdk/ | 2026-03-28 18:09 | - | |
| gitql/ | 2026-03-28 18:09 | - | |
| gitservers/ | 2026-03-28 18:09 | - | |
| gittuf/ | 2026-03-28 18:09 | - | |
| gitversion/ | 2026-03-28 18:09 | - | |
| glab-cli/ | 2026-03-28 18:09 | - | |
| glab/ | 2026-03-28 18:09 | - | |
| glacier2/ | 2026-03-28 18:10 | - | |
| glade-interface-designer/ | 2026-03-28 18:09 | - | |
| gladeinterfacedesigner/ | 2026-03-28 18:09 | - | |
| glary/ | 2026-03-28 18:09 | - | |
| glarysoft/ | 2026-03-28 18:09 | - | |
| glass-cannon/ | 2026-03-28 18:09 | - | |
| glb/ | 2026-03-28 18:09 | - | |
| glob/ | 2026-03-28 18:09 | - | |
| global-hotkeys/ | 2026-03-28 18:09 | - | |
| globalping/ | 2026-03-28 18:09 | - | |
| globe/ | 2026-03-28 18:09 | - | |
| glpi/ | 2026-03-28 18:09 | - | |
| glsl-shaders/ | 2026-03-28 18:09 | - | |
| glsl/ | 2026-03-28 18:09 | - | |
| gltf-viewer/ | 2026-03-28 18:09 | - | |
| gltf/ | 2026-03-28 18:09 | - | |
| glucose/ | 2026-03-28 18:09 | - | |
| glue-language/ | 2026-03-28 18:09 | - | |
| gluon/ | 2026-03-28 18:09 | - | |
| gluonhq/ | 2026-03-28 18:09 | - | |
| glyf/ | 2026-03-28 18:09 | - | |
| gm/ | 2026-03-28 18:09 | - | |
| gm8/ | 2026-03-28 18:09 | - | |
| gm81/ | 2026-03-28 18:09 | - | |
| gmail/ | 2026-03-28 18:09 | - | |
| gml/ | 2026-03-28 18:09 | - | |
| gnmi/ | 2026-03-28 18:09 | - | |
| gnome-glade/ | 2026-03-28 18:09 | - | |
| gnome-shell-extension/ | 2026-03-28 18:09 | - | |
| gnome-translation-editor/ | 2026-03-28 18:09 | - | |
| gnome/ | 2026-03-28 18:09 | - | |
| gnomeglade/ | 2026-03-28 18:09 | - | |
| gnomeplanner/ | 2026-03-28 18:09 | - | |
| gnss/ | 2026-03-28 18:09 | - | |
| gnu-coreutils/ | 2026-03-28 18:10 | - | |
| gnu/ | 2026-03-28 18:09 | - | |
| gnupg/ | 2026-03-28 18:09 | - | |
| gnuradio/ | 2026-03-28 18:09 | - | |
| gnuwin32/ | 2026-03-28 18:09 | - | |
| go-away-edge/ | 2026-03-28 18:09 | - | |
| go/ | 2026-03-28 18:09 | - | |
| goal/ | 2026-03-28 18:10 | - | |
| goawayedge/ | 2026-03-28 18:09 | - | |
| gobierno de españa/ | 2026-03-28 18:09 | - | |
| gocover/ | 2026-03-28 18:09 | - | |
| god/ | 2026-03-28 18:09 | - | |
| goddessofvictory/ | 2026-03-28 18:10 | - | |
| godot-dec/ | 2026-03-28 18:09 | - | |
| godot-engine-package-files/ | 2026-03-28 18:09 | - | |
| godot-engine/ | 2026-03-28 18:09 | - | |
| godot-launcher-app/ | 2026-03-28 18:09 | - | |
| godot-launcher/ | 2026-03-28 18:09 | - | |
| godot/ | 2026-03-28 18:09 | - | |
| godotengine/ | 2026-03-28 18:09 | - | |
| godotenginepackagefiles/ | 2026-03-28 18:09 | - | |
| gofmt/ | 2026-03-28 18:10 | - | |
| gog-galaxy/ | 2026-03-28 18:09 | - | |
| gog.com/ | 2026-03-28 18:09 | - | |
| gogear/ | 2026-03-28 18:10 | - | |
| golang-application/ | 2026-03-28 18:09 | - | |
| golang-library/ | 2026-03-28 18:10 | - | |
| golang-tools/ | 2026-03-28 18:09 | - | |
| golang/ | 2026-03-28 18:09 | - | |
| golangci-lint/ | 2026-03-28 18:09 | - | |
| goldendict/ | 2026-03-28 18:09 | - | |
| gomoku/ | 2026-03-28 18:09 | - | |
| gongwen/ | 2026-03-28 18:10 | - | |
| goodbye-dpi/ | 2026-03-28 18:10 | - | |
| goofcord/ | 2026-03-28 18:09 | - | |
| google-admin-sdk/ | 2026-03-28 18:09 | - | |
| google-admin/ | 2026-03-28 18:09 | - | |
| google-api/ | 2026-03-28 18:09 | - | |
| google-apps/ | 2026-03-28 18:09 | - | |
| google-arts-culture/ | 2026-03-28 18:09 | - | |
| google-calendar/ | 2026-03-28 18:09 | - | |
| google-chat/ | 2026-03-28 18:09 | - | |
| google-chrome/ | 2026-03-28 18:10 | - | |
| google-cloud-functions/ | 2026-03-28 18:10 | - | |
| google-cloud-storage/ | 2026-03-28 18:09 | - | |
| google-cloud/ | 2026-03-28 18:09 | - | |
| google-docs/ | 2026-03-28 18:09 | - | |
| google-drive/ | 2026-03-28 18:09 | - | |
| google-fonts/ | 2026-03-28 18:09 | - | |
| google-hangouts/ | 2026-03-28 18:09 | - | |
| google-mail/ | 2026-03-28 18:09 | - | |
| google-photos/ | 2026-03-28 18:10 | - | |
| google-play-store/ | 2026-03-28 18:09 | - | |
| google-sheets/ | 2026-03-28 18:09 | - | |
| google-voice/ | 2026-03-28 18:09 | - | |
| google-workspace-cli/ | 2026-03-28 18:09 | - | |
| google-workspace/ | 2026-03-28 18:09 | - | |
| google/ | 2026-03-28 18:09 | - | |
| googlecloud/ | 2026-03-28 18:09 | - | |
| googlemeet/ | 2026-03-28 18:09 | - | |
| googleplaygames/ | 2026-03-28 18:09 | - | |
| googleplaystore/ | 2026-03-28 18:09 | - | |
| gop/ | 2026-03-28 18:09 | - | |
| gopass/ | 2026-03-28 18:09 | - | |
| goplus/ | 2026-03-28 18:09 | - | |
| gopro/ | 2026-03-28 18:09 | - | |
| gosu/ | 2026-03-28 18:10 | - | |
| gotiengviet/ | 2026-03-28 18:10 | - | |
| gotify/ | 2026-03-28 18:10 | - | |
| govee-api/ | 2026-03-28 18:09 | - | |
| govee/ | 2026-03-28 18:09 | - | |
| government/ | 2026-03-28 18:09 | - | |
| goxlr-on-linux/ | 2026-03-28 18:09 | - | |
| goxlr/ | 2026-03-28 18:09 | - | |
| gpg/ | 2026-03-28 18:09 | - | |
| gpgpu/ | 2026-03-28 18:09 | - | |
| gpio/ | 2026-03-28 18:09 | - | |
| gpl/ | 2026-03-28 18:09 | - | |
| gplv2/ | 2026-03-28 18:09 | - | |
| gplv3/ | 2026-03-28 18:09 | - | |
| gpo/ | 2026-03-28 18:09 | - | |
| gps/ | 2026-03-28 18:09 | - | |
| gpt-3/ | 2026-03-28 18:10 | - | |
| gpt/ | 2026-03-28 18:09 | - | |
| gpt3/ | 2026-03-28 18:10 | - | |
| gptpartitions/ | 2026-03-28 18:09 | - | |
| gpu-computing/ | 2026-03-28 18:09 | - | |
| gpu-encoding/ | 2026-03-28 18:09 | - | |
| gpu-fans/ | 2026-03-28 18:09 | - | |
| gpu-monitoring/ | 2026-03-28 18:09 | - | |
| gpu-utility/ | 2026-03-28 18:09 | - | |
| gpu/ | 2026-03-28 18:09 | - | |
| gpui/ | 2026-03-28 18:10 | - | |
| gpx/ | 2026-03-28 18:09 | - | |
| gql/ | 2026-03-28 18:09 | - | |
| gqrx/ | 2026-03-28 18:09 | - | |
| graalvm/ | 2026-03-28 18:09 | - | |
| grabber/ | 2026-03-28 18:09 | - | |
| gradient/ | 2026-03-28 18:09 | - | |
| grading/ | 2026-03-28 18:09 | - | |
| gradle/ | 2026-03-28 18:09 | - | |
| graffiti/ | 2026-03-28 18:09 | - | |
| graft/ | 2026-03-28 18:10 | - | |
| grammaire/ | 2026-03-28 18:09 | - | |
| grammar-checker/ | 2026-03-28 18:09 | - | |
| grammar/ | 2026-03-28 18:09 | - | |
| grand-theft-auto/ | 2026-03-28 18:09 | - | |
| grandtheftauto/ | 2026-03-28 18:09 | - | |
| graph-database/ | 2026-03-28 18:10 | - | |
| graph/ | 2026-03-28 18:09 | - | |
| grapheme-cluster/ | 2026-03-28 18:09 | - | |
| graph generator/ | 2026-03-28 18:10 | - | |
| graphic-design/ | 2026-03-28 18:09 | - | |
| graphics-card/ | 2026-03-28 18:09 | - | |
| graphics/ | 2026-03-28 18:09 | - | |
| graphicscard/ | 2026-03-28 18:09 | - | |
| graphicscards/ | 2026-03-28 18:09 | - | |
| graphicstablet/ | 2026-03-28 18:09 | - | |
| graphing/ | 2026-03-28 18:09 | - | |
| graphql-client/ | 2026-03-28 18:09 | - | |
| graphql-ide/ | 2026-03-28 18:09 | - | |
| graphql/ | 2026-03-28 18:09 | - | |
| graphqlide/ | 2026-03-28 18:09 | - | |
| graphs/ | 2026-03-28 18:10 | - | |
| graylog/ | 2026-03-28 18:09 | - | |
| grayscale/ | 2026-03-28 18:09 | - | |
| green energy_saving benefiting label/ | 2026-03-28 18:10 | - | |
| grep/ | 2026-03-28 18:09 | - | |
| grib/ | 2026-03-28 18:10 | - | |
| grib2/ | 2026-03-28 18:10 | - | |
| grid-computing/ | 2026-03-28 18:09 | - | |
| gridcoin/ | 2026-03-28 18:09 | - | |
| groceries/ | 2026-03-28 18:10 | - | |
| grocy/ | 2026-03-28 18:10 | - | |
| grok/ | 2026-03-28 18:09 | - | |
| groovy/ | 2026-03-28 18:10 | - | |
| ground-station/ | 2026-03-28 18:09 | - | |
| grouppolicies/ | 2026-03-28 18:09 | - | |
| grpc-client/ | 2026-03-28 18:10 | - | |
| grpc-gui/ | 2026-03-28 18:10 | - | |
| grpc/ | 2026-03-28 18:09 | - | |
| gs-base/ | 2026-03-28 18:10 | - | |
| gs/ | 2026-03-28 18:10 | - | |
| gs808e/ | 2026-03-28 18:09 | - | |
| gs810emx/ | 2026-03-28 18:09 | - | |
| gsak/ | 2026-03-28 18:09 | - | |
| gstreamer/ | 2026-03-28 18:09 | - | |
| gsuite/ | 2026-03-28 18:09 | - | |
| gta+/ | 2026-03-28 18:09 | - | |
| gta5/ | 2026-03-28 18:09 | - | |
| gtd-applications/ | 2026-03-28 18:09 | - | |
| gtd-workflow/ | 2026-03-28 18:09 | - | |
| gtd/ | 2026-03-28 18:09 | - | |
| gtk+/ | 2026-03-28 18:09 | - | |
| gtk-sharp/ | 2026-03-28 18:10 | - | |
| gtk/ | 2026-03-28 18:09 | - | |
| gtk3/ | 2026-03-28 18:09 | - | |
| gtk4/ | 2026-03-28 18:09 | - | |
| gtkmm/ | 2026-03-28 18:10 | - | |
| gtranslator/ | 2026-03-28 18:09 | - | |
| gui-app/ | 2026-03-28 18:09 | - | |
| gui-application/ | 2026-03-28 18:09 | - | |
| gui-client/ | 2026-03-28 18:10 | - | |
| gui-operation/ | 2026-03-28 18:10 | - | |
| gui/ | 2026-03-28 18:09 | - | |
| guide/ | 2026-03-28 18:09 | - | |
| guides/ | 2026-03-28 18:09 | - | |
| guiding/ | 2026-03-28 18:09 | - | |
| guidpartitiontable/ | 2026-03-28 18:09 | - | |
| guild/ | 2026-03-28 18:09 | - | |
| guitar-tabs/ | 2026-03-28 18:09 | - | |
| guitar/ | 2026-03-28 18:09 | - | |
| guix/ | 2026-03-28 18:10 | - | |
| gutenberg/ | 2026-03-28 18:09 | - | |
| gvfs/ | 2026-03-28 18:09 | - | |
| gvim/ | 2026-03-28 18:09 | - | |
| gvisor/ | 2026-03-28 18:10 | - | |
| gwt/ | 2026-03-28 18:09 | - | |
| gyb/ | 2026-03-28 18:09 | - | |
| gyroscope/ | 2026-03-28 18:09 | - | |
| gzip/ | 2026-03-28 18:09 | - | |
| h264/ | 2026-03-28 18:09 | - | |
| h265/ | 2026-03-28 18:09 | - | |
| hacking/ | 2026-03-28 18:09 | - | |
| hackintosh/ | 2026-03-28 18:09 | - | |
| hackmd/ | 2026-03-28 18:09 | - | |
| hackrf/ | 2026-03-28 18:09 | - | |
| hacktoberfest-accepted/ | 2026-03-28 18:09 | - | |
| hacktoberfest/ | 2026-03-28 18:09 | - | |
| hacktoberfest22/ | 2026-03-28 18:09 | - | |
| hacktoberfest2020/ | 2026-03-28 18:09 | - | |
| hacktoberfest2021/ | 2026-03-28 18:09 | - | |
| hacktoberfest2023/ | 2026-03-28 18:10 | - | |
| hactoberfest/ | 2026-03-28 18:09 | - | |
| hale-studio/ | 2026-03-28 18:10 | - | |
| hale/ | 2026-03-28 18:10 | - | |
| half-life/ | 2026-03-28 18:09 | - | |
| halloy/ | 2026-03-28 18:09 | - | |
| ham-radio/ | 2026-03-28 18:09 | - | |
| ham/ | 2026-03-28 18:09 | - | |
| hambands/ | 2026-03-28 18:09 | - | |
| hamradio/ | 2026-03-28 18:09 | - | |
| hamster/ | 2026-03-28 18:09 | - | |
| hancom/ | 2026-03-28 18:09 | - | |
| handbrake/ | 2026-03-28 18:09 | - | |
| handoff/ | 2026-03-28 18:09 | - | |
| handwriting/ | 2026-03-28 18:09 | - | |
| handy/ | 2026-03-28 18:09 | - | |
| handycontrol/ | 2026-03-28 18:09 | - | |
| handywinget/ | 2026-03-28 18:09 | - | |
| hang-out/ | 2026-03-28 18:09 | - | |
| hangouts-chat/ | 2026-03-28 18:09 | - | |
| hangouts/ | 2026-03-28 18:09 | - | |
| hantek/ | 2026-03-28 18:10 | - | |
| hantek6022/ | 2026-03-28 18:10 | - | |
| hanword/ | 2026-03-28 18:09 | - | |
| har/ | 2026-03-28 18:09 | - | |
| hard-disk-drive/ | 2026-03-28 18:09 | - | |
| hard-disk/ | 2026-03-28 18:09 | - | |
| hard-drive-password/ | 2026-03-28 18:09 | - | |
| hard-drive/ | 2026-03-28 18:09 | - | |
| hard-link/ | 2026-03-28 18:10 | - | |
| hard-links/ | 2026-03-28 18:09 | - | |
| hard-of-hearing/ | 2026-03-28 18:09 | - | |
| hard/ | 2026-03-28 18:09 | - | |
| harddisk/ | 2026-03-28 18:09 | - | |
| harddiskconversion/ | 2026-03-28 18:09 | - | |
| harddiskmaintenance/ | 2026-03-28 18:09 | - | |
| harddisks/ | 2026-03-28 18:09 | - | |
| harddrive/ | 2026-03-28 18:09 | - | |
| harddriveconverting/ | 2026-03-28 18:09 | - | |
| harddrivemaintenance/ | 2026-03-28 18:09 | - | |
| harddrivepassword/ | 2026-03-28 18:09 | - | |
| harddrives/ | 2026-03-28 18:09 | - | |
| hardening/ | 2026-03-28 18:09 | - | |
| hardlink/ | 2026-03-28 18:09 | - | |
| hardlinks/ | 2026-03-28 18:09 | - | |
| hardsub/ | 2026-03-28 18:09 | - | |
| hardware-acceleration/ | 2026-03-28 18:09 | - | |
| hardware-detection/ | 2026-03-28 18:09 | - | |
| hardware-monitor/ | 2026-03-28 18:09 | - | |
| hardware-monitoring/ | 2026-03-28 18:09 | - | |
| hardware-performance/ | 2026-03-28 18:10 | - | |
| hardware-renderers/ | 2026-03-28 18:10 | - | |
| hardware-simulation/ | 2026-03-28 18:10 | - | |
| hardware-utility/ | 2026-03-28 18:09 | - | |
| hardware-wallet/ | 2026-03-28 18:09 | - | |
| hardware/ | 2026-03-28 18:09 | - | |
| hardwareacceleration/ | 2026-03-28 18:09 | - | |
| hardware monitor/ | 2026-03-28 18:09 | - | |
| harmonyos/ | 2026-03-28 18:09 | - | |
| harvesters/ | 2026-03-28 18:09 | - | |
| has-160/ | 2026-03-28 18:10 | - | |
| hash-calc/ | 2026-03-28 18:10 | - | |
| hash-calculator/ | 2026-03-28 18:10 | - | |
| hash-files/ | 2026-03-28 18:09 | - | |
| hash-functions/ | 2026-03-28 18:10 | - | |
| hash-generator/ | 2026-03-28 18:09 | - | |
| hash/ | 2026-03-28 18:09 | - | |
| hashandcrc/ | 2026-03-28 18:09 | - | |
| hashcheck/ | 2026-03-28 18:10 | - | |
| hasher/ | 2026-03-28 18:09 | - | |
| hashes/ | 2026-03-28 18:09 | - | |
| hashgen/ | 2026-03-28 18:09 | - | |
| hashicorp-vault/ | 2026-03-28 18:09 | - | |
| hashicorp/ | 2026-03-28 18:09 | - | |
| hashing/ | 2026-03-28 18:09 | - | |
| hashsums/ | 2026-03-28 18:09 | - | |
| hashtab/ | 2026-03-28 18:10 | - | |
| hashtags/ | 2026-03-28 18:09 | - | |
| haskell-application/ | 2026-03-28 18:10 | - | |
| haskell/ | 2026-03-28 18:09 | - | |
| hat/ | 2026-03-28 18:09 | - | |
| haval/ | 2026-03-28 18:10 | - | |
| haveibeenpwned/ | 2026-03-28 18:09 | - | |
| hawkthorne-journey/ | 2026-03-28 18:09 | - | |
| hawkthornejourney/ | 2026-03-28 18:09 | - | |
| haxe/ | 2026-03-28 18:09 | - | |
| hbci/ | 2026-03-28 18:09 | - | |
| hcloud/ | 2026-03-28 18:09 | - | |
| hd/ | 2026-03-28 18:09 | - | |
| hd60x/ | 2026-03-28 18:09 | - | |
| hdb/ | 2026-03-28 18:09 | - | |
| hdcleaner/ | 2026-03-28 18:10 | - | |
| hdd-recovery/ | 2026-03-28 18:09 | - | |
| hdd/ | 2026-03-28 18:09 | - | |
| hddmaintenance/ | 2026-03-28 18:09 | - | |
| hdiffpatch/ | 2026-03-28 18:10 | - | |
| hdmi/ | 2026-03-28 18:10 | - | |
| hdmiaudio/ | 2026-03-28 18:09 | - | |
| hdr-images/ | 2026-03-28 18:10 | - | |
| hdr/ | 2026-03-28 18:09 | - | |
| hdsentinel/ | 2026-03-28 18:09 | - | |
| hdwwiz/ | 2026-03-28 18:09 | - | |
| headlamp/ | 2026-03-28 18:09 | - | |
| headless-console/ | 2026-03-28 18:10 | - | |
| headphone/ | 2026-03-28 18:09 | - | |
| headphones/ | 2026-03-28 18:09 | - | |
| headset/ | 2026-03-28 18:09 | - | |
| headtracking/ | 2026-03-28 18:09 | - | |
| health-app/ | 2026-03-28 18:09 | - | |
| health-check/ | 2026-03-28 18:09 | - | |
| health-monitor/ | 2026-03-28 18:10 | - | |
| health/ | 2026-03-28 18:09 | - | |
| healthcare/ | 2026-03-28 18:09 | - | |
| hearthstone/ | 2026-03-28 18:10 | - | |
| hearts-of-iron-4/ | 2026-03-28 18:09 | - | |
| hearts-of-iron-iv/ | 2026-03-28 18:09 | - | |
| heat-pump/ | 2026-03-28 18:09 | - | |
| heatmap/ | 2026-03-28 18:09 | - | |
| heaven/ | 2026-03-28 18:10 | - | |
| heic/ | 2026-03-28 18:09 | - | |
| heif/ | 2026-03-28 18:09 | - | |
| height/ | 2026-03-28 18:09 | - | |
| helium-browser/ | 2026-03-28 18:10 | - | |
| heliumbrowser/ | 2026-03-28 18:10 | - | |
| helix/ | 2026-03-28 18:09 | - | |
| helm-charts/ | 2026-03-28 18:09 | - | |
| helm/ | 2026-03-28 18:09 | - | |
| help-files/ | 2026-03-28 18:09 | - | |
| help/ | 2026-03-28 18:09 | - | |
| helpdesk/ | 2026-03-28 18:09 | - | |
| helpndoc/ | 2026-03-28 18:09 | - | |
| hemtt/ | 2026-03-28 18:09 | - | |
| heritageresearch/ | 2026-03-28 18:10 | - | |
| heroic/ | 2026-03-28 18:09 | - | |
| heroku/ | 2026-03-28 18:09 | - | |
| hertz/ | 2026-03-28 18:10 | - | |
| hetzner-cloud/ | 2026-03-28 18:09 | - | |
| hetzner/ | 2026-03-28 18:09 | - | |
| hex-edit/ | 2026-03-28 18:09 | - | |
| hex-editor-neo/ | 2026-03-28 18:09 | - | |
| hex-editor/ | 2026-03-28 18:09 | - | |
| hex-viewer/ | 2026-03-28 18:09 | - | |
| hex/ | 2026-03-28 18:09 | - | |
| hexadecimal/ | 2026-03-28 18:09 | - | |
| hexadecimalviewer/ | 2026-03-28 18:09 | - | |
| hexdump/ | 2026-03-28 18:09 | - | |
| hexeditor/ | 2026-03-28 18:09 | - | |
| hexo-client/ | 2026-03-28 18:09 | - | |
| hexo/ | 2026-03-28 18:09 | - | |
| hfs+/ | 2026-03-28 18:09 | - | |
| hfs/ | 2026-03-28 18:09 | - | |
| hg/ | 2026-03-28 18:09 | - | |
| hibernate/ | 2026-03-28 18:09 | - | |
| hibp/ | 2026-03-28 18:09 | - | |
| hid/ | 2026-03-28 18:09 | - | |
| hidden-objects/ | 2026-03-28 18:09 | - | |
| hide/ | 2026-03-28 18:09 | - | |
| hider/ | 2026-03-28 18:10 | - | |
| hiding/ | 2026-03-28 18:09 | - | |
| hierarchy/ | 2026-03-28 18:09 | - | |
| hifi/ | 2026-03-28 18:09 | - | |
| higan/ | 2026-03-28 18:09 | - | |
| high-dynamic-range/ | 2026-03-28 18:10 | - | |
| highdpi/ | 2026-03-28 18:10 | - | |
| highdynamicrange/ | 2026-03-28 18:09 | - | |
| highlight/ | 2026-03-28 18:09 | - | |
| highlighting/ | 2026-03-28 18:10 | - | |
| highrez/ | 2026-03-28 18:10 | - | |
| highschool/ | 2026-03-28 18:10 | - | |
| hikari_field/ | 2026-03-28 18:09 | - | |
| hindsight/ | 2026-03-28 18:10 | - | |
| hipin/ | 2026-03-28 18:09 | - | |
| hips/ | 2026-03-28 18:10 | - | |
| history/ | 2026-03-28 18:09 | - | |
| hitencent/ | 2026-03-28 18:09 | - | |
| hive/ | 2026-03-28 18:09 | - | |
| hl7/ | 2026-03-28 18:09 | - | |
| hlp/ | 2026-03-28 18:09 | - | |
| hls-downloader/ | 2026-03-28 18:09 | - | |
| hls/ | 2026-03-28 18:09 | - | |
| hlsdownloader/ | 2026-03-28 18:09 | - | |
| hlsl/ | 2026-03-28 18:09 | - | |
| hmac/ | 2026-03-28 18:09 | - | |
| hmi/ | 2026-03-28 18:09 | - | |
| hoi4/ | 2026-03-28 18:09 | - | |
| holiday/ | 2026-03-28 18:09 | - | |
| hololensclicker/ | 2026-03-28 18:10 | - | |
| home-automation/ | 2026-03-28 18:10 | - | |
| home-office/ | 2026-03-28 18:09 | - | |
| home/ | 2026-03-28 18:09 | - | |
| homebrew/ | 2026-03-28 18:09 | - | |
| homecinemas/ | 2026-03-28 18:09 | - | |
| homelab/ | 2026-03-28 18:09 | - | |
| hometheaters/ | 2026-03-28 18:09 | - | |
| hometheatres/ | 2026-03-28 18:09 | - | |
| homework/ | 2026-03-28 18:09 | - | |
| homoiconic/ | 2026-03-28 18:09 | - | |
| honeyview/ | 2026-03-28 18:10 | - | |
| honkai-impact/ | 2026-03-28 18:09 | - | |
| honkai-starrail/ | 2026-03-28 18:09 | - | |
| honkai/ | 2026-03-28 18:09 | - | |
| honkai3rd/ | 2026-03-28 18:09 | - | |
| honor-earbuds/ | 2026-03-28 18:10 | - | |
| honor/ | 2026-03-28 18:09 | - | |
| hooking/ | 2026-03-28 18:09 | - | |
| hooks/ | 2026-03-28 18:09 | - | |
| hori-device-manager/ | 2026-03-28 18:09 | - | |
| horipad+/ | 2026-03-28 18:09 | - | |
| horizon/ | 2026-03-28 18:09 | - | |
| host/ | 2026-03-28 18:10 | - | |
| hosting/ | 2026-03-28 18:10 | - | |
| hosts/ | 2026-03-28 18:09 | - | |
| hostsfile/ | 2026-03-28 18:09 | - | |
| hostsfiles/ | 2026-03-28 18:09 | - | |
| hotchocolate/ | 2026-03-28 18:09 | - | |
| hotkey/ | 2026-03-28 18:09 | - | |
| hotkeys/ | 2026-03-28 18:09 | - | |
| hotspot/ | 2026-03-28 18:09 | - | |
| hover/ | 2026-03-28 18:09 | - | |
| howlerjs/ | 2026-03-28 18:09 | - | |
| hoxy/ | 2026-03-28 18:09 | - | |
| hp/ | 2026-03-28 18:09 | - | |
| hpc/ | 2026-03-28 18:09 | - | |
| hpia/ | 2026-03-28 18:09 | - | |
| hpsdr/ | 2026-03-28 18:09 | - | |
| hpsmart/ | 2026-03-28 18:09 | - | |
| hrkfdn/ | 2026-03-28 18:09 | - | |
| hsl/ | 2026-03-28 18:09 | - | |
| hsm/ | 2026-03-28 18:09 | - | |
| hsv/ | 2026-03-28 18:09 | - | |
| htc/ | 2026-03-28 18:10 | - | |
| htm/ | 2026-03-28 18:09 | - | |
| html-css-javascript/ | 2026-03-28 18:10 | - | |
| html-to-markdown/ | 2026-03-28 18:09 | - | |
| html/ | 2026-03-28 18:09 | - | |
| html5-speedtest/ | 2026-03-28 18:09 | - | |
| htop/ | 2026-03-28 18:09 | - | |
| http-archive/ | 2026-03-28 18:09 | - | |
| http-client/ | 2026-03-28 18:09 | - | |
| http-performance/ | 2026-03-28 18:09 | - | |
| http-proxy/ | 2026-03-28 18:09 | - | |
| http-server/ | 2026-03-28 18:09 | - | |
| http-testing/ | 2026-03-28 18:10 | - | |
| http2/ | 2026-03-28 18:09 | - | |
| http3/ | 2026-03-28 18:09 | - | |
| httpscertificates/ | 2026-03-28 18:09 | - | |
| httpserver/ | 2026-03-28 18:10 | - | |
| httpsproxy/ | 2026-03-28 18:10 | - | |
| huawei-cloud/ | 2026-03-28 18:09 | - | |
| huawei/ | 2026-03-28 18:10 | - | |
| hub/ | 2026-03-28 18:09 | - | |
| hubble/ | 2026-03-28 18:09 | - | |
| hubspot/ | 2026-03-28 18:10 | - | |
| hud/ | 2026-03-28 18:10 | - | |
| hue-saturation-value/ | 2026-03-28 18:10 | - | |
| hue/ | 2026-03-28 18:09 | - | |
| huebridge/ | 2026-03-28 18:10 | - | |
| huggingface/ | 2026-03-28 18:09 | - | |
| humboldt-alignment-editor/ | 2026-03-28 18:10 | - | |
| hummingbird/ | 2026-03-28 18:09 | - | |
| hunter/ | 2026-03-28 18:09 | - | |
| hunterpie-v2/ | 2026-03-28 18:09 | - | |
| hunterpie/ | 2026-03-28 18:09 | - | |
| hunyuan/ | 2026-03-28 18:09 | - | |
| huoshan/ | 2026-03-28 18:10 | - | |
| hwinfo64/ | 2026-03-28 18:09 | - | |
| hwp/ | 2026-03-28 18:09 | - | |
| hynix/ | 2026-03-28 18:10 | - | |
| hyper-v-switch/ | 2026-03-28 18:10 | - | |
| hyper-v/ | 2026-03-28 18:09 | - | |
| hyper/ | 2026-03-28 18:09 | - | |
| hypersnap9/ | 2026-03-28 18:10 | - | |
| hyperv/ | 2026-03-28 18:09 | - | |
| hypervisor/ | 2026-03-28 18:10 | - | |
| hypixel-studios/ | 2026-03-28 18:10 | - | |
| hypixel/ | 2026-03-28 18:10 | - | |
| hytale/ | 2026-03-28 18:09 | - | |
| hz/ | 2026-03-28 18:10 | - | |
| i.link/ | 2026-03-28 18:09 | - | |
| i2c/ | 2026-03-28 18:09 | - | |
| i2p/ | 2026-03-28 18:10 | - | |
| i3c/ | 2026-03-28 18:09 | - | |
| i3wm/ | 2026-03-28 18:09 | - | |
| i18n/ | 2026-03-28 18:09 | - | |
| iac/ | 2026-03-28 18:09 | - | |
| iam/ | 2026-03-28 18:09 | - | |
| iap/ | 2026-03-28 18:09 | - | |
| ibm/ | 2026-03-28 18:09 | - | |
| ibmdos/ | 2026-03-28 18:10 | - | |
| ibw/ | 2026-03-28 18:10 | - | |
| ic-card/ | 2026-03-28 18:10 | - | |
| ica/ | 2026-03-28 18:09 | - | |
| icat/ | 2026-03-28 18:10 | - | |
| icbc/ | 2026-03-28 18:09 | - | |
| icc/ | 2026-03-28 18:09 | - | |
| iccprofile/ | 2026-03-28 18:09 | - | |
| ice/ | 2026-03-28 18:10 | - | |
| iced/ | 2026-03-28 18:09 | - | |
| icedtea/ | 2026-03-28 18:10 | - | |
| icegrid/ | 2026-03-28 18:10 | - | |
| icestorm/ | 2026-03-28 18:10 | - | |
| iciba/ | 2026-03-28 18:09 | - | |
| icinga/ | 2026-03-28 18:09 | - | |
| icloud/ | 2026-03-28 18:09 | - | |
| icmp/ | 2026-03-28 18:09 | - | |
| icns/ | 2026-03-28 18:09 | - | |
| icon-buttons/ | 2026-03-28 18:09 | - | |
| icon-extractor/ | 2026-03-28 18:09 | - | |
| iconbutton/ | 2026-03-28 18:09 | - | |
| iconset/ | 2026-03-28 18:09 | - | |
| iconutil/ | 2026-03-28 18:09 | - | |
| iconv/ | 2026-03-28 18:09 | - | |
| icp-brasil/ | 2026-03-28 18:09 | - | |
| icq/ | 2026-03-28 18:09 | - | |
| ics/ | 2026-03-28 18:09 | - | |
| id3/ | 2026-03-28 18:09 | - | |
| idd/ | 2026-03-28 18:09 | - | |
| iddcx/ | 2026-03-28 18:09 | - | |
| iddsampledriver/ | 2026-03-28 18:09 | - | |
| ide-launcher/ | 2026-03-28 18:09 | - | |
| ide/ | 2026-03-28 18:09 | - | |
| ideacentre/ | 2026-03-28 18:09 | - | |
| ideahub/ | 2026-03-28 18:09 | - | |
| ideapad/ | 2026-03-28 18:09 | - | |
| ideashare/ | 2026-03-28 18:09 | - | |
| idempotent/ | 2026-03-28 18:09 | - | |
| identifier/ | 2026-03-28 18:10 | - | |
| identity-v/ | 2026-03-28 18:09 | - | |
| identity/ | 2026-03-28 18:09 | - | |
| idevice/ | 2026-03-28 18:09 | - | |
| idle/ | 2026-03-28 18:09 | - | |
| idolmaster-cinderella-girls/ | 2026-03-28 18:10 | - | |
| ie/ | 2026-03-28 18:09 | - | |
| iec101/ | 2026-03-28 18:09 | - | |
| iec104/ | 2026-03-28 18:09 | - | |
| iec18181/ | 2026-03-28 18:09 | - | |
| iec61850/ | 2026-03-28 18:09 | - | |
| ieee-1394-driver/ | 2026-03-28 18:09 | - | |
| ieee-1394/ | 2026-03-28 18:10 | - | |
| ieee-p1394/ | 2026-03-28 18:09 | - | |
| ieee1394/ | 2026-03-28 18:10 | - | |
| ieee1394driver/ | 2026-03-28 18:09 | - | |
| ieeep1394/ | 2026-03-28 18:09 | - | |
| ietf/ | 2026-03-28 18:09 | - | |
| ifc/ | 2026-03-28 18:10 | - | |
| ifile/ | 2026-03-28 18:09 | - | |
| iflytek/ | 2026-03-28 18:09 | - | |
| ign/ | 2026-03-28 18:09 | - | |
| ignite/ | 2026-03-28 18:09 | - | |
| igor-pro/ | 2026-03-28 18:09 | - | |
| igs/ | 2026-03-28 18:09 | - | |
| iiif/ | 2026-03-28 18:09 | - | |
| iio-devices/ | 2026-03-28 18:09 | - | |
| iio-oscilloscope/ | 2026-03-28 18:09 | - | |
| iio/ | 2026-03-28 18:09 | - | |
| iiot/ | 2026-03-28 18:09 | - | |
| iis/ | 2026-03-28 18:09 | - | |
| iium-schedule/ | 2026-03-28 18:09 | - | |
| iium/ | 2026-03-28 18:09 | - | |
| ikev2/ | 2026-03-28 18:09 | - | |
| il/ | 2026-03-28 18:09 | - | |
| il2cpp/ | 2026-03-28 18:10 | - | |
| illustrator/ | 2026-03-28 18:09 | - | |
| ilovepdf/ | 2026-03-28 18:10 | - | |
| ilspy/ | 2026-03-28 18:09 | - | |
| im/ | 2026-03-28 18:09 | - | |
| imag-ecompressing/ | 2026-03-28 18:10 | - | |
| image-analysis/ | 2026-03-28 18:09 | - | |
| image-analyzing/ | 2026-03-28 18:09 | - | |
| image-benchmark/ | 2026-03-28 18:09 | - | |
| image-burner/ | 2026-03-28 18:10 | - | |
| image-compression/ | 2026-03-28 18:09 | - | |
| image-compressor/ | 2026-03-28 18:10 | - | |
| image-converter/ | 2026-03-28 18:09 | - | |
| image-converting/ | 2026-03-28 18:09 | - | |
| image-database/ | 2026-03-28 18:09 | - | |
| image-diff/ | 2026-03-28 18:09 | - | |
| image-editor/ | 2026-03-28 18:09 | - | |
| image-enhancement/ | 2026-03-28 18:09 | - | |
| image-file-execution-options/ | 2026-03-28 18:10 | - | |
| image-file-metadata/ | 2026-03-28 18:09 | - | |
| image-files/ | 2026-03-28 18:09 | - | |
| image-filters/ | 2026-03-28 18:10 | - | |
| image-flashing/ | 2026-03-28 18:09 | - | |
| image-format/ | 2026-03-28 18:09 | - | |
| image-layers/ | 2026-03-28 18:09 | - | |
| image-optimization/ | 2026-03-28 18:09 | - | |
| image-processing/ | 2026-03-28 18:09 | - | |
| image-resizer/ | 2026-03-28 18:09 | - | |
| image-thumbnails/ | 2026-03-28 18:09 | - | |
| image-to-ascii/ | 2026-03-28 18:10 | - | |
| image-upscaling/ | 2026-03-28 18:10 | - | |
| image-viewer/ | 2026-03-28 18:09 | - | |
| image-watermark/ | 2026-03-28 18:09 | - | |
| image.db/ | 2026-03-28 18:09 | - | |
| image/ | 2026-03-28 18:09 | - | |
| image analysis/ | 2026-03-28 18:09 | - | |
| imageanalysis/ | 2026-03-28 18:09 | - | |
| imageanalyzing/ | 2026-03-28 18:09 | - | |
| imagecomparison&analysistool/ | 2026-03-28 18:10 | - | |
| image comparison/ | 2026-03-28 18:09 | - | |
| imagecomparisonanalysistool/ | 2026-03-28 18:10 | - | |
| imagecomparisonandanalysistool/ | 2026-03-28 18:10 | - | |
| imagecompressing/ | 2026-03-28 18:09 | - | |
| imagecompression/ | 2026-03-28 18:09 | - | |
| imagecompressor/ | 2026-03-28 18:09 | - | |
| image converter/ | 2026-03-28 18:09 | - | |
| imageconverter/ | 2026-03-28 18:09 | - | |
| imageconverting/ | 2026-03-28 18:09 | - | |
| imageextraction/ | 2026-03-28 18:09 | - | |
| imagefilemetadata/ | 2026-03-28 18:09 | - | |
| imagefilerecovery/ | 2026-03-28 18:09 | - | |
| imagefiles/ | 2026-03-28 18:09 | - | |
| imagefiletypes/ | 2026-03-28 18:09 | - | |
| imagej/ | 2026-03-28 18:09 | - | |
| imagemagick/ | 2026-03-28 18:09 | - | |
| imagemetadata/ | 2026-03-28 18:09 | - | |
| imagen/ | 2026-03-28 18:09 | - | |
| imageoptimization/ | 2026-03-28 18:09 | - | |
| imagepreviews/ | 2026-03-28 18:09 | - | |
| image processing software/ | 2026-03-28 18:10 | - | |
| imager/ | 2026-03-28 18:09 | - | |
| imageresizer/ | 2026-03-28 18:09 | - | |
| images/ | 2026-03-28 18:09 | - | |
| imagetester/ | 2026-03-28 18:10 | - | |
| imagethumbnails/ | 2026-03-28 18:09 | - | |
| imaging/ | 2026-03-28 18:09 | - | |
| imap/ | 2026-03-28 18:09 | - | |
| ime/ | 2026-03-28 18:09 | - | |
| imessage/ | 2026-03-28 18:09 | - | |
| img/ | 2026-03-28 18:09 | - | |
| immich-api/ | 2026-03-28 18:10 | - | |
| immich-cli/ | 2026-03-28 18:10 | - | |
| immich/ | 2026-03-28 18:09 | - | |
| imperative-language/ | 2026-03-28 18:09 | - | |
| imperatorrome/ | 2026-03-28 18:09 | - | |
| impersonate/ | 2026-03-28 18:09 | - | |
| imphash/ | 2026-03-28 18:09 | - | |
| import/ | 2026-03-28 18:09 | - | |
| importer/ | 2026-03-28 18:09 | - | |
| impossible-spaces/ | 2026-03-28 18:09 | - | |
| improve-quality/ | 2026-03-28 18:09 | - | |
| improved/ | 2026-03-28 18:09 | - | |
| ims-mdu/ | 2026-03-28 18:09 | - | |
| ims/ | 2026-03-28 18:09 | - | |
| in-cell-charts/ | 2026-03-28 18:09 | - | |
| in-line-diffs/ | 2026-03-28 18:10 | - | |
| in-memory/ | 2026-03-28 18:10 | - | |
| incremental/ | 2026-03-28 18:09 | - | |
| indent/ | 2026-03-28 18:09 | - | |
| indentation/ | 2026-03-28 18:09 | - | |
| independent-combinatorial-testing/ | 2026-03-28 18:09 | - | |
| index/ | 2026-03-28 18:09 | - | |
| indexer/ | 2026-03-28 18:09 | - | |
| indexing/ | 2026-03-28 18:09 | - | |
| indirect-display/ | 2026-03-28 18:09 | - | |
| individual-speakers/ | 2026-03-28 18:10 | - | |
| individualspeakers/ | 2026-03-28 18:10 | - | |
| inf/ | 2026-03-28 18:09 | - | |
| inference/ | 2026-03-28 18:09 | - | |
| influxdb/ | 2026-03-28 18:09 | - | |
| info/ | 2026-03-28 18:09 | - | |
| infographic/ | 2026-03-28 18:09 | - | |
| information-retrieval/ | 2026-03-28 18:09 | - | |
| information-security/ | 2026-03-28 18:09 | - | |
| information/ | 2026-03-28 18:09 | - | |
| infosec/ | 2026-03-28 18:09 | - | |
| infra-as-code/ | 2026-03-28 18:10 | - | |
| infrastructure-as-code/ | 2026-03-28 18:09 | - | |
| infrastructure/ | 2026-03-28 18:09 | - | |
| ini/ | 2026-03-28 18:09 | - | |
| injection/ | 2026-03-28 18:09 | - | |
| ink/ | 2026-03-28 18:09 | - | |
| inline-preview/ | 2026-03-28 18:09 | - | |
| inno-extractor/ | 2026-03-28 18:09 | - | |
| inno-setup-exe-files/ | 2026-03-28 18:09 | - | |
| inno-setup/ | 2026-03-28 18:09 | - | |
| inno/ | 2026-03-28 18:10 | - | |
| innoextracting/ | 2026-03-28 18:09 | - | |
| innosetup/ | 2026-03-28 18:09 | - | |
| innosetupexefiles/ | 2026-03-28 18:09 | - | |
| innounp/ | 2026-03-28 18:09 | - | |
| innounpacker/ | 2026-03-28 18:09 | - | |
| innounpacking/ | 2026-03-28 18:09 | - | |
| inoreader/ | 2026-03-28 18:09 | - | |
| inplaceupgrades/ | 2026-03-28 18:09 | - | |
| input-leap/ | 2026-03-28 18:09 | - | |
| input-method/ | 2026-03-28 18:09 | - | |
| input-simulation/ | 2026-03-28 18:09 | - | |
| input/ | 2026-03-28 18:09 | - | |
| insert-text/ | 2026-03-28 18:09 | - | |
| insert/ | 2026-03-28 18:09 | - | |
| insignia/ | 2026-03-28 18:09 | - | |
| inso-cli/ | 2026-03-28 18:09 | - | |
| inso/ | 2026-03-28 18:09 | - | |
| insomnia-core/ | 2026-03-28 18:09 | - | |
| insomnia/ | 2026-03-28 18:09 | - | |
| inspect/ | 2026-03-28 18:09 | - | |
| inspector/ | 2026-03-28 18:09 | - | |
| inspire/ | 2026-03-28 18:10 | - | |
| inspiron/ | 2026-03-28 18:09 | - | |
| insta360-link/ | 2026-03-28 18:10 | - | |
| insta360/ | 2026-03-28 18:09 | - | |
| instagram-client/ | 2026-03-28 18:09 | - | |
| instagram-downloader/ | 2026-03-28 18:09 | - | |
| instagram-feed/ | 2026-03-28 18:09 | - | |
| instagram-metadata/ | 2026-03-28 18:09 | - | |
| instagram-photos/ | 2026-03-28 18:09 | - | |
| instagram-scraper/ | 2026-03-28 18:09 | - | |
| instagram-stories/ | 2026-03-28 18:09 | - | |
| instagram-user-photos/ | 2026-03-28 18:09 | - | |
| instagram/ | 2026-03-28 18:09 | - | |
| install-script/ | 2026-03-28 18:09 | - | |
| install/ | 2026-03-28 18:09 | - | |
| install_script.exe-flags/ | 2026-03-28 18:09 | - | |
| installation/ | 2026-03-28 18:09 | - | |
| installationparameters/ | 2026-03-28 18:10 | - | |
| installcabfiles/ | 2026-03-28 18:09 | - | |
| installer-script/ | 2026-03-28 18:10 | - | |
| installer/ | 2026-03-28 18:09 | - | |
| installers/ | 2026-03-28 18:09 | - | |
| installerscriptflags/ | 2026-03-28 18:09 | - | |
| installerswitches/ | 2026-03-28 18:10 | - | |
| instaloader/ | 2026-03-28 18:09 | - | |
| instant-messaging/ | 2026-03-28 18:09 | - | |
| instructor/ | 2026-03-28 18:10 | - | |
| instrument/ | 2026-03-28 18:10 | - | |
| instrumentation/ | 2026-03-28 18:09 | - | |
| instruments/ | 2026-03-28 18:10 | - | |
| integer-programming/ | 2026-03-28 18:09 | - | |
| integer/ | 2026-03-28 18:09 | - | |
| integral-image/ | 2026-03-28 18:09 | - | |
| integration-testing/ | 2026-03-28 18:10 | - | |
| integrity/ | 2026-03-28 18:09 | - | |
| intel-12th-gen/ | 2026-03-28 18:09 | - | |
| intel-13th-gen/ | 2026-03-28 18:09 | - | |
| intel-alder-lake/ | 2026-03-28 18:09 | - | |
| intel-cpus/ | 2026-03-28 18:09 | - | |
| intel-ema-platform-manager/ | 2026-03-28 18:09 | - | |
| intel-endpoint-management-assistant/ | 2026-03-28 18:09 | - | |
| intel-processors/ | 2026-03-28 18:09 | - | |
| intel-raptor-lake/ | 2026-03-28 18:09 | - | |
| intel-ssu/ | 2026-03-28 18:09 | - | |
| intel-system-support-utility/ | 2026-03-28 18:09 | - | |
| intel/ | 2026-03-28 18:09 | - | |
| intel12thgen/ | 2026-03-28 18:09 | - | |
| intel13thgen/ | 2026-03-28 18:09 | - | |
| intelalderlake/ | 2026-03-28 18:09 | - | |
| intelcpus/ | 2026-03-28 18:09 | - | |
| intelemaplatformmanager/ | 2026-03-28 18:09 | - | |
| intelendpointmanagementassistant/ | 2026-03-28 18:09 | - | |
| intelligentethernetadapters/ | 2026-03-28 18:09 | - | |
| intellihawk intellivision colecovision/ | 2026-03-28 18:10 | - | |
| intellij/ | 2026-03-28 18:09 | - | |
| intelprocessors/ | 2026-03-28 18:09 | - | |
| intelraptorlake/ | 2026-03-28 18:09 | - | |
| intelssu/ | 2026-03-28 18:09 | - | |
| intelsystemsupportutility/ | 2026-03-28 18:09 | - | |
| interactive/ | 2026-03-28 18:09 | - | |
| intercal/ | 2026-03-28 18:09 | - | |
| interception-driver/ | 2026-03-28 18:09 | - | |
| interface/ | 2026-03-28 18:09 | - | |
| interior-design/ | 2026-03-28 18:09 | - | |
| interior/ | 2026-03-28 18:09 | - | |
| intermedia/ | 2026-03-28 18:10 | - | |
| internal-exe-files/ | 2026-03-28 18:09 | - | |
| internationalization/ | 2026-03-28 18:09 | - | |
| internet-banking/ | 2026-03-28 18:10 | - | |
| internet-browser/ | 2026-03-28 18:09 | - | |
| internet-connections/ | 2026-03-28 18:10 | - | |
| internet-engineering-task-force/ | 2026-03-28 18:09 | - | |
| internet-explorer/ | 2026-03-28 18:09 | - | |
| internet-freedom/ | 2026-03-28 18:10 | - | |
| internet-of-things/ | 2026-03-28 18:10 | - | |
| internet-service-provider-bypass/ | 2026-03-28 18:10 | - | |
| internet-speed/ | 2026-03-28 18:09 | - | |
| internet-tethering/ | 2026-03-28 18:09 | - | |
| internet-video-downloader/ | 2026-03-28 18:09 | - | |
| internet/ | 2026-03-28 18:09 | - | |
| internetconnections/ | 2026-03-28 18:10 | - | |
| internetengineeringtaskforce/ | 2026-03-28 18:09 | - | |
| internetofthings/ | 2026-03-28 18:09 | - | |
| internetproxy/ | 2026-03-28 18:09 | - | |
| internetserviceproviderbypass/ | 2026-03-28 18:10 | - | |
| internettethering/ | 2026-03-28 18:09 | - | |
| interoperability/ | 2026-03-28 18:09 | - | |
| interpreter/ | 2026-03-28 18:09 | - | |
| interval-timer/ | 2026-03-28 18:09 | - | |
| intiface/ | 2026-03-28 18:09 | - | |
| intranet/ | 2026-03-28 18:09 | - | |
| intrusion-detection/ | 2026-03-28 18:09 | - | |
| intune/ | 2026-03-28 18:09 | - | |
| inventory/ | 2026-03-28 18:09 | - | |
| inventur/ | 2026-03-28 18:09 | - | |
| invisibleinternetproject/ | 2026-03-28 18:09 | - | |
| invoice/ | 2026-03-28 18:09 | - | |
| invoices-pdf/ | 2026-03-28 18:10 | - | |
| invoices/ | 2026-03-28 18:10 | - | |
| invoicing-billing-accounting-taxes/ | 2026-03-28 18:09 | - | |
| ion/ | 2026-03-28 18:10 | - | |
| ionmonkey/ | 2026-03-28 18:09 | - | |
| ios-backup-viewer/ | 2026-03-28 18:09 | - | |
| ios-backups/ | 2026-03-28 18:09 | - | |
| ios/ | 2026-03-28 18:09 | - | |
| ios1/ | 2026-03-28 18:09 | - | |
| ios2/ | 2026-03-28 18:09 | - | |
| ios3/ | 2026-03-28 18:09 | - | |
| iot/ | 2026-03-28 18:09 | - | |
| ip-address-lookup/ | 2026-03-28 18:09 | - | |
| ip-address/ | 2026-03-28 18:09 | - | |
| ip-cam/ | 2026-03-28 18:09 | - | |
| ip-camera/ | 2026-03-28 18:09 | - | |
| ip-changer/ | 2026-03-28 18:09 | - | |
| ip-filtering/ | 2026-03-28 18:09 | - | |
| ip-lookup/ | 2026-03-28 18:09 | - | |
| ip-messenger/ | 2026-03-28 18:10 | - | |
| ip-scanner/ | 2026-03-28 18:09 | - | |
| ip-viewer/ | 2026-03-28 18:09 | - | |
| ip/ | 2026-03-28 18:09 | - | |
| ipad/ | 2026-03-28 18:09 | - | |
| ipaddresses/ | 2026-03-28 18:09 | - | |
| ipados/ | 2026-03-28 18:09 | - | |
| ipblocking/ | 2026-03-28 18:09 | - | |
| ipbx/ | 2026-03-28 18:09 | - | |
| ipchat/ | 2026-03-28 18:10 | - | |
| iperf/ | 2026-03-28 18:09 | - | |
| iperf3/ | 2026-03-28 18:09 | - | |
| ipfilter/ | 2026-03-28 18:09 | - | |
| ipfs/ | 2026-03-28 18:09 | - | |
| iphone/ | 2026-03-28 18:09 | - | |
| iphoneapps/ | 2026-03-28 18:09 | - | |
| ipmsg/ | 2026-03-28 18:10 | - | |
| ipod/ | 2026-03-28 18:09 | - | |
| iprint&scan/ | 2026-03-28 18:09 | - | |
| ips/ | 2026-03-28 18:09 | - | |
| iptc/ | 2026-03-28 18:09 | - | |
| iptv-player/ | 2026-03-28 18:09 | - | |
| iptv/ | 2026-03-28 18:09 | - | |
| ipv4/ | 2026-03-28 18:09 | - | |
| ipv6/ | 2026-03-28 18:09 | - | |
| ipxe/ | 2026-03-28 18:10 | - | |
| ipython/ | 2026-03-28 18:10 | - | |
| iracing/ | 2026-03-28 18:10 | - | |
| irc-client/ | 2026-03-28 18:09 | - | |
| irc/ | 2026-03-28 18:09 | - | |
| iriver/ | 2026-03-28 18:10 | - | |
| iron-browser/ | 2026-03-28 18:10 | - | |
| ironbrowser/ | 2026-03-28 18:10 | - | |
| irrecorder/ | 2026-03-28 18:09 | - | |
| isbn/ | 2026-03-28 18:09 | - | |
| isdb/ | 2026-03-28 18:10 | - | |
| isf/ | 2026-03-28 18:10 | - | |
| ishachar/ | 2026-03-28 18:09 | - | |
| islam/ | 2026-03-28 18:09 | - | |
| islamic/ | 2026-03-28 18:10 | - | |
| island/ | 2026-03-28 18:09 | - | |
| isn-autoit-studio/ | 2026-03-28 18:09 | - | |
| isn-studio/ | 2026-03-28 18:09 | - | |
| isnaidd64.inf/ | 2026-03-28 18:09 | - | |
| isnasta.inf/ | 2026-03-28 18:09 | - | |
| iso-2022-jp iso-2022-kr/ | 2026-03-28 18:09 | - | |
| iso-8859/ | 2026-03-28 18:09 | - | |
| iso-burner/ | 2026-03-28 18:09 | - | |
| iso-files/ | 2026-03-28 18:09 | - | |
| iso-manager/ | 2026-03-28 18:10 | - | |
| iso-to-cso/ | 2026-03-28 18:10 | - | |
| iso/ | 2026-03-28 18:09 | - | |
| iso14443/ | 2026-03-28 18:10 | - | |
| iso14443a/ | 2026-03-28 18:10 | - | |
| iso15693/ | 2026-03-28 18:10 | - | |
| iso18181/ | 2026-03-28 18:09 | - | |
| isochronic/ | 2026-03-28 18:10 | - | |
| isofile/ | 2026-03-28 18:10 | - | |
| isofiles/ | 2026-03-28 18:09 | - | |
| isometric/ | 2026-03-28 18:09 | - | |
| isotocso/ | 2026-03-28 18:10 | - | |
| isousb.inf/ | 2026-03-28 18:09 | - | |
| isp-bypass/ | 2026-03-28 18:10 | - | |
| iss-files/ | 2026-03-28 18:09 | - | |
| issue-tracker/ | 2026-03-28 18:09 | - | |
| issue-tracking/ | 2026-03-28 18:10 | - | |
| isv/ | 2026-03-28 18:09 | - | |
| isystem/ | 2026-03-28 18:10 | - | |
| it-support/ | 2026-03-28 18:09 | - | |
| iterm/ | 2026-03-28 18:09 | - | |
| itksnap/ | 2026-03-28 18:09 | - | |
| its-mine/ | 2026-03-28 18:10 | - | |
| itunes-backup-viewer/ | 2026-03-28 18:09 | - | |
| itunes-backups/ | 2026-03-28 18:09 | - | |
| itunes/ | 2026-03-28 18:09 | - | |
| ivpn/ | 2026-03-28 18:09 | - | |
| ja3/ | 2026-03-28 18:09 | - | |
| jabber/ | 2026-03-28 18:09 | - | |
| jabrabcdfu.inf/ | 2026-03-28 18:10 | - | |
| jabraengage/ | 2026-03-28 18:10 | - | |
| jabraevolve2/ | 2026-03-28 18:10 | - | |
| jabralink/ | 2026-03-28 18:10 | - | |
| jabrapanacast/ | 2026-03-28 18:10 | - | |
| jabraperform/ | 2026-03-28 18:10 | - | |
| jackbox-party-pack/ | 2026-03-28 18:09 | - | |
| jackbox-tv/ | 2026-03-28 18:09 | - | |
| jackbox/ | 2026-03-28 18:09 | - | |
| jackboxgames/ | 2026-03-28 18:09 | - | |
| jacoco/ | 2026-03-28 18:09 | - | |
| jaeger/ | 2026-03-28 18:09 | - | |
| jailbreak/ | 2026-03-28 18:09 | - | |
| jak/ | 2026-03-28 18:10 | - | |
| jakubpařez/ | 2026-03-28 18:09 | - | |
| jam-sessions/ | 2026-03-28 18:09 | - | |
| jam/ | 2026-03-28 18:09 | - | |
| jamulus/ | 2026-03-28 18:09 | - | |
| japanese-mahjong/ | 2026-03-28 18:09 | - | |
| japanese/ | 2026-03-28 18:09 | - | |
| jarkviewer/ | 2026-03-28 18:09 | - | |
| jarsigner/ | 2026-03-28 18:10 | - | |
| java-swing/ | 2026-03-28 18:10 | - | |
| java/ | 2026-03-28 18:09 | - | |
| javafx-application/ | 2026-03-28 18:09 | - | |
| javafx-desktop-apps/ | 2026-03-28 18:09 | - | |
| javafx/ | 2026-03-28 18:09 | - | |
| javascript-runtime/ | 2026-03-28 18:09 | - | |
| javascript/ | 2026-03-28 18:09 | - | |
| javascriptcore/ | 2026-03-28 18:10 | - | |
| jaws/ | 2026-03-28 18:09 | - | |
| jaypee-college-noida-india/ | 2026-03-28 18:09 | - | |
| jaypeecollegenoidaindia/ | 2026-03-28 18:09 | - | |
| jaypeeinstituteofinformationtechnology/ | 2026-03-28 18:09 | - | |
| jaysmitomukherjee/ | 2026-03-28 18:09 | - | |
| jazz-jackrabbit/ | 2026-03-28 18:09 | - | |
| jbox/ | 2026-03-28 18:09 | - | |
| jca365/ | 2026-03-28 18:09 | - | |
| jca366/ | 2026-03-28 18:09 | - | |
| jchem/ | 2026-03-28 18:09 | - | |
| jd-gui/ | 2026-03-28 18:09 | - | |
| jd/ | 2026-03-28 18:09 | - | |
| jdk/ | 2026-03-28 18:09 | - | |
| jellyfin-client/ | 2026-03-28 18:09 | - | |
| jellyfin-ffmpeg/ | 2026-03-28 18:09 | - | |
| jellyfin/ | 2026-03-28 18:09 | - | |
| jest/ | 2026-03-28 18:09 | - | |
| jesus/ | 2026-03-28 18:09 | - | |
| jet-set-radio/ | 2026-03-28 18:09 | - | |
| jetbrains-mono/ | 2026-03-28 18:09 | - | |
| jetbrains/ | 2026-03-28 18:09 | - | |
| jetpack-compose/ | 2026-03-28 18:10 | - | |
| jfrog/ | 2026-03-28 18:09 | - | |
| jfxchess/ | 2026-03-28 18:10 | - | |
| jiit/ | 2026-03-28 18:09 | - | |
| jira/ | 2026-03-28 18:09 | - | |
| jit-compiler/ | 2026-03-28 18:10 | - | |
| jit/ | 2026-03-28 18:09 | - | |
| jitsi-meet/ | 2026-03-28 18:09 | - | |
| jitsi/ | 2026-03-28 18:09 | - | |
| jj/ | 2026-03-28 18:09 | - | |
| jjgtechnologies/ | 2026-03-28 18:09 | - | |
| jnizm-hash-calc/ | 2026-03-28 18:09 | - | |
| jnlp/ | 2026-03-28 18:09 | - | |
| job-scheduling/ | 2026-03-28 18:09 | - | |
| join-files/ | 2026-03-28 18:09 | - | |
| join/ | 2026-03-28 18:10 | - | |
| journal/ | 2026-03-28 18:09 | - | |
| journaling/ | 2026-03-28 18:09 | - | |
| journey-to-the-center-of-hawkthorne/ | 2026-03-28 18:09 | - | |
| joystick/ | 2026-03-28 18:09 | - | |
| jp2/ | 2026-03-28 18:09 | - | |
| jpeg-encoder/ | 2026-03-28 18:10 | - | |
| jpeg-snoop/ | 2026-03-28 18:09 | - | |
| jpeg-xl/ | 2026-03-28 18:09 | - | |
| jpeg-xr/ | 2026-03-28 18:09 | - | |
| jpeg/ | 2026-03-28 18:09 | - | |
| jpegoptim/ | 2026-03-28 18:10 | - | |
| jpegxl/ | 2026-03-28 18:09 | - | |
| jpg/ | 2026-03-28 18:09 | - | |
| jpgsnoop/ | 2026-03-28 18:09 | - | |
| jpgxl/ | 2026-03-28 18:09 | - | |
| jq/ | 2026-03-28 18:09 | - | |
| jquery/ | 2026-03-28 18:09 | - | |
| jrds/ | 2026-03-28 18:09 | - | |
| jre/ | 2026-03-28 18:09 | - | |
| jreleaser/ | 2026-03-28 18:09 | - | |
| jriver/ | 2026-03-28 18:09 | - | |
| js-shell/ | 2026-03-28 18:09 | - | |
| js/ | 2026-03-28 18:09 | - | |
| json-data/ | 2026-03-28 18:09 | - | |
| json-inspector/ | 2026-03-28 18:09 | - | |
| json-lint/ | 2026-03-28 18:10 | - | |
| json-parser/ | 2026-03-28 18:09 | - | |
| json-rpc/ | 2026-03-28 18:09 | - | |
| json-schema/ | 2026-03-28 18:10 | - | |
| json/ | 2026-03-28 18:09 | - | |
| jsonpath/ | 2026-03-28 18:10 | - | |
| jsx/ | 2026-03-28 18:09 | - | |
| jtag/ | 2026-03-28 18:10 | - | |
| juce/ | 2026-03-28 18:09 | - | |
| juice/ | 2026-03-28 18:09 | - | |
| juicity/ | 2026-03-28 18:10 | - | |
| juju/ | 2026-03-28 18:09 | - | |
| jujutsu/ | 2026-03-28 18:09 | - | |
| jukebox/ | 2026-03-28 18:10 | - | |
| julia/ | 2026-03-28 18:09 | - | |
| jumboframes/ | 2026-03-28 18:09 | - | |
| jump/ | 2026-03-28 18:10 | - | |
| jumpnrun/ | 2026-03-28 18:09 | - | |
| junction-links/ | 2026-03-28 18:09 | - | |
| junction-point/ | 2026-03-28 18:10 | - | |
| junction/ | 2026-03-28 18:09 | - | |
| junctionlinks/ | 2026-03-28 18:09 | - | |
| junit/ | 2026-03-28 18:10 | - | |
| junk/ | 2026-03-28 18:09 | - | |
| jupyter-notebook/ | 2026-03-28 18:09 | - | |
| jupyter/ | 2026-03-28 18:09 | - | |
| jupyterlab-desktop/ | 2026-03-28 18:09 | - | |
| jvm-languages/ | 2026-03-28 18:09 | - | |
| jvm/ | 2026-03-28 18:09 | - | |
| jwt/ | 2026-03-28 18:09 | - | |
| jxl/ | 2026-03-28 18:09 | - | |
| k-lite/ | 2026-03-28 18:09 | - | |
| k0s/ | 2026-03-28 18:09 | - | |
| k3s/ | 2026-03-28 18:09 | - | |
| k6/ | 2026-03-28 18:09 | - | |
| k8s-cluster/ | 2026-03-28 18:09 | - | |
| k8s/ | 2026-03-28 18:09 | - | |
| k9s/ | 2026-03-28 18:09 | - | |
| kad/ | 2026-03-28 18:09 | - | |
| kaddressbook/ | 2026-03-28 18:09 | - | |
| kafka-client/ | 2026-03-28 18:09 | - | |
| kafka-clients/ | 2026-03-28 18:09 | - | |
| kafka-connector/ | 2026-03-28 18:09 | - | |
| kafka-gui-client/ | 2026-03-28 18:09 | - | |
| kafka-gui/ | 2026-03-28 18:09 | - | |
| kafka/ | 2026-03-28 18:09 | - | |
| kafkagui/ | 2026-03-28 18:09 | - | |
| kaha/ | 2026-03-28 18:09 | - | |
| kahla/ | 2026-03-28 18:09 | - | |
| kaitai-struct/ | 2026-03-28 18:09 | - | |
| kakoune/ | 2026-03-28 18:09 | - | |
| kaku/ | 2026-03-28 18:09 | - | |
| kanata/ | 2026-03-28 18:09 | - | |
| kanban/ | 2026-03-28 18:09 | - | |
| kanji/ | 2026-03-28 18:09 | - | |
| kantai/ | 2026-03-28 18:10 | - | |
| kapacitor/ | 2026-03-28 18:09 | - | |
| karaoke/ | 2026-03-28 18:09 | - | |
| kasse/ | 2026-03-28 18:09 | - | |
| kassensoftware/ | 2026-03-28 18:09 | - | |
| katex/ | 2026-03-28 18:09 | - | |
| kattis/ | 2026-03-28 18:09 | - | |
| kb890830/ | 2026-03-28 18:09 | - | |
| kb891716/ | 2026-03-28 18:09 | - | |
| kb5034510/ | 2026-03-28 18:09 | - | |
| kcleditor/ | 2026-03-28 18:09 | - | |
| kdbx/ | 2026-03-28 18:09 | - | |
| kde-iso-image-writer/ | 2026-03-28 18:09 | - | |
| kde-plasma/ | 2026-03-28 18:09 | - | |
| kde/ | 2026-03-28 18:09 | - | |
| kdeisoimagewriter/ | 2026-03-28 18:09 | - | |
| kdiff/ | 2026-03-28 18:09 | - | |
| kdiff3/ | 2026-03-28 18:09 | - | |
| keep/ | 2026-03-28 18:10 | - | |
| keepachangelog/ | 2026-03-28 18:10 | - | |
| keepass/ | 2026-03-28 18:09 | - | |
| kernel-mode/ | 2026-03-28 18:09 | - | |
| kernel/ | 2026-03-28 18:10 | - | |
| key-pair/ | 2026-03-28 18:09 | - | |
| key-rings/ | 2026-03-28 18:10 | - | |
| key-value/ | 2026-03-28 18:09 | - | |
| key/ | 2026-03-28 18:09 | - | |
| keybind/ | 2026-03-28 18:09 | - | |
| keybinding/ | 2026-03-28 18:10 | - | |
| keybindings/ | 2026-03-28 18:10 | - | |
| keybinds/ | 2026-03-28 18:09 | - | |
| keyboard-emulation/ | 2026-03-28 18:09 | - | |
| keyboard-layout/ | 2026-03-28 18:09 | - | |
| keyboard-shortcut/ | 2026-03-28 18:10 | - | |
| keyboard-shortcuts/ | 2026-03-28 18:09 | - | |
| keyboard-sounds/ | 2026-03-28 18:10 | - | |
| keyboard/ | 2026-03-28 18:09 | - | |
| keyboardinput/ | 2026-03-28 18:10 | - | |
| keyboardlayouts/ | 2026-03-28 18:09 | - | |
| keyboardmanager/ | 2026-03-28 18:09 | - | |
| keyboardshortcuts/ | 2026-03-28 18:09 | - | |
| keycaps/ | 2026-03-28 18:10 | - | |
| keychain/ | 2026-03-28 18:09 | - | |
| keymap/ | 2026-03-28 18:09 | - | |
| keymapper/ | 2026-03-28 18:09 | - | |
| keymapping/ | 2026-03-28 18:10 | - | |
| keypass/ | 2026-03-28 18:09 | - | |
| keypuncher-wiinupro/ | 2026-03-28 18:09 | - | |
| keypuncher.wiinupro/ | 2026-03-28 18:09 | - | |
| keypuncherwiinupro/ | 2026-03-28 18:09 | - | |
| keyrings/ | 2026-03-28 18:10 | - | |
| keysight/ | 2026-03-28 18:09 | - | |
| keystore/ | 2026-03-28 18:10 | - | |
| keystroke/ | 2026-03-28 18:09 | - | |
| keytool/ | 2026-03-28 18:10 | - | |
| keyvault/ | 2026-03-28 18:09 | - | |
| keyword-search/ | 2026-03-28 18:09 | - | |
| kibana/ | 2026-03-28 18:10 | - | |
| kichiku/ | 2026-03-28 18:10 | - | |
| kids/ | 2026-03-28 18:09 | - | |
| killdisk/ | 2026-03-28 18:09 | - | |
| kimi/ | 2026-03-28 18:09 | - | |
| kindle/ | 2026-03-28 18:09 | - | |
| kineticavionic/ | 2026-03-28 18:09 | - | |
| kinonivad.inf/ | 2026-03-28 18:09 | - | |
| kinonivd.inf/ | 2026-03-28 18:09 | - | |
| kinvolk/ | 2026-03-28 18:09 | - | |
| kiosk-software/ | 2026-03-28 18:10 | - | |
| kiosk/ | 2026-03-28 18:10 | - | |
| kisstnc/ | 2026-03-28 18:09 | - | |
| kitsu/ | 2026-03-28 18:09 | - | |
| kiwix-js-windows/ | 2026-03-28 18:09 | - | |
| kiwix-js/ | 2026-03-28 18:09 | - | |
| kiwix/ | 2026-03-28 18:09 | - | |
| kiwixjs/ | 2026-03-28 18:09 | - | |
| klc/ | 2026-03-28 18:09 | - | |
| klite-basic/ | 2026-03-28 18:09 | - | |
| klite-full/ | 2026-03-28 18:09 | - | |
| klite-mega/ | 2026-03-28 18:09 | - | |
| klite-standard/ | 2026-03-28 18:09 | - | |
| klite/ | 2026-03-28 18:09 | - | |
| kmail/ | 2026-03-28 18:09 | - | |
| kmeans/ | 2026-03-28 18:09 | - | |
| kmp-app/ | 2026-03-28 18:10 | - | |
| kmp/ | 2026-03-28 18:10 | - | |
| kneeboard/ | 2026-03-28 18:09 | - | |
| knowledge-base/ | 2026-03-28 18:09 | - | |
| knowledge-graph/ | 2026-03-28 18:10 | - | |
| knowledge/ | 2026-03-28 18:09 | - | |
| knowledgebase/ | 2026-03-28 18:10 | - | |
| koa2/ | 2026-03-28 18:10 | - | |
| kobo/ | 2026-03-28 18:09 | - | |
| kodi/ | 2026-03-28 18:10 | - | |
| komoreb-gui/ | 2026-03-28 18:09 | - | |
| komorebi/ | 2026-03-28 18:09 | - | |
| konten/ | 2026-03-28 18:09 | - | |
| kooyoseb/ | 2026-03-28 18:09 | - | |
| kopi/ | 2026-03-28 18:09 | - | |
| koreader/ | 2026-03-28 18:09 | - | |
| korean/ | 2026-03-28 18:09 | - | |
| korganizer/ | 2026-03-28 18:09 | - | |
| kotlin/ | 2026-03-28 18:09 | - | |
| kpn/ | 2026-03-28 18:09 | - | |
| kps/ | 2026-03-28 18:09 | - | |
| kql/ | 2026-03-28 18:09 | - | |
| kreditinstitute/ | 2026-03-28 18:09 | - | |
| krita/ | 2026-03-28 18:09 | - | |
| krunker/ | 2026-03-28 18:09 | - | |
| krunkerio/ | 2026-03-28 18:09 | - | |
| ksm-u/ | 2026-03-28 18:09 | - | |
| kts/ | 2026-03-28 18:09 | - | |
| kubeconfig/ | 2026-03-28 18:10 | - | |
| kubectl-plugins/ | 2026-03-28 18:09 | - | |
| kubectl/ | 2026-03-28 18:09 | - | |
| kubernetes-cli/ | 2026-03-28 18:09 | - | |
| kubernetes-cluster/ | 2026-03-28 18:09 | - | |
| kubernetes-clusters/ | 2026-03-28 18:09 | - | |
| kubernetes-dashboard/ | 2026-03-28 18:09 | - | |
| kubernetes-deployment/ | 2026-03-28 18:09 | - | |
| kubernetes-gui/ | 2026-03-28 18:09 | - | |
| kubernetes-plugin/ | 2026-03-28 18:09 | - | |
| kubernetes-setup/ | 2026-03-28 18:09 | - | |
| kubernetes-ui/ | 2026-03-28 18:09 | - | |
| kubernetes/ | 2026-03-28 18:09 | - | |
| kudu/ | 2026-03-28 18:09 | - | |
| kugou-music/ | 2026-03-28 18:09 | - | |
| kugou/ | 2026-03-28 18:09 | - | |
| kusto/ | 2026-03-28 18:09 | - | |
| kustomize/ | 2026-03-28 18:09 | - | |
| kuwo-music/ | 2026-03-28 18:09 | - | |
| kvm-framerelay/ | 2026-03-28 18:09 | - | |
| kvm/ | 2026-03-28 18:09 | - | |
| kvmfr/ | 2026-03-28 18:09 | - | |
| kwmusic/ | 2026-03-28 18:09 | - | |
| kwok/ | 2026-03-28 18:09 | - | |
| löve/ | 2026-03-28 18:09 | - | |
| l-band/ | 2026-03-28 18:09 | - | |
| l10n/ | 2026-03-28 18:09 | - | |
| la-noire/ | 2026-03-28 18:09 | - | |
| lab-machine-hyperv/ | 2026-03-28 18:09 | - | |
| labadvisor/ | 2026-03-28 18:10 | - | |
| label/ | 2026-03-28 18:09 | - | |
| labelary/ | 2026-03-28 18:10 | - | |
| labelmanager-280/ | 2026-03-28 18:09 | - | |
| labelmanager-420p/ | 2026-03-28 18:09 | - | |
| labelmanager-450/ | 2026-03-28 18:10 | - | |
| labelmanager-450d/ | 2026-03-28 18:10 | - | |
| labelmanager-500ts/ | 2026-03-28 18:09 | - | |
| labelmanager-pcii/ | 2026-03-28 18:10 | - | |
| labelmanager-pnp/ | 2026-03-28 18:09 | - | |
| labelmanager-wireless-pnp/ | 2026-03-28 18:10 | - | |
| labelpoint-350/ | 2026-03-28 18:10 | - | |
| labelwriter-4xl/ | 2026-03-28 18:09 | - | |
| labelwriter-400-turbo/ | 2026-03-28 18:10 | - | |
| labelwriter-400/ | 2026-03-28 18:10 | - | |
| labelwriter-450-duo/ | 2026-03-28 18:09 | - | |
| labelwriter-450-turbo/ | 2026-03-28 18:09 | - | |
| labelwriter-450-twin-turbo/ | 2026-03-28 18:09 | - | |
| labelwriter-450/ | 2026-03-28 18:09 | - | |
| labelwriter-duo/ | 2026-03-28 18:10 | - | |
| labelwriter-twin-turbo/ | 2026-03-28 18:10 | - | |
| labelwriter-wireless/ | 2026-03-28 18:09 | - | |
| labelwriter/ | 2026-03-28 18:09 | - | |
| labx/ | 2026-03-28 18:10 | - | |
| lager/ | 2026-03-28 18:09 | - | |
| lagoon/ | 2026-03-28 18:09 | - | |
| laihua/ | 2026-03-28 18:09 | - | |
| laipic/ | 2026-03-28 18:09 | - | |
| lambda/ | 2026-03-28 18:09 | - | |
| lame/ | 2026-03-28 18:09 | - | |
| lamps/ | 2026-03-28 18:10 | - | |
| lan-device-detections/ | 2026-03-28 18:09 | - | |
| lan-filesharing/ | 2026-03-28 18:09 | - | |
| lan-networking/ | 2026-03-28 18:09 | - | |
| lan/ | 2026-03-28 18:09 | - | |
| language-learning/ | 2026-03-28 18:09 | - | |
| language-server-protocol/ | 2026-03-28 18:09 | - | |
| language-server/ | 2026-03-28 18:09 | - | |
| language/ | 2026-03-28 18:09 | - | |
| languages/ | 2026-03-28 18:09 | - | |
| lanoire/ | 2026-03-28 18:09 | - | |
| lapce/ | 2026-03-28 18:10 | - | |
| laps/ | 2026-03-28 18:09 | - | |
| laptop/ | 2026-03-28 18:09 | - | |
| laravel/ | 2026-03-28 18:09 | - | |
| large-language-model/ | 2026-03-28 18:09 | - | |
| large-language-models/ | 2026-03-28 18:09 | - | |
| large-page-support/ | 2026-03-28 18:09 | - | |
| large-ram-pages/ | 2026-03-28 18:09 | - | |
| largeaddressaware/ | 2026-03-28 18:10 | - | |
| largepagesupport/ | 2026-03-28 18:09 | - | |
| laser-cutting/ | 2026-03-28 18:09 | - | |
| laser-engraving/ | 2026-03-28 18:09 | - | |
| laser/ | 2026-03-28 18:09 | - | |
| lastfm/ | 2026-03-28 18:09 | - | |
| latency-analysis/ | 2026-03-28 18:09 | - | |
| latency-monitor/ | 2026-03-28 18:10 | - | |
| latency/ | 2026-03-28 18:09 | - | |
| latex-editor/ | 2026-03-28 18:10 | - | |
| latex/ | 2026-03-28 18:09 | - | |
| latitude/ | 2026-03-28 18:09 | - | |
| launcher-application/ | 2026-03-28 18:09 | - | |
| launcher/ | 2026-03-28 18:09 | - | |
| launchy/ | 2026-03-28 18:09 | - | |
| lav/ | 2026-03-28 18:10 | - | |
| lavalink/ | 2026-03-28 18:10 | - | |
| layers/ | 2026-03-28 18:09 | - | |
| layout/ | 2026-03-28 18:09 | - | |
| layouts/ | 2026-03-28 18:09 | - | |
| lazap/ | 2026-03-28 18:09 | - | |
| lazarus/ | 2026-03-28 18:09 | - | |
| lcm/ | 2026-03-28 18:10 | - | |
| lcov/ | 2026-03-28 18:09 | - | |
| ldap/ | 2026-03-28 18:09 | - | |
| lead/ | 2026-03-28 18:09 | - | |
| leafletjs/ | 2026-03-28 18:09 | - | |
| league-of-legends/ | 2026-03-28 18:09 | - | |
| league/ | 2026-03-28 18:09 | - | |
| leagueoflegends/ | 2026-03-28 18:09 | - | |
| lean/ | 2026-03-28 18:09 | - | |
| learn/ | 2026-03-28 18:09 | - | |
| learning/ | 2026-03-28 18:09 | - | |
| lecture/ | 2026-03-28 18:09 | - | |
| lecturer/ | 2026-03-28 18:10 | - | |
| led-lights/ | 2026-03-28 18:09 | - | |
| led/ | 2026-03-28 18:09 | - | |
| ledger/ | 2026-03-28 18:09 | - | |
| ledlights/ | 2026-03-28 18:09 | - | |
| left-speaker/ | 2026-03-28 18:10 | - | |
| lefthook/ | 2026-03-28 18:09 | - | |
| leftovers/ | 2026-03-28 18:09 | - | |
| leftspeaker/ | 2026-03-28 18:10 | - | |
| legacy-runtime-libraries/ | 2026-03-28 18:09 | - | |
| legacyruntimelibraries/ | 2026-03-28 18:09 | - | |
| legcord/ | 2026-03-28 18:10 | - | |
| legends-of-runeterra/ | 2026-03-28 18:09 | - | |
| legion/ | 2026-03-28 18:09 | - | |
| lego/ | 2026-03-28 18:09 | - | |
| lemmings/ | 2026-03-28 18:09 | - | |
| lenovo/ | 2026-03-28 18:09 | - | |
| lenovodisplay.inf/ | 2026-03-28 18:09 | - | |
| lenovodriveraudio.inf/ | 2026-03-28 18:09 | - | |
| lenovodriverhid.inf/ | 2026-03-28 18:09 | - | |
| lens/ | 2026-03-28 18:09 | - | |
| leptos/ | 2026-03-28 18:09 | - | |
| less/ | 2026-03-28 18:10 | - | |
| lesson/ | 2026-03-28 18:09 | - | |
| letsencrypt/ | 2026-03-28 18:09 | - | |
| level-editor/ | 2026-03-28 18:09 | - | |
| leveldb/ | 2026-03-28 18:10 | - | |
| levilamina/ | 2026-03-28 18:09 | - | |
| lexibar/ | 2026-03-28 18:09 | - | |
| lg/ | 2026-03-28 18:09 | - | |
| lghub/ | 2026-03-28 18:09 | - | |
| lgtv/ | 2026-03-28 18:10 | - | |
| lha/ | 2026-03-28 18:09 | - | |
| lhm/ | 2026-03-28 18:09 | - | |
| lhw/ | 2026-03-28 18:09 | - | |
| libadwaita/ | 2026-03-28 18:09 | - | |
| libclang/ | 2026-03-28 18:09 | - | |
| liberica/ | 2026-03-28 18:09 | - | |
| libgdx/ | 2026-03-28 18:09 | - | |
| libgen/ | 2026-03-28 18:09 | - | |
| libimobiledevice/ | 2026-03-28 18:09 | - | |
| libjpeg/ | 2026-03-28 18:09 | - | |
| libmediainfo/ | 2026-03-28 18:10 | - | |
| libndi/ | 2026-03-28 18:09 | - | |
| libopus-1.3/ | 2026-03-28 18:09 | - | |
| libp2p/ | 2026-03-28 18:10 | - | |
| libpng/ | 2026-03-28 18:09 | - | |
| libraries/ | 2026-03-28 18:09 | - | |
| library-genesis/ | 2026-03-28 18:09 | - | |
| library/ | 2026-03-28 18:09 | - | |
| libre-hardware-monitor/ | 2026-03-28 18:09 | - | |
| libre/ | 2026-03-28 18:10 | - | |
| librefancontrol/ | 2026-03-28 18:10 | - | |
| librefm/ | 2026-03-28 18:09 | - | |
| librehardwaremonitor/ | 2026-03-28 18:10 | - | |
| libretranslate/ | 2026-03-28 18:10 | - | |
| libretro/ | 2026-03-28 18:09 | - | |
| librhash/ | 2026-03-28 18:10 | - | |
| libsensors/ | 2026-03-28 18:10 | - | |
| libtorrent/ | 2026-03-28 18:09 | - | |
| libtwlpy/ | 2026-03-28 18:10 | - | |
| libusb-win32/ | 2026-03-28 18:09 | - | |
| libusb/ | 2026-03-28 18:09 | - | |
| libusb0.sys/ | 2026-03-28 18:09 | - | |
| libusbk.dll/ | 2026-03-28 18:09 | - | |
| libusbk.sys/ | 2026-03-28 18:09 | - | |
| libusbk/ | 2026-03-28 18:09 | - | |
| libwdi/ | 2026-03-28 18:09 | - | |
| libwiipy/ | 2026-03-28 18:10 | - | |
| license-compliance/ | 2026-03-28 18:10 | - | |
| license/ | 2026-03-28 18:09 | - | |
| licensemanager/ | 2026-03-28 18:09 | - | |
| licensing/ | 2026-03-28 18:10 | - | |
| lichess/ | 2026-03-28 18:09 | - | |
| lidarr/ | 2026-03-28 18:10 | - | |
| life/ | 2026-03-28 18:09 | - | |
| liferay/ | 2026-03-28 18:09 | - | |
| lifesimulator/ | 2026-03-28 18:10 | - | |
| lifestyle/ | 2026-03-28 18:09 | - | |
| lifetime/ | 2026-03-28 18:09 | - | |
| lifx-light/ | 2026-03-28 18:09 | - | |
| lifx/ | 2026-03-28 18:09 | - | |
| light-control/ | 2026-03-28 18:09 | - | |
| light-effects/ | 2026-03-28 18:09 | - | |
| light-gbm/ | 2026-03-28 18:09 | - | |
| light-gradient-boosting-machine/ | 2026-03-28 18:09 | - | |
| light-mode/ | 2026-03-28 18:09 | - | |
| light-switch/ | 2026-03-28 18:09 | - | |
| light-theme/ | 2026-03-28 18:09 | - | |
| light/ | 2026-03-28 18:09 | - | |
| lightbulb/ | 2026-03-28 18:10 | - | |
| lightburn/ | 2026-03-28 18:09 | - | |
| lighteffects/ | 2026-03-28 18:09 | - | |
| lightfx/ | 2026-03-28 18:10 | - | |
| lightgradientboostingmachine/ | 2026-03-28 18:09 | - | |
| lighting-controller/ | 2026-03-28 18:09 | - | |
| lighting-effects/ | 2026-03-28 18:09 | - | |
| lighting-strips/ | 2026-03-28 18:09 | - | |
| lighting/ | 2026-03-28 18:09 | - | |
| lightingeffects/ | 2026-03-28 18:09 | - | |
| lightmode/ | 2026-03-28 18:09 | - | |
| lightness/ | 2026-03-28 18:09 | - | |
| lightning/ | 2026-03-28 18:09 | - | |
| lightpack/ | 2026-03-28 18:10 | - | |
| lightroom/ | 2026-03-28 18:10 | - | |
| lights/ | 2026-03-28 18:09 | - | |
| lightscreen/ | 2026-03-28 18:09 | - | |
| lightstrips/ | 2026-03-28 18:10 | - | |
| lighttable/ | 2026-03-28 18:09 | - | |
| lightweight/ | 2026-03-28 18:09 | - | |
| likee/ | 2026-03-28 18:09 | - | |
| lime/ | 2026-03-28 18:09 | - | |
| limesdr/ | 2026-03-28 18:09 | - | |
| limit-resources/ | 2026-03-28 18:10 | - | |
| limiter/ | 2026-03-28 18:10 | - | |
| line-of-business/ | 2026-03-28 18:09 | - | |
| linear-programming/ | 2026-03-28 18:09 | - | |
| linearb-test/ | 2026-03-28 18:09 | - | |
| lingoes/ | 2026-03-28 18:09 | - | |
| lingva/ | 2026-03-28 18:10 | - | |
| link-checker/ | 2026-03-28 18:09 | - | |
| link-checkers/ | 2026-03-28 18:09 | - | |
| link-checking/ | 2026-03-28 18:09 | - | |
| link/ | 2026-03-28 18:09 | - | |
| linq/ | 2026-03-28 18:09 | - | |
| linstor/ | 2026-03-28 18:10 | - | |
| lint/ | 2026-03-28 18:09 | - | |
| lintcode/ | 2026-03-28 18:09 | - | |
| linter/ | 2026-03-28 18:09 | - | |
| linters/ | 2026-03-28 18:09 | - | |
| linting/ | 2026-03-28 18:09 | - | |
| linux-app/ | 2026-03-28 18:09 | - | |
| linux-cleaner/ | 2026-03-28 18:09 | - | |
| linux-desktop/ | 2026-03-28 18:09 | - | |
| linux-subsystem/ | 2026-03-28 18:09 | - | |
| linux-vendor-firmware-service/ | 2026-03-28 18:09 | - | |
| linux/ | 2026-03-28 18:09 | - | |
| linuxdo/ | 2026-03-28 18:10 | - | |
| linuxvendorfirmwareservice/ | 2026-03-28 18:09 | - | |
| lip/ | 2026-03-28 18:09 | - | |
| lisk/ | 2026-03-28 18:10 | - | |
| lisp/ | 2026-03-28 18:09 | - | |
| list-files/ | 2026-03-28 18:09 | - | |
| list/ | 2026-03-28 18:09 | - | |
| listary/ | 2026-03-28 18:09 | - | |
| listen/ | 2026-03-28 18:09 | - | |
| listenbrainz/ | 2026-03-28 18:09 | - | |
| lite-xl/ | 2026-03-28 18:09 | - | |
| lite/ | 2026-03-28 18:10 | - | |
| litecoin/ | 2026-03-28 18:09 | - | |
| litedb-studio/ | 2026-03-28 18:09 | - | |
| litedb/ | 2026-03-28 18:09 | - | |
| literature/ | 2026-03-28 18:09 | - | |
| live-captions/ | 2026-03-28 18:09 | - | |
| live-cd/ | 2026-03-28 18:10 | - | |
| live-chat/ | 2026-03-28 18:09 | - | |
| live-dwnloader/ | 2026-03-28 18:09 | - | |
| live-proctoring/ | 2026-03-28 18:10 | - | |
| live-recovery/ | 2026-03-28 18:09 | - | |
| live-reload/ | 2026-03-28 18:10 | - | |
| live-sound/ | 2026-03-28 18:10 | - | |
| live-streaming/ | 2026-03-28 18:09 | - | |
| live-usb/ | 2026-03-28 18:10 | - | |
| live-video/ | 2026-03-28 18:09 | - | |
| live-wallpaper/ | 2026-03-28 18:09 | - | |
| live-wallpapers-on-windows/ | 2026-03-28 18:10 | - | |
| live-wallpapers/ | 2026-03-28 18:10 | - | |
| live/ | 2026-03-28 18:09 | - | |
| live2d/ | 2026-03-28 18:09 | - | |
| livepreview/ | 2026-03-28 18:09 | - | |
| livereload/ | 2026-03-28 18:10 | - | |
| livestream/ | 2026-03-28 18:09 | - | |
| live streaming/ | 2026-03-28 18:10 | - | |
| livestreaming/ | 2026-03-28 18:09 | - | |
| liveview/ | 2026-03-28 18:09 | - | |
| livewallpaper/ | 2026-03-28 18:10 | - | |
| lizard/ | 2026-03-28 18:09 | - | |
| llama/ | 2026-03-28 18:09 | - | |
| llama3/ | 2026-03-28 18:09 | - | |
| llama4/ | 2026-03-28 18:09 | - | |
| llamacpp/ | 2026-03-28 18:09 | - | |
| llava/ | 2026-03-28 18:09 | - | |
| lld/ | 2026-03-28 18:10 | - | |
| lldb/ | 2026-03-28 18:10 | - | |
| lldp/ | 2026-03-28 18:09 | - | |
| llf/ | 2026-03-28 18:09 | - | |
| llm-agent/ | 2026-03-28 18:09 | - | |
| llm-inference/ | 2026-03-28 18:10 | - | |
| llm/ | 2026-03-28 18:09 | - | |
| llms/ | 2026-03-28 18:09 | - | |
| llvm/ | 2026-03-28 18:09 | - | |
| lmstudio/ | 2026-03-28 18:09 | - | |
| load-balancer/ | 2026-03-28 18:09 | - | |
| load-balancing/ | 2026-03-28 18:09 | - | |
| load-testing/ | 2026-03-28 18:09 | - | |
| load/ | 2026-03-28 18:10 | - | |
| loader/ | 2026-03-28 18:09 | - | |
| load testing/ | 2026-03-28 18:09 | - | |
| lobster/ | 2026-03-28 18:09 | - | |
| local-ai/ | 2026-03-28 18:09 | - | |
| local-area-network/ | 2026-03-28 18:09 | - | |
| local-development/ | 2026-03-28 18:09 | - | |
| local-first/ | 2026-03-28 18:09 | - | |
| local-llm/ | 2026-03-28 18:09 | - | |
| local-music-player/ | 2026-03-28 18:09 | - | |
| local-music/ | 2026-03-28 18:09 | - | |
| local-network-chat-windows/ | 2026-03-28 18:10 | - | |
| local-network/ | 2026-03-28 18:10 | - | |
| local-storage/ | 2026-03-28 18:09 | - | |
| local/ | 2026-03-28 18:09 | - | |
| localazy/ | 2026-03-28 18:10 | - | |
| localgrouppolicy/ | 2026-03-28 18:09 | - | |
| localhost/ | 2026-03-28 18:09 | - | |
| localisation/ | 2026-03-28 18:10 | - | |
| localization/ | 2026-03-28 18:09 | - | |
| localllama/ | 2026-03-28 18:09 | - | |
| localllm/ | 2026-03-28 18:09 | - | |
| localmultiplayer/ | 2026-03-28 18:09 | - | |
| locate/ | 2026-03-28 18:09 | - | |
| location/ | 2026-03-28 18:09 | - | |
| lock/ | 2026-03-28 18:09 | - | |
| lockdown-browser/ | 2026-03-28 18:10 | - | |
| lockdown/ | 2026-03-28 18:10 | - | |
| locked-files/ | 2026-03-28 18:10 | - | |
| locked-folders/ | 2026-03-28 18:10 | - | |
![[DIR]](/icons/binary.gif) | lockoutstatus.exe/ | 2026-03-28 18:09 | - | |
| log-analysis/ | 2026-03-28 18:10 | - | |
| log-analytics/ | 2026-03-28 18:10 | - | |
| log-analyzer/ | 2026-03-28 18:10 | - | |
| log-explorer/ | 2026-03-28 18:10 | - | |
| log-file-viewer/ | 2026-03-28 18:09 | - | |
| log-files/ | 2026-03-28 18:09 | - | |
| log-management/ | 2026-03-28 18:10 | - | |
| log-monitor/ | 2026-03-28 18:10 | - | |
| log-search/ | 2026-03-28 18:10 | - | |
| log-viewer/ | 2026-03-28 18:09 | - | |
| log-visualization/ | 2026-03-28 18:10 | - | |
| log/ | 2026-03-28 18:09 | - | |
| log4cxx/ | 2026-03-28 18:10 | - | |
| log4j/ | 2026-03-28 18:10 | - | |
| log4net/ | 2026-03-28 18:10 | - | |
| logbook/ | 2026-03-28 18:10 | - | |
| logfiles/ | 2026-03-28 18:09 | - | |
| logfileviewer/ | 2026-03-28 18:09 | - | |
| logger-interface/ | 2026-03-28 18:10 | - | |
| logger/ | 2026-03-28 18:09 | - | |
| logging/ | 2026-03-28 18:09 | - | |
| logi-dock/ | 2026-03-28 18:09 | - | |
| logi/ | 2026-03-28 18:09 | - | |
| logi_joy_bus_enum.inf/ | 2026-03-28 18:09 | - | |
| logi_joy_vir_hid.inf/ | 2026-03-28 18:09 | - | |
| logi_lamparray_hid.inf/ | 2026-03-28 18:09 | - | |
| logi_lamparray_usb.inf/ | 2026-03-28 18:09 | - | |
| logic-analyzer/ | 2026-03-28 18:09 | - | |
| logic/ | 2026-03-28 18:09 | - | |
| login/ | 2026-03-28 18:09 | - | |
| logioptions/ | 2026-03-28 18:09 | - | |
| logisim/ | 2026-03-28 18:09 | - | |
| logitech/ | 2026-03-28 18:09 | - | |
| logonui/ | 2026-03-28 18:09 | - | |
| logs/ | 2026-03-28 18:09 | - | |
| logviewer/ | 2026-03-28 18:09 | - | |
| lokal/ | 2026-03-28 18:10 | - | |
| lokijs/ | 2026-03-28 18:10 | - | |
| lol/ | 2026-03-28 18:09 | - | |
| longmynd/ | 2026-03-28 18:10 | - | |
| longwave/ | 2026-03-28 18:09 | - | |
| loop-back-mixer/ | 2026-03-28 18:09 | - | |
| loops/ | 2026-03-28 18:09 | - | |
| lor/ | 2026-03-28 18:09 | - | |
| lorem-ipsum/ | 2026-03-28 18:09 | - | |
| lossless-compression-algorithm/ | 2026-03-28 18:09 | - | |
| lossless/ | 2026-03-28 18:09 | - | |
| lotw/ | 2026-03-28 18:09 | - | |
| loudness/ | 2026-03-28 18:09 | - | |
| lovable/ | 2026-03-28 18:09 | - | |
| low-code/ | 2026-03-28 18:09 | - | |
| low-latency-audio/ | 2026-03-28 18:09 | - | |
| low-level-format/ | 2026-03-28 18:09 | - | |
| low-poly/ | 2026-03-28 18:09 | - | |
| lpeg/ | 2026-03-28 18:09 | - | |
| lpeglabel/ | 2026-03-28 18:09 | - | |
| lr/ | 2026-03-28 18:10 | - | |
| ls/ | 2026-03-28 18:09 | - | |
| lsp-client/ | 2026-03-28 18:10 | - | |
| lsp-server/ | 2026-03-28 18:09 | - | |
| lsp/ | 2026-03-28 18:09 | - | |
| lstm/ | 2026-03-28 18:10 | - | |
| lsusb/ | 2026-03-28 18:10 | - | |
| lua/ | 2026-03-28 18:09 | - | |
| lua5.4/ | 2026-03-28 18:09 | - | |
| lua54/ | 2026-03-28 18:09 | - | |
| luajit/ | 2026-03-28 18:09 | - | |
| luarocks/ | 2026-03-28 18:09 | - | |
| luau/ | 2026-03-28 18:09 | - | |
| lucasarts/ | 2026-03-28 18:10 | - | |
| lucasfilm/ | 2026-03-28 18:10 | - | |
| lufs/ | 2026-03-28 18:09 | - | |
| lumiauefiblue.inf/ | 2026-03-28 18:10 | - | |
| luminance/ | 2026-03-28 18:10 | - | |
| luminescence software/ | 2026-03-28 18:10 | - | |
| lv2/ | 2026-03-28 18:09 | - | |
| lvfs/ | 2026-03-28 18:09 | - | |
| lxd/ | 2026-03-28 18:10 | - | |
| lyft-envoy/ | 2026-03-28 18:09 | - | |
| lync/ | 2026-03-28 18:09 | - | |
| lyric/ | 2026-03-28 18:10 | - | |
| lyrics/ | 2026-03-28 18:09 | - | |
| lz4/ | 2026-03-28 18:09 | - | |
| lz5/ | 2026-03-28 18:09 | - | |
| lzma/ | 2026-03-28 18:09 | - | |
| lzma2/ | 2026-03-28 18:09 | - | |
| m&m3/ | 2026-03-28 18:09 | - | |
| m-series/ | 2026-03-28 18:10 | - | |
| m.2/ | 2026-03-28 18:09 | - | |
| m2/ | 2026-03-28 18:09 | - | |
| m3u/ | 2026-03-28 18:09 | - | |
| m3u8-files/ | 2026-03-28 18:09 | - | |
| m3u8-recorder/ | 2026-03-28 18:09 | - | |
| m3u8-recording/ | 2026-03-28 18:09 | - | |
| m3u8-to-mp4/ | 2026-03-28 18:09 | - | |
| m3u8/ | 2026-03-28 18:09 | - | |
| m3u8downloader/ | 2026-03-28 18:09 | - | |
| m3u8files/ | 2026-03-28 18:09 | - | |
| m3u8recorder/ | 2026-03-28 18:09 | - | |
| m3u8recording/ | 2026-03-28 18:09 | - | |
| m3u8tomp4/ | 2026-03-28 18:09 | - | |
| m3u8webstreams/ | 2026-03-28 18:09 | - | |
| m4/ | 2026-03-28 18:09 | - | |
| m4b/ | 2026-03-28 18:09 | - | |
| m6/ | 2026-03-28 18:10 | - | |
| m24lr/ | 2026-03-28 18:10 | - | |
| m68k/ | 2026-03-28 18:09 | - | |
| m365/ | 2026-03-28 18:09 | - | |
| maa/ | 2026-03-28 18:09 | - | |
| maas/ | 2026-03-28 18:09 | - | |
| mac-address/ | 2026-03-28 18:10 | - | |
| mac-cleaner/ | 2026-03-28 18:09 | - | |
| mac/ | 2026-03-28 18:09 | - | |
| mach2/ | 2026-03-28 18:10 | - | |
| machine-learning/ | 2026-03-28 18:09 | - | |
| macho/ | 2026-03-28 18:09 | - | |
| macintosh/ | 2026-03-28 18:09 | - | |
| macos-app/ | 2026-03-28 18:09 | - | |
| macos/ | 2026-03-28 18:09 | - | |
| macro-editor/ | 2026-03-28 18:09 | - | |
| macro-recorder/ | 2026-03-28 18:09 | - | |
| macro/ | 2026-03-28 18:09 | - | |
| macros/ | 2026-03-28 18:09 | - | |
| made/ | 2026-03-28 18:09 | - | |
| madsonic/ | 2026-03-28 18:09 | - | |
| madvr/ | 2026-03-28 18:09 | - | |
| magazines/ | 2026-03-28 18:09 | - | |
| magento/ | 2026-03-28 18:09 | - | |
| magento2/ | 2026-03-28 18:09 | - | |
| magic-the-gathering/ | 2026-03-28 18:10 | - | |
| magic-wormhole/ | 2026-03-28 18:09 | - | |
| magic/ | 2026-03-28 18:09 | - | |
| magiccontrol/ | 2026-03-28 18:09 | - | |
| magichub/ | 2026-03-28 18:09 | - | |
| magick/ | 2026-03-28 18:09 | - | |
| magicos/ | 2026-03-28 18:09 | - | |
| magicui/ | 2026-03-28 18:09 | - | |
| magnet-link/ | 2026-03-28 18:10 | - | |
| magnet/ | 2026-03-28 18:09 | - | |
| magnetfile/ | 2026-03-28 18:10 | - | |
| magnetlink/ | 2026-03-28 18:10 | - | |
| magnification/ | 2026-03-28 18:09 | - | |
| magnifier/ | 2026-03-28 18:09 | - | |
| magnify/ | 2026-03-28 18:09 | - | |
| magpie/ | 2026-03-28 18:09 | - | |
| mahjong/ | 2026-03-28 18:09 | - | |
| mail-merge/ | 2026-03-28 18:10 | - | |
| mail-patcher/ | 2026-03-28 18:10 | - | |
| mail/ | 2026-03-28 18:09 | - | |
| mailbox/ | 2026-03-28 18:09 | - | |
| majora's-mask/ | 2026-03-28 18:09 | - | |
| majsoul-plus/ | 2026-03-28 18:09 | - | |
| majsoul/ | 2026-03-28 18:09 | - | |
| make-the-internet-great-again/ | 2026-03-28 18:10 | - | |
| make/ | 2026-03-28 18:09 | - | |
| makeappx/ | 2026-03-28 18:09 | - | |
| makefile/ | 2026-03-28 18:10 | - | |
| makemsix/ | 2026-03-28 18:10 | - | |
| makepri/ | 2026-03-28 18:09 | - | |
| maker/ | 2026-03-28 18:09 | - | |
| makernote/ | 2026-03-28 18:09 | - | |
| makrdown-it/ | 2026-03-28 18:10 | - | |
| malicious-software-removal-tool/ | 2026-03-28 18:09 | - | |
| malware-analysis/ | 2026-03-28 18:09 | - | |
| malware-detection/ | 2026-03-28 18:09 | - | |
| malware/ | 2026-03-28 18:09 | - | |
| mamba/ | 2026-03-28 18:09 | - | |
| mambaforge/ | 2026-03-28 18:10 | - | |
| mame arcade msxhawk atarijaguar/ | 2026-03-28 18:10 | - | |
| manage-remoteapps/ | 2026-03-28 18:09 | - | |
| manage/ | 2026-03-28 18:09 | - | |
| manageddirectx/ | 2026-03-28 18:09 | - | |
| management-studio/ | 2026-03-28 18:09 | - | |
| management-tools/ | 2026-03-28 18:09 | - | |
| management/ | 2026-03-28 18:09 | - | |
| manager/ | 2026-03-28 18:09 | - | |
| managing/ | 2026-03-28 18:10 | - | |
| manga-downloader/ | 2026-03-28 18:09 | - | |
| manga-reader/ | 2026-03-28 18:09 | - | |
| manga-viewer/ | 2026-03-28 18:10 | - | |
| manga/ | 2026-03-28 18:09 | - | |
| mangas/ | 2026-03-28 18:09 | - | |
| manifest/ | 2026-03-28 18:09 | - | |
| manifests-generator/ | 2026-03-28 18:09 | - | |
| manifestv2/ | 2026-03-28 18:09 | - | |
| manifestv3/ | 2026-03-28 18:09 | - | |
| manipulation/ | 2026-03-28 18:09 | - | |
| mantine-ui/ | 2026-03-28 18:10 | - | |
| manual/ | 2026-03-28 18:09 | - | |
| manufacturing/ | 2026-03-28 18:09 | - | |
| manwha/ | 2026-03-28 18:10 | - | |
| map/ | 2026-03-28 18:09 | - | |
| mapa/ | 2026-03-28 18:09 | - | |
| mapas/ | 2026-03-28 18:09 | - | |
| mapchart/ | 2026-03-28 18:09 | - | |
| mapi/ | 2026-03-28 18:09 | - | |
| maplesea/ | 2026-03-28 18:09 | - | |
| maplestory-sea/ | 2026-03-28 18:09 | - | |
| maplestorysea/ | 2026-03-28 18:09 | - | |
| mapper/ | 2026-03-28 18:10 | - | |
| mapping/ | 2026-03-28 18:09 | - | |
| maps/ | 2026-03-28 18:09 | - | |
| map updates/ | 2026-03-28 18:09 | - | |
| marblerolling/ | 2026-03-28 18:10 | - | |
| marc/ | 2026-03-28 18:09 | - | |
| mariadb/ | 2026-03-28 18:09 | - | |
| marine/ | 2026-03-28 18:10 | - | |
| mario/ | 2026-03-28 18:09 | - | |
| mariokartwii/ | 2026-03-28 18:09 | - | |
| mark/ | 2026-03-28 18:09 | - | |
| markdown-conversion/ | 2026-03-28 18:09 | - | |
| markdown-editor/ | 2026-03-28 18:09 | - | |
| markdown-preview/ | 2026-03-28 18:09 | - | |
| markdown-slides/ | 2026-03-28 18:09 | - | |
| markdown-viewer/ | 2026-03-28 18:09 | - | |
| markdown/ | 2026-03-28 18:09 | - | |
| markdownify/ | 2026-03-28 18:09 | - | |
| market/ | 2026-03-28 18:09 | - | |
| marketplace/ | 2026-03-28 18:09 | - | |
| marking-menu/ | 2026-03-28 18:09 | - | |
| markup/ | 2026-03-28 18:09 | - | |
| markwesker/ | 2026-03-28 18:09 | - | |
| marlin/ | 2026-03-28 18:10 | - | |
| marshalling/ | 2026-03-28 18:09 | - | |
| mart/ | 2026-03-28 18:09 | - | |
| martinvonz.jj/ | 2026-03-28 18:09 | - | |
| marvellfastlinq/ | 2026-03-28 18:09 | - | |
| marvellql41x6x-cna/ | 2026-03-28 18:09 | - | |
| marvellql45x6x-cna/ | 2026-03-28 18:09 | - | |
| marvellqle34xx/ | 2026-03-28 18:09 | - | |
| marvellqle84xx-cna/ | 2026-03-28 18:09 | - | |
| marvin/ | 2026-03-28 18:09 | - | |
| masixpackaging/ | 2026-03-28 18:10 | - | |
| mask/ | 2026-03-28 18:09 | - | |
| masks/ | 2026-03-28 18:10 | - | |
| mass-mailing/ | 2026-03-28 18:10 | - | |
| mass-spectrometry/ | 2026-03-28 18:10 | - | |
| mass/ | 2026-03-28 18:09 | - | |
| masterbootrecord/ | 2026-03-28 18:09 | - | |
| master data management/ | 2026-03-28 18:10 | - | |
| mastergo/ | 2026-03-28 18:09 | - | |
| mastering/ | 2026-03-28 18:09 | - | |
| mastodon-app/ | 2026-03-28 18:09 | - | |
| mastodon-client/ | 2026-03-28 18:09 | - | |
| mastodon/ | 2026-03-28 18:09 | - | |
| match-3/ | 2026-03-28 18:09 | - | |
| match-tree/ | 2026-03-28 18:09 | - | |
| match/ | 2026-03-28 18:09 | - | |
| match3/ | 2026-03-28 18:09 | - | |
| matchmaking/ | 2026-03-28 18:09 | - | |
| matchthree/ | 2026-03-28 18:09 | - | |
| matebook/ | 2026-03-28 18:09 | - | |
| matepath/ | 2026-03-28 18:10 | - | |
| material-design/ | 2026-03-28 18:09 | - | |
| material-maker/ | 2026-03-28 18:10 | - | |
| material-ui/ | 2026-03-28 18:09 | - | |
| material-you/ | 2026-03-28 18:09 | - | |
| material/ | 2026-03-28 18:09 | - | |
| material3/ | 2026-03-28 18:09 | - | |
| matestation/ | 2026-03-28 18:09 | - | |
| math-tool/ | 2026-03-28 18:10 | - | |
| math/ | 2026-03-28 18:09 | - | |
| matheditor/ | 2026-03-28 18:09 | - | |
| mathematica/ | 2026-03-28 18:09 | - | |
| mathematical-evaluator/ | 2026-03-28 18:09 | - | |
| mathematics/ | 2026-03-28 18:09 | - | |
| maths/ | 2026-03-28 18:09 | - | |
| matlab/ | 2026-03-28 18:09 | - | |
| matrix-client/ | 2026-03-28 18:09 | - | |
| matrix-org/ | 2026-03-28 18:09 | - | |
| matrix-rain-ch/ | 2026-03-28 18:09 | - | |
| matrix-rain/ | 2026-03-28 18:09 | - | |
| matrix/ | 2026-03-28 18:09 | - | |
| matrix operation/ | 2026-03-28 18:10 | - | |
| matroska/ | 2026-03-28 18:10 | - | |
| mattermost/ | 2026-03-28 18:10 | - | |
| maven/ | 2026-03-28 18:09 | - | |
| max-payne-3/ | 2026-03-28 18:09 | - | |
| maxhub/ | 2026-03-28 18:09 | - | |
| maxima/ | 2026-03-28 18:09 | - | |
| maximize/ | 2026-03-28 18:09 | - | |
| maximumtransmissionunit/ | 2026-03-28 18:09 | - | |
| maxis/ | 2026-03-28 18:10 | - | |
| maxpayne3/ | 2026-03-28 18:09 | - | |
| maya/ | 2026-03-28 18:09 | - | |
| mazecity/ | 2026-03-28 18:10 | - | |
| mbrpartitions/ | 2026-03-28 18:09 | - | |
| mbtiles/ | 2026-03-28 18:09 | - | |
| mbus/ | 2026-03-28 18:09 | - | |
| mc/ | 2026-03-28 18:09 | - | |
| mcatt-pattern-editor/ | 2026-03-28 18:09 | - | |
| mcattpatterneditor/ | 2026-03-28 18:09 | - | |
| mchose/ | 2026-03-28 18:09 | - | |
| mcmod/ | 2026-03-28 18:09 | - | |
| mcp-server/ | 2026-03-28 18:09 | - | |
| mcp/ | 2026-03-28 18:09 | - | |
| mcu/ | 2026-03-28 18:09 | - | |
| md/ | 2026-03-28 18:09 | - | |
| md2 md-2/ | 2026-03-28 18:09 | - | |
| md4/ | 2026-03-28 18:10 | - | |
| md4 md-4/ | 2026-03-28 18:09 | - | |
| md5-sha1/ | 2026-03-28 18:09 | - | |
| md5/ | 2026-03-28 18:09 | - | |
| md5 md-5/ | 2026-03-28 18:09 | - | |
| md5 md4 md2/ | 2026-03-28 18:10 | - | |
| md5sum/ | 2026-03-28 18:10 | - | |
| mdbook-plugins/ | 2026-03-28 18:09 | - | |
| mdf/ | 2026-03-28 18:10 | - | |
| mdict/ | 2026-03-28 18:09 | - | |
| mdns-sd/ | 2026-03-28 18:09 | - | |
| mdns/ | 2026-03-28 18:09 | - | |
| mdt/ | 2026-03-28 18:09 | - | |
| mdx/ | 2026-03-28 18:09 | - | |
| measure/ | 2026-03-28 18:09 | - | |
| measurement/ | 2026-03-28 18:09 | - | |
| measuring/ | 2026-03-28 18:09 | - | |
| mechanical-keyboard/ | 2026-03-28 18:10 | - | |
| media-art/ | 2026-03-28 18:10 | - | |
| media-center/ | 2026-03-28 18:09 | - | |
| media-conversion-tool/ | 2026-03-28 18:09 | - | |
| media-converter/ | 2026-03-28 18:09 | - | |
| media-downloader/ | 2026-03-28 18:09 | - | |
| media-foundation/ | 2026-03-28 18:09 | - | |
| media-player-classic/ | 2026-03-28 18:09 | - | |
| media-player-remote/ | 2026-03-28 18:10 | - | |
| media-player/ | 2026-03-28 18:09 | - | |
| media-preservation/ | 2026-03-28 18:10 | - | |
| media-processing/ | 2026-03-28 18:09 | - | |
| media-server/ | 2026-03-28 18:09 | - | |
| media-streamer/ | 2026-03-28 18:09 | - | |
| media-transcoder/ | 2026-03-28 18:09 | - | |
| media/ | 2026-03-28 18:09 | - | |
| media controls/ | 2026-03-28 18:09 | - | |
| mediainfo/ | 2026-03-28 18:10 | - | |
| mediaserver/ | 2026-03-28 18:09 | - | |
| mediawiki-api/ | 2026-03-28 18:10 | - | |
| mediawiki-client/ | 2026-03-28 18:10 | - | |
| mediawiki/ | 2026-03-28 18:09 | - | |
| medical-imaging/ | 2026-03-28 18:09 | - | |
| medical/ | 2026-03-28 18:09 | - | |
| medicine/ | 2026-03-28 18:09 | - | |
| meditation/ | 2026-03-28 18:09 | - | |
| mediumwave/ | 2026-03-28 18:09 | - | |
| mednafen/ | 2026-03-28 18:10 | - | |
| meet/ | 2026-03-28 18:09 | - | |
| meeting-minutes/ | 2026-03-28 18:09 | - | |
| meeting-notes/ | 2026-03-28 18:09 | - | |
| meeting/ | 2026-03-28 18:09 | - | |
| meetings/ | 2026-03-28 18:09 | - | |
| megadev/ | 2026-03-28 18:09 | - | |
| meinbergos/ | 2026-03-28 18:09 | - | |
| melody-extraction/ | 2026-03-28 18:09 | - | |
| melody/ | 2026-03-28 18:09 | - | |
| melonds nintendods nds 3ds 2ds/ | 2026-03-28 18:10 | - | |
| memcached/ | 2026-03-28 18:10 | - | |
| meme/ | 2026-03-28 18:09 | - | |
| memo/ | 2026-03-28 18:09 | - | |
| memorandum/ | 2026-03-28 18:09 | - | |
| memorize/ | 2026-03-28 18:10 | - | |
| memorizer/ | 2026-03-28 18:10 | - | |
| memory-cache/ | 2026-03-28 18:09 | - | |
| memory-cleaner/ | 2026-03-28 18:09 | - | |
| memory-database/ | 2026-03-28 18:09 | - | |
| memory-dumping/ | 2026-03-28 18:09 | - | |
| memory-leak/ | 2026-03-28 18:09 | - | |
| memory-management/ | 2026-03-28 18:09 | - | |
| memory-manager/ | 2026-03-28 18:09 | - | |
| memory-monitoring/ | 2026-03-28 18:09 | - | |
| memory-optimization/ | 2026-03-28 18:09 | - | |
| memory-optimizer/ | 2026-03-28 18:09 | - | |
| memory/ | 2026-03-28 18:09 | - | |
| memorydumping/ | 2026-03-28 18:09 | - | |
| memorymodules/ | 2026-03-28 18:09 | - | |
| memoryregisters/ | 2026-03-28 18:10 | - | |
| memurai/ | 2026-03-28 18:10 | - | |
| memvid/ | 2026-03-28 18:09 | - | |
| menu-bar/ | 2026-03-28 18:10 | - | |
| menu/ | 2026-03-28 18:09 | - | |
| menubar-app/ | 2026-03-28 18:10 | - | |
| menubar/ | 2026-03-28 18:10 | - | |
| mercurial/ | 2026-03-28 18:09 | - | |
| mercury/ | 2026-03-28 18:09 | - | |
| merge-files/ | 2026-03-28 18:09 | - | |
| merge-pdf/ | 2026-03-28 18:09 | - | |
| merge-tabs/ | 2026-03-28 18:10 | - | |
| merge/ | 2026-03-28 18:09 | - | |
| mergepartitions/ | 2026-03-28 18:09 | - | |
| mergetabs/ | 2026-03-28 18:10 | - | |
| merging/ | 2026-03-28 18:09 | - | |
| mermaid/ | 2026-03-28 18:10 | - | |
| mermaidjs/ | 2026-03-28 18:09 | - | |
| mersenne-twister/ | 2026-03-28 18:09 | - | |
| mesh-networks/ | 2026-03-28 18:10 | - | |
| mesh/ | 2026-03-28 18:09 | - | |
| meshgenerators/ | 2026-03-28 18:09 | - | |
| meson/ | 2026-03-28 18:09 | - | |
| message-bus/ | 2026-03-28 18:09 | - | |
| message-passing-interface-standard/ | 2026-03-28 18:09 | - | |
| message-queue/ | 2026-03-28 18:09 | - | |
| message/ | 2026-03-28 18:09 | - | |
| messagepassinginterfacestandard/ | 2026-03-28 18:09 | - | |
| messages/ | 2026-03-28 18:09 | - | |
| messaging-app/ | 2026-03-28 18:10 | - | |
| messaging-entities/ | 2026-03-28 18:10 | - | |
| messaging-services/ | 2026-03-28 18:10 | - | |
| messaging/ | 2026-03-28 18:09 | - | |
| messenger/ | 2026-03-28 18:09 | - | |
| met/ | 2026-03-28 18:09 | - | |
| meta/ | 2026-03-28 18:09 | - | |
| metadata-extraction/ | 2026-03-28 18:10 | - | |
| metadata/ | 2026-03-28 18:09 | - | |
| metapath/ | 2026-03-28 18:10 | - | |
| metaverse/ | 2026-03-28 18:09 | - | |
| meter/ | 2026-03-28 18:09 | - | |
| metrics/ | 2026-03-28 18:09 | - | |
| metro/ | 2026-03-28 18:09 | - | |
| metronome-wallet/ | 2026-03-28 18:09 | - | |
| metronome/ | 2026-03-28 18:09 | - | |
| mfa/ | 2026-03-28 18:09 | - | |
| mfc/ | 2026-03-28 18:09 | - | |
| mft/ | 2026-03-28 18:09 | - | |
| mgba gameboyadvance sameboy gbhawk gbc/ | 2026-03-28 18:10 | - | |
| mgbdevman/ | 2026-03-28 18:09 | - | |
| mhc/ | 2026-03-28 18:09 | - | |
| mhed/ | 2026-03-28 18:10 | - | |
| mi/ | 2026-03-28 18:10 | - | |
| mic/ | 2026-03-28 18:10 | - | |
| mica/ | 2026-03-28 18:09 | - | |
| mice-without-borders/ | 2026-03-28 18:09 | - | |
| mice/ | 2026-03-28 18:09 | - | |
| microarchitecture/ | 2026-03-28 18:09 | - | |
| microbit/ | 2026-03-28 18:09 | - | |
| microchip/ | 2026-03-28 18:09 | - | |
| microcontroller/ | 2026-03-28 18:09 | - | |
| microphone/ | 2026-03-28 18:09 | - | |
| microprocessor/ | 2026-03-28 18:10 | - | |
| microqrcode/ | 2026-03-28 18:10 | - | |
| microscope/ | 2026-03-28 18:10 | - | |
| microscopy/ | 2026-03-28 18:09 | - | |
| microservice/ | 2026-03-28 18:09 | - | |
| microservices-architecture/ | 2026-03-28 18:09 | - | |
| microservices/ | 2026-03-28 18:09 | - | |
| microsoft-app-control-policy-wizard/ | 2026-03-28 18:09 | - | |
| microsoft-app-control-wizard/ | 2026-03-28 18:09 | - | |
| microsoft-application-inspector/ | 2026-03-28 18:09 | - | |
| microsoft-applocker-policy-converter/ | 2026-03-28 18:09 | - | |
| microsoft-bluetooth-test-platform-pack/ | 2026-03-28 18:09 | - | |
| microsoft-btp/ | 2026-03-28 18:09 | - | |
| microsoft-dataverse/ | 2026-03-28 18:09 | - | |
| microsoft-defender-antivirus/ | 2026-03-28 18:09 | - | |
| microsoft-defender/ | 2026-03-28 18:10 | - | |
| microsoft-dynamics-crm/ | 2026-03-28 18:09 | - | |
| microsoft-dynamics/ | 2026-03-28 18:09 | - | |
| microsoft-firewire-1394-legacy-driver/ | 2026-03-28 18:09 | - | |
| microsoft-flight-simulator-2020/ | 2026-03-28 18:09 | - | |
| microsoft-flight-simulator/ | 2026-03-28 18:09 | - | |
| microsoft-hololens/ | 2026-03-28 18:10 | - | |
| microsoft-log-cheetah/ | 2026-03-28 18:09 | - | |
| microsoft-mpi/ | 2026-03-28 18:09 | - | |
| microsoft-multiple-interface-test-tool/ | 2026-03-28 18:09 | - | |
| microsoft-office/ | 2026-03-28 18:09 | - | |
| microsoft-powertoys/ | 2026-03-28 18:09 | - | |
| microsoft-safety-scanner/ | 2026-03-28 18:09 | - | |
| microsoft-screen-recorder/ | 2026-03-28 18:09 | - | |
| microsoft-sql-server/ | 2026-03-28 18:09 | - | |
| microsoft-sql/ | 2026-03-28 18:09 | - | |
| microsoft-store-apps/ | 2026-03-28 18:09 | - | |
| microsoft-store/ | 2026-03-28 18:09 | - | |
| microsoft-surface/ | 2026-03-28 18:10 | - | |
| microsoft-symcrypt-unit-test/ | 2026-03-28 18:09 | - | |
| microsoft-teams/ | 2026-03-28 18:09 | - | |
| microsoft-typography/ | 2026-03-28 18:09 | - | |
| microsoft-visual-truetype/ | 2026-03-28 18:09 | - | |
| microsoft-xaml-ui/ | 2026-03-28 18:09 | - | |
| microsoft-xna/ | 2026-03-28 18:09 | - | |
| microsoft.commandpalette/ | 2026-03-28 18:09 | - | |
| microsoft.xna.framework.dll/ | 2026-03-28 18:09 | - | |
| microsoft/ | 2026-03-28 18:09 | - | |
| microsoft365/ | 2026-03-28 18:09 | - | |
| microsoftappcontrolpolicywizard/ | 2026-03-28 18:09 | - | |
| microsoftappcontrolwizard/ | 2026-03-28 18:09 | - | |
| microsoftapplicationinspector/ | 2026-03-28 18:09 | - | |
| microsoftapplockerpolicyconverter/ | 2026-03-28 18:09 | - | |
| microsoftbluetoothtestplatformpack/ | 2026-03-28 18:09 | - | |
| microsoftbtp/ | 2026-03-28 18:09 | - | |
| microsoftdefenderantivirus/ | 2026-03-28 18:09 | - | |
| microsoftfabric/ | 2026-03-28 18:09 | - | |
| microsoftfirewire1394legacydriver/ | 2026-03-28 18:09 | - | |
| microsofthololens/ | 2026-03-28 18:10 | - | |
| microsoftlogcheetah/ | 2026-03-28 18:09 | - | |
| microsoftmpi/ | 2026-03-28 18:09 | - | |
| microsoftmultipleinterfacetesttool/ | 2026-03-28 18:09 | - | |
| microsoftoffice/ | 2026-03-28 18:09 | - | |
| microsoftoffice2013/ | 2026-03-28 18:10 | - | |
| microsoftoffice2016/ | 2026-03-28 18:10 | - | |
| microsoftonelake/ | 2026-03-28 18:09 | - | |
| microsoftsafetyscanner/ | 2026-03-28 18:09 | - | |
| microsoftscreenrecorder/ | 2026-03-28 18:09 | - | |
| microsoftstoreapps/ | 2026-03-28 18:09 | - | |
| microsoftsurface/ | 2026-03-28 18:10 | - | |
| microsoftsymcryptunittest/ | 2026-03-28 18:09 | - | |
| microsoftteamsplugin/ | 2026-03-28 18:10 | - | |
| microsofttypography/ | 2026-03-28 18:09 | - | |
| microsoftupdatecatalog/ | 2026-03-28 18:09 | - | |
| microsoftvisualtruetype/ | 2026-03-28 18:09 | - | |
| microsoftxna/ | 2026-03-28 18:09 | - | |
| microsync/ | 2026-03-28 18:09 | - | |
| midi-audio/ | 2026-03-28 18:09 | - | |
| midi-converter/ | 2026-03-28 18:09 | - | |
| midi-data/ | 2026-03-28 18:10 | - | |
| midi-editor/ | 2026-03-28 18:10 | - | |
| midi-file/ | 2026-03-28 18:09 | - | |
| midi-runtime/ | 2026-03-28 18:09 | - | |
| midi-sound/ | 2026-03-28 18:09 | - | |
| midi/ | 2026-03-28 18:09 | - | |
| midi1/ | 2026-03-28 18:09 | - | |
| midiaudio/ | 2026-03-28 18:09 | - | |
| mididata/ | 2026-03-28 18:10 | - | |
| midiruntime/ | 2026-03-28 18:09 | - | |
| midisound/ | 2026-03-28 18:09 | - | |
| midisrv.exe/ | 2026-03-28 18:09 | - | |
| mifare/ | 2026-03-28 18:10 | - | |
| might&magic3/ | 2026-03-28 18:09 | - | |
| mightandmagicIIIcomplete/ | 2026-03-28 18:09 | - | |
| migrate/ | 2026-03-28 18:09 | - | |
| migration/ | 2026-03-28 18:09 | - | |
| migrations/ | 2026-03-28 18:09 | - | |
| migu-music/ | 2026-03-28 18:09 | - | |
| migu/ | 2026-03-28 18:09 | - | |
| mihomo-party/ | 2026-03-28 18:09 | - | |
| mihomo/ | 2026-03-28 18:09 | - | |
| mikrotik-router/ | 2026-03-28 18:09 | - | |
| military-game/ | 2026-03-28 18:09 | - | |
| military/ | 2026-03-28 18:09 | - | |
| mind-map/ | 2026-03-28 18:09 | - | |
| mind-mapping/ | 2026-03-28 18:09 | - | |
| mindmap/ | 2026-03-28 18:09 | - | |
| mindmapping/ | 2026-03-28 18:09 | - | |
| mindstorms/ | 2026-03-28 18:09 | - | |
| minecraft-curseforge/ | 2026-03-28 18:09 | - | |
| minecraft-custom-launcher/ | 2026-03-28 18:09 | - | |
| minecraft-java-edition/ | 2026-03-28 18:10 | - | |
| minecraft-java/ | 2026-03-28 18:09 | - | |
| minecraft-launcher/ | 2026-03-28 18:09 | - | |
| minecraft-mod/ | 2026-03-28 18:09 | - | |
| minecraft-modrinth/ | 2026-03-28 18:09 | - | |
| minecraft-server/ | 2026-03-28 18:09 | - | |
| minecraft/ | 2026-03-28 18:09 | - | |
| minecraftdungeons/ | 2026-03-28 18:09 | - | |
| minecraftlegends/ | 2026-03-28 18:09 | - | |
| minesweeper/ | 2026-03-28 18:09 | - | |
| minetest/ | 2026-03-28 18:09 | - | |
| mingw-w64/ | 2026-03-28 18:09 | - | |
| mingw/ | 2026-03-28 18:09 | - | |
| mini-app/ | 2026-03-28 18:09 | - | |
| mini-game/ | 2026-03-28 18:09 | - | |
| mini-program/ | 2026-03-28 18:09 | - | |
| mini-programs/ | 2026-03-28 18:09 | - | |
| mini/ | 2026-03-28 18:09 | - | |
| miniconda/ | 2026-03-28 18:09 | - | |
| miniconda3/ | 2026-03-28 18:09 | - | |
| minidriver/ | 2026-03-28 18:10 | - | |
| minidump/ | 2026-03-28 18:10 | - | |
| minidv-tapes/ | 2026-03-28 18:10 | - | |
| minifier/ | 2026-03-28 18:10 | - | |
| miniforge/ | 2026-03-28 18:10 | - | |
| minigolf/ | 2026-03-28 18:09 | - | |
| minimal/ | 2026-03-28 18:09 | - | |
| minimalist/ | 2026-03-28 18:09 | - | |
| minimalistic/ | 2026-03-28 18:09 | - | |
| minimax/ | 2026-03-28 18:09 | - | |
| minimize-to-system-tray/ | 2026-03-28 18:09 | - | |
| minimize/ | 2026-03-28 18:09 | - | |
| minio/ | 2026-03-28 18:09 | - | |
| minion/ | 2026-03-28 18:10 | - | |
| minizinc/ | 2026-03-28 18:09 | - | |
| mintty/ | 2026-03-28 18:09 | - | |
| mips/ | 2026-03-28 18:09 | - | |
| mips64/ | 2026-03-28 18:09 | - | |
| mirics/ | 2026-03-28 18:09 | - | |
| miro/ | 2026-03-28 18:09 | - | |
| mirror/ | 2026-03-28 18:09 | - | |
| mirroring/ | 2026-03-28 18:09 | - | |
| misskey/ | 2026-03-28 18:09 | - | |
| mistral/ | 2026-03-28 18:09 | - | |
| mit/ | 2026-03-28 18:09 | - | |
| mitm-proxy/ | 2026-03-28 18:10 | - | |
| mitm/ | 2026-03-28 18:09 | - | |
| mitmproxy/ | 2026-03-28 18:09 | - | |
| mitre-attack/ | 2026-03-28 18:09 | - | |
| mittboards/ | 2026-03-28 18:09 | - | |
| miui/ | 2026-03-28 18:09 | - | |
| mixboard/ | 2026-03-28 18:10 | - | |
| mixer/ | 2026-03-28 18:09 | - | |
| mixing/ | 2026-03-28 18:09 | - | |
| mixingboard/ | 2026-03-28 18:10 | - | |
| mjpg/ | 2026-03-28 18:09 | - | |
| mklink/ | 2026-03-28 18:09 | - | |
| mkv-editor/ | 2026-03-28 18:09 | - | |
| mkv/ | 2026-03-28 18:09 | - | |
| mkvextract/ | 2026-03-28 18:09 | - | |
| mkvinfo/ | 2026-03-28 18:09 | - | |
| mkvmerge/ | 2026-03-28 18:09 | - | |
| mkvpropedit/ | 2026-03-28 18:09 | - | |
| ml/ | 2026-03-28 18:09 | - | |
| mm.inf/ | 2026-03-28 18:09 | - | |
| mmap/ | 2026-03-28 18:09 | - | |
| mmccards/ | 2026-03-28 18:09 | - | |
| mmo/ | 2026-03-28 18:09 | - | |
| mmorpg/ | 2026-03-28 18:09 | - | |
| mmorts/ | 2026-03-28 18:09 | - | |
| mndp/ | 2026-03-28 18:09 | - | |
| moarvm/ | 2026-03-28 18:10 | - | |
| mob/ | 2026-03-28 18:09 | - | |
| mobi/ | 2026-03-28 18:09 | - | |
| mobile-games/ | 2026-03-28 18:09 | - | |
| mobile-printing/ | 2026-03-28 18:10 | - | |
| mobile/ | 2026-03-28 18:09 | - | |
| mobileconfig/ | 2026-03-28 18:09 | - | |
| mobilephoneconnection/ | 2026-03-28 18:09 | - | |
| mobilerecovery.inf/ | 2026-03-28 18:10 | - | |
| mobx/ | 2026-03-28 18:09 | - | |
| mock-server/ | 2026-03-28 18:10 | - | |
| mocking/ | 2026-03-28 18:10 | - | |
| mockup/ | 2026-03-28 18:09 | - | |
| mod-launcher/ | 2026-03-28 18:09 | - | |
| mod-loader/ | 2026-03-28 18:09 | - | |
| mod-manager/ | 2026-03-28 18:09 | - | |
| mod-organizer/ | 2026-03-28 18:09 | - | |
| mod/ | 2026-03-28 18:09 | - | |
| modbus/ | 2026-03-28 18:09 | - | |
| modded/ | 2026-03-28 18:09 | - | |
| modding-tools/ | 2026-03-28 18:09 | - | |
| modding/ | 2026-03-28 18:09 | - | |
| mode-s/ | 2026-03-28 18:09 | - | |
| model-based-systems-engineering/ | 2026-03-28 18:09 | - | |
| model-context-protocol/ | 2026-03-28 18:09 | - | |
| model-railway/ | 2026-03-28 18:10 | - | |
| model-train/ | 2026-03-28 18:10 | - | |
| model/ | 2026-03-28 18:09 | - | |
| modelcontextprotocol/ | 2026-03-28 18:10 | - | |
| modeler/ | 2026-03-28 18:10 | - | |
| modeling-tool/ | 2026-03-28 18:09 | - | |
| modeling/ | 2026-03-28 18:09 | - | |
| modelio/ | 2026-03-28 18:09 | - | |
| modelling/ | 2026-03-28 18:09 | - | |
| models/ | 2026-03-28 18:09 | - | |
| modification/ | 2026-03-28 18:10 | - | |
| modlist/ | 2026-03-28 18:10 | - | |
| modloader/ | 2026-03-28 18:09 | - | |
| modpack/ | 2026-03-28 18:09 | - | |
| modplug/ | 2026-03-28 18:09 | - | |
| modrinth/ | 2026-03-28 18:09 | - | |
| mods/ | 2026-03-28 18:09 | - | |
| modstation/ | 2026-03-28 18:09 | - | |
| modules/ | 2026-03-28 18:09 | - | |
| modv/ | 2026-03-28 18:10 | - | |
| mojang/ | 2026-03-28 18:09 | - | |
| molecule/ | 2026-03-28 18:09 | - | |
| molecules/ | 2026-03-28 18:09 | - | |
| momdm.inf/ | 2026-03-28 18:09 | - | |
| moments/ | 2026-03-28 18:09 | - | |
| monaco-editor/ | 2026-03-28 18:09 | - | |
| monero/ | 2026-03-28 18:09 | - | |
| money-management/ | 2026-03-28 18:09 | - | |
| money-manager/ | 2026-03-28 18:10 | - | |
| money/ | 2026-03-28 18:09 | - | |
| mongo/ | 2026-03-28 18:09 | - | |
| mongodb/ | 2026-03-28 18:09 | - | |
| mongodump/ | 2026-03-28 18:09 | - | |
| mongoexport/ | 2026-03-28 18:09 | - | |
| mongofiles/ | 2026-03-28 18:09 | - | |
| mongoimport/ | 2026-03-28 18:09 | - | |
| mongoose/ | 2026-03-28 18:09 | - | |
| mongorestore/ | 2026-03-28 18:09 | - | |
| mongostat/ | 2026-03-28 18:09 | - | |
| mongotop/ | 2026-03-28 18:09 | - | |
| monitor-performance/ | 2026-03-28 18:10 | - | |
| monitor-recorder/ | 2026-03-28 18:09 | - | |
| monitor/ | 2026-03-28 18:09 | - | |
| monitoring/ | 2026-03-28 18:09 | - | |
| monitorrecorder/ | 2026-03-28 18:09 | - | |
| monitors/ | 2026-03-28 18:10 | - | |
| monitos/ | 2026-03-28 18:09 | - | |
| mono/ | 2026-03-28 18:09 | - | |
| monogame/ | 2026-03-28 18:09 | - | |
| monorepo/ | 2026-03-28 18:09 | - | |
| monster-hunter-rise/ | 2026-03-28 18:09 | - | |
| monster-hunter-wilds/ | 2026-03-28 18:09 | - | |
| monster-hunter-world/ | 2026-03-28 18:09 | - | |
| monte-carlo-simulations/ | 2026-03-28 18:09 | - | |
| monte-carlo/ | 2026-03-28 18:09 | - | |
| moodle/ | 2026-03-28 18:09 | - | |
| moonlight/ | 2026-03-28 18:09 | - | |
| more/ | 2026-03-28 18:09 | - | |
| morse-code/ | 2026-03-28 18:09 | - | |
| moser.inf/ | 2026-03-28 18:09 | - | |
| mosh/ | 2026-03-28 18:09 | - | |
| motccgp.inf/ | 2026-03-28 18:09 | - | |
| motherboard/ | 2026-03-28 18:09 | - | |
| motion-capture/ | 2026-03-28 18:09 | - | |
| motion-controls/ | 2026-03-28 18:09 | - | |
| motion/ | 2026-03-28 18:09 | - | |
| motioncontrols/ | 2026-03-28 18:09 | - | |
| motmodem.inf/ | 2026-03-28 18:09 | - | |
| motoandroid.inf/ | 2026-03-28 18:09 | - | |
| motoandroid2.inf/ | 2026-03-28 18:09 | - | |
| motocross/ | 2026-03-28 18:10 | - | |
| motodrv.inf/ | 2026-03-28 18:09 | - | |
| motousbnet.inf/ | 2026-03-28 18:09 | - | |
| motport.inf/ | 2026-03-28 18:09 | - | |
| motucoreuac.inf/ | 2026-03-28 18:10 | - | |
| motumseriesupdate.inf/ | 2026-03-28 18:10 | - | |
| motusbdevice.inf/ | 2026-03-28 18:09 | - | |
| motusbser.inf/ | 2026-03-28 18:09 | - | |
| mount/ | 2026-03-28 18:09 | - | |
| mountpoint/ | 2026-03-28 18:09 | - | |
| mouse-controls/ | 2026-03-28 18:09 | - | |
| mouse-emulation/ | 2026-03-28 18:09 | - | |
| mouse-movement/ | 2026-03-28 18:09 | - | |
| mouse-without-borders/ | 2026-03-28 18:09 | - | |
| mouse/ | 2026-03-28 18:09 | - | |
| mousebuttonclicks/ | 2026-03-28 18:10 | - | |
| mouseclicks/ | 2026-03-28 18:10 | - | |
| mousecontrols/ | 2026-03-28 18:09 | - | |
| mousemove/ | 2026-03-28 18:09 | - | |
| mousepad/ | 2026-03-28 18:09 | - | |
| move-files/ | 2026-03-28 18:09 | - | |
| move-virtualdesktop/ | 2026-03-28 18:09 | - | |
| move-window-between-desktops/ | 2026-03-28 18:09 | - | |
| move-window-with-hotkeys/ | 2026-03-28 18:09 | - | |
| move/ | 2026-03-28 18:09 | - | |
| movie-making/ | 2026-03-28 18:09 | - | |
| movie/ | 2026-03-28 18:09 | - | |
| movies/ | 2026-03-28 18:09 | - | |
| moz-regression/ | 2026-03-28 18:09 | - | |
| mozilla-firefox-106/ | 2026-03-28 18:09 | - | |
| mozilla-flowstate/ | 2026-03-28 18:09 | - | |
| mozilla-pinebuild/ | 2026-03-28 18:09 | - | |
| mozilla.pinebuild/ | 2026-03-28 18:09 | - | |
| mozilla/ | 2026-03-28 18:09 | - | |
| mozillafirefox106/ | 2026-03-28 18:09 | - | |
| mozillaflowstate/ | 2026-03-28 18:09 | - | |
| mozillapinebuild/ | 2026-03-28 18:09 | - | |
| mp3-converter/ | 2026-03-28 18:09 | - | |
| mp3-player/ | 2026-03-28 18:09 | - | |
| mp3/ | 2026-03-28 18:09 | - | |
| mp3 flac ogg vorbis wma m4a aac alac asf/ | 2026-03-28 18:10 | - | |
| mp3player/ | 2026-03-28 18:10 | - | |
| mp4/ | 2026-03-28 18:09 | - | |
| mp4box/ | 2026-03-28 18:09 | - | |
| mpc-be/ | 2026-03-28 18:10 | - | |
| mpc-hc/ | 2026-03-28 18:09 | - | |
| mpc/ | 2026-03-28 18:09 | - | |
| mpd/ | 2026-03-28 18:10 | - | |
| mpeg-ts/ | 2026-03-28 18:10 | - | |
| mpeg/ | 2026-03-28 18:09 | - | |
| mpi/ | 2026-03-28 18:09 | - | |
| mpich/ | 2026-03-28 18:09 | - | |
| mpo/ | 2026-03-28 18:09 | - | |
| mpv/ | 2026-03-28 18:09 | - | |
| mqtt-client/ | 2026-03-28 18:09 | - | |
| mqtt-explorer/ | 2026-03-28 18:10 | - | |
| mqtt-smarthome/ | 2026-03-28 18:10 | - | |
| mqtt-tool/ | 2026-03-28 18:10 | - | |
| mqtt/ | 2026-03-28 18:09 | - | |
| ms-dos/ | 2026-03-28 18:09 | - | |
| ms-edge-declutter/ | 2026-03-28 18:09 | - | |
| ms-gamebar/ | 2026-03-28 18:09 | - | |
| ms-gamingoverlay/ | 2026-03-28 18:09 | - | |
| ms-mpi/ | 2026-03-28 18:09 | - | |
| ms-scci/ | 2026-03-28 18:09 | - | |
| msa/ | 2026-03-28 18:09 | - | |
| msbuild/ | 2026-03-28 18:09 | - | |
| msdos/ | 2026-03-28 18:10 | - | |
| msea/ | 2026-03-28 18:09 | - | |
| msedge/ | 2026-03-28 18:09 | - | |
| msedit/ | 2026-03-28 18:09 | - | |
| msert/ | 2026-03-28 18:09 | - | |
| msflightsim/ | 2026-03-28 18:09 | - | |
| msfs-2020/ | 2026-03-28 18:09 | - | |
| msfs-flight-simulator/ | 2026-03-28 18:10 | - | |
| msfs/ | 2026-03-28 18:09 | - | |
| msgamebar/ | 2026-03-28 18:09 | - | |
| msgamingoverlay/ | 2026-03-28 18:09 | - | |
| msi-editing/ | 2026-03-28 18:09 | - | |
| msi-editor/ | 2026-03-28 18:09 | - | |
| msi-files/ | 2026-03-28 18:09 | - | |
| msi-to-msix/ | 2026-03-28 18:09 | - | |
| msi/ | 2026-03-28 18:09 | - | |
| msix-builder/ | 2026-03-28 18:09 | - | |
| msix-converter/ | 2026-03-28 18:09 | - | |
| msix-core/ | 2026-03-28 18:10 | - | |
| msix-file-creator/ | 2026-03-28 18:09 | - | |
| msix-package-tool/ | 2026-03-28 18:09 | - | |
| msix-packaging-tool/ | 2026-03-28 18:09 | - | |
| msix-packaging/ | 2026-03-28 18:10 | - | |
| msix-sdk/ | 2026-03-28 18:10 | - | |
| msix-toolkit/ | 2026-03-28 18:09 | - | |
| msix/ | 2026-03-28 18:09 | - | |
| msixbuilder/ | 2026-03-28 18:09 | - | |
| msixconverter/ | 2026-03-28 18:09 | - | |
| msixfilecreator/ | 2026-03-28 18:09 | - | |
| msixmgr/ | 2026-03-28 18:10 | - | |
| msixpackagetool/ | 2026-03-28 18:09 | - | |
| msixsdk/ | 2026-03-28 18:10 | - | |
| msixtoolkit/ | 2026-03-28 18:09 | - | |
| msklc/ | 2026-03-28 18:09 | - | |
| msla/ | 2026-03-28 18:09 | - | |
| msmpisetup.exe/ | 2026-03-28 18:09 | - | |
| msoffice2013/ | 2026-03-28 18:10 | - | |
| msoffice2016/ | 2026-03-28 18:10 | - | |
| mspaint/ | 2026-03-28 18:09 | - | |
| msscci/ | 2026-03-28 18:09 | - | |
| mssql/ | 2026-03-28 18:09 | - | |
| mst/ | 2026-03-28 18:09 | - | |
| msteams/ | 2026-03-28 18:09 | - | |
| mstream/ | 2026-03-28 18:10 | - | |
| msvc/ | 2026-03-28 18:09 | - | |
| msx1/ | 2026-03-28 18:10 | - | |
| msx2/ | 2026-03-28 18:10 | - | |
| mtg/ | 2026-03-28 18:09 | - | |
| mtr/ | 2026-03-28 18:09 | - | |
| mud-client/ | 2026-03-28 18:10 | - | |
| mud/ | 2026-03-28 18:10 | - | |
| multi-account/ | 2026-03-28 18:10 | - | |
| multi-agent/ | 2026-03-28 18:10 | - | |
| multi-currency/ | 2026-03-28 18:09 | - | |
| multi-device/ | 2026-03-28 18:10 | - | |
| multi-dpi/ | 2026-03-28 18:09 | - | |
| multi-factor-authentication/ | 2026-03-28 18:09 | - | |
| multi-language/ | 2026-03-28 18:09 | - | |
| multi-line/ | 2026-03-28 18:09 | - | |
| multi-monitor/ | 2026-03-28 18:09 | - | |
| multi-platform/ | 2026-03-28 18:09 | - | |
| multi-protocol/ | 2026-03-28 18:09 | - | |
| multi-screen/ | 2026-03-28 18:09 | - | |
| multi-source/ | 2026-03-28 18:10 | - | |
| multi-step-authentication/ | 2026-03-28 18:09 | - | |
| multi-tenancy/ | 2026-03-28 18:09 | - | |
| multi-touch/ | 2026-03-28 18:09 | - | |
| multiboot/ | 2026-03-28 18:09 | - | |
| multichannel/ | 2026-03-28 18:09 | - | |
| multiframe/ | 2026-03-28 18:10 | - | |
| multilingual/ | 2026-03-28 18:09 | - | |
| multimc/ | 2026-03-28 18:09 | - | |
| multimc5/ | 2026-03-28 18:09 | - | |
| multimedia/ | 2026-03-28 18:09 | - | |
| multimethod/ | 2026-03-28 18:09 | - | |
| multipass/ | 2026-03-28 18:09 | - | |
| multiplatform/ | 2026-03-28 18:09 | - | |
| multiplayer/ | 2026-03-28 18:09 | - | |
| multiple-documents/ | 2026-03-28 18:09 | - | |
| multiple-files/ | 2026-03-28 18:09 | - | |
| multiple-replace/ | 2026-03-28 18:09 | - | |
| multiple-robots/ | 2026-03-28 18:10 | - | |
| multiplexer/ | 2026-03-28 18:09 | - | |
| multistream/ | 2026-03-28 18:10 | - | |
| multitask/ | 2026-03-28 18:09 | - | |
| multitasking/ | 2026-03-28 18:09 | - | |
| multithreading/ | 2026-03-28 18:09 | - | |
| mumble/ | 2026-03-28 18:10 | - | |
| musegroup/ | 2026-03-28 18:09 | - | |
| museum/ | 2026-03-28 18:09 | - | |
| music-collaboration/ | 2026-03-28 18:09 | - | |
| music-composition/ | 2026-03-28 18:09 | - | |
| music-downloader/ | 2026-03-28 18:10 | - | |
| music-identification/ | 2026-03-28 18:10 | - | |
| music-library/ | 2026-03-28 18:09 | - | |
| music-maker/ | 2026-03-28 18:09 | - | |
| music-metadata/ | 2026-03-28 18:09 | - | |
| music-notation/ | 2026-03-28 18:09 | - | |
| music-organization/ | 2026-03-28 18:09 | - | |
| music-player-application/ | 2026-03-28 18:09 | - | |
| music-player/ | 2026-03-28 18:09 | - | |
| music-presence/ | 2026-03-28 18:10 | - | |
| music-production/ | 2026-03-28 18:09 | - | |
| music-server/ | 2026-03-28 18:09 | - | |
| music-software/ | 2026-03-28 18:09 | - | |
| music-streamer/ | 2026-03-28 18:09 | - | |
| music-streaming-server/ | 2026-03-28 18:10 | - | |
| music-streaming/ | 2026-03-28 18:10 | - | |
| music-studio/ | 2026-03-28 18:09 | - | |
| music-tagger/ | 2026-03-28 18:10 | - | |
| music-thumbnails/ | 2026-03-28 18:10 | - | |
| music-visualizer/ | 2026-03-28 18:09 | - | |
| music/ | 2026-03-28 18:09 | - | |
| musicbee/ | 2026-03-28 18:10 | - | |
| musicbrainz/ | 2026-03-28 18:09 | - | |
| musiceditor/ | 2026-03-28 18:10 | - | |
| musicfox/ | 2026-03-28 18:09 | - | |
| musickeyboard/ | 2026-03-28 18:09 | - | |
| musiclake/ | 2026-03-28 18:10 | - | |
| musicperformance/ | 2026-03-28 18:09 | - | |
| musicplayer/ | 2026-03-28 18:09 | - | |
| musics/ | 2026-03-28 18:09 | - | |
| musicstudio/ | 2026-03-28 18:09 | - | |
| musicthumbnails/ | 2026-03-28 18:10 | - | |
| musicthumbs.db/ | 2026-03-28 18:09 | - | |
| musicw/ | 2026-03-28 18:09 | - | |
| musicxml/ | 2026-03-28 18:09 | - | |
| muslim-prayer-times/ | 2026-03-28 18:10 | - | |
| muslims-prayer/ | 2026-03-28 18:10 | - | |
| muttutil/ | 2026-03-28 18:09 | - | |
| mux/ | 2026-03-28 18:09 | - | |
| mv2/ | 2026-03-28 18:09 | - | |
| mv3/ | 2026-03-28 18:09 | - | |
| mv7/ | 2026-03-28 18:10 | - | |
| mv88/ | 2026-03-28 18:10 | - | |
| mvvm/ | 2026-03-28 18:09 | - | |
| my-biorhythms/ | 2026-03-28 18:09 | - | |
| myanimelist/ | 2026-03-28 18:09 | - | |
| myepson-portal/ | 2026-03-28 18:09 | - | |
| mypal/ | 2026-03-28 18:09 | - | |
| mypeugeot/ | 2026-03-28 18:09 | - | |
| myrient/ | 2026-03-28 18:09 | - | |
| mysql/ | 2026-03-28 18:09 | - | |
| n--/ | 2026-03-28 18:09 | - | |
| n-gage-2/ | 2026-03-28 18:09 | - | |
| n-gage/ | 2026-03-28 18:09 | - | |
| n64/ | 2026-03-28 18:09 | - | |
| naemon/ | 2026-03-28 18:10 | - | |
| nagios/ | 2026-03-28 18:09 | - | |
| named-pipe/ | 2026-03-28 18:10 | - | |
| namedpipe/ | 2026-03-28 18:09 | - | |
| names/ | 2026-03-28 18:09 | - | |
| nanoleaf/ | 2026-03-28 18:09 | - | |
| nanovg/ | 2026-03-28 18:10 | - | |
| nanovna-saver/ | 2026-03-28 18:09 | - | |
| nanovna/ | 2026-03-28 18:09 | - | |
| napiprojekt/ | 2026-03-28 18:10 | - | |
| napisy24/ | 2026-03-28 18:10 | - | |
| nas-frontend/ | 2026-03-28 18:09 | - | |
| nas/ | 2026-03-28 18:09 | - | |
| nasm/ | 2026-03-28 18:10 | - | |
| nat/ | 2026-03-28 18:10 | - | |
| nationsforever/ | 2026-03-28 18:09 | - | |
| native-aot/ | 2026-03-28 18:09 | - | |
| native/ | 2026-03-28 18:09 | - | |
| nativefier/ | 2026-03-28 18:09 | - | |
| nats-server/ | 2026-03-28 18:09 | - | |
| natural-biorhythms/ | 2026-03-28 18:09 | - | |
| natural-language/ | 2026-03-28 18:10 | - | |
| nature/ | 2026-03-28 18:09 | - | |
| naudio/ | 2026-03-28 18:10 | - | |
| nautical-charts/ | 2026-03-28 18:09 | - | |
| nautical/ | 2026-03-28 18:09 | - | |
| navicat/ | 2026-03-28 18:09 | - | |
| navidrome/ | 2026-03-28 18:09 | - | |
| navigate/ | 2026-03-28 18:09 | - | |
| navigation/ | 2026-03-28 18:09 | - | |
| navitel/ | 2026-03-28 18:09 | - | |
| nbfc/ | 2026-03-28 18:09 | - | |
| nbitcoin/ | 2026-03-28 18:09 | - | |
| nbt/ | 2026-03-28 18:09 | - | |
| ncdu/ | 2026-03-28 18:09 | - | |
| ncm/ | 2026-03-28 18:10 | - | |
| ncover/ | 2026-03-28 18:09 | - | |
| ncspot/ | 2026-03-28 18:09 | - | |
| ncurses/ | 2026-03-28 18:09 | - | |
| ndat/ | 2026-03-28 18:10 | - | |
| ndd/ | 2026-03-28 18:09 | - | |
| ndi/ | 2026-03-28 18:09 | - | |
| ndiscap/ | 2026-03-28 18:09 | - | |
| nds/ | 2026-03-28 18:09 | - | |
| ndt/ | 2026-03-28 18:09 | - | |
| nearby-share/ | 2026-03-28 18:09 | - | |
| nearfieldcommunication/ | 2026-03-28 18:09 | - | |
| nebulae/ | 2026-03-28 18:09 | - | |
| necpc-98/ | 2026-03-28 18:10 | - | |
| necsupergrafx/ | 2026-03-28 18:09 | - | |
| nef/ | 2026-03-28 18:09 | - | |
| negative/ | 2026-03-28 18:09 | - | |
| nenadhrg/ | 2026-03-28 18:10 | - | |
| neo,3l/ | 2026-03-28 18:10 | - | |
| neo,bone/ | 2026-03-28 18:10 | - | |
| neo,neo2/ | 2026-03-28 18:10 | - | |
| neo,neoqwertz/ | 2026-03-28 18:10 | - | |
| neo-dlp/ | 2026-03-28 18:09 | - | |
| neo/ | 2026-03-28 18:09 | - | |
| neo4j/ | 2026-03-28 18:09 | - | |
| neodlp/ | 2026-03-28 18:09 | - | |
| neofetch-win/ | 2026-03-28 18:09 | - | |
| neofetch/ | 2026-03-28 18:09 | - | |
| neogeopocketcolor/ | 2026-03-28 18:09 | - | |
| neopop neogeopocket ngp channelfhawk/ | 2026-03-28 18:10 | - | |
| neovim-guis/ | 2026-03-28 18:09 | - | |
| neovim/ | 2026-03-28 18:09 | - | |
| nerd-font/ | 2026-03-28 18:09 | - | |
| nerd-fonts/ | 2026-03-28 18:09 | - | |
| nerdctl/ | 2026-03-28 18:09 | - | |
| nes/ | 2026-03-28 18:09 | - | |
| neshawk nintendoentertainmentsystem/ | 2026-03-28 18:10 | - | |
| net-framework/ | 2026-03-28 18:09 | - | |
| net6/ | 2026-03-28 18:10 | - | |
| net8/ | 2026-03-28 18:09 | - | |
| net48/ | 2026-03-28 18:09 | - | |
| net80/ | 2026-03-28 18:09 | - | |
| netbanner/ | 2026-03-28 18:09 | - | |
| netcore/ | 2026-03-28 18:09 | - | |
| netdata/ | 2026-03-28 18:09 | - | |
| netdisk/ | 2026-03-28 18:09 | - | |
| netease-cloud-music/ | 2026-03-28 18:09 | - | |
| netease-music/ | 2026-03-28 18:09 | - | |
| neteasecloud/ | 2026-03-28 18:09 | - | |
| netframework48/ | 2026-03-28 18:10 | - | |
| netframeworks/ | 2026-03-28 18:10 | - | |
| netgearswitchdiscoverytool/ | 2026-03-28 18:09 | - | |
| nethack/ | 2026-03-28 18:09 | - | |
| netkvm.inf/ | 2026-03-28 18:09 | - | |
| netpbm/ | 2026-03-28 18:09 | - | |
| netportal/ | 2026-03-28 18:10 | - | |
| netrtwlanu6.inf/ | 2026-03-28 18:09 | - | |
| netspeedmon/ | 2026-03-28 18:09 | - | |
| netstat/ | 2026-03-28 18:10 | - | |
| netusb.inf/ | 2026-03-28 18:10 | - | |
| netusbwin10.inf/ | 2026-03-28 18:10 | - | |
| network-analysis/ | 2026-03-28 18:09 | - | |
| network-discovery/ | 2026-03-28 18:09 | - | |
| network-filtering/ | 2026-03-28 18:09 | - | |
| network-manager/ | 2026-03-28 18:10 | - | |
| network-monitor/ | 2026-03-28 18:09 | - | |
| network-monitoring/ | 2026-03-28 18:10 | - | |
| network-security-firewall-sse-sase-ztna/ | 2026-03-28 18:10 | - | |
| network-security/ | 2026-03-28 18:09 | - | |
| network-speed/ | 2026-03-28 18:09 | - | |
| network-statistics/ | 2026-03-28 18:09 | - | |
| network-switch/ | 2026-03-28 18:09 | - | |
| network-tethering/ | 2026-03-28 18:09 | - | |
| network-tools/ | 2026-03-28 18:09 | - | |
| network-traffic/ | 2026-03-28 18:09 | - | |
| network/ | 2026-03-28 18:09 | - | |
| networkdiagnostic/ | 2026-03-28 18:09 | - | |
| networkdriver/ | 2026-03-28 18:09 | - | |
| networkencryption/ | 2026-03-28 18:09 | - | |
| networkfilesystem/ | 2026-03-28 18:09 | - | |
| networkfirewall/ | 2026-03-28 18:10 | - | |
| networking/ | 2026-03-28 18:09 | - | |
| networkmanagement/ | 2026-03-28 18:09 | - | |
| networktethering/ | 2026-03-28 18:09 | - | |
| networktimeprotocol/ | 2026-03-28 18:09 | - | |
| neural-network/ | 2026-03-28 18:10 | - | |
| neurojson/ | 2026-03-28 18:09 | - | |
| newcloud/ | 2026-03-28 18:09 | - | |
| newrelic/ | 2026-03-28 18:10 | - | |
| news/ | 2026-03-28 18:09 | - | |
| newschannel/ | 2026-03-28 18:10 | - | |
| newsfeed/ | 2026-03-28 18:09 | - | |
| newsletter/ | 2026-03-28 18:09 | - | |
| newsreader/ | 2026-03-28 18:09 | - | |
| newtonian/ | 2026-03-28 18:10 | - | |
| nexonlauncher/ | 2026-03-28 18:09 | - | |
| next-trace/ | 2026-03-28 18:09 | - | |
| nextcloud-desktop-client/ | 2026-03-28 18:09 | - | |
| nextcloud-talk/ | 2026-03-28 18:09 | - | |
| nextcloud/ | 2026-03-28 18:09 | - | |
| nextest/ | 2026-03-28 18:10 | - | |
| nextjs/ | 2026-03-28 18:09 | - | |
| nexttrace/ | 2026-03-28 18:09 | - | |
| nexus-mods/ | 2026-03-28 18:09 | - | |
| nexus/ | 2026-03-28 18:09 | - | |
| nexys2/ | 2026-03-28 18:09 | - | |
| nfc/ | 2026-03-28 18:09 | - | |
| nfcgeschrieben/ | 2026-03-28 18:09 | - | |
| nfcreader/ | 2026-03-28 18:09 | - | |
| nfctags/ | 2026-03-28 18:09 | - | |
| nfctagswriting/ | 2026-03-28 18:09 | - | |
| nfcwriter/ | 2026-03-28 18:09 | - | |
| nfo/ | 2026-03-28 18:09 | - | |
| nfs2/ | 2026-03-28 18:09 | - | |
| nfs3/ | 2026-03-28 18:09 | - | |
| nfsserver/ | 2026-03-28 18:09 | - | |
| nft/ | 2026-03-28 18:09 | - | |
| ngage/ | 2026-03-28 18:09 | - | |
| ngage2/ | 2026-03-28 18:09 | - | |
| ngc/ | 2026-03-28 18:09 | - | |
| nginx/ | 2026-03-28 18:09 | - | |
| ngrok/ | 2026-03-28 18:09 | - | |
| ngs/ | 2026-03-28 18:09 | - | |
| nhs/ | 2026-03-28 18:10 | - | |
| nickel/ | 2026-03-28 18:09 | - | |
| niconico/ | 2026-03-28 18:09 | - | |
| nicovideo/ | 2026-03-28 18:09 | - | |
| night-light/ | 2026-03-28 18:09 | - | |
| night-mode/ | 2026-03-28 18:09 | - | |
| nightscout/ | 2026-03-28 18:09 | - | |
| nikon-raw/ | 2026-03-28 18:10 | - | |
| nim-lang/ | 2026-03-28 18:09 | - | |
| nim/ | 2026-03-28 18:09 | - | |
| nimbus-note/ | 2026-03-28 18:10 | - | |
| nimbus-web/ | 2026-03-28 18:10 | - | |
| ninja/ | 2026-03-28 18:09 | - | |
| ninjam/ | 2026-03-28 18:09 | - | |
| nintendo-hacking/ | 2026-03-28 18:10 | - | |
| nintendo-rvl-wbc-01/ | 2026-03-28 18:09 | - | |
| nintendo-switch-1/ | 2026-03-28 18:09 | - | |
| nintendo-switch-homebrew/ | 2026-03-28 18:10 | - | |
| nintendo-switch/ | 2026-03-28 18:10 | - | |
| nintendo-wii/ | 2026-03-28 18:09 | - | |
| nintendo/ | 2026-03-28 18:09 | - | |
| nintendo64/ | 2026-03-28 18:09 | - | |
| nintendochannel/ | 2026-03-28 18:10 | - | |
| nintendods/ | 2026-03-28 18:09 | - | |
| nintendodsistore/ | 2026-03-28 18:10 | - | |
| nintendoentertainmentsystem/ | 2026-03-28 18:09 | - | |
| nintendoeshop/ | 2026-03-28 18:10 | - | |
| nintendoswitch1/ | 2026-03-28 18:09 | - | |
| nintendoupdateservers/ | 2026-03-28 18:10 | - | |
| nintendowii/ | 2026-03-28 18:09 | - | |
| nist/ | 2026-03-28 18:09 | - | |
| nitro-gui/ | 2026-03-28 18:09 | - | |
| nitrogui/ | 2026-03-28 18:09 | - | |
| nix/ | 2026-03-28 18:10 | - | |
| nlog/ | 2026-03-28 18:10 | - | |
| nlp/ | 2026-03-28 18:09 | - | |
| nlyt/ | 2026-03-28 18:10 | - | |
| nmea/ | 2026-03-28 18:09 | - | |
| nmea2000/ | 2026-03-28 18:09 | - | |
| no-cloud/ | 2026-03-28 18:10 | - | |
| no-code/ | 2026-03-28 18:09 | - | |
| no-electron/ | 2026-03-28 18:09 | - | |
| no-extension-support/ | 2026-03-28 18:09 | - | |
| no-more-404/ | 2026-03-28 18:10 | - | |
| node-graph/ | 2026-03-28 18:09 | - | |
| node-js/ | 2026-03-28 18:09 | - | |
| node.js/ | 2026-03-28 18:09 | - | |
| node/ | 2026-03-28 18:09 | - | |
| nodejs/ | 2026-03-28 18:09 | - | |
| noip/ | 2026-03-28 18:09 | - | |
| noise-removal/ | 2026-03-28 18:10 | - | |
| noise/ | 2026-03-28 18:09 | - | |
| nokia-lumia/ | 2026-03-28 18:10 | - | |
| nokia-ovi-suite/ | 2026-03-28 18:09 | - | |
| nokia/ | 2026-03-28 18:09 | - | |
| nokialumia/ | 2026-03-28 18:10 | - | |
| nomad/ | 2026-03-28 18:09 | - | |
| non-24/ | 2026-03-28 18:09 | - | |
| non-custodial/ | 2026-03-28 18:09 | - | |
| non-euclidean/ | 2026-03-28 18:09 | - | |
| nonsense/ | 2026-03-28 18:10 | - | |
| normalization/ | 2026-03-28 18:10 | - | |
| normalize/ | 2026-03-28 18:09 | - | |
| northstar-client/ | 2026-03-28 18:10 | - | |
| northstar/ | 2026-03-28 18:10 | - | |
| nosql/ | 2026-03-28 18:09 | - | |
| nostr/ | 2026-03-28 18:10 | - | |
| notarization/ | 2026-03-28 18:09 | - | |
| notarize/ | 2026-03-28 18:09 | - | |
| notation/ | 2026-03-28 18:09 | - | |
| note-management/ | 2026-03-28 18:09 | - | |
| note-managment/ | 2026-03-28 18:09 | - | |
| note-taker/ | 2026-03-28 18:09 | - | |
| note-taking-app/ | 2026-03-28 18:09 | - | |
| note-taking/ | 2026-03-28 18:09 | - | |
| note/ | 2026-03-28 18:09 | - | |
| noteblock/ | 2026-03-28 18:10 | - | |
| notebook/ | 2026-03-28 18:09 | - | |
| notebooks/ | 2026-03-28 18:09 | - | |
| notejoy/ | 2026-03-28 18:09 | - | |
| noteoad2/ | 2026-03-28 18:10 | - | |
| notepad++/ | 2026-03-28 18:09 | - | |
| notepad/ | 2026-03-28 18:09 | - | |
| notepad2-mod/ | 2026-03-28 18:09 | - | |
| notepad2/ | 2026-03-28 18:10 | - | |
| notepad4/ | 2026-03-28 18:10 | - | |
| notepadsapp/ | 2026-03-28 18:09 | - | |
| notes-app/ | 2026-03-28 18:09 | - | |
| notes-taking/ | 2026-03-28 18:10 | - | |
| notes/ | 2026-03-28 18:09 | - | |
| notetaking/ | 2026-03-28 18:09 | - | |
| notification-area/ | 2026-03-28 18:09 | - | |
| notification-hubs/ | 2026-03-28 18:10 | - | |
| notification/ | 2026-03-28 18:09 | - | |
| notifications/ | 2026-03-28 18:09 | - | |
| notion-alternative/ | 2026-03-28 18:09 | - | |
| notion/ | 2026-03-28 18:09 | - | |
| nova/ | 2026-03-28 18:09 | - | |
| novationusbmidi.inf/ | 2026-03-28 18:10 | - | |
| novel-reader/ | 2026-03-28 18:10 | - | |
| novel/ | 2026-03-28 18:09 | - | |
| nowplaying/ | 2026-03-28 18:10 | - | |
| npki/ | 2026-03-28 18:10 | - | |
| npm-desktop-manager/ | 2026-03-28 18:09 | - | |
| npm-gui/ | 2026-03-28 18:09 | - | |
| npm/ | 2026-03-28 18:09 | - | |
| npmjs/ | 2026-03-28 18:09 | - | |
| nprc/ | 2026-03-28 18:10 | - | |
| npu/ | 2026-03-28 18:09 | - | |
| nqp/ | 2026-03-28 18:10 | - | |
| nrktv/ | 2026-03-28 18:10 | - | |
| ns/ | 2026-03-28 18:09 | - | |
| nsa/ | 2026-03-28 18:09 | - | |
| nscr/ | 2026-03-28 18:10 | - | |
| nsdt/ | 2026-03-28 18:09 | - | |
| nservicebus/ | 2026-03-28 18:10 | - | |
| nsis/ | 2026-03-28 18:09 | - | |
| nsp/ | 2026-03-28 18:09 | - | |
| nssm/ | 2026-03-28 18:09 | - | |
| ntag/ | 2026-03-28 18:09 | - | |
| ntfs/ | 2026-03-28 18:09 | - | |
| ntpclient/ | 2026-03-28 18:09 | - | |
| ntppool/ | 2026-03-28 18:09 | - | |
| ntpserver/ | 2026-03-28 18:09 | - | |
| ntptimeserver/ | 2026-03-28 18:09 | - | |
| ntptimesync/ | 2026-03-28 18:09 | - | |
| ntwind-software/ | 2026-03-28 18:09 | - | |
| ntwind/ | 2026-03-28 18:09 | - | |
| nuget/ | 2026-03-28 18:09 | - | |
| nuitka/ | 2026-03-28 18:09 | - | |
| nuitkagui/ | 2026-03-28 18:09 | - | |
| nullsoft/ | 2026-03-28 18:09 | - | |
| num-lock/ | 2026-03-28 18:09 | - | |
| number-generator/ | 2026-03-28 18:09 | - | |
| number base converter/ | 2026-03-28 18:09 | - | |
| number conversion/ | 2026-03-28 18:09 | - | |
| numere/ | 2026-03-28 18:10 | - | |
| numerical-computation/ | 2026-03-28 18:10 | - | |
| numerical/ | 2026-03-28 18:09 | - | |
| numerical computation/ | 2026-03-28 18:10 | - | |
| nunchuk/ | 2026-03-28 18:09 | - | |
| nunit-4-framework/ | 2026-03-28 18:10 | - | |
| nunit-lite-runner/ | 2026-03-28 18:10 | - | |
| nunit-test-framework/ | 2026-03-28 18:10 | - | |
| nunit4framework/ | 2026-03-28 18:10 | - | |
| nunitlite-runner.exe/ | 2026-03-28 18:10 | - | |
| nunitliterunner/ | 2026-03-28 18:10 | - | |
| nunittestframework/ | 2026-03-28 18:10 | - | |
| nushell/ | 2026-03-28 18:09 | - | |
| nutstore/ | 2026-03-28 18:10 | - | |
| nuxt/ | 2026-03-28 18:09 | - | |
| nvenc/ | 2026-03-28 18:09 | - | |
| nvidia/ | 2026-03-28 18:09 | - | |
| nvidiagameworks/ | 2026-03-28 18:09 | - | |
| nvim-qt/ | 2026-03-28 18:09 | - | |
| nvm/ | 2026-03-28 18:09 | - | |
| nvm4w/ | 2026-03-28 18:10 | - | |
| nvmexpress/ | 2026-03-28 18:09 | - | |
| nvr/ | 2026-03-28 18:09 | - | |
| nvs/ | 2026-03-28 18:09 | - | |
| nwg/ | 2026-03-28 18:09 | - | |
| nx/ | 2026-03-28 18:10 | - | |
| nxlog/ | 2026-03-28 18:09 | - | |
| nymashock octoshock playstation psx ps1/ | 2026-03-28 18:10 | - | |
| nzb/ | 2026-03-28 18:09 | - | |
| nzbget/ | 2026-03-28 18:09 | - | |
| o365/ | 2026-03-28 18:09 | - | |
| oa/ | 2026-03-28 18:09 | - | |
| oas/ | 2026-03-28 18:09 | - | |
| oasv3/ | 2026-03-28 18:10 | - | |
| oauth-2.0/ | 2026-03-28 18:10 | - | |
| oauth/ | 2026-03-28 18:09 | - | |
| oauth2-client/ | 2026-03-28 18:09 | - | |
| oauth2/ | 2026-03-28 18:09 | - | |
| obfuscated/ | 2026-03-28 18:09 | - | |
| obfuscator/ | 2026-03-28 18:10 | - | |
| object2vr/ | 2026-03-28 18:09 | - | |
| objective-c/ | 2026-03-28 18:09 | - | |
| objects-namespace/ | 2026-03-28 18:09 | - | |
| oblivion/ | 2026-03-28 18:09 | - | |
| oblivious-dns-over-https/ | 2026-03-28 18:09 | - | |
| obs-ndi/ | 2026-03-28 18:09 | - | |
| obs-plugin/ | 2026-03-28 18:10 | - | |
| obs-remote/ | 2026-03-28 18:09 | - | |
| obs-rtspserver/ | 2026-03-28 18:09 | - | |
| obs-studio/ | 2026-03-28 18:09 | - | |
| obs/ | 2026-03-28 18:09 | - | |
| observability/ | 2026-03-28 18:09 | - | |
| observable/ | 2026-03-28 18:09 | - | |
| obsfucation/ | 2026-03-28 18:10 | - | |
| obsidian-md/ | 2026-03-28 18:09 | - | |
| obsidian/ | 2026-03-28 18:09 | - | |
| obsndi/ | 2026-03-28 18:09 | - | |
| obs plugin/ | 2026-03-28 18:10 | - | |
| obsstudio/ | 2026-03-28 18:09 | - | |
| ocaml/ | 2026-03-28 18:09 | - | |
| ocarina-of-time/ | 2026-03-28 18:09 | - | |
| ocat/ | 2026-03-28 18:10 | - | |
| oci-artifacts/ | 2026-03-28 18:09 | - | |
| oci-image/ | 2026-03-28 18:10 | - | |
| oci/ | 2026-03-28 18:09 | - | |
| ocm/ | 2026-03-28 18:10 | - | |
| ocr-engine/ | 2026-03-28 18:10 | - | |
| ocr-pdf/ | 2026-03-28 18:09 | - | |
| ocr/ | 2026-03-28 18:09 | - | |
| octal/ | 2026-03-28 18:09 | - | |
| octopus/ | 2026-03-28 18:09 | - | |
| oculus-quest/ | 2026-03-28 18:09 | - | |
| oculus/ | 2026-03-28 18:09 | - | |
| odassey/ | 2026-03-28 18:10 | - | |
| odata-v4/ | 2026-03-28 18:10 | - | |
| odata/ | 2026-03-28 18:10 | - | |
| odbc/ | 2026-03-28 18:09 | - | |
| odf/ | 2026-03-28 18:09 | - | |
| odin/ | 2026-03-28 18:10 | - | |
| odm/ | 2026-03-28 18:09 | - | |
| ods/ | 2026-03-28 18:09 | - | |
| odt/ | 2026-03-28 18:09 | - | |
| offentligatjänster/ | 2026-03-28 18:09 | - | |
| office-deployment-tool/ | 2026-03-28 18:09 | - | |
| office-extension/ | 2026-03-28 18:09 | - | |
| office-plugin/ | 2026-03-28 18:09 | - | |
| office/ | 2026-03-28 18:09 | - | |
| office365/ | 2026-03-28 18:09 | - | |
| official-account/ | 2026-03-28 18:09 | - | |
| offline/ | 2026-03-28 18:09 | - | |
| offlinedetection/ | 2026-03-28 18:09 | - | |
| ogg-files/ | 2026-03-28 18:09 | - | |
| ogg/ | 2026-03-28 18:09 | - | |
| oggfiles/ | 2026-03-28 18:09 | - | |
| ogr/ | 2026-03-28 18:09 | - | |
| ogre-next/ | 2026-03-28 18:10 | - | |
| ogre3d/ | 2026-03-28 18:10 | - | |
| oh-my-posh/ | 2026-03-28 18:09 | - | |
| oh-my-zsh/ | 2026-03-28 18:09 | - | |
| ohci/ | 2026-03-28 18:10 | - | |
| ohne-upload/ | 2026-03-28 18:10 | - | |
| ohrrpgce/ | 2026-03-28 18:09 | - | |
| oidc/ | 2026-03-28 18:09 | - | |
| oil/ | 2026-03-28 18:10 | - | |
| ojs/ | 2026-03-28 18:09 | - | |
| okta/ | 2026-03-28 18:09 | - | |
| okteto/ | 2026-03-28 18:10 | - | |
| olap/ | 2026-03-28 18:09 | - | |
| old/ | 2026-03-28 18:10 | - | |
| oldschool/ | 2026-03-28 18:09 | - | |
| oled/ | 2026-03-28 18:09 | - | |
| ollama/ | 2026-03-28 18:09 | - | |
| omni/ | 2026-03-28 18:10 | - | |
| omniedge/ | 2026-03-28 18:10 | - | |
| omsi/ | 2026-03-28 18:10 | - | |
| omsi2/ | 2026-03-28 18:10 | - | |
| on-premises/ | 2026-03-28 18:09 | - | |
| on-screen-display/ | 2026-03-28 18:09 | - | |
| on-screen-keyboard/ | 2026-03-28 18:09 | - | |
| on-top/ | 2026-03-28 18:09 | - | |
| ondemand/ | 2026-03-28 18:09 | - | |
| one.one.one.one/ | 2026-03-28 18:09 | - | |
| oneai/ | 2026-03-28 18:10 | - | |
| onedrive-for-business/ | 2026-03-28 18:09 | - | |
| onedrive/ | 2026-03-28 18:09 | - | |
| onenote/ | 2026-03-28 18:09 | - | |
| onescript/ | 2026-03-28 18:10 | - | |
| onetab/ | 2026-03-28 18:09 | - | |
| onion-service/ | 2026-03-28 18:09 | - | |
| onion/ | 2026-03-28 18:09 | - | |
| oniro/ | 2026-03-28 18:09 | - | |
| onkyo-car-audio/ | 2026-03-28 18:10 | - | |
| onkyocaraudio/ | 2026-03-28 18:10 | - | |
| online-game/ | 2026-03-28 18:10 | - | |
| online-help/ | 2026-03-28 18:09 | - | |
| online-jamming/ | 2026-03-28 18:09 | - | |
| online-manuals/ | 2026-03-28 18:09 | - | |
| online/ | 2026-03-28 18:09 | - | |
| onlineconnection/ | 2026-03-28 18:09 | - | |
| onlinegaming/ | 2026-03-28 18:10 | - | |
| onlinemultiplayer/ | 2026-03-28 18:10 | - | |
| onlineserver/ | 2026-03-28 18:09 | - | |
| onscreenkeyboard/ | 2026-03-28 18:09 | - | |
| ooni/ | 2026-03-28 18:10 | - | |
| ooniprobe/ | 2026-03-28 18:10 | - | |
| oop/ | 2026-03-28 18:09 | - | |
| oop7/ | 2026-03-28 18:10 | - | |
| op5/ | 2026-03-28 18:09 | - | |
| opa/ | 2026-03-28 18:09 | - | |
| opacity/ | 2026-03-28 18:09 | - | |
| opc-ua/ | 2026-03-28 18:09 | - | |
| opcua/ | 2026-03-28 18:09 | - | |
| open-access/ | 2026-03-28 18:09 | - | |
| open-component-model/ | 2026-03-28 18:10 | - | |
| open-hardware/ | 2026-03-28 18:10 | - | |
| open-msx/ | 2026-03-28 18:10 | - | |
| open-science/ | 2026-03-28 18:10 | - | |
| open-sound-control/ | 2026-03-28 18:10 | - | |
| open-source-game/ | 2026-03-28 18:10 | - | |
| open-source-licensing/ | 2026-03-28 18:09 | - | |
| open-source-vulnerabilities/ | 2026-03-28 18:09 | - | |
| open-source/ | 2026-03-28 18:09 | - | |
| open/ | 2026-03-28 18:09 | - | |
| openaction/ | 2026-03-28 18:09 | - | |
| openai-api/ | 2026-03-28 18:09 | - | |
| openai-codex/ | 2026-03-28 18:09 | - | |
| openai-response/ | 2026-03-28 18:10 | - | |
| openai/ | 2026-03-28 18:09 | - | |
| openal/ | 2026-03-28 18:10 | - | |
| openapi-specification/ | 2026-03-28 18:10 | - | |
| openapi/ | 2026-03-28 18:09 | - | |
| openapi3/ | 2026-03-28 18:09 | - | |
| opencascade/ | 2026-03-28 18:10 | - | |
| opencc/ | 2026-03-28 18:10 | - | |
| openchemistry/ | 2026-03-28 18:10 | - | |
| opencl-on-12/ | 2026-03-28 18:09 | - | |
| opencl-on-d3d12/ | 2026-03-28 18:09 | - | |
| opencl/ | 2026-03-28 18:09 | - | |
| openclaw/ | 2026-03-28 18:09 | - | |
| openclon12/ | 2026-03-28 18:09 | - | |
| opencode/ | 2026-03-28 18:09 | - | |
| opencore/ | 2026-03-28 18:09 | - | |
| opencover/ | 2026-03-28 18:09 | - | |
| opencv/ | 2026-03-28 18:09 | - | |
| opendrive/ | 2026-03-28 18:09 | - | |
| openexr/ | 2026-03-28 18:09 | - | |
| openflow/ | 2026-03-28 18:10 | - | |
| openfoam/ | 2026-03-28 18:09 | - | |
| opengl-compatibility-pack/ | 2026-03-28 18:09 | - | |
| opengl/ | 2026-03-28 18:09 | - | |
| openharmony/ | 2026-03-28 18:09 | - | |
| openid-connect/ | 2026-03-28 18:09 | - | |
| openidconnect/ | 2026-03-28 18:10 | - | |
| openjdk/ | 2026-03-28 18:09 | - | |
| openjre/ | 2026-03-28 18:09 | - | |
| openlist/ | 2026-03-28 18:10 | - | |
| openoffice/ | 2026-03-28 18:09 | - | |
| openpgp/ | 2026-03-28 18:09 | - | |
| openpolicyagent/ | 2026-03-28 18:10 | - | |
| openproxy/ | 2026-03-28 18:09 | - | |
| openrct2/ | 2026-03-28 18:09 | - | |
| openrgb/ | 2026-03-28 18:10 | - | |
| openrouter/ | 2026-03-28 18:10 | - | |
| opensc/ | 2026-03-28 18:10 | - | |
| openscad/ | 2026-03-28 18:10 | - | |
| openshift/ | 2026-03-28 18:10 | - | |
| open source/ | 2026-03-28 18:09 | - | |
| opensource/ | 2026-03-28 18:09 | - | |
| openssh/ | 2026-03-28 18:09 | - | |
| openssl/ | 2026-03-28 18:09 | - | |
| openstack/ | 2026-03-28 18:09 | - | |
| openstreetmap/ | 2026-03-28 18:10 | - | |
| opensubsonic/ | 2026-03-28 18:09 | - | |
| opensubtitles/ | 2026-03-28 18:09 | - | |
| opensubtitlescom/ | 2026-03-28 18:09 | - | |
| opentelemetry/ | 2026-03-28 18:09 | - | |
| opentofu/ | 2026-03-28 18:09 | - | |
| openutau/ | 2026-03-28 18:09 | - | |
| openvex/ | 2026-03-28 18:09 | - | |
| openvpn/ | 2026-03-28 18:09 | - | |
| openwebui/ | 2026-03-28 18:10 | - | |
| openwrt/ | 2026-03-28 18:10 | - | |
| openxr-layer/ | 2026-03-28 18:09 | - | |
| openxr-layers/ | 2026-03-28 18:09 | - | |
| openxr/ | 2026-03-28 18:09 | - | |
| opera-browser/ | 2026-03-28 18:09 | - | |
| operatingsystemupdates/ | 2026-03-28 18:09 | - | |
| opertion/ | 2026-03-28 18:09 | - | |
| opne-source/ | 2026-03-28 18:10 | - | |
| opsview/ | 2026-03-28 18:09 | - | |
| optical-music-recognition/ | 2026-03-28 18:09 | - | |
| optical/ | 2026-03-28 18:10 | - | |
| optics/ | 2026-03-28 18:09 | - | |
| optifine/ | 2026-03-28 18:10 | - | |
| optimisation/ | 2026-03-28 18:09 | - | |
| optimiser/ | 2026-03-28 18:09 | - | |
| optimising/ | 2026-03-28 18:09 | - | |
| optimization/ | 2026-03-28 18:09 | - | |
| optimize/ | 2026-03-28 18:09 | - | |
| optimizing/ | 2026-03-28 18:09 | - | |
| options/ | 2026-03-28 18:09 | - | |
| optiplex/ | 2026-03-28 18:09 | - | |
| opus-files/ | 2026-03-28 18:09 | - | |
| opus/ | 2026-03-28 18:09 | - | |
| opusfiles/ | 2026-03-28 18:09 | - | |
| opustools/ | 2026-03-28 18:09 | - | |
| oracle-cloud/ | 2026-03-28 18:09 | - | |
| oracle/ | 2026-03-28 18:09 | - | |
| oraclevirtualbox/ | 2026-03-28 18:10 | - | |
| orange-player/ | 2026-03-28 18:09 | - | |
| orange-tint/ | 2026-03-28 18:10 | - | |
| orbitprediction/ | 2026-03-28 18:09 | - | |
| orbx-simulation/ | 2026-03-28 18:10 | - | |
| orca/ | 2026-03-28 18:09 | - | |
| orchestration/ | 2026-03-28 18:09 | - | |
| ordered-dithering/ | 2026-03-28 18:09 | - | |
| org-mode/ | 2026-03-28 18:09 | - | |
| organic-chemistry/ | 2026-03-28 18:09 | - | |
| organization/ | 2026-03-28 18:09 | - | |
| organizational-chart/ | 2026-03-28 18:09 | - | |
| organize/ | 2026-03-28 18:09 | - | |
| organizer/ | 2026-03-28 18:09 | - | |
| origin-games/ | 2026-03-28 18:10 | - | |
| origin/ | 2026-03-28 18:09 | - | |
| originos/ | 2026-03-28 18:09 | - | |
| orm/ | 2026-03-28 18:09 | - | |
| orthographe/ | 2026-03-28 18:09 | - | |
| os-installer/ | 2026-03-28 18:09 | - | |
| osc-messages/ | 2026-03-28 18:10 | - | |
| osc/ | 2026-03-28 18:09 | - | |
| oscar/ | 2026-03-28 18:09 | - | |
| oscilloscope/ | 2026-03-28 18:09 | - | |
| oscript/ | 2026-03-28 18:10 | - | |
| osint-python/ | 2026-03-28 18:09 | - | |
| osint/ | 2026-03-28 18:09 | - | |
| osk/ | 2026-03-28 18:09 | - | |
| ospray/ | 2026-03-28 18:09 | - | |
| oss/ | 2026-03-28 18:09 | - | |
| osu/ | 2026-03-28 18:09 | - | |
| osx/ | 2026-03-28 18:09 | - | |
| otel/ | 2026-03-28 18:09 | - | |
| otl/ | 2026-03-28 18:09 | - | |
| otlp/ | 2026-03-28 18:09 | - | |
| otp-generator/ | 2026-03-28 18:10 | - | |
| otp/ | 2026-03-28 18:09 | - | |
| outer-wilds/ | 2026-03-28 18:10 | - | |
| outerspace/ | 2026-03-28 18:09 | - | |
| outline/ | 2026-03-28 18:09 | - | |
| outliner/ | 2026-03-28 18:09 | - | |
| outlook-desktop-client/ | 2026-03-28 18:09 | - | |
| outlook/ | 2026-03-28 18:09 | - | |
| outlookmailprocessor_v35/ | 2026-03-28 18:09 | - | |
| overclock/ | 2026-03-28 18:09 | - | |
| overclocking/ | 2026-03-28 18:09 | - | |
| overlay/ | 2026-03-28 18:09 | - | |
| owasp-threat-dragon/ | 2026-03-28 18:10 | - | |
| owasp/ | 2026-03-28 18:09 | - | |
| owl/ | 2026-03-28 18:09 | - | |
| owncloud/ | 2026-03-28 18:10 | - | |
| ownership/ | 2026-03-28 18:09 | - | |
| ownyourdata/ | 2026-03-28 18:10 | - | |
| ox/ | 2026-03-28 18:09 | - | |
| p2p-file-sharing/ | 2026-03-28 18:10 | - | |
| p2p/ | 2026-03-28 18:09 | - | |
| p7zip/ | 2026-03-28 18:10 | - | |
| pa/ | 2026-03-28 18:09 | - | |
| package-files/ | 2026-03-28 18:10 | - | |
| package-management/ | 2026-03-28 18:09 | - | |
| package-manager-tool/ | 2026-03-28 18:09 | - | |
| package-manager/ | 2026-03-28 18:09 | - | |
| package-manifests/ | 2026-03-28 18:09 | - | |
| package-url/ | 2026-03-28 18:09 | - | |
| package/ | 2026-03-28 18:09 | - | |
| packagemanagement/ | 2026-03-28 18:10 | - | |
| packagemanager/ | 2026-03-28 18:09 | - | |
| packagemanagers/ | 2026-03-28 18:10 | - | |
| packager/ | 2026-03-28 18:09 | - | |
| packages/ | 2026-03-28 18:09 | - | |
| packaging/ | 2026-03-28 18:09 | - | |
| packer/ | 2026-03-28 18:09 | - | |
| packet-analysis/ | 2026-03-28 18:09 | - | |
| packet-sender/ | 2026-03-28 18:09 | - | |
| packets/ | 2026-03-28 18:09 | - | |
| pacman/ | 2026-03-28 18:09 | - | |
| padman/ | 2026-03-28 18:10 | - | |
| page/ | 2026-03-28 18:10 | - | |
| pageant-bridge/ | 2026-03-28 18:09 | - | |
| pageant/ | 2026-03-28 18:09 | - | |
| pager/ | 2026-03-28 18:09 | - | |
| paint/ | 2026-03-28 18:09 | - | |
| painting/ | 2026-03-28 18:09 | - | |
| pair-programming/ | 2026-03-28 18:10 | - | |
| pairwiseindependentcombinatorialtesting/ | 2026-03-28 18:09 | - | |
| pak/ | 2026-03-28 18:09 | - | |
| pake/ | 2026-03-28 18:10 | - | |
| paketmanager/ | 2026-03-28 18:09 | - | |
| pale-moon/ | 2026-03-28 18:09 | - | |
| palermostest25/ | 2026-03-28 18:09 | - | |
| palette/ | 2026-03-28 18:09 | - | |
| pallet/ | 2026-03-28 18:09 | - | |
| pam/ | 2026-03-28 18:10 | - | |
| pan/ | 2026-03-28 18:09 | - | |
| pandaoc-ui/ | 2026-03-28 18:09 | - | |
| pandoc/ | 2026-03-28 18:09 | - | |
| pane/ | 2026-03-28 18:09 | - | |
| panel/ | 2026-03-28 18:10 | - | |
| panes/ | 2026-03-28 18:09 | - | |
| pano2vr/ | 2026-03-28 18:09 | - | |
| panorama/ | 2026-03-28 18:09 | - | |
| paper/ | 2026-03-28 18:09 | - | |
| papyrus-script-files/ | 2026-03-28 18:10 | - | |
| papyrusscriptfiles/ | 2026-03-28 18:10 | - | |
| par/ | 2026-03-28 18:10 | - | |
| par2/ | 2026-03-28 18:10 | - | |
| paradox-interactive/ | 2026-03-28 18:09 | - | |
| paradox/ | 2026-03-28 18:09 | - | |
| parallel/ | 2026-03-28 18:09 | - | |
| parallelism/ | 2026-03-28 18:09 | - | |
| parametric/ | 2026-03-28 18:10 | - | |
| parchive/ | 2026-03-28 18:10 | - | |
| parent/ | 2026-03-28 18:09 | - | |
| parental-control/ | 2026-03-28 18:09 | - | |
| parezj/ | 2026-03-28 18:09 | - | |
| parity-volume/ | 2026-03-28 18:10 | - | |
| parity/ | 2026-03-28 18:09 | - | |
| parquet-viewer/ | 2026-03-28 18:09 | - | |
| parsec/ | 2026-03-28 18:09 | - | |
| parseccloud/ | 2026-03-28 18:09 | - | |
| parser/ | 2026-03-28 18:09 | - | |
| parsing/ | 2026-03-28 18:09 | - | |
| part/ | 2026-03-28 18:09 | - | |
| partial-differential-equations/ | 2026-03-28 18:09 | - | |
| partial/ | 2026-03-28 18:09 | - | |
| partition-backup/ | 2026-03-28 18:09 | - | |
| partition-recovery/ | 2026-03-28 18:09 | - | |
| partition/ | 2026-03-28 18:09 | - | |
| partitionalignment/ | 2026-03-28 18:09 | - | |
| partitionschemes/ | 2026-03-28 18:09 | - | |
| party/ | 2026-03-28 18:09 | - | |
| pascal/ | 2026-03-28 18:09 | - | |
| pass/ | 2026-03-28 18:09 | - | |
| passphrase/ | 2026-03-28 18:10 | - | |
| passphrases/ | 2026-03-28 18:09 | - | |
| password-generator/ | 2026-03-28 18:09 | - | |
| password-manager/ | 2026-03-28 18:09 | - | |
| password-safe/ | 2026-03-28 18:10 | - | |
| password/ | 2026-03-28 18:09 | - | |
| passwordprotected/ | 2026-03-28 18:10 | - | |
| passwords/ | 2026-03-28 18:09 | - | |
| paste/ | 2026-03-28 18:09 | - | |
| pastel/ | 2026-03-28 18:09 | - | |
| patch-picture/ | 2026-03-28 18:09 | - | |
| patch/ | 2026-03-28 18:09 | - | |
| patcher/ | 2026-03-28 18:09 | - | |
| path-cleanup/ | 2026-03-28 18:10 | - | |
| path-environment-variables/ | 2026-03-28 18:10 | - | |
| path-tracer/ | 2026-03-28 18:09 | - | |
| path-variable/ | 2026-03-28 18:10 | - | |
| path-variables/ | 2026-03-28 18:10 | - | |
| path/ | 2026-03-28 18:09 | - | |
| pathcleanup/ | 2026-03-28 18:10 | - | |
| pathenvironmentvariables/ | 2026-03-28 18:10 | - | |
| pathofexile/ | 2026-03-28 18:09 | - | |
| pathvariables/ | 2026-03-28 18:10 | - | |
| pathwave/ | 2026-03-28 18:09 | - | |
| pattern-generator/ | 2026-03-28 18:09 | - | |
| pattern-highlighting/ | 2026-03-28 18:09 | - | |
| pattern-language/ | 2026-03-28 18:09 | - | |
| pattern/ | 2026-03-28 18:09 | - | |
| pause/ | 2026-03-28 18:09 | - | |
| pawn-io/ | 2026-03-28 18:10 | - | |
| pawn.io/ | 2026-03-28 18:10 | - | |
| pawnio.inf/ | 2026-03-28 18:10 | - | |
| pawnpp/ | 2026-03-28 18:10 | - | |
| payload/ | 2026-03-28 18:09 | - | |
| pbkdf2/ | 2026-03-28 18:09 | - | |
| pbx/ | 2026-03-28 18:09 | - | |
| pc-case-fans/ | 2026-03-28 18:09 | - | |
| pc-cleaner/ | 2026-03-28 18:09 | - | |
| pc-dos/ | 2026-03-28 18:10 | - | |
| pc-emulator/ | 2026-03-28 18:09 | - | |
| pc-engine/ | 2026-03-28 18:10 | - | |
| pc-kasse/ | 2026-03-28 18:09 | - | |
| pc-optimization/ | 2026-03-28 18:09 | - | |
| pc-speed/ | 2026-03-28 18:10 | - | |
| pc-volume/ | 2026-03-28 18:09 | - | |
| pc/ | 2026-03-28 18:09 | - | |
| pc98/ | 2026-03-28 18:10 | - | |
| pca/ | 2026-03-28 18:09 | - | |
| pcap/ | 2026-03-28 18:09 | - | |
| pcb/ | 2026-03-28 18:09 | - | |
| pccasefans/ | 2026-03-28 18:09 | - | |
| pcdos/ | 2026-03-28 18:10 | - | |
| pcehawk turbonyma turbografx16 pcengine/ | 2026-03-28 18:10 | - | |
| pcem/ | 2026-03-28 18:09 | - | |
| pci/ | 2026-03-28 18:09 | - | |
| pck-files/ | 2026-03-28 18:09 | - | |
| pck-unpacker/ | 2026-03-28 18:09 | - | |
| pckasse/ | 2026-03-28 18:09 | - | |
| pckfiles/ | 2026-03-28 18:09 | - | |
| pcl2/ | 2026-03-28 18:10 | - | |
| pcloud/ | 2026-03-28 18:10 | - | |
| pclstats/ | 2026-03-28 18:09 | - | |
| pcr/ | 2026-03-28 18:10 | - | |
| pc servicetool/ | 2026-03-28 18:09 | - | |
| pcsx2/ | 2026-03-28 18:09 | - | |
| pcx/ | 2026-03-28 18:09 | - | |
| pd/ | 2026-03-28 18:09 | - | |
| pdanetplus/ | 2026-03-28 18:09 | - | |
| pdb/ | 2026-03-28 18:09 | - | |
| pdf-architect/ | 2026-03-28 18:09 | - | |
| pdf-conversion/ | 2026-03-28 18:09 | - | |
| pdf-converter/ | 2026-03-28 18:09 | - | |
| pdf-creator/ | 2026-03-28 18:09 | - | |
| pdf-document-processor/ | 2026-03-28 18:09 | - | |
| pdf-edit/ | 2026-03-28 18:10 | - | |
| pdf-editor/ | 2026-03-28 18:09 | - | |
| pdf-export/ | 2026-03-28 18:09 | - | |
| pdf-files/ | 2026-03-28 18:09 | - | |
| pdf-forms/ | 2026-03-28 18:09 | - | |
| pdf-lib/ | 2026-03-28 18:10 | - | |
| pdf-manipulation/ | 2026-03-28 18:10 | - | |
| pdf-merger/ | 2026-03-28 18:10 | - | |
| pdf-ocr/ | 2026-03-28 18:10 | - | |
| pdf-output/ | 2026-03-28 18:10 | - | |
| pdf-printer/ | 2026-03-28 18:09 | - | |
| pdf-processor/ | 2026-03-28 18:10 | - | |
| pdf-reader/ | 2026-03-28 18:09 | - | |
| pdf-to-mp3/ | 2026-03-28 18:09 | - | |
| pdf-toolkit/ | 2026-03-28 18:09 | - | |
| pdf-tools/ | 2026-03-28 18:09 | - | |
| pdf-verbinden/ | 2026-03-28 18:10 | - | |
| pdf-viewer/ | 2026-03-28 18:09 | - | |
| pdf-web-apps/ | 2026-03-28 18:10 | - | |
| pdf-writer/ | 2026-03-28 18:09 | - | |
| pdf-zusammenfuegen/ | 2026-03-28 18:10 | - | |
| pdf/ | 2026-03-28 18:09 | - | |
| pdfcompiler/ | 2026-03-28 18:09 | - | |
| pdfcreator/ | 2026-03-28 18:09 | - | |
| pdffiles/ | 2026-03-28 18:09 | - | |
| pdflib/ | 2026-03-28 18:10 | - | |
| pdfmerger/ | 2026-03-28 18:10 | - | |
| pdfopener/ | 2026-03-28 18:09 | - | |
| pdfreader/ | 2026-03-28 18:10 | - | |
| pdq-connect/ | 2026-03-28 18:09 | - | |
| pdq-detect/ | 2026-03-28 18:09 | - | |
| pdq/ | 2026-03-28 18:09 | - | |
| pe-analyzer-gui/ | 2026-03-28 18:09 | - | |
| pe-analyzer/ | 2026-03-28 18:09 | - | |
| pe-editor/ | 2026-03-28 18:09 | - | |
| pe-file/ | 2026-03-28 18:09 | - | |
| pe-format/ | 2026-03-28 18:09 | - | |
| pe/ | 2026-03-28 18:09 | - | |
| peekaboo/ | 2026-03-28 18:10 | - | |
| peer-to-peer/ | 2026-03-28 18:09 | - | |
| peer/ | 2026-03-28 18:09 | - | |
| pefiles/ | 2026-03-28 18:10 | - | |
| peimages/ | 2026-03-28 18:10 | - | |
| peking-university/ | 2026-03-28 18:10 | - | |
| pekkakana2/ | 2026-03-28 18:10 | - | |
| pem/ | 2026-03-28 18:09 | - | |
| penguin/ | 2026-03-28 18:09 | - | |
| pentablet/ | 2026-03-28 18:09 | - | |
| pentest/ | 2026-03-28 18:09 | - | |
| pentesting-tool/ | 2026-03-28 18:09 | - | |
| pentesting/ | 2026-03-28 18:09 | - | |
| pep8/ | 2026-03-28 18:10 | - | |
| percentage/ | 2026-03-28 18:09 | - | |
| performance-analysis/ | 2026-03-28 18:09 | - | |
| performance-monitoring/ | 2026-03-28 18:10 | - | |
| performance-testing/ | 2026-03-28 18:09 | - | |
| performance-tuning/ | 2026-03-28 18:10 | - | |
| performance/ | 2026-03-28 18:09 | - | |
| performanceperwatt/ | 2026-03-28 18:09 | - | |
| performance testing/ | 2026-03-28 18:09 | - | |
| perl/ | 2026-03-28 18:09 | - | |
| permission/ | 2026-03-28 18:09 | - | |
| permissions/ | 2026-03-28 18:09 | - | |
| persistence/ | 2026-03-28 18:10 | - | |
| personal-finance/ | 2026-03-28 18:09 | - | |
| personal-information-manager/ | 2026-03-28 18:09 | - | |
| personal-knowledge-base/ | 2026-03-28 18:09 | - | |
| personal-management/ | 2026-03-28 18:09 | - | |
| personal-wiki/ | 2026-03-28 18:10 | - | |
| personalausweis/ | 2026-03-28 18:09 | - | |
| pex-decompiler/ | 2026-03-28 18:10 | - | |
| pex-to-psc-converter/ | 2026-03-28 18:10 | - | |
| pex2psc/ | 2026-03-28 18:10 | - | |
| pexdecompiler/ | 2026-03-28 18:10 | - | |
| pextopscconverter/ | 2026-03-28 18:10 | - | |
| pf/ | 2026-03-28 18:09 | - | |
| pfazure/ | 2026-03-28 18:09 | - | |
| pfm/ | 2026-03-28 18:10 | - | |
| pgm/ | 2026-03-28 18:10 | - | |
| pgn/ | 2026-03-28 18:09 | - | |
| pgp-key/ | 2026-03-28 18:09 | - | |
| pgp/ | 2026-03-28 18:09 | - | |
| pgsql/ | 2026-03-28 18:09 | - | |
| philipshue/ | 2026-03-28 18:10 | - | |
| phillips-hue/ | 2026-03-28 18:09 | - | |
| phillips-light/ | 2026-03-28 18:09 | - | |
| phoenix/ | 2026-03-28 18:09 | - | |
| phone/ | 2026-03-28 18:09 | - | |
| phonecalls/ | 2026-03-28 18:10 | - | |
| phone system/ | 2026-03-28 18:10 | - | |
| phonetics/ | 2026-03-28 18:10 | - | |
| photino/ | 2026-03-28 18:10 | - | |
| photo-adjustments/ | 2026-03-28 18:10 | - | |
| photo-album/ | 2026-03-28 18:10 | - | |
| photo-albums/ | 2026-03-28 18:09 | - | |
| photo-converter/ | 2026-03-28 18:09 | - | |
| photo-editing/ | 2026-03-28 18:09 | - | |
| photo-editor/ | 2026-03-28 18:09 | - | |
| photo-gallery/ | 2026-03-28 18:10 | - | |
| photo-manager/ | 2026-03-28 18:09 | - | |
| photo-organizer/ | 2026-03-28 18:09 | - | |
| photo-printing/ | 2026-03-28 18:09 | - | |
| photo-processing/ | 2026-03-28 18:09 | - | |
| photo-viewer/ | 2026-03-28 18:09 | - | |
| photo/ | 2026-03-28 18:09 | - | |
| photogrammetry/ | 2026-03-28 18:09 | - | |
| photography/ | 2026-03-28 18:09 | - | |
| photonics/ | 2026-03-28 18:10 | - | |
| photoprinting/ | 2026-03-28 18:09 | - | |
| photos/ | 2026-03-28 18:09 | - | |
| photoshop/ | 2026-03-28 18:09 | - | |
| photovoltaic/ | 2026-03-28 18:09 | - | |
| php/ | 2026-03-28 18:09 | - | |
| php81/ | 2026-03-28 18:10 | - | |
| php82/ | 2026-03-28 18:10 | - | |
| php83/ | 2026-03-28 18:10 | - | |
| php84/ | 2026-03-28 18:10 | - | |
| php85/ | 2026-03-28 18:10 | - | |
| phpmyadmin/ | 2026-03-28 18:10 | - | |
| phpunit/ | 2026-03-28 18:09 | - | |
| phun/ | 2026-03-28 18:09 | - | |
| physically-based-rendering/ | 2026-03-28 18:09 | - | |
| physics/ | 2026-03-28 18:09 | - | |
| physicseffects/ | 2026-03-28 18:09 | - | |
| physicsengine/ | 2026-03-28 18:09 | - | |
| physx/ | 2026-03-28 18:09 | - | |
| pi-hole/ | 2026-03-28 18:10 | - | |
| piano-chords/ | 2026-03-28 18:09 | - | |
| piano-player/ | 2026-03-28 18:09 | - | |
| piano/ | 2026-03-28 18:09 | - | |
| picgo/ | 2026-03-28 18:09 | - | |
| picguard/ | 2026-03-28 18:09 | - | |
| picker/ | 2026-03-28 18:09 | - | |
| piclist/ | 2026-03-28 18:09 | - | |
| picodrive sega32x saturnus segasaturn/ | 2026-03-28 18:10 | - | |
| picotuner/ | 2026-03-28 18:10 | - | |
| picross/ | 2026-03-28 18:09 | - | |
| pictogram/ | 2026-03-28 18:09 | - | |
| picture-converter/ | 2026-03-28 18:09 | - | |
| picture-in-picture/ | 2026-03-28 18:09 | - | |
| picture-metadata/ | 2026-03-28 18:09 | - | |
| picture-viewer/ | 2026-03-28 18:09 | - | |
| picture/ | 2026-03-28 18:09 | - | |
| picturemetadata/ | 2026-03-28 18:09 | - | |
| pictures/ | 2026-03-28 18:09 | - | |
| pictureuploader/ | 2026-03-28 18:10 | - | |
| pie-menu/ | 2026-03-28 18:09 | - | |
| piece/ | 2026-03-28 18:09 | - | |
| pierre-barre/ | 2026-03-28 18:10 | - | |
| pilot/ | 2026-03-28 18:10 | - | |
| pim/ | 2026-03-28 18:09 | - | |
| pin/ | 2026-03-28 18:09 | - | |
| pin_tan/ | 2026-03-28 18:09 | - | |
| pine64/ | 2026-03-28 18:09 | - | |
| pinecil-v2/ | 2026-03-28 18:09 | - | |
| pinecil/ | 2026-03-28 18:09 | - | |
| ping/ | 2026-03-28 18:09 | - | |
| pinga/ | 2026-03-28 18:09 | - | |
| pingo/ | 2026-03-28 18:09 | - | |
| pingt/ | 2026-03-28 18:10 | - | |
| pingu/ | 2026-03-28 18:09 | - | |
| pinning/ | 2026-03-28 18:09 | - | |
| pinta/ | 2026-03-28 18:10 | - | |
| pinyin/ | 2026-03-28 18:09 | - | |
| pioneer/ | 2026-03-28 18:09 | - | |
| pioneerdj/ | 2026-03-28 18:10 | - | |
| pioneerlaseractive/ | 2026-03-28 18:09 | - | |
| pip/ | 2026-03-28 18:09 | - | |
| pipe-puzzle-game/ | 2026-03-28 18:09 | - | |
| pipe/ | 2026-03-28 18:10 | - | |
| pipeline/ | 2026-03-28 18:09 | - | |
| pipelines/ | 2026-03-28 18:09 | - | |
| pipepuzzlegame/ | 2026-03-28 18:09 | - | |
| pipes/ | 2026-03-28 18:09 | - | |
| pipewire/ | 2026-03-28 18:09 | - | |
| piracy/ | 2026-03-28 18:09 | - | |
| pirates/ | 2026-03-28 18:10 | - | |
| pistegamez/ | 2026-03-28 18:10 | - | |
| pitch-shift/ | 2026-03-28 18:09 | - | |
| pitch-shifting/ | 2026-03-28 18:10 | - | |
| piv/ | 2026-03-28 18:09 | - | |
| pivot-table/ | 2026-03-28 18:09 | - | |
| pivot-tables/ | 2026-03-28 18:09 | - | |
| pivot/ | 2026-03-28 18:09 | - | |
| pivots/ | 2026-03-28 18:09 | - | |
| pixcut/ | 2026-03-28 18:09 | - | |
| pixel-art-maker/ | 2026-03-28 18:10 | - | |
| pixel-art/ | 2026-03-28 18:09 | - | |
| pixel-capture/ | 2026-03-28 18:09 | - | |
| pixel-editor/ | 2026-03-28 18:10 | - | |
| pixelart/ | 2026-03-28 18:09 | - | |
| pixelfed/ | 2026-03-28 18:09 | - | |
| pixiv-client/ | 2026-03-28 18:09 | - | |
| pixiv/ | 2026-03-28 18:09 | - | |
| pixoo/ | 2026-03-28 18:09 | - | |
| pixoo64/ | 2026-03-28 18:09 | - | |
| pixso/ | 2026-03-28 18:09 | - | |
| pixstudio/ | 2026-03-28 18:09 | - | |
| pk2/ | 2026-03-28 18:10 | - | |
| pkcs7/ | 2026-03-28 18:10 | - | |
| pkcs11/ | 2026-03-28 18:09 | - | |
| pkg/ | 2026-03-28 18:10 | - | |
| pki/ | 2026-03-28 18:09 | - | |
| pkm/ | 2026-03-28 18:09 | - | |
| pktmon/ | 2026-03-28 18:09 | - | |
| pktokens/ | 2026-03-28 18:10 | - | |
| pku/ | 2026-03-28 18:10 | - | |
| pl_sql/ | 2026-03-28 18:09 | - | |
| plain-craft-launcher/ | 2026-03-28 18:10 | - | |
| plain-text-accounting/ | 2026-03-28 18:10 | - | |
| plain-text/ | 2026-03-28 18:10 | - | |
| plaintext-accounting/ | 2026-03-28 18:10 | - | |
| plaintext/ | 2026-03-28 18:10 | - | |
| plan/ | 2026-03-28 18:09 | - | |
| planet/ | 2026-03-28 18:09 | - | |
| planetarium/ | 2026-03-28 18:09 | - | |
| plantronics/ | 2026-03-28 18:09 | - | |
| plantuml/ | 2026-03-28 18:09 | - | |
| plasma-desktop/ | 2026-03-28 18:09 | - | |
| plasma/ | 2026-03-28 18:09 | - | |
| plasmoid/ | 2026-03-28 18:09 | - | |
| platform-engineering/ | 2026-03-28 18:09 | - | |
| platform-tools/ | 2026-03-28 18:09 | - | |
| platform/ | 2026-03-28 18:09 | - | |
| platformer-game/ | 2026-03-28 18:10 | - | |
| platformer/ | 2026-03-28 18:09 | - | |
| platinum/ | 2026-03-28 18:10 | - | |
| play-games/ | 2026-03-28 18:09 | - | |
| play-points/ | 2026-03-28 18:09 | - | |
| play-store/ | 2026-03-28 18:09 | - | |
| play/ | 2026-03-28 18:09 | - | |
| playback/ | 2026-03-28 18:09 | - | |
| playcanvas/ | 2026-03-28 18:10 | - | |
| player/ | 2026-03-28 18:09 | - | |
| playground/ | 2026-03-28 18:10 | - | |
| playlist/ | 2026-03-28 18:09 | - | |
| playlists/ | 2026-03-28 18:09 | - | |
| playready/ | 2026-03-28 18:10 | - | |
| playstation-5/ | 2026-03-28 18:10 | - | |
| playstation-accessories/ | 2026-03-28 18:10 | - | |
| playstation-controllers/ | 2026-03-28 18:09 | - | |
| playstation-portable/ | 2026-03-28 18:09 | - | |
| playstation/ | 2026-03-28 18:09 | - | |
| playstation2/ | 2026-03-28 18:09 | - | |
| playstation3/ | 2026-03-28 18:09 | - | |
| playstation3fat/ | 2026-03-28 18:10 | - | |
| playstation4/ | 2026-03-28 18:10 | - | |
| playstation5/ | 2026-03-28 18:10 | - | |
| playstationcontrollers/ | 2026-03-28 18:09 | - | |
| playstationportable/ | 2026-03-28 18:09 | - | |
| pleroma/ | 2026-03-28 18:09 | - | |
| plex-client/ | 2026-03-28 18:10 | - | |
| plex-for-windows/ | 2026-03-28 18:10 | - | |
| plex-home-theater-pc/ | 2026-03-28 18:09 | - | |
| plex-htpc/ | 2026-03-28 18:09 | - | |
| plex-media-server/ | 2026-03-28 18:09 | - | |
| plex/ | 2026-03-28 18:09 | - | |
| plexforwindows/ | 2026-03-28 18:10 | - | |
| plexhometheaterpc/ | 2026-03-28 18:09 | - | |
| plitch/ | 2026-03-28 18:10 | - | |
| plot/ | 2026-03-28 18:09 | - | |
| plotting/ | 2026-03-28 18:09 | - | |
| plsql/ | 2026-03-28 18:09 | - | |
| plug-in/ | 2026-03-28 18:09 | - | |
| plugin-support/ | 2026-03-28 18:09 | - | |
| plugin/ | 2026-03-28 18:09 | - | |
| plugins/ | 2026-03-28 18:09 | - | |
| plus/ | 2026-03-28 18:10 | - | |
| plutosdr/ | 2026-03-28 18:10 | - | |
| pm2/ | 2026-03-28 18:10 | - | |
| pm3/ | 2026-03-28 18:09 | - | |
| pm4/ | 2026-03-28 18:09 | - | |
| pm5/ | 2026-03-28 18:09 | - | |
| pmndrs/ | 2026-03-28 18:10 | - | |
| pmux/ | 2026-03-28 18:09 | - | |
| pneteth.inf/ | 2026-03-28 18:09 | - | |
| pneumatictube/ | 2026-03-28 18:09 | - | |
| png-2-dds/ | 2026-03-28 18:09 | - | |
| png-compression/ | 2026-03-28 18:09 | - | |
| png-converter/ | 2026-03-28 18:09 | - | |
| png-optimization/ | 2026-03-28 18:10 | - | |
| png-to-dds/ | 2026-03-28 18:09 | - | |
| png/ | 2026-03-28 18:09 | - | |
| png2icons/ | 2026-03-28 18:10 | - | |
| pngcompression/ | 2026-03-28 18:09 | - | |
| pngoptimization/ | 2026-03-28 18:09 | - | |
| pngquant/ | 2026-03-28 18:09 | - | |
| pngtodds/ | 2026-03-28 18:09 | - | |
| pnpm/ | 2026-03-28 18:09 | - | |
| pnpunattend/ | 2026-03-28 18:09 | - | |
| pnputil/ | 2026-03-28 18:09 | - | |
| po-files/ | 2026-03-28 18:09 | - | |
| po/ | 2026-03-28 18:10 | - | |
| pob/ | 2026-03-28 18:10 | - | |
| pocketchallengev2/ | 2026-03-28 18:09 | - | |
| pod/ | 2026-03-28 18:09 | - | |
| podcast/ | 2026-03-28 18:09 | - | |
| podman-desktop/ | 2026-03-28 18:09 | - | |
| podman/ | 2026-03-28 18:09 | - | |
| poe/ | 2026-03-28 18:09 | - | |
| poi/ | 2026-03-28 18:10 | - | |
| point-and-click/ | 2026-03-28 18:10 | - | |
| point-cloud/ | 2026-03-28 18:09 | - | |
| point-to-point-direct-communication/ | 2026-03-28 18:10 | - | |
| pokémon/ | 2026-03-28 18:09 | - | |
| pokemon/ | 2026-03-28 18:09 | - | |
| poker/ | 2026-03-28 18:09 | - | |
| pol/ | 2026-03-28 18:09 | - | |
| policy/ | 2026-03-28 18:10 | - | |
| poll/ | 2026-03-28 18:10 | - | |
| poly/ | 2026-03-28 18:09 | - | |
| polyglot-microservices/ | 2026-03-28 18:09 | - | |
| polygon/ | 2026-03-28 18:10 | - | |
| polymc/ | 2026-03-28 18:09 | - | |
| pomodoro-app/ | 2026-03-28 18:09 | - | |
| pomodoro-clock/ | 2026-03-28 18:10 | - | |
| pomodoro-technique/ | 2026-03-28 18:09 | - | |
| pomodoro-timer/ | 2026-03-28 18:09 | - | |
| pomodoro/ | 2026-03-28 18:09 | - | |
| pongo2/ | 2026-03-28 18:10 | - | |
| pop/ | 2026-03-28 18:09 | - | |
| popcorn-time/ | 2026-03-28 18:10 | - | |
| poppler-data/ | 2026-03-28 18:10 | - | |
| poppler-feedstock/ | 2026-03-28 18:10 | - | |
| poppler/ | 2026-03-28 18:09 | - | |
| port-forward/ | 2026-03-28 18:09 | - | |
| port-forwarding/ | 2026-03-28 18:09 | - | |
| port-manager/ | 2026-03-28 18:09 | - | |
| port-scanner/ | 2026-03-28 18:09 | - | |
| port/ | 2026-03-28 18:09 | - | |
| portability/ | 2026-03-28 18:09 | - | |
| portable-apps/ | 2026-03-28 18:10 | - | |
| portable-executable/ | 2026-03-28 18:10 | - | |
| portable-spreadsheet/ | 2026-03-28 18:09 | - | |
| portable/ | 2026-03-28 18:09 | - | |
| portableexecutable/ | 2026-03-28 18:10 | - | |
| portablemultitool/ | 2026-03-28 18:09 | - | |
| portal/ | 2026-03-28 18:10 | - | |
| portaudio/ | 2026-03-28 18:09 | - | |
| portmanger/ | 2026-03-28 18:09 | - | |
| ports/ | 2026-03-28 18:09 | - | |
| pos/ | 2026-03-28 18:09 | - | |
| post-apocalyptic/ | 2026-03-28 18:09 | - | |
| post-installation/ | 2026-03-28 18:09 | - | |
| post-quantum/ | 2026-03-28 18:09 | - | |
| post/ | 2026-03-28 18:09 | - | |
| postal/ | 2026-03-28 18:09 | - | |
| postapocalyptic/ | 2026-03-28 18:09 | - | |
| poster/ | 2026-03-28 18:09 | - | |
| postgis/ | 2026-03-28 18:09 | - | |
| postgre/ | 2026-03-28 18:09 | - | |
| postgres/ | 2026-03-28 18:09 | - | |
| postgrespro/ | 2026-03-28 18:09 | - | |
| postgresql/ | 2026-03-28 18:09 | - | |
| postman-collection/ | 2026-03-28 18:10 | - | |
| postman/ | 2026-03-28 18:10 | - | |
| postscript/ | 2026-03-28 18:09 | - | |
| pot-app/ | 2026-03-28 18:09 | - | |
| pot/ | 2026-03-28 18:09 | - | |
| potential-secrets/ | 2026-03-28 18:10 | - | |
| potplayer/ | 2026-03-28 18:10 | - | |
| power-bi/ | 2026-03-28 18:09 | - | |
| power-button/ | 2026-03-28 18:10 | - | |
| power-control/ | 2026-03-28 18:09 | - | |
| power-toys/ | 2026-03-28 18:09 | - | |
| power/ | 2026-03-28 18:09 | - | |
| powerapps/ | 2026-03-28 18:09 | - | |
| powerbi/ | 2026-03-28 18:09 | - | |
| powerdraw-specs/ | 2026-03-28 18:10 | - | |
| powermenu/ | 2026-03-28 18:09 | - | |
| powerpanel/ | 2026-03-28 18:09 | - | |
| powerpoint/ | 2026-03-28 18:09 | - | |
| powerrename/ | 2026-03-28 18:09 | - | |
| powersavesportal/ | 2026-03-28 18:09 | - | |
| powersession/ | 2026-03-28 18:09 | - | |
| powershell-gallery/ | 2026-03-28 18:09 | - | |
| powershell-script/ | 2026-03-28 18:09 | - | |
| powershell/ | 2026-03-28 18:09 | - | |
| powertoys-command-palette/ | 2026-03-28 18:09 | - | |
| powertoys-run-plugin/ | 2026-03-28 18:09 | - | |
| powertoys-run/ | 2026-03-28 18:09 | - | |
| powertoys/ | 2026-03-28 18:09 | - | |
| ppm/ | 2026-03-28 18:09 | - | |
| ppt/ | 2026-03-28 18:09 | - | |
| pptx/ | 2026-03-28 18:09 | - | |
| pqc/ | 2026-03-28 18:09 | - | |
| prayer-times/ | 2026-03-28 18:09 | - | |
| pre-commit-hook/ | 2026-03-28 18:09 | - | |
| pre-commit/ | 2026-03-28 18:09 | - | |
| pre-processor/ | 2026-03-28 18:09 | - | |
| pre-push/ | 2026-03-28 18:10 | - | |
| pre-release/ | 2026-03-28 18:09 | - | |
| precision/ | 2026-03-28 18:09 | - | |
| prediction/ | 2026-03-28 18:09 | - | |
| prek/ | 2026-03-28 18:09 | - | |
| premake/ | 2026-03-28 18:10 | - | |
| premiere-pro/ | 2026-03-28 18:09 | - | |
| premiere/ | 2026-03-28 18:09 | - | |
| premiumsoft/ | 2026-03-28 18:09 | - | |
| preprocessing/ | 2026-03-28 18:10 | - | |
| presence-api/ | 2026-03-28 18:09 | - | |
| presence/ | 2026-03-28 18:09 | - | |
| present/ | 2026-03-28 18:09 | - | |
| presentation/ | 2026-03-28 18:09 | - | |
| presentations/ | 2026-03-28 18:09 | - | |
| presenter/ | 2026-03-28 18:09 | - | |
| preservation/ | 2026-03-28 18:09 | - | |
| presto/ | 2026-03-28 18:09 | - | |
| prettify/ | 2026-03-28 18:09 | - | |
| preview/ | 2026-03-28 18:09 | - | |
| previewfonts/ | 2026-03-28 18:10 | - | |
| previewing/ | 2026-03-28 18:09 | - | |
| prime-numbers/ | 2026-03-28 18:09 | - | |
| prime/ | 2026-03-28 18:09 | - | |
| primes/ | 2026-03-28 18:09 | - | |
| print-management/ | 2026-03-28 18:10 | - | |
| print/ | 2026-03-28 18:09 | - | |
| printer-driver-security-support-tool/ | 2026-03-28 18:10 | - | |
| printer/ | 2026-03-28 18:09 | - | |
| printing/ | 2026-03-28 18:09 | - | |
| printing of car environmental list/ | 2026-03-28 18:10 | - | |
| printing of certificate of conformity/ | 2026-03-28 18:10 | - | |
| printing platform management system/ | 2026-03-28 18:10 | - | |
| printing system/ | 2026-03-28 18:10 | - | |
| print module of car environmental list/ | 2026-03-28 18:10 | - | |
| print of car certificate of conformity/ | 2026-03-28 18:10 | - | |
| priority/ | 2026-03-28 18:09 | - | |
| prism/ | 2026-03-28 18:09 | - | |
| prismatik/ | 2026-03-28 18:10 | - | |
| prismlauncher/ | 2026-03-28 18:09 | - | |
| privacy-protection/ | 2026-03-28 18:10 | - | |
| privacy-tools/ | 2026-03-28 18:09 | - | |
| privacy/ | 2026-03-28 18:09 | - | |
| private-cloud/ | 2026-03-28 18:09 | - | |
| private-keys/ | 2026-03-28 18:09 | - | |
| private-network/ | 2026-03-28 18:09 | - | |
| private/ | 2026-03-28 18:09 | - | |
| privatekeys/ | 2026-03-28 18:10 | - | |
| priviledge/ | 2026-03-28 18:09 | - | |
| privilege/ | 2026-03-28 18:09 | - | |
| probability-distribution/ | 2026-03-28 18:09 | - | |
| probability/ | 2026-03-28 18:09 | - | |
| procedural-generation/ | 2026-03-28 18:09 | - | |
| proceduralterraingeneration/ | 2026-03-28 18:09 | - | |
| process-documents/ | 2026-03-28 18:09 | - | |
| process-killer/ | 2026-03-28 18:09 | - | |
| process-manager/ | 2026-03-28 18:09 | - | |
| process-monitor/ | 2026-03-28 18:10 | - | |
| process-text/ | 2026-03-28 18:09 | - | |
| process-viewer/ | 2026-03-28 18:09 | - | |
| process/ | 2026-03-28 18:09 | - | |
| processing/ | 2026-03-28 18:09 | - | |
| processmanager/ | 2026-03-28 18:09 | - | |
| processor-fans/ | 2026-03-28 18:09 | - | |
| processor/ | 2026-03-28 18:09 | - | |
| processormeasuring/ | 2026-03-28 18:09 | - | |
| procrastination/ | 2026-03-28 18:10 | - | |
| proctoring/ | 2026-03-28 18:10 | - | |
| product-design/ | 2026-03-28 18:10 | - | |
| product-management/ | 2026-03-28 18:10 | - | |
| product/ | 2026-03-28 18:09 | - | |
| production/ | 2026-03-28 18:09 | - | |
| productivity-app/ | 2026-03-28 18:10 | - | |
| productivity-booster/ | 2026-03-28 18:10 | - | |
| productivity-timer/ | 2026-03-28 18:10 | - | |
| productivity-tool/ | 2026-03-28 18:10 | - | |
| productivity/ | 2026-03-28 18:09 | - | |
| profile/ | 2026-03-28 18:09 | - | |
| profiles/ | 2026-03-28 18:09 | - | |
| profiling-library/ | 2026-03-28 18:10 | - | |
| profiling/ | 2026-03-28 18:09 | - | |
| program-analysis/ | 2026-03-28 18:09 | - | |
| program/ | 2026-03-28 18:09 | - | |
| programmer/ | 2026-03-28 18:09 | - | |
| programming-ide/ | 2026-03-28 18:10 | - | |
| programming-language/ | 2026-03-28 18:09 | - | |
| programming/ | 2026-03-28 18:09 | - | |
| programminglanguage/ | 2026-03-28 18:09 | - | |
| progremmer/ | 2026-03-28 18:10 | - | |
| progressive-web-app/ | 2026-03-28 18:09 | - | |
| project-launcher/ | 2026-03-28 18:09 | - | |
| project-management-tool/ | 2026-03-28 18:09 | - | |
| project-management/ | 2026-03-28 18:09 | - | |
| project-manager/ | 2026-03-28 18:09 | - | |
| project-tracking/ | 2026-03-28 18:09 | - | |
| project/ | 2026-03-28 18:09 | - | |
| project64/ | 2026-03-28 18:10 | - | |
| projecthawkthorne/ | 2026-03-28 18:09 | - | |
| projecting/ | 2026-03-28 18:09 | - | |
| projection-mapping/ | 2026-03-28 18:09 | - | |
| projection/ | 2026-03-28 18:09 | - | |
| projection mapping/ | 2026-03-28 18:09 | - | |
| projections/ | 2026-03-28 18:09 | - | |
| projectmanagementtool/ | 2026-03-28 18:09 | - | |
| projector/ | 2026-03-28 18:09 | - | |
| projectors/ | 2026-03-28 18:09 | - | |
| projects/ | 2026-03-28 18:09 | - | |
| projt/ | 2026-03-28 18:10 | - | |
| projtlauncher/ | 2026-03-28 18:10 | - | |
| prolog/ | 2026-03-28 18:09 | - | |
| prometheus-exporter/ | 2026-03-28 18:09 | - | |
| prometheus/ | 2026-03-28 18:09 | - | |
| prompt-engineering/ | 2026-03-28 18:09 | - | |
| prompt/ | 2026-03-28 18:09 | - | |
| promptflow/ | 2026-03-28 18:09 | - | |
| proof-of-space/ | 2026-03-28 18:09 | - | |
| proof-of-time/ | 2026-03-28 18:09 | - | |
| properties/ | 2026-03-28 18:09 | - | |
| proplus/ | 2026-03-28 18:09 | - | |
| proresrawhq/ | 2026-03-28 18:09 | - | |
| protect-files/ | 2026-03-28 18:09 | - | |
| protect-photos/ | 2026-03-28 18:09 | - | |
| protect/ | 2026-03-28 18:09 | - | |
| protection/ | 2026-03-28 18:09 | - | |
| protein-folding/ | 2026-03-28 18:10 | - | |
| protein/ | 2026-03-28 18:09 | - | |
| proteins/ | 2026-03-28 18:10 | - | |
| proteomics/ | 2026-03-28 18:09 | - | |
| protobuf-runtime/ | 2026-03-28 18:09 | - | |
| protobuf/ | 2026-03-28 18:09 | - | |
| protoc/ | 2026-03-28 18:09 | - | |
| protocol-analyzer/ | 2026-03-28 18:10 | - | |
| protocol-buffers/ | 2026-03-28 18:09 | - | |
| protocol-compiler/ | 2026-03-28 18:09 | - | |
| protocol/ | 2026-03-28 18:09 | - | |
| proton-mail/ | 2026-03-28 18:10 | - | |
| proton/ | 2026-03-28 18:09 | - | |
| protonmail/ | 2026-03-28 18:09 | - | |
| protonvpn/ | 2026-03-28 18:10 | - | |
| prototype/ | 2026-03-28 18:09 | - | |
| prototypes/ | 2026-03-28 18:09 | - | |
| protractor/ | 2026-03-28 18:10 | - | |
| provider/ | 2026-03-28 18:09 | - | |
| prowlarr/ | 2026-03-28 18:09 | - | |
| proxies/ | 2026-03-28 18:09 | - | |
| proxifier-alternative/ | 2026-03-28 18:10 | - | |
| proxifier/ | 2026-03-28 18:10 | - | |
| proxmox/ | 2026-03-28 18:09 | - | |
| proxmoxve/ | 2026-03-28 18:09 | - | |
| proxy-checker/ | 2026-03-28 18:09 | - | |
| proxy-client/ | 2026-03-28 18:09 | - | |
| proxy-injection/ | 2026-03-28 18:10 | - | |
| proxy-list/ | 2026-03-28 18:09 | - | |
| proxy-server/ | 2026-03-28 18:10 | - | |
| proxy/ | 2026-03-28 18:09 | - | |
| proxychains/ | 2026-03-28 18:10 | - | |
| prrawdebayer.dll/ | 2026-03-28 18:09 | - | |
| prrawdecoder.dll/ | 2026-03-28 18:09 | - | |
| prt/ | 2026-03-28 18:10 | - | |
| prtg/ | 2026-03-28 18:09 | - | |
| prun/ | 2026-03-28 18:09 | - | |
| prune/ | 2026-03-28 18:09 | - | |
| prusa-slicer/ | 2026-03-28 18:09 | - | |
| prusa/ | 2026-03-28 18:09 | - | |
| ps-vita/ | 2026-03-28 18:10 | - | |
| ps/ | 2026-03-28 18:09 | - | |
| ps1-to-msix/ | 2026-03-28 18:09 | - | |
| ps1/ | 2026-03-28 18:09 | - | |
| ps2/ | 2026-03-28 18:09 | - | |
| ps3/ | 2026-03-28 18:10 | - | |
| ps3fat/ | 2026-03-28 18:10 | - | |
| ps4/ | 2026-03-28 18:09 | - | |
| ps5/ | 2026-03-28 18:09 | - | |
| psd/ | 2026-03-28 18:09 | - | |
| pseudorandom/ | 2026-03-28 18:09 | - | |
| psf/ | 2026-03-28 18:09 | - | |
| psiphon/ | 2026-03-28 18:09 | - | |
| psp/ | 2026-03-28 18:09 | - | |
| psr-sx/ | 2026-03-28 18:10 | - | |
| psu/ | 2026-03-28 18:09 | - | |
| psv/ | 2026-03-28 18:10 | - | |
| psvita/ | 2026-03-28 18:10 | - | |
| psx/ | 2026-03-28 18:09 | - | |
| ptm/ | 2026-03-28 18:09 | - | |
| ptptrackhound/ | 2026-03-28 18:09 | - | |
| pty/ | 2026-03-28 18:10 | - | |
| public/ | 2026-03-28 18:10 | - | |
| publickeys/ | 2026-03-28 18:10 | - | |
| publicservices/ | 2026-03-28 18:09 | - | |
| publii/ | 2026-03-28 18:09 | - | |
| publisher/ | 2026-03-28 18:09 | - | |
| publishing/ | 2026-03-28 18:09 | - | |
| puffin-cloud-avatar-technology/ | 2026-03-28 18:09 | - | |
| puffin-secure-browser/ | 2026-03-28 18:09 | - | |
| puffincloudavatartechnology/ | 2026-03-28 18:09 | - | |
| pull/ | 2026-03-28 18:10 | - | |
| pulsar-edit/ | 2026-03-28 18:09 | - | |
| pulsar/ | 2026-03-28 18:09 | - | |
| pulse/ | 2026-03-28 18:10 | - | |
| pulseaudio/ | 2026-03-28 18:09 | - | |
| pulumi/ | 2026-03-28 18:10 | - | |
| punishing-gray-raven/ | 2026-03-28 18:10 | - | |
| puppet/ | 2026-03-28 18:09 | - | |
| puppetlabs/ | 2026-03-28 18:09 | - | |
| purchase/ | 2026-03-28 18:09 | - | |
| puredata/ | 2026-03-28 18:09 | - | |
| purl/ | 2026-03-28 18:09 | - | |
| push/ | 2026-03-28 18:10 | - | |
| pushbullet/ | 2026-03-28 18:10 | - | |
| putty/ | 2026-03-28 18:09 | - | |
| puzzle-game/ | 2026-03-28 18:09 | - | |
| puzzlegame/ | 2026-03-28 18:09 | - | |
| pv/ | 2026-03-28 18:09 | - | |
| pvpanic.inf/ | 2026-03-28 18:09 | - | |
| pvr/ | 2026-03-28 18:09 | - | |
| pwa/ | 2026-03-28 18:09 | - | |
| pwgen/ | 2026-03-28 18:09 | - | |
| pwm/ | 2026-03-28 18:09 | - | |
| pwsh/ | 2026-03-28 18:09 | - | |
| pxlogic/ | 2026-03-28 18:09 | - | |
| py/ | 2026-03-28 18:09 | - | |
| pyatv/ | 2026-03-28 18:09 | - | |
| pygi/ | 2026-03-28 18:09 | - | |
| pyo3/ | 2026-03-28 18:09 | - | |
| pypad/ | 2026-03-28 18:09 | - | |
| pypy/ | 2026-03-28 18:09 | - | |
| pyqt/ | 2026-03-28 18:09 | - | |
| pyqt4/ | 2026-03-28 18:09 | - | |
| pyqt5-desktop-application/ | 2026-03-28 18:10 | - | |
| pyqt5/ | 2026-03-28 18:09 | - | |
| pyside/ | 2026-03-28 18:10 | - | |
| pyside6/ | 2026-03-28 18:09 | - | |
| python-3/ | 2026-03-28 18:09 | - | |
| python-app/ | 2026-03-28 18:09 | - | |
| python-file-organiser/ | 2026-03-28 18:09 | - | |
| python-gui/ | 2026-03-28 18:09 | - | |
| python-script/ | 2026-03-28 18:09 | - | |
| python-virtual-environment/ | 2026-03-28 18:10 | - | |
| python/ | 2026-03-28 18:09 | - | |
| python3/ | 2026-03-28 18:09 | - | |
| pytorch/ | 2026-03-28 18:09 | - | |
| pytubepp-helper/ | 2026-03-28 18:09 | - | |
| pytubepp/ | 2026-03-28 18:09 | - | |
| pywebview/ | 2026-03-28 18:10 | - | |
| qaac/ | 2026-03-28 18:10 | - | |
| qbittorent-fork/ | 2026-03-28 18:09 | - | |
| qbittorrent/ | 2026-03-28 18:09 | - | |
| qck/ | 2026-03-28 18:09 | - | |
| qemu-kvm/ | 2026-03-28 18:09 | - | |
| qemu/ | 2026-03-28 18:09 | - | |
| qemupciserial.inf/ | 2026-03-28 18:09 | - | |
| qgis/ | 2026-03-28 18:10 | - | |
| qif/ | 2026-03-28 18:09 | - | |
| qlogiccorportation/ | 2026-03-28 18:09 | - | |
| qlogicdriverinstaller/ | 2026-03-28 18:09 | - | |
| qmk/ | 2026-03-28 18:09 | - | |
| qml/ | 2026-03-28 18:09 | - | |
| qmmp/ | 2026-03-28 18:09 | - | |
| qnn/ | 2026-03-28 18:09 | - | |
| qobuz-downloader/ | 2026-03-28 18:09 | - | |
| qodana/ | 2026-03-28 18:09 | - | |
| qownnotes/ | 2026-03-28 18:10 | - | |
| qq音乐/ | 2026-03-28 18:10 | - | |
| qq-music/ | 2026-03-28 18:09 | - | |
| qq/ | 2026-03-28 18:09 | - | |
| qqbot/ | 2026-03-28 18:09 | - | |
| qqgames/ | 2026-03-28 18:10 | - | |
| qqmusic/ | 2026-03-28 18:09 | - | |
| qqrobot/ | 2026-03-28 18:09 | - | |
| qr/ | 2026-03-28 18:09 | - | |
| qrcode-generator/ | 2026-03-28 18:09 | - | |
| qrcode-reader/ | 2026-03-28 18:09 | - | |
| qrcode-scanner/ | 2026-03-28 18:09 | - | |
| qrcode/ | 2026-03-28 18:09 | - | |
| qsl/ | 2026-03-28 18:09 | - | |
| qt-ts/ | 2026-03-28 18:10 | - | |
| qt-widgets/ | 2026-03-28 18:09 | - | |
| qt/ | 2026-03-28 18:09 | - | |
| qt5/ | 2026-03-28 18:09 | - | |
| qt6-gui/ | 2026-03-28 18:09 | - | |
| qt6/ | 2026-03-28 18:09 | - | |
| qtpy/ | 2026-03-28 18:09 | - | |
| qtspim/ | 2026-03-28 18:09 | - | |
| qttabbar/ | 2026-03-28 18:09 | - | |
| qtwebengine/ | 2026-03-28 18:09 | - | |
| quadratic-programming/ | 2026-03-28 18:09 | - | |
| quake/ | 2026-03-28 18:10 | - | |
| quality-assurance/ | 2026-03-28 18:09 | - | |
| qualityassurance/ | 2026-03-28 18:09 | - | |
| quantified-self/ | 2026-03-28 18:09 | - | |
| quantum/ | 2026-03-28 18:09 | - | |
| quasar/ | 2026-03-28 18:10 | - | |
| quehun/ | 2026-03-28 18:09 | - | |
| query-tool/ | 2026-03-28 18:10 | - | |
| quest/ | 2026-03-28 18:09 | - | |
| questpdf/ | 2026-03-28 18:10 | - | |
| questpdfcompanion/ | 2026-03-28 18:10 | - | |
| quic/ | 2026-03-28 18:10 | - | |
| quick-access/ | 2026-03-28 18:09 | - | |
| quick-share/ | 2026-03-28 18:09 | - | |
| quickapp/ | 2026-03-28 18:09 | - | |
| quickbms/ | 2026-03-28 18:09 | - | |
| quicken/ | 2026-03-28 18:09 | - | |
| quicklook/ | 2026-03-28 18:10 | - | |
| quicksync/ | 2026-03-28 18:10 | - | |
| quicktime-video/ | 2026-03-28 18:09 | - | |
| quicktime/ | 2026-03-28 18:09 | - | |
| quilt/ | 2026-03-28 18:09 | - | |
| quiltmc/ | 2026-03-28 18:10 | - | |
| quiz/ | 2026-03-28 18:09 | - | |
| quotes/ | 2026-03-28 18:09 | - | |
| qupzilla/ | 2026-03-28 18:09 | - | |
| quran-desktop/ | 2026-03-28 18:09 | - | |
| quran/ | 2026-03-28 18:09 | - | |
| qv/ | 2026-03-28 18:09 | - | |
| qw/ | 2026-03-28 18:09 | - | |
| qwen/ | 2026-03-28 18:09 | - | |
| qxldod.inf/ | 2026-03-28 18:09 | - | |
| rédaction/ | 2026-03-28 18:09 | - | |
| røde-central/ | 2026-03-28 18:10 | - | |
| rødecentral/ | 2026-03-28 18:10 | - | |
| r/ | 2026-03-28 18:09 | - | |
| r2northstar/ | 2026-03-28 18:10 | - | |
| r3dactedfox/ | 2026-03-28 18:09 | - | |
| r3f/ | 2026-03-28 18:10 | - | |
| rabbitmq/ | 2026-03-28 18:09 | - | |
| racing-game/ | 2026-03-28 18:10 | - | |
| racing-wheel-apex/ | 2026-03-28 18:09 | - | |
| racing/ | 2026-03-28 18:09 | - | |
| racingwheelapex/ | 2026-03-28 18:09 | - | |
| rack/ | 2026-03-28 18:10 | - | |
| racket/ | 2026-03-28 18:09 | - | |
| rad/ | 2026-03-28 18:09 | - | |
| radar/ | 2026-03-28 18:09 | - | |
| radarr/ | 2026-03-28 18:09 | - | |
| radio/ | 2026-03-28 18:09 | - | |
| radiomateur/ | 2026-03-28 18:09 | - | |
| radix-ui/ | 2026-03-28 18:09 | - | |
| radpdf/ | 2026-03-28 18:10 | - | |
| raf/ | 2026-03-28 18:09 | - | |
| raft/ | 2026-03-28 18:09 | - | |
| rag/ | 2026-03-28 18:09 | - | |
| raid/ | 2026-03-28 18:09 | - | |
| railos/ | 2026-03-28 18:10 | - | |
| rails/ | 2026-03-28 18:09 | - | |
| railway/ | 2026-03-28 18:09 | - | |
| railway operation simulator/ | 2026-03-28 18:10 | - | |
| rainbow-board/ | 2026-03-28 18:09 | - | |
| rainbow/ | 2026-03-28 18:09 | - | |
| rakk/ | 2026-03-28 18:10 | - | |
| raku/ | 2026-03-28 18:10 | - | |
| rakudo/ | 2026-03-28 18:10 | - | |
| rally/ | 2026-03-28 18:09 | - | |
| rallycross/ | 2026-03-28 18:09 | - | |
| ram-cleaner/ | 2026-03-28 18:09 | - | |
| ram-optimizer/ | 2026-03-28 18:09 | - | |
| ram/ | 2026-03-28 18:09 | - | |
| ramdisk/ | 2026-03-28 18:09 | - | |
| rammap/ | 2026-03-28 18:09 | - | |
| rammodules/ | 2026-03-28 18:09 | - | |
| rancher/ | 2026-03-28 18:09 | - | |
| random-access-memory-pages/ | 2026-03-28 18:09 | - | |
| random-number-generator/ | 2026-03-28 18:09 | - | |
| random-number/ | 2026-03-28 18:09 | - | |
| random-password/ | 2026-03-28 18:09 | - | |
| randomaccessmemory/ | 2026-03-28 18:09 | - | |
| randomaccessmemorypages/ | 2026-03-28 18:09 | - | |
| randomness/ | 2026-03-28 18:09 | - | |
| ranger/ | 2026-03-28 18:09 | - | |
| rank/ | 2026-03-28 18:09 | - | |
| ransomware/ | 2026-03-28 18:09 | - | |
| rapid prototyping/ | 2026-03-28 18:10 | - | |
| rar/ | 2026-03-28 18:09 | - | |
| rarfiles/ | 2026-03-28 18:09 | - | |
| raspberry-pi/ | 2026-03-28 18:09 | - | |
| raspberrypi/ | 2026-03-28 18:09 | - | |
| raster/ | 2026-03-28 18:10 | - | |
| ratatui/ | 2026-03-28 18:09 | - | |
| ravencoin/ | 2026-03-28 18:10 | - | |
| ravencore/ | 2026-03-28 18:10 | - | |
| raw-image/ | 2026-03-28 18:09 | - | |
| raw/ | 2026-03-28 18:09 | - | |
| ray-tracing/ | 2026-03-28 18:09 | - | |
| raycast/ | 2026-03-28 18:10 | - | |
| rayman/ | 2026-03-28 18:10 | - | |
| raysafe/ | 2026-03-28 18:10 | - | |
| raytracing/ | 2026-03-28 18:09 | - | |
| rbac/ | 2026-03-28 18:09 | - | |
| rbxfpsunlocker/ | 2026-03-28 18:09 | - | |
| rc-chuah/ | 2026-03-28 18:10 | - | |
| rc/ | 2026-03-28 18:10 | - | |
| rce/ | 2026-03-28 18:10 | - | |
| rcedit/ | 2026-03-28 18:09 | - | |
| rclone-browser/ | 2026-03-28 18:09 | - | |
| rclone-client/ | 2026-03-28 18:09 | - | |
| rclone/ | 2026-03-28 18:09 | - | |
| rdbms/ | 2026-03-28 18:09 | - | |
| rdf/ | 2026-03-28 18:09 | - | |
| rdm-agent/ | 2026-03-28 18:09 | - | |
| rdm/ | 2026-03-28 18:09 | - | |
| rdp-files/ | 2026-03-28 18:09 | - | |
| rdp/ | 2026-03-28 18:09 | - | |
| rdptool/ | 2026-03-28 18:10 | - | |
| rdr/ | 2026-03-28 18:09 | - | |
| re-imaging/ | 2026-03-28 18:09 | - | |
| react-native/ | 2026-03-28 18:09 | - | |
| react-three-fiber/ | 2026-03-28 18:10 | - | |
| react.js/ | 2026-03-28 18:09 | - | |
| react/ | 2026-03-28 18:09 | - | |
| reactive/ | 2026-03-28 18:09 | - | |
| reactjs/ | 2026-03-28 18:09 | - | |
| reactnative/ | 2026-03-28 18:10 | - | |
| reactor/ | 2026-03-28 18:10 | - | |
| read-solomon/ | 2026-03-28 18:09 | - | |
| read/ | 2026-03-28 18:09 | - | |
| reader/ | 2026-03-28 18:09 | - | |
| reading/ | 2026-03-28 18:09 | - | |
| readline/ | 2026-03-28 18:09 | - | |
| readme/ | 2026-03-28 18:09 | - | |
| readonly/ | 2026-03-28 18:09 | - | |
| readyapi/ | 2026-03-28 18:09 | - | |
| real-time-strategy/ | 2026-03-28 18:09 | - | |
| real-video/ | 2026-03-28 18:09 | - | |
| realcugan/ | 2026-03-28 18:09 | - | |
| realesrgan/ | 2026-03-28 18:09 | - | |
| reality/ | 2026-03-28 18:09 | - | |
| realtek-rtl8852au/ | 2026-03-28 18:09 | - | |
| realtek/ | 2026-03-28 18:09 | - | |
| realtime-database/ | 2026-03-28 18:10 | - | |
| realtime/ | 2026-03-28 18:09 | - | |
| realtimestrategy/ | 2026-03-28 18:09 | - | |
| reasearch/ | 2026-03-28 18:09 | - | |
| rebac/ | 2026-03-28 18:09 | - | |
| rebase/ | 2026-03-28 18:09 | - | |
| receive/ | 2026-03-28 18:09 | - | |
| receiver/ | 2026-03-28 18:09 | - | |
| recent-files/ | 2026-03-28 18:09 | - | |
| recipe manager/ | 2026-03-28 18:09 | - | |
| recipes-app/ | 2026-03-28 18:09 | - | |
| recipes/ | 2026-03-28 18:09 | - | |
| recognise/ | 2026-03-28 18:10 | - | |
| recognition/ | 2026-03-28 18:09 | - | |
| recognize/ | 2026-03-28 18:09 | - | |
| recom/ | 2026-03-28 18:09 | - | |
| record-video/ | 2026-03-28 18:09 | - | |
| record/ | 2026-03-28 18:09 | - | |
| recorder/ | 2026-03-28 18:09 | - | |
| recording/ | 2026-03-28 18:09 | - | |
| recover-data/ | 2026-03-28 18:10 | - | |
| recover-deleted/ | 2026-03-28 18:09 | - | |
| recover-file/ | 2026-03-28 18:10 | - | |
| recover-files/ | 2026-03-28 18:10 | - | |
| recover-images/ | 2026-03-28 18:09 | - | |
| recover/ | 2026-03-28 18:09 | - | |
| recoverfiles/ | 2026-03-28 18:10 | - | |
| recovery/ | 2026-03-28 18:09 | - | |
| recruitment/ | 2026-03-28 18:09 | - | |
| recursive-search/ | 2026-03-28 18:09 | - | |
| recursively-search/ | 2026-03-28 18:09 | - | |
| red-alert/ | 2026-03-28 18:09 | - | |
| red-dead-redemption/ | 2026-03-28 18:09 | - | |
| redact/ | 2026-03-28 18:10 | - | |
| redaction/ | 2026-03-28 18:10 | - | |
| reddeadredemption/ | 2026-03-28 18:09 | - | |
| reddit/ | 2026-03-28 18:09 | - | |
| redeclipse/ | 2026-03-28 18:10 | - | |
| redirect/ | 2026-03-28 18:09 | - | |
| redirection/ | 2026-03-28 18:09 | - | |
| redirector/ | 2026-03-28 18:10 | - | |
| redis-client/ | 2026-03-28 18:10 | - | |
| redis-cluster/ | 2026-03-28 18:09 | - | |
| redis-compatible/ | 2026-03-28 18:10 | - | |
| redis-desktop-manager/ | 2026-03-28 18:09 | - | |
| redis-gui-client/ | 2026-03-28 18:09 | - | |
| redis-gui/ | 2026-03-28 18:09 | - | |
| redis-sentinel/ | 2026-03-28 18:09 | - | |
| redis-ssh-ssl/ | 2026-03-28 18:09 | - | |
| redis-ui/ | 2026-03-28 18:10 | - | |
| redis/ | 2026-03-28 18:09 | - | |
| redist/ | 2026-03-28 18:09 | - | |
| redmi/ | 2026-03-28 18:09 | - | |
| redpitaya/ | 2026-03-28 18:09 | - | |
| reduce/ | 2026-03-28 18:09 | - | |
| redux/ | 2026-03-28 18:09 | - | |
| refactoring/ | 2026-03-28 18:09 | - | |
| refalac/ | 2026-03-28 18:10 | - | |
| reference-docs/ | 2026-03-28 18:10 | - | |
| reference/ | 2026-03-28 18:09 | - | |
| referenceimplementation/ | 2026-03-28 18:09 | - | |
| refresh-rate/ | 2026-03-28 18:09 | - | |
| refresh/ | 2026-03-28 18:09 | - | |
| refrigeration/ | 2026-03-28 18:09 | - | |
| refs/ | 2026-03-28 18:09 | - | |
| reg-pack/ | 2026-03-28 18:09 | - | |
| regcool/ | 2026-03-28 18:10 | - | |
| regedit/ | 2026-03-28 18:09 | - | |
| regex-editor/ | 2026-03-28 18:09 | - | |
| regex-files/ | 2026-03-28 18:09 | - | |
| regex-format/ | 2026-03-28 18:09 | - | |
| regex-replace/ | 2026-03-28 18:09 | - | |
| regex/ | 2026-03-28 18:09 | - | |
| regexp/ | 2026-03-28 18:09 | - | |
| region-capture/ | 2026-03-28 18:09 | - | |
| region/ | 2026-03-28 18:09 | - | |
| registry-cleaner/ | 2026-03-28 18:10 | - | |
| registry-data/ | 2026-03-28 18:10 | - | |
| registry-editor/ | 2026-03-28 18:10 | - | |
| registry-pack/ | 2026-03-28 18:09 | - | |
| registry/ | 2026-03-28 18:09 | - | |
| registrycleaner/ | 2026-03-28 18:10 | - | |
| registryeditor/ | 2026-03-28 18:10 | - | |
| regpack/ | 2026-03-28 18:09 | - | |
| regression-range-finder/ | 2026-03-28 18:09 | - | |
| regression/ | 2026-03-28 18:09 | - | |
| regressionrangefinder/ | 2026-03-28 18:09 | - | |
| regsofts-software-registry-repair/ | 2026-03-28 18:10 | - | |
| regsoftssoftwareregistryrepair/ | 2026-03-28 18:10 | - | |
| regul/ | 2026-03-28 18:10 | - | |
| regular-expression/ | 2026-03-28 18:09 | - | |
| regular-expressions/ | 2026-03-28 18:09 | - | |
| regulsavecleaner/ | 2026-03-28 18:10 | - | |
| reimaging/ | 2026-03-28 18:09 | - | |
| reimplementation/ | 2026-03-28 18:09 | - | |
| reiserfs/ | 2026-03-28 18:09 | - | |
| reko-decompiler/ | 2026-03-28 18:09 | - | |
| rekordbox-7/ | 2026-03-28 18:09 | - | |
| rekordbox-db/ | 2026-03-28 18:09 | - | |
| rekordbox-dj-software/ | 2026-03-28 18:09 | - | |
| rekordbox/ | 2026-03-28 18:09 | - | |
| relationships/ | 2026-03-28 18:10 | - | |
| relaxation/ | 2026-03-28 18:09 | - | |
| relay/ | 2026-03-28 18:09 | - | |
| release-automation/ | 2026-03-28 18:09 | - | |
| release/ | 2026-03-28 18:09 | - | |
| releasenotes/ | 2026-03-28 18:09 | - | |
| releases/ | 2026-03-28 18:09 | - | |
| religion/ | 2026-03-28 18:09 | - | |
| remaol061.exe/ | 2026-03-28 18:10 | - | |
| remap/ | 2026-03-28 18:09 | - | |
| remarkable-tablet/ | 2026-03-28 18:09 | - | |
| remarkable/ | 2026-03-28 18:09 | - | |
| remediation/ | 2026-03-28 18:09 | - | |
| reminder/ | 2026-03-28 18:09 | - | |
| remix/ | 2026-03-28 18:09 | - | |
| remote-access/ | 2026-03-28 18:09 | - | |
| remote-assistance/ | 2026-03-28 18:09 | - | |
| remote-connection/ | 2026-03-28 18:09 | - | |
| remote-control/ | 2026-03-28 18:09 | - | |
| remote-desktop-forwarding/ | 2026-03-28 18:10 | - | |
| remote-desktop-manager/ | 2026-03-28 18:09 | - | |
| remote-desktop/ | 2026-03-28 18:09 | - | |
| remote-development-environment/ | 2026-03-28 18:09 | - | |
| remote-development/ | 2026-03-28 18:09 | - | |
| remote-exams/ | 2026-03-28 18:10 | - | |
| remote-file-manager/ | 2026-03-28 18:10 | - | |
| remote-machine/ | 2026-03-28 18:09 | - | |
| remote-management/ | 2026-03-28 18:09 | - | |
| remote-mouse/ | 2026-03-28 18:09 | - | |
| remote-play/ | 2026-03-28 18:09 | - | |
| remote-proctoring/ | 2026-03-28 18:10 | - | |
| remote-support/ | 2026-03-28 18:09 | - | |
| remote-viewer/ | 2026-03-28 18:09 | - | |
| remote/ | 2026-03-28 18:09 | - | |
| remoteaccess/ | 2026-03-28 18:09 | - | |
| remoteapps/ | 2026-03-28 18:09 | - | |
| remoteconnect/ | 2026-03-28 18:09 | - | |
| remoteconnections/ | 2026-03-28 18:09 | - | |
| remotecontrol/ | 2026-03-28 18:09 | - | |
| remotedesktop/ | 2026-03-28 18:09 | - | |
| remotedev/ | 2026-03-28 18:09 | - | |
| remotefilemanager/ | 2026-03-28 18:10 | - | |
| remoteframebuffer/ | 2026-03-28 18:09 | - | |
| remote machine/ | 2026-03-28 18:09 | - | |
| remotemachine/ | 2026-03-28 18:09 | - | |
| remoteplay/ | 2026-03-28 18:10 | - | |
| removal/ | 2026-03-28 18:09 | - | |
| remove-broken-open-with-options/ | 2026-03-28 18:10 | - | |
| remove-desktop-shortcuts/ | 2026-03-28 18:09 | - | |
| remove-noise/ | 2026-03-28 18:09 | - | |
| remove-old-drivers/ | 2026-03-28 18:09 | - | |
| remove-shortcuts/ | 2026-03-28 18:10 | - | |
| remove/ | 2026-03-28 18:09 | - | |
| removebrokenopenwithoptions/ | 2026-03-28 18:10 | - | |
| removedesktopshortcuts/ | 2026-03-28 18:09 | - | |
| removeemptydirectories/ | 2026-03-28 18:09 | - | |
| removeemptyfiles/ | 2026-03-28 18:09 | - | |
| removeemptyfolders/ | 2026-03-28 18:09 | - | |
| removelingeringobject/ | 2026-03-28 18:09 | - | |
| removeolddrivers/ | 2026-03-28 18:09 | - | |
| remover/ | 2026-03-28 18:09 | - | |
| removeshortcuts/ | 2026-03-28 18:10 | - | |
| rename-files/ | 2026-03-28 18:09 | - | |
| rename/ | 2026-03-28 18:09 | - | |
| renamer/ | 2026-03-28 18:09 | - | |
| renaming-files/ | 2026-03-28 18:09 | - | |
| renaming/ | 2026-03-28 18:09 | - | |
| render/ | 2026-03-28 18:09 | - | |
| rendering/ | 2026-03-28 18:09 | - | |
| reopen/ | 2026-03-28 18:10 | - | |
| repackaging/ | 2026-03-28 18:09 | - | |
| repair/ | 2026-03-28 18:09 | - | |
| repetitive-strain-injury/ | 2026-03-28 18:09 | - | |
| repl/ | 2026-03-28 18:09 | - | |
| replace-bytes/ | 2026-03-28 18:09 | - | |
| replace-files/ | 2026-03-28 18:09 | - | |
| replace-text/ | 2026-03-28 18:09 | - | |
| replace-word/ | 2026-03-28 18:09 | - | |
| replace/ | 2026-03-28 18:09 | - | |
| replacetext/ | 2026-03-28 18:09 | - | |
| replacingtext/ | 2026-03-28 18:09 | - | |
| replay/ | 2026-03-28 18:09 | - | |
| replaygain/ | 2026-03-28 18:09 | - | |
| replit/ | 2026-03-28 18:09 | - | |
| repo/ | 2026-03-28 18:09 | - | |
| report-generator/ | 2026-03-28 18:09 | - | |
| report/ | 2026-03-28 18:09 | - | |
| reporting-tool/ | 2026-03-28 18:10 | - | |
| reporting/ | 2026-03-28 18:09 | - | |
| repository-management/ | 2026-03-28 18:09 | - | |
| repository/ | 2026-03-28 18:09 | - | |
| reproducible-builds/ | 2026-03-28 18:09 | - | |
| republic-of-gamers/ | 2026-03-28 18:10 | - | |
| republicofgamers/ | 2026-03-28 18:10 | - | |
| request-routing/ | 2026-03-28 18:09 | - | |
| request/ | 2026-03-28 18:09 | - | |
| requires-decryption-keys/ | 2026-03-28 18:09 | - | |
| requires-firmware/ | 2026-03-28 18:09 | - | |
| requires-wii-remote-plus/ | 2026-03-28 18:10 | - | |
| requiresbluetooth/ | 2026-03-28 18:09 | - | |
| requirescdm/ | 2026-03-28 18:09 | - | |
| requireschargingbox/ | 2026-03-28 18:09 | - | |
| requirescmd/ | 2026-03-28 18:09 | - | |
| requiresgamefiles/ | 2026-03-28 18:09 | - | |
| requiresmouse/ | 2026-03-28 18:09 | - | |
| requiresorganizationaccount/ | 2026-03-28 18:09 | - | |
| requiresreboot/ | 2026-03-28 18:10 | - | |
| requiresusb/ | 2026-03-28 18:09 | - | |
| resample-images/ | 2026-03-28 18:09 | - | |
| resample/ | 2026-03-28 18:09 | - | |
| research/ | 2026-03-28 18:09 | - | |
| reset-passwords/ | 2026-03-28 18:10 | - | |
| resharper/ | 2026-03-28 18:09 | - | |
| resiliency/ | 2026-03-28 18:09 | - | |
| resin/ | 2026-03-28 18:10 | - | |
| resin print/ | 2026-03-28 18:09 | - | |
| resize-images/ | 2026-03-28 18:09 | - | |
| resize-pdf/ | 2026-03-28 18:10 | - | |
| resize-photos/ | 2026-03-28 18:09 | - | |
| resize/ | 2026-03-28 18:09 | - | |
| resizer/ | 2026-03-28 18:09 | - | |
| resizing/ | 2026-03-28 18:09 | - | |
| resnum/ | 2026-03-28 18:09 | - | |
| resolution/ | 2026-03-28 18:09 | - | |
| resource-compiler/ | 2026-03-28 18:10 | - | |
| resource-decompiler/ | 2026-03-28 18:10 | - | |
| resource-editor/ | 2026-03-28 18:10 | - | |
| resource/ | 2026-03-28 18:09 | - | |
| response-transform/ | 2026-03-28 18:09 | - | |
| response/ | 2026-03-28 18:09 | - | |
| responsive-design/ | 2026-03-28 18:09 | - | |
| rest, api, testing, http/ | 2026-03-28 18:10 | - | |
| rest-api/ | 2026-03-28 18:09 | - | |
| rest-client/ | 2026-03-28 18:09 | - | |
| rest/ | 2026-03-28 18:09 | - | |
| restart/ | 2026-03-28 18:09 | - | |
| restful/ | 2026-03-28 18:09 | - | |
| restic-backups/ | 2026-03-28 18:09 | - | |
| restic/ | 2026-03-28 18:09 | - | |
| restore-bsod-info/ | 2026-03-28 18:09 | - | |
| restore-file/ | 2026-03-28 18:10 | - | |
| restore-lost-files/ | 2026-03-28 18:09 | - | |
| restore/ | 2026-03-28 18:09 | - | |
| resx-files/ | 2026-03-28 18:10 | - | |
| resx/ | 2026-03-28 18:10 | - | |
| retina/ | 2026-03-28 18:09 | - | |
| retouch/ | 2026-03-28 18:09 | - | |
| retrieve/ | 2026-03-28 18:10 | - | |
| retro/ | 2026-03-28 18:09 | - | |
| retroarch/ | 2026-03-28 18:09 | - | |
| retrocycles/ | 2026-03-28 18:09 | - | |
| reveal-js/ | 2026-03-28 18:10 | - | |
| reveal/ | 2026-03-28 18:09 | - | |
| reverse-engineering/ | 2026-03-28 18:09 | - | |
| reverse-proxy/ | 2026-03-28 18:09 | - | |
| reversi/ | 2026-03-28 18:09 | - | |
| reversing/ | 2026-03-28 18:09 | - | |
| review-pdf/ | 2026-03-28 18:09 | - | |
| revision/ | 2026-03-28 18:09 | - | |
| revit/ | 2026-03-28 18:09 | - | |
| revolution/ | 2026-03-28 18:09 | - | |
| revu/ | 2026-03-28 18:09 | - | |
| rf/ | 2026-03-28 18:09 | - | |
| rfb/ | 2026-03-28 18:09 | - | |
| rfc8555/ | 2026-03-28 18:09 | - | |
| rfc8737/ | 2026-03-28 18:09 | - | |
| rfc8738/ | 2026-03-28 18:09 | - | |
| rfid/ | 2026-03-28 18:09 | - | |
| rfidtagsreader/ | 2026-03-28 18:10 | - | |
| rfspace/ | 2026-03-28 18:09 | - | |
| rgb-controller-software/ | 2026-03-28 18:10 | - | |
| rgb/ | 2026-03-28 18:09 | - | |
| rgbfusion/ | 2026-03-28 18:09 | - | |
| rhythm-game/ | 2026-03-28 18:09 | - | |
| rhythm/ | 2026-03-28 18:09 | - | |
| rich-presence/ | 2026-03-28 18:09 | - | |
| richpresence/ | 2026-03-28 18:10 | - | |
| ricing/ | 2026-03-28 18:09 | - | |
| ricoh/ | 2026-03-28 18:10 | - | |
| rider/ | 2026-03-28 18:09 | - | |
| riding/ | 2026-03-28 18:10 | - | |
| rift/ | 2026-03-28 18:09 | - | |
| right-click/ | 2026-03-28 18:09 | - | |
| right-speaker/ | 2026-03-28 18:10 | - | |
| rightsmanagementserviceclient/ | 2026-03-28 18:09 | - | |
| rightspeaker/ | 2026-03-28 18:10 | - | |
| riichi-mahjong/ | 2026-03-28 18:09 | - | |
| rimworld/ | 2026-03-28 18:10 | - | |
| ringcentral/ | 2026-03-28 18:09 | - | |
| riot/ | 2026-03-28 18:09 | - | |
| rip/ | 2026-03-28 18:09 | - | |
| ripe/ | 2026-03-28 18:09 | - | |
| ripemd-128/ | 2026-03-28 18:10 | - | |
| ripemd-128 ripemd-256 ripemd-320/ | 2026-03-28 18:10 | - | |
| ripemd-160/ | 2026-03-28 18:09 | - | |
| ripgrep/ | 2026-03-28 18:09 | - | |
| ripper/ | 2026-03-28 18:09 | - | |
| ripscrip/ | 2026-03-28 18:09 | - | |
| risc-v/ | 2026-03-28 18:09 | - | |
| rival/ | 2026-03-28 18:09 | - | |
| rivatuner-statistics-server/ | 2026-03-28 18:09 | - | |
| rivatuner/ | 2026-03-28 18:09 | - | |
| rivatunerstatisticsserver/ | 2026-03-28 18:09 | - | |
| rlogin/ | 2026-03-28 18:09 | - | |
| rm/ | 2026-03-28 18:09 | - | |
| rmarkdown/ | 2026-03-28 18:09 | - | |
| rmqrcode/ | 2026-03-28 18:10 | - | |
| rmvb/ | 2026-03-28 18:10 | - | |
| rng/ | 2026-03-28 18:09 | - | |
| roadmap/ | 2026-03-28 18:10 | - | |
| robertnwood/ | 2026-03-28 18:10 | - | |
| robinsummers/ | 2026-03-28 18:10 | - | |
| roblox-studio/ | 2026-03-28 18:09 | - | |
| roblox/ | 2026-03-28 18:09 | - | |
| robocopy/ | 2026-03-28 18:09 | - | |
| robomongo/ | 2026-03-28 18:09 | - | |
| robot/ | 2026-03-28 18:09 | - | |
| robotics/ | 2026-03-28 18:09 | - | |
| roccat/ | 2026-03-28 18:10 | - | |
| rockbox/ | 2026-03-28 18:10 | - | |
| rocket-chat/ | 2026-03-28 18:09 | - | |
| rocket.chat/ | 2026-03-28 18:09 | - | |
| rocket/ | 2026-03-28 18:09 | - | |
| rocketchat/ | 2026-03-28 18:09 | - | |
| rocks/ | 2026-03-28 18:09 | - | |
| rocksdb/ | 2026-03-28 18:10 | - | |
| rockstar-games-launcher/ | 2026-03-28 18:09 | - | |
| rockstar-social-club/ | 2026-03-28 18:09 | - | |
| rockstargameslauncher/ | 2026-03-28 18:09 | - | |
| rockstarsocialclub/ | 2026-03-28 18:09 | - | |
| rode-central/ | 2026-03-28 18:10 | - | |
| rode/ | 2026-03-28 18:09 | - | |
| rodecastervad.inf/ | 2026-03-28 18:10 | - | |
| rog/ | 2026-03-28 18:09 | - | |
| rogue/ | 2026-03-28 18:09 | - | |
| roguelike/ | 2026-03-28 18:09 | - | |
| roku-development/ | 2026-03-28 18:09 | - | |
| roku/ | 2026-03-28 18:09 | - | |
| role-playing-game/ | 2026-03-28 18:09 | - | |
| role-playing/ | 2026-03-28 18:09 | - | |
| roleplaying-games/ | 2026-03-28 18:09 | - | |
| roleplaying/ | 2026-03-28 18:09 | - | |
| roleplayinggame/ | 2026-03-28 18:09 | - | |
| rollback/ | 2026-03-28 18:09 | - | |
| rollercoaster-tycoon/ | 2026-03-28 18:09 | - | |
| rollermouse/ | 2026-03-28 18:10 | - | |
| rolling-shutter-undistortion/ | 2026-03-28 18:09 | - | |
| rom/ | 2026-03-28 18:09 | - | |
| romfs/ | 2026-03-28 18:09 | - | |
| roonbridge/ | 2026-03-28 18:10 | - | |
| roonserver/ | 2026-03-28 18:10 | - | |
| rooster/ | 2026-03-28 18:10 | - | |
| rootfs/ | 2026-03-28 18:10 | - | |
| ror/ | 2026-03-28 18:09 | - | |
| roshambo/ | 2026-03-28 18:10 | - | |
| rotate/ | 2026-03-28 18:09 | - | |
| rotation/ | 2026-03-28 18:09 | - | |
| route/ | 2026-03-28 18:09 | - | |
| routeit/ | 2026-03-28 18:09 | - | |
| router/ | 2026-03-28 18:10 | - | |
| routeros/ | 2026-03-28 18:09 | - | |
| routing-algorithm/ | 2026-03-28 18:10 | - | |
| routing-mesh/ | 2026-03-28 18:10 | - | |
| rovo-dev/ | 2026-03-28 18:09 | - | |
| rovo/ | 2026-03-28 18:09 | - | |
| rowerg/ | 2026-03-28 18:09 | - | |
| rowing/ | 2026-03-28 18:09 | - | |
| rpa/ | 2026-03-28 18:09 | - | |
| rpc/ | 2026-03-28 18:09 | - | |
| rpcs3/ | 2026-03-28 18:09 | - | |
| rpg/ | 2026-03-28 18:09 | - | |
| rpi/ | 2026-03-28 18:09 | - | |
| rrd4j/ | 2026-03-28 18:09 | - | |
| rrdtool/ | 2026-03-28 18:09 | - | |
| rs-274/ | 2026-03-28 18:09 | - | |
| rsa/ | 2026-03-28 18:09 | - | |
| rsi-launcher/ | 2026-03-28 18:09 | - | |
| rsi/ | 2026-03-28 18:09 | - | |
| rss-feed-generator/ | 2026-03-28 18:09 | - | |
| rss-feed/ | 2026-03-28 18:09 | - | |
| rss-guard/ | 2026-03-28 18:09 | - | |
| rss-reader/ | 2026-03-28 18:09 | - | |
| rss/ | 2026-03-28 18:09 | - | |
| rssfeedreader/ | 2026-03-28 18:10 | - | |
| rssreader/ | 2026-03-28 18:10 | - | |
| rst/ | 2026-03-28 18:09 | - | |
| rstats/ | 2026-03-28 18:09 | - | |
| rsync-backup/ | 2026-03-28 18:09 | - | |
| rsync/ | 2026-03-28 18:09 | - | |
| rsyncbackup/ | 2026-03-28 18:09 | - | |
| rtcp/ | 2026-03-28 18:09 | - | |
| rtf/ | 2026-03-28 18:09 | - | |
| rtl-sdr/ | 2026-03-28 18:09 | - | |
| rtl-tcp/ | 2026-03-28 18:10 | - | |
| rtl/ | 2026-03-28 18:09 | - | |
| rtlsdr-dongle/ | 2026-03-28 18:09 | - | |
| rtlsdr/ | 2026-03-28 18:09 | - | |
| rtmp-proxy/ | 2026-03-28 18:09 | - | |
| rtmp-server/ | 2026-03-28 18:09 | - | |
| rtmp/ | 2026-03-28 18:09 | - | |
| rtorrent/ | 2026-03-28 18:10 | - | |
| rtp/ | 2026-03-28 18:09 | - | |
| rts/ | 2026-03-28 18:09 | - | |
| rtsp-proxy/ | 2026-03-28 18:09 | - | |
| rtsp-relay/ | 2026-03-28 18:09 | - | |
| rtsp-server/ | 2026-03-28 18:09 | - | |
| rtsp/ | 2026-03-28 18:09 | - | |
| rtu/ | 2026-03-28 18:09 | - | |
| rtx-voice/ | 2026-03-28 18:10 | - | |
| rtx/ | 2026-03-28 18:10 | - | |
| ruby-on-rails/ | 2026-03-28 18:09 | - | |
| ruby/ | 2026-03-28 18:09 | - | |
| ruckzuck/ | 2026-03-28 18:10 | - | |
| ruff/ | 2026-03-28 18:10 | - | |
| rulers/ | 2026-03-28 18:10 | - | |
| run-as/ | 2026-03-28 18:09 | - | |
| runas/ | 2026-03-28 18:09 | - | |
| rune/ | 2026-03-28 18:10 | - | |
| runner/ | 2026-03-28 18:09 | - | |
| running/ | 2026-03-28 18:09 | - | |
| runsduringbootprocess/ | 2026-03-28 18:09 | - | |
| runtime-system/ | 2026-03-28 18:10 | - | |
| runtime/ | 2026-03-28 18:09 | - | |
| russh/ | 2026-03-28 18:09 | - | |
| russian/ | 2026-03-28 18:10 | - | |
| rust-application/ | 2026-03-28 18:10 | - | |
| rust-crate/ | 2026-03-28 18:10 | - | |
| rust-lang/ | 2026-03-28 18:09 | - | |
| rust-language-server/ | 2026-03-28 18:09 | - | |
| rust-language/ | 2026-03-28 18:09 | - | |
| rust-library/ | 2026-03-28 18:10 | - | |
| rust/ | 2026-03-28 18:09 | - | |
| rustlang/ | 2026-03-28 18:10 | - | |
| rustpython/ | 2026-03-28 18:10 | - | |
| rusty-rain/ | 2026-03-28 18:09 | - | |
| ruta/ | 2026-03-28 18:09 | - | |
| rutas/ | 2026-03-28 18:09 | - | |
| ruv-is/ | 2026-03-28 18:10 | - | |
| rx/ | 2026-03-28 18:09 | - | |
| rythm-games/ | 2026-03-28 18:10 | - | |
| rythms/ | 2026-03-28 18:09 | - | |
| ryzen/ | 2026-03-28 18:09 | - | |
| ryzenmobile/ | 2026-03-28 18:09 | - | |
| s.m.a.r.t/ | 2026-03-28 18:10 | - | |
| s3-browser/ | 2026-03-28 18:09 | - | |
| s3-client/ | 2026-03-28 18:09 | - | |
| s3/ | 2026-03-28 18:09 | - | |
| s3scanner/ | 2026-03-28 18:10 | - | |
| s8000/ | 2026-03-28 18:09 | - | |
| s_mime/ | 2026-03-28 18:09 | - | |
| s_pdif/ | 2026-03-28 18:09 | - | |
| saas/ | 2026-03-28 18:09 | - | |
| saasbom/ | 2026-03-28 18:09 | - | |
| safari/ | 2026-03-28 18:09 | - | |
| safe-exam-browser/ | 2026-03-28 18:10 | - | |
| safe/ | 2026-03-28 18:09 | - | |
| safedisc/ | 2026-03-28 18:09 | - | |
| sailing/ | 2026-03-28 18:09 | - | |
| sailmath/ | 2026-03-28 18:09 | - | |
| sakura-editor/ | 2026-03-28 18:09 | - | |
| sakura/ | 2026-03-28 18:09 | - | |
| salad/ | 2026-03-28 18:09 | - | |
| saladict/ | 2026-03-28 18:09 | - | |
| sales/ | 2026-03-28 18:09 | - | |
| salesforce-cli/ | 2026-03-28 18:09 | - | |
| salesforce/ | 2026-03-28 18:10 | - | |
| salting/ | 2026-03-28 18:09 | - | |
| saltstack/ | 2026-03-28 18:10 | - | |
| sam/ | 2026-03-28 18:09 | - | |
| samba/ | 2026-03-28 18:10 | - | |
| samdriverspack/ | 2026-03-28 18:09 | - | |
| sameboy/ | 2026-03-28 18:09 | - | |
| samsung-cloud/ | 2026-03-28 18:10 | - | |
| samsung/ | 2026-03-28 18:09 | - | |
| samsunggalaxybuds/ | 2026-03-28 18:09 | - | |
| samsunggalaxyphones/ | 2026-03-28 18:09 | - | |
| samsunggear/ | 2026-03-28 18:09 | - | |
| samsungknox/ | 2026-03-28 18:09 | - | |
| samsungsmarttv/ | 2026-03-28 18:09 | - | |
| samsungtablets/ | 2026-03-28 18:09 | - | |
| sandbox/ | 2026-03-28 18:09 | - | |
| sandisk/ | 2026-03-28 18:09 | - | |
| sangoma/ | 2026-03-28 18:10 | - | |
| sanitize/ | 2026-03-28 18:10 | - | |
| sansa/ | 2026-03-28 18:10 | - | |
| sao/ | 2026-03-28 18:09 | - | |
| sap/ | 2026-03-28 18:10 | - | |
| sasm/ | 2026-03-28 18:10 | - | |
| sass/ | 2026-03-28 18:10 | - | |
| sat/ | 2026-03-28 18:10 | - | |
| satcom/ | 2026-03-28 18:09 | - | |
| satellaview/ | 2026-03-28 18:09 | - | |
| satellite/ | 2026-03-28 18:09 | - | |
| satellitecommunications/ | 2026-03-28 18:10 | - | |
| satellitephones/ | 2026-03-28 18:09 | - | |
| satellitetracking/ | 2026-03-28 18:09 | - | |
| satisfactory/ | 2026-03-28 18:10 | - | |
| saturation/ | 2026-03-28 18:09 | - | |
| sauerbraten/ | 2026-03-28 18:09 | - | |
| save-editor/ | 2026-03-28 18:09 | - | |
| save-eye/ | 2026-03-28 18:10 | - | |
| save-the-internet/ | 2026-03-28 18:10 | - | |
| save-video/ | 2026-03-28 18:09 | - | |
| save/ | 2026-03-28 18:09 | - | |
| savecleaner/ | 2026-03-28 18:10 | - | |
| savediskspace/ | 2026-03-28 18:10 | - | |
| savefiles/ | 2026-03-28 18:10 | - | |
| saves/ | 2026-03-28 18:10 | - | |
| sbagen/ | 2026-03-28 18:10 | - | |
| sbc/ | 2026-03-28 18:09 | - | |
| sbcl/ | 2026-03-28 18:09 | - | |
| sbom-generator/ | 2026-03-28 18:09 | - | |
| sbom/ | 2026-03-28 18:09 | - | |
| sbs-1/ | 2026-03-28 18:09 | - | |
| sbs-3/ | 2026-03-28 18:09 | - | |
| sbs1/ | 2026-03-28 18:09 | - | |
| sbs3/ | 2026-03-28 18:09 | - | |
| sbt/ | 2026-03-28 18:09 | - | |
| sc/ | 2026-03-28 18:10 | - | |
| sca/ | 2026-03-28 18:09 | - | |
| scada/ | 2026-03-28 18:09 | - | |
| scaf/ | 2026-03-28 18:10 | - | |
| scaffolding/ | 2026-03-28 18:09 | - | |
| scala/ | 2026-03-28 18:09 | - | |
| scalable/ | 2026-03-28 18:09 | - | |
| scalajs/ | 2026-03-28 18:09 | - | |
| scale/ | 2026-03-28 18:09 | - | |
| scaleway-cli/ | 2026-03-28 18:10 | - | |
| scaleway/ | 2026-03-28 18:10 | - | |
| scaling/ | 2026-03-28 18:09 | - | |
| scan-files/ | 2026-03-28 18:09 | - | |
| scan/ | 2026-03-28 18:09 | - | |
| scanner/ | 2026-03-28 18:09 | - | |
| scanning-modes/ | 2026-03-28 18:09 | - | |
| scanning/ | 2026-03-28 18:09 | - | |
| scans/ | 2026-03-28 18:10 | - | |
| scantailor/ | 2026-03-28 18:09 | - | |
| scapy/ | 2026-03-28 18:09 | - | |
| sccm/ | 2026-03-28 18:09 | - | |
| scene/ | 2026-03-28 18:09 | - | |
| schedule-maker/ | 2026-03-28 18:09 | - | |
| schedule/ | 2026-03-28 18:09 | - | |
| scheduler/ | 2026-03-28 18:09 | - | |
| scheduling/ | 2026-03-28 18:09 | - | |
| schema/ | 2026-03-28 18:09 | - | |
| schematic/ | 2026-03-28 18:10 | - | |
| scheme/ | 2026-03-28 18:10 | - | |
| schild/ | 2026-03-28 18:10 | - | |
| school/ | 2026-03-28 18:09 | - | |
| sci-fi/ | 2026-03-28 18:09 | - | |
| science/ | 2026-03-28 18:09 | - | |
| scientific-calculator/ | 2026-03-28 18:09 | - | |
| scientific/ | 2026-03-28 18:09 | - | |
| scientific calculator/ | 2026-03-28 18:10 | - | |
| scientificstudies/ | 2026-03-28 18:10 | - | |
| scif/ | 2026-03-28 18:09 | - | |
| scifi/ | 2026-03-28 18:10 | - | |
| scintilla/ | 2026-03-28 18:09 | - | |
| scm/ | 2026-03-28 18:09 | - | |
| scoop-bucket/ | 2026-03-28 18:09 | - | |
| scoop/ | 2026-03-28 18:09 | - | |
| score/ | 2026-03-28 18:09 | - | |
| scp/ | 2026-03-28 18:09 | - | |
| scps/ | 2026-03-28 18:09 | - | |
| scps3/ | 2026-03-28 18:09 | - | |
| scrape/ | 2026-03-28 18:09 | - | |
| scratch/ | 2026-03-28 18:09 | - | |
| scrcpy-gui/ | 2026-03-28 18:10 | - | |
| scrcpy-ui/ | 2026-03-28 18:10 | - | |
| scrcpy/ | 2026-03-28 18:09 | - | |
| screen-capture/ | 2026-03-28 18:09 | - | |
| screen-magnification/ | 2026-03-28 18:09 | - | |
| screen-magnifier/ | 2026-03-28 18:09 | - | |
| screen-mirroring/ | 2026-03-28 18:09 | - | |
| screen-reader/ | 2026-03-28 18:09 | - | |
| screen-record/ | 2026-03-28 18:09 | - | |
| screen-recorder/ | 2026-03-28 18:09 | - | |
| screen-recording/ | 2026-03-28 18:09 | - | |
| screen-sharing/ | 2026-03-28 18:09 | - | |
| screen-time/ | 2026-03-28 18:09 | - | |
| screen-zooming/ | 2026-03-28 18:09 | - | |
| screen/ | 2026-03-28 18:09 | - | |
| screen3/ | 2026-03-28 18:09 | - | |
| screencapture/ | 2026-03-28 18:09 | - | |
| screencast/ | 2026-03-28 18:09 | - | |
| screencasting/ | 2026-03-28 18:09 | - | |
| screencolors/ | 2026-03-28 18:09 | - | |
| screenfetch/ | 2026-03-28 18:09 | - | |
| screengrab/ | 2026-03-28 18:10 | - | |
| screenmirroring/ | 2026-03-28 18:09 | - | |
| screenoverlay/ | 2026-03-28 18:09 | - | |
| screenrecorder/ | 2026-03-28 18:09 | - | |
| screenrecording/ | 2026-03-28 18:09 | - | |
| screens/ | 2026-03-28 18:10 | - | |
| screensaver/ | 2026-03-28 18:09 | - | |
| screensharing/ | 2026-03-28 18:09 | - | |
| screenshot-sharing/ | 2026-03-28 18:10 | - | |
| screenshot/ | 2026-03-28 18:09 | - | |
| screenshots/ | 2026-03-28 18:10 | - | |
| screenshotsharing/ | 2026-03-28 18:10 | - | |
| screenwriting/ | 2026-03-28 18:10 | - | |
| script-engine/ | 2026-03-28 18:09 | - | |
| script-language/ | 2026-03-28 18:09 | - | |
| script-parser/ | 2026-03-28 18:09 | - | |
| script/ | 2026-03-28 18:09 | - | |
| scriptable-universal-kernel-driver/ | 2026-03-28 18:10 | - | |
| scriptable/ | 2026-03-28 18:09 | - | |
| scriptableuniversalkerneldriver/ | 2026-03-28 18:10 | - | |
| scripted-deployment/ | 2026-03-28 18:09 | - | |
| scripted/ | 2026-03-28 18:09 | - | |
| scripting-engine/ | 2026-03-28 18:09 | - | |
| scripting-language/ | 2026-03-28 18:09 | - | |
| scripting-shell/ | 2026-03-28 18:09 | - | |
| scripting/ | 2026-03-28 18:09 | - | |
| scriptlets/ | 2026-03-28 18:10 | - | |
| scripture/ | 2026-03-28 18:09 | - | |
| scrobbler/ | 2026-03-28 18:09 | - | |
| scroll-lock/ | 2026-03-28 18:09 | - | |
| scrolling-screenshot/ | 2026-03-28 18:09 | - | |
| scrubbing/ | 2026-03-28 18:09 | - | |
| scrypt/ | 2026-03-28 18:10 | - | |
| scss/ | 2026-03-28 18:09 | - | |
| sctp/ | 2026-03-28 18:09 | - | |
| scumm/ | 2026-03-28 18:10 | - | |
| scw/ | 2026-03-28 18:10 | - | |
| sd/ | 2026-03-28 18:09 | - | |
| sdb/ | 2026-03-28 18:09 | - | |
| sdcard-image/ | 2026-03-28 18:09 | - | |
| sdi/ | 2026-03-28 18:09 | - | |
| sdiff/ | 2026-03-28 18:09 | - | |
| sdio/ | 2026-03-28 18:09 | - | |
| sdk-manager/ | 2026-03-28 18:10 | - | |
| sdk/ | 2026-03-28 18:09 | - | |
| sdl/ | 2026-03-28 18:09 | - | |
| sdl2-controllers/ | 2026-03-28 18:09 | - | |
| sdl2-game-controller-mappings/ | 2026-03-28 18:09 | - | |
| sdl2-gamepad-tool/ | 2026-03-28 18:09 | - | |
| sdl2/ | 2026-03-28 18:09 | - | |
| sdl2controllers/ | 2026-03-28 18:09 | - | |
| sdl2gamecontrollermappings/ | 2026-03-28 18:09 | - | |
| sdl_gamecontrollerconfig/ | 2026-03-28 18:09 | - | |
| sdlc/ | 2026-03-28 18:10 | - | |
| sdr++/ | 2026-03-28 18:09 | - | |
| sdr-rtl/ | 2026-03-28 18:09 | - | |
| sdr/ | 2026-03-28 18:09 | - | |
| sdrplay-devices/ | 2026-03-28 18:09 | - | |
| sdrplay-rsp-devices/ | 2026-03-28 18:09 | - | |
| sdrplay/ | 2026-03-28 18:09 | - | |
| sds/ | 2026-03-28 18:10 | - | |
| seabios/ | 2026-03-28 18:10 | - | |
| seanavigation/ | 2026-03-28 18:09 | - | |
| search-bytes/ | 2026-03-28 18:09 | - | |
| search-contents/ | 2026-03-28 18:09 | - | |
| search-engine/ | 2026-03-28 18:09 | - | |
| search-files/ | 2026-03-28 18:09 | - | |
| search-replace/ | 2026-03-28 18:09 | - | |
| search-text/ | 2026-03-28 18:09 | - | |
| search/ | 2026-03-28 18:09 | - | |
| searchformediaservers/ | 2026-03-28 18:09 | - | |
| seb/ | 2026-03-28 18:10 | - | |
| second-brain/ | 2026-03-28 18:09 | - | |
| seconds/ | 2026-03-28 18:09 | - | |
| secret-distribution/ | 2026-03-28 18:09 | - | |
| secret-management/ | 2026-03-28 18:09 | - | |
| secret-storage/ | 2026-03-28 18:09 | - | |
| secret/ | 2026-03-28 18:09 | - | |
| secrets-manager/ | 2026-03-28 18:09 | - | |
| secrets/ | 2026-03-28 18:09 | - | |
| secure-boot/ | 2026-03-28 18:10 | - | |
| secure-by-default/ | 2026-03-28 18:09 | - | |
| secure-erase/ | 2026-03-28 18:09 | - | |
| secure-files/ | 2026-03-28 18:09 | - | |
| secure-messenger/ | 2026-03-28 18:09 | - | |
| secure-pdf/ | 2026-03-28 18:09 | - | |
| secure/ | 2026-03-28 18:09 | - | |
| securefs/ | 2026-03-28 18:09 | - | |
| secureshelldaemon/ | 2026-03-28 18:10 | - | |
| secure web gateway/ | 2026-03-28 18:09 | - | |
| security-audit/ | 2026-03-28 18:09 | - | |
| security-eye/ | 2026-03-28 18:10 | - | |
| security-hardening/ | 2026-03-28 18:10 | - | |
| security-key/ | 2026-03-28 18:09 | - | |
| security-tools/ | 2026-03-28 18:09 | - | |
| security/ | 2026-03-28 18:09 | - | |
| sed/ | 2026-03-28 18:09 | - | |
| segagamegear/ | 2026-03-28 18:10 | - | |
| segamastersystem/ | 2026-03-28 18:10 | - | |
| segamegadrive/ | 2026-03-28 18:09 | - | |
| segasaturn/ | 2026-03-28 18:10 | - | |
| segasg-1000/ | 2026-03-28 18:09 | - | |
| segmentation/ | 2026-03-28 18:09 | - | |
| segwit/ | 2026-03-28 18:09 | - | |
| sekuritykey/ | 2026-03-28 18:10 | - | |
| select/ | 2026-03-28 18:09 | - | |
| selenium/ | 2026-03-28 18:09 | - | |
| self-custodial/ | 2026-03-28 18:09 | - | |
| self-custody/ | 2026-03-28 18:09 | - | |
| self-host-friendly/ | 2026-03-28 18:09 | - | |
| self-hosted/ | 2026-03-28 18:09 | - | |
| self-hosting/ | 2026-03-28 18:10 | - | |
| self-signed-certificate/ | 2026-03-28 18:09 | - | |
| self-sovereign-identity/ | 2026-03-28 18:10 | - | |
| self-updating/ | 2026-03-28 18:09 | - | |
| selfsignedcertificates/ | 2026-03-28 18:09 | - | |
| semantic/ | 2026-03-28 18:09 | - | |
| semconv/ | 2026-03-28 18:10 | - | |
| semeru/ | 2026-03-28 18:10 | - | |
| semmod/ | 2026-03-28 18:09 | - | |
| semver/ | 2026-03-28 18:09 | - | |
| send-files/ | 2026-03-28 18:10 | - | |
| send/ | 2026-03-28 18:09 | - | |
| sensor/ | 2026-03-28 18:09 | - | |
| sensors/ | 2026-03-28 18:09 | - | |
| sentry/ | 2026-03-28 18:10 | - | |
| seo/ | 2026-03-28 18:09 | - | |
| separate/ | 2026-03-28 18:09 | - | |
| separation/ | 2026-03-28 18:09 | - | |
| seq/ | 2026-03-28 18:09 | - | |
| sequelize/ | 2026-03-28 18:09 | - | |
| sequence/ | 2026-03-28 18:09 | - | |
| sequencer/ | 2026-03-28 18:09 | - | |
| sequencing/ | 2026-03-28 18:09 | - | |
| serbian/ | 2026-03-28 18:10 | - | |
| serial-port/ | 2026-03-28 18:09 | - | |
| serial-studio/ | 2026-03-28 18:09 | - | |
| serial/ | 2026-03-28 18:09 | - | |
| serialization-library/ | 2026-03-28 18:09 | - | |
| serialization/ | 2026-03-28 18:09 | - | |
| serialize/ | 2026-03-28 18:09 | - | |
| serialport/ | 2026-03-28 18:09 | - | |
| series/ | 2026-03-28 18:09 | - | |
| serpant/ | 2026-03-28 18:09 | - | |
| sershare.inf/ | 2026-03-28 18:09 | - | |
| serve/ | 2026-03-28 18:10 | - | |
| server-sent-events/ | 2026-03-28 18:10 | - | |
| server/ | 2026-03-28 18:09 | - | |
| serverless-functions/ | 2026-03-28 18:09 | - | |
| serverless/ | 2026-03-28 18:09 | - | |
| serverpicker/ | 2026-03-28 18:09 | - | |
| service-bus/ | 2026-03-28 18:09 | - | |
| service-choreography/ | 2026-03-28 18:09 | - | |
| service-management/ | 2026-03-28 18:09 | - | |
| service-manager/ | 2026-03-28 18:09 | - | |
| service-mesh/ | 2026-03-28 18:09 | - | |
| service-supervisor/ | 2026-03-28 18:09 | - | |
| service-wrapper/ | 2026-03-28 18:09 | - | |
| service/ | 2026-03-28 18:09 | - | |
| servicefabric/ | 2026-03-28 18:09 | - | |
| services/ | 2026-03-28 18:09 | - | |
| servicetool/ | 2026-03-28 18:09 | - | |
| servinfo/ | 2026-03-28 18:10 | - | |
| session/ | 2026-03-28 18:09 | - | |
| session0/ | 2026-03-28 18:09 | - | |
| setup/ | 2026-03-28 18:09 | - | |
| setupapi/ | 2026-03-28 18:09 | - | |
| sevenmax/ | 2026-03-28 18:09 | - | |
| sfark-to-sf2-converter/ | 2026-03-28 18:09 | - | |
| sfark2sf2/ | 2026-03-28 18:09 | - | |
| sfarktosf2converter/ | 2026-03-28 18:09 | - | |
| sfdx-cli/ | 2026-03-28 18:09 | - | |
| sfdx/ | 2026-03-28 18:09 | - | |
| sftp-client/ | 2026-03-28 18:09 | - | |
| sftp/ | 2026-03-28 18:09 | - | |
| sfu/ | 2026-03-28 18:09 | - | |
| sfv/ | 2026-03-28 18:09 | - | |
| sgb/ | 2026-03-28 18:09 | - | |
| sha-256 sha-384 sha-512 sha-224/ | 2026-03-28 18:10 | - | |
| sha/ | 2026-03-28 18:09 | - | |
| sha1/ | 2026-03-28 18:09 | - | |
| sha1checksumcalculating/ | 2026-03-28 18:09 | - | |
| sha1 sha-1/ | 2026-03-28 18:09 | - | |
| sha2-224 sha2-256 sha2-384 sha2-512/ | 2026-03-28 18:09 | - | |
| sha2/ | 2026-03-28 18:09 | - | |
| sha3-224 sha3-256 sha3-384 sha3-512/ | 2026-03-28 18:09 | - | |
| sha3/ | 2026-03-28 18:09 | - | |
| sha256-checksum-calculating/ | 2026-03-28 18:09 | - | |
| sha256/ | 2026-03-28 18:09 | - | |
| sha256 sha-256/ | 2026-03-28 18:09 | - | |
| sha256sum/ | 2026-03-28 18:10 | - | |
| sha384/ | 2026-03-28 18:09 | - | |
| sha384 sha-384/ | 2026-03-28 18:09 | - | |
| sha512/ | 2026-03-28 18:09 | - | |
| sha512 sha-512/ | 2026-03-28 18:09 | - | |
| shade/ | 2026-03-28 18:09 | - | |
| shader/ | 2026-03-28 18:10 | - | |
| shaders/ | 2026-03-28 18:10 | - | |
| shading/ | 2026-03-28 18:09 | - | |
| shadow/ | 2026-03-28 18:09 | - | |
| shadowplay/ | 2026-03-28 18:09 | - | |
| shadowsocks-electron/ | 2026-03-28 18:10 | - | |
| shadowsocks-gui/ | 2026-03-28 18:10 | - | |
| shadowsocks-libev-gui/ | 2026-03-28 18:10 | - | |
| shadowsocks-libev/ | 2026-03-28 18:10 | - | |
| shadowsocks/ | 2026-03-28 18:09 | - | |
| shadowsocksr/ | 2026-03-28 18:09 | - | |
| shake-128 shake-256/ | 2026-03-28 18:09 | - | |
| shamelesschecksums/ | 2026-03-28 18:09 | - | |
| share/ | 2026-03-28 18:09 | - | |
| sharefile/ | 2026-03-28 18:10 | - | |
| shareit/ | 2026-03-28 18:09 | - | |
| sharepoint/ | 2026-03-28 18:09 | - | |
| sharex/ | 2026-03-28 18:10 | - | |
| sharik/ | 2026-03-28 18:10 | - | |
| sharing/ | 2026-03-28 18:09 | - | |
| sharpen/ | 2026-03-28 18:09 | - | |
| shazam/ | 2026-03-28 18:10 | - | |
| sheet-music/ | 2026-03-28 18:09 | - | |
| sheet/ | 2026-03-28 18:09 | - | |
| sheet music/ | 2026-03-28 18:09 | - | |
| sheets/ | 2026-03-28 18:09 | - | |
| shell-extension/ | 2026-03-28 18:09 | - | |
| shell-prompt/ | 2026-03-28 18:09 | - | |
| shell-scripting/ | 2026-03-28 18:09 | - | |
| shell/ | 2026-03-28 18:09 | - | |
| shellcheck/ | 2026-03-28 18:09 | - | |
| shelter/ | 2026-03-28 18:10 | - | |
| shift-jis shift_jis shiftjis/ | 2026-03-28 18:09 | - | |
| shift-left/ | 2026-03-28 18:09 | - | |
| shifter/ | 2026-03-28 18:10 | - | |
| shim/ | 2026-03-28 18:09 | - | |
| shinchiro/ | 2026-03-28 18:10 | - | |
| shman/ | 2026-03-28 18:10 | - | |
| shogi/ | 2026-03-28 18:09 | - | |
| shooter/ | 2026-03-28 18:09 | - | |
| shootmaniastorm/ | 2026-03-28 18:09 | - | |
| shop/ | 2026-03-28 18:09 | - | |
| shopping/ | 2026-03-28 18:10 | - | |
| short-video/ | 2026-03-28 18:09 | - | |
| shortcut/ | 2026-03-28 18:09 | - | |
| shortcutbinds/ | 2026-03-28 18:09 | - | |
| shortcuts-man/ | 2026-03-28 18:10 | - | |
| shortcuts-on-desktop/ | 2026-03-28 18:09 | - | |
| shortcuts/ | 2026-03-28 18:09 | - | |
| shorts/ | 2026-03-28 18:09 | - | |
| shortwave/ | 2026-03-28 18:09 | - | |
| show/ | 2026-03-28 18:09 | - | |
| showdown/ | 2026-03-28 18:10 | - | |
| shred/ | 2026-03-28 18:09 | - | |
| shredder/ | 2026-03-28 18:10 | - | |
| shrink/ | 2026-03-28 18:09 | - | |
| shuffle/ | 2026-03-28 18:09 | - | |
| shutdown-timer/ | 2026-03-28 18:09 | - | |
| shutdown/ | 2026-03-28 18:09 | - | |
| sidebar/ | 2026-03-28 18:09 | - | |
| sidebyside/ | 2026-03-28 18:10 | - | |
| sideload/ | 2026-03-28 18:09 | - | |
| sideloader/ | 2026-03-28 18:09 | - | |
| sideloading/ | 2026-03-28 18:09 | - | |
| sidequest/ | 2026-03-28 18:09 | - | |
| sidescroller/ | 2026-03-28 18:09 | - | |
| sidescrolling/ | 2026-03-28 18:09 | - | |
| siege/ | 2026-03-28 18:09 | - | |
| siemens/ | 2026-03-28 18:09 | - | |
| sierra/ | 2026-03-28 18:10 | - | |
| sieve/ | 2026-03-28 18:10 | - | |
| sigid/ | 2026-03-28 18:09 | - | |
| sign-pdf/ | 2026-03-28 18:09 | - | |
| sign/ | 2026-03-28 18:09 | - | |
| signage/ | 2026-03-28 18:09 | - | |
| signal-processing/ | 2026-03-28 18:09 | - | |
| signal/ | 2026-03-28 18:09 | - | |
| signalk/ | 2026-03-28 18:09 | - | |
| signals/ | 2026-03-28 18:09 | - | |
| signature-verification/ | 2026-03-28 18:09 | - | |
| signature/ | 2026-03-28 18:09 | - | |
| signatures/ | 2026-03-28 18:09 | - | |
| signifyholding/ | 2026-03-28 18:10 | - | |
| silent-install/ | 2026-03-28 18:09 | - | |
| silentinstallations/ | 2026-03-28 18:10 | - | |
| silentinstallers/ | 2026-03-28 18:10 | - | |
| silver-searcher/ | 2026-03-28 18:09 | - | |
| silverlight/ | 2026-03-28 18:09 | - | |
| simd/ | 2026-03-28 18:09 | - | |
| similar-images/ | 2026-03-28 18:10 | - | |
| similar-music/ | 2026-03-28 18:10 | - | |
| similar-videos/ | 2026-03-28 18:10 | - | |
| similar/ | 2026-03-28 18:09 | - | |
| similarity-measurement/ | 2026-03-28 18:09 | - | |
| similarity/ | 2026-03-28 18:09 | - | |
| simkl/ | 2026-03-28 18:10 | - | |
| simple-app/ | 2026-03-28 18:09 | - | |
| simple-calculator-app/ | 2026-03-28 18:09 | - | |
| simple-calculator-python/ | 2026-03-28 18:09 | - | |
| simple-calculator/ | 2026-03-28 18:09 | - | |
| simple-mail-transfer-protocol/ | 2026-03-28 18:10 | - | |
| simple-networking/ | 2026-03-28 18:09 | - | |
| simple/ | 2026-03-28 18:09 | - | |
| simplehttpserver/ | 2026-03-28 18:10 | - | |
| simple image converter/ | 2026-03-28 18:09 | - | |
| simplemailtransferprotocol/ | 2026-03-28 18:10 | - | |
| sims/ | 2026-03-28 18:09 | - | |
| sims3-tool/ | 2026-03-28 18:10 | - | |
| sims3/ | 2026-03-28 18:09 | - | |
| simulate/ | 2026-03-28 18:09 | - | |
| simulation-framework/ | 2026-03-28 18:09 | - | |
| simulator/ | 2026-03-28 18:09 | - | |
| simulink/ | 2026-03-28 18:10 | - | |
| simultaneous-interpreting/ | 2026-03-28 18:09 | - | |
| sing-box/ | 2026-03-28 18:09 | - | |
| sing/ | 2026-03-28 18:10 | - | |
| singbox/ | 2026-03-28 18:09 | - | |
| singing-synthesis/ | 2026-03-28 18:09 | - | |
| singing-voice-synthesis/ | 2026-03-28 18:09 | - | |
| singing/ | 2026-03-28 18:10 | - | |
| single-sign-on/ | 2026-03-28 18:10 | - | |
| single-speakers/ | 2026-03-28 18:10 | - | |
| single-window/ | 2026-03-28 18:09 | - | |
| singleplayer/ | 2026-03-28 18:09 | - | |
| singlescreen/ | 2026-03-28 18:10 | - | |
| singlespeakers/ | 2026-03-28 18:10 | - | |
| sip/ | 2026-03-28 18:09 | - | |
| site/ | 2026-03-28 18:09 | - | |
| sites/ | 2026-03-28 18:10 | - | |
| six/ | 2026-03-28 18:09 | - | |
| sixel-graphics/ | 2026-03-28 18:09 | - | |
| sixel/ | 2026-03-28 18:09 | - | |
| size/ | 2026-03-28 18:09 | - | |
| sjtu/ | 2026-03-28 18:09 | - | |
| sk6812/ | 2026-03-28 18:09 | - | |
| skeletal-animation/ | 2026-03-28 18:09 | - | |
| skeleton/ | 2026-03-28 18:09 | - | |
| sketching/ | 2026-03-28 18:09 | - | |
| sk hynix/ | 2026-03-28 18:10 | - | |
| skhynix/ | 2026-03-28 18:10 | - | |
| skia/ | 2026-03-28 18:09 | - | |
| skills/ | 2026-03-28 18:10 | - | |
| skin/ | 2026-03-28 18:10 | - | |
| skk/ | 2026-03-28 18:09 | - | |
| sky/ | 2026-03-28 18:09 | - | |
| skype/ | 2026-03-28 18:09 | - | |
| skyrim/ | 2026-03-28 18:09 | - | |
| skytv/ | 2026-03-28 18:09 | - | |
| sl/ | 2026-03-28 18:10 | - | |
| sla/ | 2026-03-28 18:09 | - | |
| slack/ | 2026-03-28 18:09 | - | |
| sleep-apnea/ | 2026-03-28 18:09 | - | |
| sleep/ | 2026-03-28 18:09 | - | |
| sleuthkit/ | 2026-03-28 18:09 | - | |
| slice-images/ | 2026-03-28 18:09 | - | |
| slice-photo/ | 2026-03-28 18:09 | - | |
| slice-picture/ | 2026-03-28 18:09 | - | |
| slice-pictures/ | 2026-03-28 18:09 | - | |
| slicer/ | 2026-03-28 18:09 | - | |
| slide/ | 2026-03-28 18:09 | - | |
| slides/ | 2026-03-28 18:09 | - | |
| slideshow-maker/ | 2026-03-28 18:09 | - | |
| slideshow/ | 2026-03-28 18:09 | - | |
| slideshows/ | 2026-03-28 18:09 | - | |
| slik/ | 2026-03-28 18:09 | - | |
| slm/ | 2026-03-28 18:10 | - | |
| sloc/ | 2026-03-28 18:09 | - | |
| sloccount/ | 2026-03-28 18:09 | - | |
| sm3/ | 2026-03-28 18:09 | - | |
| smallstep/ | 2026-03-28 18:09 | - | |
| smart-card/ | 2026-03-28 18:10 | - | |
| smart-contracts/ | 2026-03-28 18:09 | - | |
| smart-copies/ | 2026-03-28 18:09 | - | |
| smart-home/ | 2026-03-28 18:09 | - | |
| smart-program/ | 2026-03-28 18:09 | - | |
| smart-tv/ | 2026-03-28 18:09 | - | |
| smart-tvs/ | 2026-03-28 18:09 | - | |
| smart/ | 2026-03-28 18:09 | - | |
| smartbox/ | 2026-03-28 18:09 | - | |
| smart card/ | 2026-03-28 18:09 | - | |
| smartcard/ | 2026-03-28 18:09 | - | |
| smartcardreader/ | 2026-03-28 18:09 | - | |
| smartcards/ | 2026-03-28 18:09 | - | |
| smartconnect/ | 2026-03-28 18:09 | - | |
| smartconnectextinstaller/ | 2026-03-28 18:09 | - | |
| smartctl/ | 2026-03-28 18:10 | - | |
| smartd/ | 2026-03-28 18:10 | - | |
| smartmanagedplus/ | 2026-03-28 18:09 | - | |
| smartmanagedpro/ | 2026-03-28 18:09 | - | |
| smartmonitor/ | 2026-03-28 18:09 | - | |
| smartphone-as-keyboard/ | 2026-03-28 18:10 | - | |
| smartphone-as-mouse/ | 2026-03-28 18:10 | - | |
| smartphone/ | 2026-03-28 18:09 | - | |
| smart room/ | 2026-03-28 18:09 | - | |
| smarttv/ | 2026-03-28 18:09 | - | |
| smarttvs/ | 2026-03-28 18:09 | - | |
| smartwatch/ | 2026-03-28 18:09 | - | |
| smb/ | 2026-03-28 18:10 | - | |
| smime/ | 2026-03-28 18:09 | - | |
| sml/ | 2026-03-28 18:10 | - | |
| sms/ | 2026-03-28 18:09 | - | |
| smtp-server/ | 2026-03-28 18:10 | - | |
| smtp/ | 2026-03-28 18:09 | - | |
| smtp4dev/ | 2026-03-28 18:10 | - | |
| snap/ | 2026-03-28 18:09 | - | |
| snappy-driver-installer/ | 2026-03-28 18:10 | - | |
| snapshot/ | 2026-03-28 18:09 | - | |
| snapshots/ | 2026-03-28 18:09 | - | |
| sndio/ | 2026-03-28 18:09 | - | |
| snefru-128 snefru-256/ | 2026-03-28 18:10 | - | |
| snes/ | 2026-03-28 18:09 | - | |
| sniffer/ | 2026-03-28 18:09 | - | |
| snip/ | 2026-03-28 18:09 | - | |
| snipaste/ | 2026-03-28 18:10 | - | |
| snippet-manager/ | 2026-03-28 18:10 | - | |
| snippet/ | 2026-03-28 18:09 | - | |
| snippets/ | 2026-03-28 18:09 | - | |
| snipping-tool/ | 2026-03-28 18:09 | - | |
| snipping/ | 2026-03-28 18:09 | - | |
| snmp/ | 2026-03-28 18:10 | - | |
| snow/ | 2026-03-28 18:09 | - | |
| snowflake/ | 2026-03-28 18:09 | - | |
| snowshot/ | 2026-03-28 18:09 | - | |
| sntp/ | 2026-03-28 18:09 | - | |
| snyk/ | 2026-03-28 18:10 | - | |
| soap/ | 2026-03-28 18:09 | - | |
| soapysdr/ | 2026-03-28 18:10 | - | |
| soc/ | 2026-03-28 18:10 | - | |
| social-media/ | 2026-03-28 18:09 | - | |
| social-network/ | 2026-03-28 18:09 | - | |
| socialmedia/ | 2026-03-28 18:09 | - | |
| socialmediastatus/ | 2026-03-28 18:10 | - | |
| socks4/ | 2026-03-28 18:09 | - | |
| socks5/ | 2026-03-28 18:09 | - | |
| soda-pdf/ | 2026-03-28 18:10 | - | |
| soda/ | 2026-03-28 18:10 | - | |
| soft-body-physics/ | 2026-03-28 18:09 | - | |
| soft-synths/ | 2026-03-28 18:09 | - | |
| softphone/ | 2026-03-28 18:09 | - | |
| softsea/ | 2026-03-28 18:09 | - | |
| softsubs/ | 2026-03-28 18:10 | - | |
| software-bill-of-materials/ | 2026-03-28 18:09 | - | |
| software-composition-analysis/ | 2026-03-28 18:10 | - | |
| software-defined-radio/ | 2026-03-28 18:09 | - | |
| software-development-kit/ | 2026-03-28 18:09 | - | |
| software-development/ | 2026-03-28 18:10 | - | |
| software-installation/ | 2026-03-28 18:09 | - | |
| software-management/ | 2026-03-28 18:09 | - | |
| software-programming/ | 2026-03-28 18:10 | - | |
| software-repository/ | 2026-03-28 18:09 | - | |
| software-supply-chain/ | 2026-03-28 18:10 | - | |
| software-updater/ | 2026-03-28 18:09 | - | |
| software/ | 2026-03-28 18:09 | - | |
| software defined radio/ | 2026-03-28 18:09 | - | |
| softwarerepository/ | 2026-03-28 18:09 | - | |
| sogou/ | 2026-03-28 18:09 | - | |
| sokoban/ | 2026-03-28 18:09 | - | |
| solana/ | 2026-03-28 18:09 | - | |
| solar/ | 2026-03-28 18:09 | - | |
| soldering/ | 2026-03-28 18:09 | - | |
| solid-state-drive/ | 2026-03-28 18:09 | - | |
| solidigm/ | 2026-03-28 18:10 | - | |
| solidjs/ | 2026-03-28 18:10 | - | |
| solidstatedrive/ | 2026-03-28 18:09 | - | |
| solidworks/ | 2026-03-28 18:10 | - | |
| solitaire/ | 2026-03-28 18:09 | - | |
| solver/ | 2026-03-28 18:09 | - | |
| somali-programming-language/ | 2026-03-28 18:10 | - | |
| somali/ | 2026-03-28 18:10 | - | |
| sonar/ | 2026-03-28 18:09 | - | |
| sonarr/ | 2026-03-28 18:09 | - | |
| song-downloader/ | 2026-03-28 18:10 | - | |
| song/ | 2026-03-28 18:09 | - | |
| songbook/ | 2026-03-28 18:09 | - | |
| songs/ | 2026-03-28 18:09 | - | |
| sonic-adventure-2/ | 2026-03-28 18:10 | - | |
| sonic-adventure/ | 2026-03-28 18:10 | - | |
| sonic-colors-ultimate/ | 2026-03-28 18:10 | - | |
| sonic-forces/ | 2026-03-28 18:10 | - | |
| sonic-generations/ | 2026-03-28 18:10 | - | |
| sonic-lost-world/ | 2026-03-28 18:10 | - | |
| sonic-origins/ | 2026-03-28 18:10 | - | |
| sono/ | 2026-03-28 18:09 | - | |
| sonoff-tasmota/ | 2026-03-28 18:09 | - | |
| sonoff/ | 2026-03-28 18:09 | - | |
| sonos/ | 2026-03-28 18:09 | - | |
| sony-alpha-cameras/ | 2026-03-28 18:09 | - | |
| sony/ | 2026-03-28 18:09 | - | |
| sop/ | 2026-03-28 18:10 | - | |
| sophia-script/ | 2026-03-28 18:10 | - | |
| sophia/ | 2026-03-28 18:10 | - | |
| sophiapp/ | 2026-03-28 18:10 | - | |
| soplang/ | 2026-03-28 18:10 | - | |
| sops/ | 2026-03-28 18:10 | - | |
| soql/ | 2026-03-28 18:10 | - | |
| sort/ | 2026-03-28 18:09 | - | |
| sorter/ | 2026-03-28 18:09 | - | |
| sorting/ | 2026-03-28 18:10 | - | |
| soulseek/ | 2026-03-28 18:09 | - | |
| sound-blaster/ | 2026-03-28 18:09 | - | |
| sound-configuration/ | 2026-03-28 18:10 | - | |
| sound-recording/ | 2026-03-28 18:09 | - | |
| sound-visualizer/ | 2026-03-28 18:09 | - | |
| sound/ | 2026-03-28 18:09 | - | |
| soundblaster/ | 2026-03-28 18:09 | - | |
| soundcloud/ | 2026-03-28 18:09 | - | |
| soundconfiguration/ | 2026-03-28 18:09 | - | |
| sounddevices/ | 2026-03-28 18:09 | - | |
| soundediting/ | 2026-03-28 18:09 | - | |
| soundeditor/ | 2026-03-28 18:09 | - | |
| soundfont-files/ | 2026-03-28 18:09 | - | |
| soundfontfiles/ | 2026-03-28 18:09 | - | |
| soundfonts/ | 2026-03-28 18:09 | - | |
| soundmixing/ | 2026-03-28 18:09 | - | |
| soundmodem/ | 2026-03-28 18:09 | - | |
| soundrecording/ | 2026-03-28 18:09 | - | |
| soundscape/ | 2026-03-28 18:09 | - | |
| soundtranscriber/ | 2026-03-28 18:10 | - | |
| soup/ | 2026-03-28 18:10 | - | |
| source-available/ | 2026-03-28 18:10 | - | |
| source-control-client/ | 2026-03-28 18:10 | - | |
| source-control/ | 2026-03-28 18:09 | - | |
| source-engine/ | 2026-03-28 18:09 | - | |
| source-port/ | 2026-03-28 18:09 | - | |
| source/ | 2026-03-28 18:09 | - | |
| source2-engine/ | 2026-03-28 18:09 | - | |
| source2/ | 2026-03-28 18:09 | - | |
| sourveillance/ | 2026-03-28 18:09 | - | |
| sp1187/ | 2026-03-28 18:10 | - | |
| space-analyzer/ | 2026-03-28 18:09 | - | |
| space-radar/ | 2026-03-28 18:09 | - | |
| space-use/ | 2026-03-28 18:09 | - | |
| space/ | 2026-03-28 18:09 | - | |
| spacecap/ | 2026-03-28 18:09 | - | |
| spacecom/ | 2026-03-28 18:09 | - | |
| spacedeskdisplay.inf/ | 2026-03-28 18:09 | - | |
| spacedeskdriverandroidcontrol.inf/ | 2026-03-28 18:09 | - | |
| spacedeskdriverandroidusb.inf/ | 2026-03-28 18:09 | - | |
| spacedeskdriveraudio.inf/ | 2026-03-28 18:09 | - | |
| spacedeskdriverbus.inf/ | 2026-03-28 18:09 | - | |
| spacedeskdriverhid.inf/ | 2026-03-28 18:09 | - | |
| spacedeskktminputmouse.inf/ | 2026-03-28 18:09 | - | |
| spacedeskvideocapture.inf/ | 2026-03-28 18:09 | - | |
| spacehogs/ | 2026-03-28 18:10 | - | |
| spacelift/ | 2026-03-28 18:10 | - | |
| spacemouse/ | 2026-03-28 18:09 | - | |
| spam-filtering/ | 2026-03-28 18:10 | - | |
| spam/ | 2026-03-28 18:09 | - | |
| spanning-tree/ | 2026-03-28 18:10 | - | |
| sparc-dataset/ | 2026-03-28 18:09 | - | |
| spark/ | 2026-03-28 18:09 | - | |
| sparkassen/ | 2026-03-28 18:09 | - | |
| sparkle/ | 2026-03-28 18:09 | - | |
| spatial-autocorrelation-statistics/ | 2026-03-28 18:09 | - | |
| spatial-data-analysis/ | 2026-03-28 18:09 | - | |
| spatial-data-science/ | 2026-03-28 18:09 | - | |
| spatial-regression-analysis/ | 2026-03-28 18:09 | - | |
| spbcmd/ | 2026-03-28 18:09 | - | |
| spbus.inf/ | 2026-03-28 18:09 | - | |
| spdif-keep-alive/ | 2026-03-28 18:09 | - | |
| spdifka/ | 2026-03-28 18:09 | - | |
| spdifkeepalive/ | 2026-03-28 18:09 | - | |
| spdx/ | 2026-03-28 18:09 | - | |
| speak/ | 2026-03-28 18:09 | - | |
| speaker-settings/ | 2026-03-28 18:10 | - | |
| speaker-volumes/ | 2026-03-28 18:10 | - | |
| speaker/ | 2026-03-28 18:09 | - | |
| speakersettings/ | 2026-03-28 18:10 | - | |
| special-characters/ | 2026-03-28 18:09 | - | |
| specialcharacters/ | 2026-03-28 18:09 | - | |
| specialized-formatter/ | 2026-03-28 18:09 | - | |
| specification/ | 2026-03-28 18:09 | - | |
| specs/ | 2026-03-28 18:09 | - | |
| spectrogram/ | 2026-03-28 18:09 | - | |
| spectrographic/ | 2026-03-28 18:10 | - | |
| spectrometry/ | 2026-03-28 18:09 | - | |
| spectroscopy/ | 2026-03-28 18:09 | - | |
| spectrum-analyzer/ | 2026-03-28 18:09 | - | |
| spectrum/ | 2026-03-28 18:09 | - | |
| speech-analysis/ | 2026-03-28 18:10 | - | |
| speech-converter/ | 2026-03-28 18:09 | - | |
| speech-recognition/ | 2026-03-28 18:09 | - | |
| speech-synthesis/ | 2026-03-28 18:09 | - | |
| speech-synthesizer/ | 2026-03-28 18:09 | - | |
| speech-to-text/ | 2026-03-28 18:09 | - | |
| speech/ | 2026-03-28 18:09 | - | |
| speechrecognition/ | 2026-03-28 18:09 | - | |
| speed-engine/ | 2026-03-28 18:09 | - | |
| speed-limit/ | 2026-03-28 18:09 | - | |
| speed-monitor/ | 2026-03-28 18:09 | - | |
| speed/ | 2026-03-28 18:09 | - | |
| speedcrunch/ | 2026-03-28 18:10 | - | |
| speedrun/ | 2026-03-28 18:09 | - | |
| speedrunning/ | 2026-03-28 18:09 | - | |
| speedtest-cli/ | 2026-03-28 18:09 | - | |
| speedtest/ | 2026-03-28 18:09 | - | |
| speedup/ | 2026-03-28 18:09 | - | |
| spell-checker/ | 2026-03-28 18:09 | - | |
| spelling/ | 2026-03-28 18:09 | - | |
| spelunky/ | 2026-03-28 18:09 | - | |
| spi/ | 2026-03-28 18:09 | - | |
| spice/ | 2026-03-28 18:09 | - | |
| spider/ | 2026-03-28 18:09 | - | |
| spidermonkey/ | 2026-03-28 18:09 | - | |
| spigot/ | 2026-03-28 18:09 | - | |
| spike/ | 2026-03-28 18:09 | - | |
| splat/ | 2026-03-28 18:09 | - | |
| split-binary/ | 2026-03-28 18:09 | - | |
| split-by-separator/ | 2026-03-28 18:09 | - | |
| split-by-size/ | 2026-03-28 18:09 | - | |
| split-files/ | 2026-03-28 18:09 | - | |
| split-pane/ | 2026-03-28 18:09 | - | |
| split-parts/ | 2026-03-28 18:09 | - | |
| split-pdf/ | 2026-03-28 18:09 | - | |
| split-photos/ | 2026-03-28 18:09 | - | |
| split-pictures/ | 2026-03-28 18:09 | - | |
| split-text/ | 2026-03-28 18:09 | - | |
| split-tunnel/ | 2026-03-28 18:09 | - | |
| split/ | 2026-03-28 18:09 | - | |
| splitpartitions/ | 2026-03-28 18:09 | - | |
| splits/ | 2026-03-28 18:09 | - | |
| splitscreen/ | 2026-03-28 18:10 | - | |
| splunk/ | 2026-03-28 18:10 | - | |
| spoon-dec/ | 2026-03-28 18:09 | - | |
| spoon-installer-extractor/ | 2026-03-28 18:09 | - | |
| spoon-installers/ | 2026-03-28 18:09 | - | |
| spooninstallerextractor/ | 2026-03-28 18:09 | - | |
| spooninstallers/ | 2026-03-28 18:09 | - | |
| sportsgame/ | 2026-03-28 18:09 | - | |
| spotify-downloader/ | 2026-03-28 18:09 | - | |
| spotify-tui/ | 2026-03-28 18:09 | - | |
| spotify-windows/ | 2026-03-28 18:09 | - | |
| spotify/ | 2026-03-28 18:09 | - | |
| spotlight/ | 2026-03-28 18:09 | - | |
| spreadsheet/ | 2026-03-28 18:09 | - | |
| spreadsheets/ | 2026-03-28 18:09 | - | |
| spright/ | 2026-03-28 18:09 | - | |
| spring-boot/ | 2026-03-28 18:10 | - | |
| sprite-animation/ | 2026-03-28 18:10 | - | |
| sprite/ | 2026-03-28 18:09 | - | |
| sprites/ | 2026-03-28 18:10 | - | |
| spritesheet-packer/ | 2026-03-28 18:09 | - | |
| spritesheet/ | 2026-03-28 18:10 | - | |
| sps/ | 2026-03-28 18:09 | - | |
| sql-cli/ | 2026-03-28 18:09 | - | |
| sql-editor/ | 2026-03-28 18:09 | - | |
| sql-like/ | 2026-03-28 18:09 | - | |
| sql-management-studio/ | 2026-03-28 18:09 | - | |
| sql-server/ | 2026-03-28 18:09 | - | |
| sql/ | 2026-03-28 18:09 | - | |
| sqlcmd/ | 2026-03-28 18:09 | - | |
| sqlite/ | 2026-03-28 18:09 | - | |
| sqlite3/ | 2026-03-28 18:09 | - | |
| sqlpackage/ | 2026-03-28 18:09 | - | |
| sqlserver/ | 2026-03-28 18:09 | - | |
| squadron-42/ | 2026-03-28 18:09 | - | |
| squarewindows/ | 2026-03-28 18:10 | - | |
| sre/ | 2026-03-28 18:09 | - | |
| srmd/ | 2026-03-28 18:09 | - | |
| srmi/ | 2026-03-28 18:09 | - | |
| ssbb/ | 2026-03-28 18:10 | - | |
| ssd-recovery/ | 2026-03-28 18:09 | - | |
| ssd/ | 2026-03-28 18:09 | - | |
| ssdb/ | 2026-03-28 18:10 | - | |
| ssh-agent/ | 2026-03-28 18:09 | - | |
| ssh-bridge/ | 2026-03-28 18:09 | - | |
| ssh-certificates/ | 2026-03-28 18:09 | - | |
| ssh-client/ | 2026-03-28 18:09 | - | |
| ssh-key/ | 2026-03-28 18:09 | - | |
| ssh-keys/ | 2026-03-28 18:09 | - | |
| ssh-tunnel/ | 2026-03-28 18:09 | - | |
| ssh/ | 2026-03-28 18:09 | - | |
| sshcertificates/ | 2026-03-28 18:09 | - | |
| sshd/ | 2026-03-28 18:09 | - | |
| sshdserver/ | 2026-03-28 18:10 | - | |
| sshfs/ | 2026-03-28 18:09 | - | |
| sshkeys/ | 2026-03-28 18:10 | - | |
| sshpublickeys/ | 2026-03-28 18:10 | - | |
| sshserver/ | 2026-03-28 18:09 | - | |
| ssim/ | 2026-03-28 18:09 | - | |
| ssl/ | 2026-03-28 18:09 | - | |
| ssml/ | 2026-03-28 18:09 | - | |
| ssms/ | 2026-03-28 18:09 | - | |
| sso/ | 2026-03-28 18:10 | - | |
| ssr-client/ | 2026-03-28 18:10 | - | |
| ssr/ | 2026-03-28 18:09 | - | |
| st25r3911b/ | 2026-03-28 18:10 | - | |
| stabilization/ | 2026-03-28 18:09 | - | |
| stable-diffusion/ | 2026-03-28 18:09 | - | |
| stack-based/ | 2026-03-28 18:09 | - | |
| stack/ | 2026-03-28 18:09 | - | |
| stackage/ | 2026-03-28 18:09 | - | |
| stackexchange/ | 2026-03-28 18:09 | - | |
| stackless/ | 2026-03-28 18:09 | - | |
| stacklok/ | 2026-03-28 18:09 | - | |
| stacks/ | 2026-03-28 18:09 | - | |
| stadium/ | 2026-03-28 18:09 | - | |
| stage-management/ | 2026-03-28 18:09 | - | |
| stage-timer/ | 2026-03-28 18:09 | - | |
| stage/ | 2026-03-28 18:09 | - | |
| standalone/ | 2026-03-28 18:09 | - | |
| standard-ml/ | 2026-03-28 18:10 | - | |
| standard/ | 2026-03-28 18:09 | - | |
| standardnotes/ | 2026-03-28 18:10 | - | |
| star-citizen/ | 2026-03-28 18:09 | - | |
| star-rail/ | 2026-03-28 18:09 | - | |
| star/ | 2026-03-28 18:09 | - | |
| stardew valley/ | 2026-03-28 18:10 | - | |
| starfield/ | 2026-03-28 18:09 | - | |
| starlight-stage/ | 2026-03-28 18:10 | - | |
| starrail/ | 2026-03-28 18:09 | - | |
| starship/ | 2026-03-28 18:09 | - | |
| start-menu/ | 2026-03-28 18:09 | - | |
| starter/ | 2026-03-28 18:09 | - | |
| startmenu/ | 2026-03-28 18:09 | - | |
| startrek/ | 2026-03-28 18:10 | - | |
| startup-manager/ | 2026-03-28 18:09 | - | |
| startup/ | 2026-03-28 18:09 | - | |
| stashing/ | 2026-03-28 18:10 | - | |
| static-analysis/ | 2026-03-28 18:09 | - | |
| static-code-analysis/ | 2026-03-28 18:09 | - | |
| static-site-generator/ | 2026-03-28 18:09 | - | |
| static-site/ | 2026-03-28 18:09 | - | |
| static/ | 2026-03-28 18:09 | - | |
| statically-typed/ | 2026-03-28 18:09 | - | |
| statistical-analysis/ | 2026-03-28 18:09 | - | |
| statistics/ | 2026-03-28 18:09 | - | |
| statligatjänster/ | 2026-03-28 18:09 | - | |
| stats/ | 2026-03-28 18:09 | - | |
| status/ | 2026-03-28 18:09 | - | |
| status bar/ | 2026-03-28 18:10 | - | |
| statusbar/ | 2026-03-28 18:09 | - | |
| stb-client/ | 2026-03-28 18:10 | - | |
| steam-account/ | 2026-03-28 18:09 | - | |
| steam-api/ | 2026-03-28 18:09 | - | |
| steam-cards/ | 2026-03-28 18:09 | - | |
| steam-client/ | 2026-03-28 18:09 | - | |
| steam-deck/ | 2026-03-28 18:10 | - | |
| steam-games/ | 2026-03-28 18:09 | - | |
| steam-link/ | 2026-03-28 18:10 | - | |
| steam-locomotive/ | 2026-03-28 18:10 | - | |
| steam-network/ | 2026-03-28 18:09 | - | |
| steam/ | 2026-03-28 18:09 | - | |
| steambot/ | 2026-03-28 18:09 | - | |
| steamdeck/ | 2026-03-28 18:09 | - | |
| steamkit2/ | 2026-03-28 18:09 | - | |
| steampipe/ | 2026-03-28 18:10 | - | |
| steam steam-idle-master steam-farm/ | 2026-03-28 18:10 | - | |
| steamstub-drm/ | 2026-03-28 18:09 | - | |
| steamvr/ | 2026-03-28 18:09 | - | |
| steamworks/ | 2026-03-28 18:10 | - | |
| steelseriesengine/ | 2026-03-28 18:09 | - | |
| steganography/ | 2026-03-28 18:10 | - | |
| stella-mod/ | 2026-03-28 18:10 | - | |
| stellamod/ | 2026-03-28 18:10 | - | |
| stellar/ | 2026-03-28 18:09 | - | |
| stellaris/ | 2026-03-28 18:09 | - | |
| stenography/ | 2026-03-28 18:10 | - | |
| step/ | 2026-03-28 18:09 | - | |
| stepmania/ | 2026-03-28 18:10 | - | |
| steps-recorder/ | 2026-03-28 18:10 | - | |
| stereoscopy/ | 2026-03-28 18:09 | - | |
| sticky-notes/ | 2026-03-28 18:09 | - | |
| stickynotes/ | 2026-03-28 18:09 | - | |
| stl-viewer/ | 2026-03-28 18:09 | - | |
| stl/ | 2026-03-28 18:09 | - | |
| stlib/ | 2026-03-28 18:09 | - | |
| stobe/ | 2026-03-28 18:09 | - | |
| stock-management/ | 2026-03-28 18:10 | - | |
| stock-market/ | 2026-03-28 18:09 | - | |
| stock-ordering/ | 2026-03-28 18:10 | - | |
| stock-positions/ | 2026-03-28 18:09 | - | |
| stock/ | 2026-03-28 18:09 | - | |
| stocks-app/ | 2026-03-28 18:09 | - | |
| stocks/ | 2026-03-28 18:09 | - | |
| stoeytelling/ | 2026-03-28 18:09 | - | |
| stop-process/ | 2026-03-28 18:09 | - | |
| stopwatch/ | 2026-03-28 18:09 | - | |
| storage-scanner/ | 2026-03-28 18:09 | - | |
| storage/ | 2026-03-28 18:09 | - | |
| storagespace/ | 2026-03-28 18:09 | - | |
| store/ | 2026-03-28 18:09 | - | |
| storj-dcs/ | 2026-03-28 18:10 | - | |
| storj/ | 2026-03-28 18:10 | - | |
| story/ | 2026-03-28 18:09 | - | |
| stow/ | 2026-03-28 18:09 | - | |
| stp/ | 2026-03-28 18:09 | - | |
| strategy-game/ | 2026-03-28 18:09 | - | |
| strategy/ | 2026-03-28 18:09 | - | |
| stream-pi/ | 2026-03-28 18:09 | - | |
| stream/ | 2026-03-28 18:09 | - | |
| streamdeck/ | 2026-03-28 18:09 | - | |
| streamer/ | 2026-03-28 18:09 | - | |
| streaming-algorithms/ | 2026-03-28 18:09 | - | |
| streaming-api/ | 2026-03-28 18:09 | - | |
| streaming-audio/ | 2026-03-28 18:09 | - | |
| streaming-data/ | 2026-03-28 18:09 | - | |
| streaming-services/ | 2026-03-28 18:09 | - | |
| streaming-video/ | 2026-03-28 18:09 | - | |
| streaming/ | 2026-03-28 18:09 | - | |
| streamlabs-obs-remote/ | 2026-03-28 18:09 | - | |
| streamlabs/ | 2026-03-28 18:09 | - | |
| streampi/ | 2026-03-28 18:10 | - | |
| streamway/ | 2026-03-28 18:10 | - | |
| streamway obs plugin/ | 2026-03-28 18:10 | - | |
| streebog/ | 2026-03-28 18:09 | - | |
| stremio-addon/ | 2026-03-28 18:09 | - | |
| stremio-client/ | 2026-03-28 18:09 | - | |
| stremio-enhanced/ | 2026-03-28 18:10 | - | |
| stremio-local-addon-manager/ | 2026-03-28 18:10 | - | |
| stremio-server/ | 2026-03-28 18:10 | - | |
| stremio-theme/ | 2026-03-28 18:10 | - | |
| stremio-themes/ | 2026-03-28 18:10 | - | |
| stremio-web/ | 2026-03-28 18:09 | - | |
| stremio-webplayer/ | 2026-03-28 18:10 | - | |
| stremio/ | 2026-03-28 18:09 | - | |
| stress-test/ | 2026-03-28 18:09 | - | |
| stress-testing/ | 2026-03-28 18:10 | - | |
| stress/ | 2026-03-28 18:09 | - | |
| stresstest/ | 2026-03-28 18:10 | - | |
| string-generator/ | 2026-03-28 18:09 | - | |
| string/ | 2026-03-28 18:09 | - | |
| strings/ | 2026-03-28 18:09 | - | |
| strobejb/ | 2026-03-28 18:09 | - | |
| stroboscope/ | 2026-03-28 18:09 | - | |
| structural-engineering/ | 2026-03-28 18:09 | - | |
| structural-search/ | 2026-03-28 18:09 | - | |
| structural/ | 2026-03-28 18:09 | - | |
| structured-log/ | 2026-03-28 18:10 | - | |
| structured-logging/ | 2026-03-28 18:10 | - | |
| stud.io/ | 2026-03-28 18:09 | - | |
| student/ | 2026-03-28 18:10 | - | |
| students/ | 2026-03-28 18:09 | - | |
| studio-roblox/ | 2026-03-28 18:10 | - | |
| studio/ | 2026-03-28 18:09 | - | |
| study/ | 2026-03-28 18:09 | - | |
| stunts/ | 2026-03-28 18:09 | - | |
| style-guide/ | 2026-03-28 18:10 | - | |
| style/ | 2026-03-28 18:09 | - | |
| styleguide/ | 2026-03-28 18:10 | - | |
| stylus/ | 2026-03-28 18:09 | - | |
| subdivision/ | 2026-03-28 18:10 | - | |
| subreddit/ | 2026-03-28 18:09 | - | |
| subrip/ | 2026-03-28 18:09 | - | |
| subs/ | 2026-03-28 18:09 | - | |
| subscriptions/ | 2026-03-28 18:10 | - | |
| subsonic-client/ | 2026-03-28 18:09 | - | |
| subsonic-server/ | 2026-03-28 18:09 | - | |
| subsonic/ | 2026-03-28 18:09 | - | |
| substitute/ | 2026-03-28 18:09 | - | |
| subtitle-conversion/ | 2026-03-28 18:09 | - | |
| subtitle-correction/ | 2026-03-28 18:10 | - | |
| subtitle-creator/ | 2026-03-28 18:09 | - | |
| subtitle-files/ | 2026-03-28 18:10 | - | |
| subtitle/ | 2026-03-28 18:09 | - | |
| subtitles/ | 2026-03-28 18:09 | - | |
| subversion/ | 2026-03-28 18:09 | - | |
| subway/ | 2026-03-28 18:09 | - | |
| sudo/ | 2026-03-28 18:09 | - | |
| sudoku/ | 2026-03-28 18:09 | - | |
| suhelper/ | 2026-03-28 18:09 | - | |
| suite/ | 2026-03-28 18:10 | - | |
| summarization/ | 2026-03-28 18:09 | - | |
| sumologic/ | 2026-03-28 18:10 | - | |
| sunspec/ | 2026-03-28 18:09 | - | |
| supaplex/ | 2026-03-28 18:09 | - | |
| super-famicom/ | 2026-03-28 18:09 | - | |
| super-game-boy/ | 2026-03-28 18:09 | - | |
| super-nintendo-entertainment-system/ | 2026-03-28 18:09 | - | |
| super-resolution/ | 2026-03-28 18:09 | - | |
| super-scope/ | 2026-03-28 18:09 | - | |
| super-smash-bros-brawl/ | 2026-03-28 18:10 | - | |
| super-smash-bros/ | 2026-03-28 18:10 | - | |
| super-structured-data/ | 2026-03-28 18:09 | - | |
| superaudiocd/ | 2026-03-28 18:10 | - | |
| supercollider/ | 2026-03-28 18:10 | - | |
| superfamicom/ | 2026-03-28 18:09 | - | |
| supergameboy/ | 2026-03-28 18:09 | - | |
| supernes/ | 2026-03-28 18:09 | - | |
| supernintendoentertainmentsystem/ | 2026-03-28 18:09 | - | |
| superpose/ | 2026-03-28 18:09 | - | |
| superposition/ | 2026-03-28 18:09 | - | |
| superscope/ | 2026-03-28 18:09 | - | |
| supertuxkart/ | 2026-03-28 18:09 | - | |
| suphx/ | 2026-03-28 18:09 | - | |
| supply-chain/ | 2026-03-28 18:09 | - | |
| supply/ | 2026-03-28 18:10 | - | |
| support/ | 2026-03-28 18:09 | - | |
| surface-app/ | 2026-03-28 18:10 | - | |
| surface-earbuds/ | 2026-03-28 18:09 | - | |
| surface-headphones/ | 2026-03-28 18:09 | - | |
| surfaceearbuds/ | 2026-03-28 18:09 | - | |
| surfaceheadphones/ | 2026-03-28 18:09 | - | |
| surfacehub1/ | 2026-03-28 18:09 | - | |
| surfacehubtoolsforit/ | 2026-03-28 18:09 | - | |
| surreal/ | 2026-03-28 18:10 | - | |
| surveillance/ | 2026-03-28 18:09 | - | |
| surveillancecamera/ | 2026-03-28 18:10 | - | |
| survivalgame/ | 2026-03-28 18:09 | - | |
| suspend/ | 2026-03-28 18:09 | - | |
| svelte/ | 2026-03-28 18:09 | - | |
| svenskadagbladet/ | 2026-03-28 18:10 | - | |
| sverige/ | 2026-03-28 18:09 | - | |
| svg-cleaner-gui/ | 2026-03-28 18:10 | - | |
| svg-converter/ | 2026-03-28 18:09 | - | |
| svg-explorer-extension/ | 2026-03-28 18:10 | - | |
| svg-optimizer/ | 2026-03-28 18:10 | - | |
| svg-optimizing/ | 2026-03-28 18:10 | - | |
| svg-png/ | 2026-03-28 18:09 | - | |
| svg-rendering-context-2d/ | 2026-03-28 18:09 | - | |
| svg/ | 2026-03-28 18:09 | - | |
| svgexplorerextension/ | 2026-03-28 18:10 | - | |
| svgz/ | 2026-03-28 18:10 | - | |
| svn/ | 2026-03-28 18:09 | - | |
| svt-av1/ | 2026-03-28 18:09 | - | |
| svt-play/ | 2026-03-28 18:10 | - | |
| svtplaydl/ | 2026-03-28 18:10 | - | |
| swagger/ | 2026-03-28 18:09 | - | |
| swap/ | 2026-03-28 18:09 | - | |
| swarm/ | 2026-03-28 18:09 | - | |
| swe-prod/ | 2026-03-28 18:09 | - | |
| sweden/ | 2026-03-28 18:09 | - | |
| swf/ | 2026-03-28 18:09 | - | |
| swg/ | 2026-03-28 18:09 | - | |
| swift/ | 2026-03-28 18:09 | - | |
| swiftpoint/ | 2026-03-28 18:10 | - | |
| swing/ | 2026-03-28 18:09 | - | |
| swiss/ | 2026-03-28 18:09 | - | |
| switch-window/ | 2026-03-28 18:10 | - | |
| switch/ | 2026-03-28 18:09 | - | |
| sword-art-online/ | 2026-03-28 18:09 | - | |
| sword/ | 2026-03-28 18:09 | - | |
| sx10/ | 2026-03-28 18:09 | - | |
| sybase/ | 2026-03-28 18:09 | - | |
| syestem/ | 2026-03-28 18:09 | - | |
| symbian-os/ | 2026-03-28 18:09 | - | |
| symbianos/ | 2026-03-28 18:09 | - | |
| symbolic-link/ | 2026-03-28 18:10 | - | |
| symbolic-links/ | 2026-03-28 18:09 | - | |
| symbolic/ | 2026-03-28 18:09 | - | |
| symboliclinks/ | 2026-03-28 18:09 | - | |
| symbols/ | 2026-03-28 18:09 | - | |
| symlink-manager/ | 2026-03-28 18:09 | - | |
| symlink/ | 2026-03-28 18:09 | - | |
| symlinks/ | 2026-03-28 18:09 | - | |
| symmetric-encryption/ | 2026-03-28 18:09 | - | |
| synapse/ | 2026-03-28 18:10 | - | |
| synaptic/ | 2026-03-28 18:09 | - | |
| synawudfbiousbkensprod.inf/ | 2026-03-28 18:09 | - | |
| sync/ | 2026-03-28 18:09 | - | |
| syncbox/ | 2026-03-28 18:09 | - | |
| synced-lyrics/ | 2026-03-28 18:09 | - | |
| synchronisation/ | 2026-03-28 18:10 | - | |
| synchronization/ | 2026-03-28 18:09 | - | |
| synchronizer/ | 2026-03-28 18:10 | - | |
| synfig/ | 2026-03-28 18:10 | - | |
| syntax-highlighting/ | 2026-03-28 18:09 | - | |
| syntax/ | 2026-03-28 18:09 | - | |
| synth/ | 2026-03-28 18:09 | - | |
| synthesis/ | 2026-03-28 18:09 | - | |
| synthesizer/ | 2026-03-28 18:09 | - | |
| synthetic/ | 2026-03-28 18:09 | - | |
| synthv/ | 2026-03-28 18:10 | - | |
| sys-ex-transfer/ | 2026-03-28 18:09 | - | |
| sysadmin/ | 2026-03-28 18:09 | - | |
| sysex/ | 2026-03-28 18:09 | - | |
| sysinfo/ | 2026-03-28 18:09 | - | |
| sysml/ | 2026-03-28 18:09 | - | |
| sysops/ | 2026-03-28 18:09 | - | |
| system-administration/ | 2026-03-28 18:09 | - | |
| system-backup/ | 2026-03-28 18:09 | - | |
| system-cleaner/ | 2026-03-28 18:09 | - | |
| system-dynamics/ | 2026-03-28 18:09 | - | |
| system-explorer/ | 2026-03-28 18:10 | - | |
| system-info/ | 2026-03-28 18:09 | - | |
| system-information/ | 2026-03-28 18:09 | - | |
| system-monitor/ | 2026-03-28 18:09 | - | |
| system-monitoring/ | 2026-03-28 18:09 | - | |
| system-overview/ | 2026-03-28 18:10 | - | |
| system-size-management/ | 2026-03-28 18:09 | - | |
| system-tray/ | 2026-03-28 18:09 | - | |
| system-upgrade/ | 2026-03-28 18:09 | - | |
| system-utility/ | 2026-03-28 18:09 | - | |
| system/ | 2026-03-28 18:09 | - | |
| systemanalysis/ | 2026-03-28 18:10 | - | |
| systemchannels/ | 2026-03-28 18:10 | - | |
| systemcleaning/ | 2026-03-28 18:09 | - | |
| systemd/ | 2026-03-28 18:10 | - | |
| systemexclusivetransfer/ | 2026-03-28 18:09 | - | |
| systemfiles/ | 2026-03-28 18:10 | - | |
| systemfunctionsdisabling/ | 2026-03-28 18:09 | - | |
| systeminformation/ | 2026-03-28 18:09 | - | |
| systemmenu/ | 2026-03-28 18:09 | - | |
| system monitor/ | 2026-03-28 18:09 | - | |
| systemoptimizing/ | 2026-03-28 18:09 | - | |
| systemprocess/ | 2026-03-28 18:09 | - | |
| systemrestore/ | 2026-03-28 18:09 | - | |
| systemtime/ | 2026-03-28 18:09 | - | |
| systemupdates/ | 2026-03-28 18:09 | - | |
| systemupgrade/ | 2026-03-28 18:09 | - | |
| szsexplorer/ | 2026-03-28 18:09 | - | |
| t-sql/ | 2026-03-28 18:09 | - | |
| t6sta.inf/ | 2026-03-28 18:09 | - | |
| tab-key/ | 2026-03-28 18:10 | - | |
| tab-rehab/ | 2026-03-28 18:10 | - | |
| tab/ | 2026-03-28 18:09 | - | |
| tabbed-interface/ | 2026-03-28 18:09 | - | |
| tabbed-ui/ | 2026-03-28 18:09 | - | |
| tablature/ | 2026-03-28 18:09 | - | |
| table-view/ | 2026-03-28 18:09 | - | |
| tableplus/ | 2026-03-28 18:09 | - | |
| tablet/ | 2026-03-28 18:09 | - | |
| tabletop-gaming/ | 2026-03-28 18:10 | - | |
| tabletop/ | 2026-03-28 18:09 | - | |
| tablets/ | 2026-03-28 18:09 | - | |
| tabs/ | 2026-03-28 18:09 | - | |
| tabular-data/ | 2026-03-28 18:09 | - | |
| tachidesk/ | 2026-03-28 18:09 | - | |
| tachiyomi/ | 2026-03-28 18:09 | - | |
| tactical/ | 2026-03-28 18:10 | - | |
| tag/ | 2026-03-28 18:09 | - | |
| tagger/ | 2026-03-28 18:09 | - | |
| tagging/ | 2026-03-28 18:09 | - | |
| tags/ | 2026-03-28 18:09 | - | |
| tags editor/ | 2026-03-28 18:10 | - | |
| tail/ | 2026-03-28 18:09 | - | |
| tailwind/ | 2026-03-28 18:09 | - | |
| tailwindcss/ | 2026-03-28 18:09 | - | |
| takeoff/ | 2026-03-28 18:09 | - | |
| takeout/ | 2026-03-28 18:10 | - | |
| taketwointeractive/ | 2026-03-28 18:09 | - | |
| talan-air/ | 2026-03-28 18:10 | - | |
| talan/ | 2026-03-28 18:10 | - | |
| talk/ | 2026-03-28 18:09 | - | |
| talos/ | 2026-03-28 18:09 | - | |
| tangent/ | 2026-03-28 18:09 | - | |
| tanks/ | 2026-03-28 18:09 | - | |
| taobao/ | 2026-03-28 18:09 | - | |
| taomee/ | 2026-03-28 18:10 | - | |
| tar/ | 2026-03-28 18:09 | - | |
| tarball/ | 2026-03-28 18:09 | - | |
| targzfiles/ | 2026-03-28 18:09 | - | |
| task-management/ | 2026-03-28 18:09 | - | |
| task-manager/ | 2026-03-28 18:09 | - | |
| task-runner/ | 2026-03-28 18:09 | - | |
| task-scheduler/ | 2026-03-28 18:09 | - | |
| task/ | 2026-03-28 18:09 | - | |
| taskbar-application/ | 2026-03-28 18:09 | - | |
| taskbar-icon/ | 2026-03-28 18:09 | - | |
| taskbar-launcher/ | 2026-03-28 18:09 | - | |
| taskbar/ | 2026-03-28 18:09 | - | |
| taskfile/ | 2026-03-28 18:10 | - | |
| tasking/ | 2026-03-28 18:10 | - | |
| tasklist/ | 2026-03-28 18:10 | - | |
| task manager/ | 2026-03-28 18:09 | - | |
| taskmanager/ | 2026-03-28 18:09 | - | |
| tasks/ | 2026-03-28 18:09 | - | |
| tasmoadmin/ | 2026-03-28 18:09 | - | |
| tasmota/ | 2026-03-28 18:09 | - | |
| tauri-app/ | 2026-03-28 18:09 | - | |
| tauri-apps/ | 2026-03-28 18:09 | - | |
| tauri-rust/ | 2026-03-28 18:09 | - | |
| tauri-v2/ | 2026-03-28 18:09 | - | |
| tauri/ | 2026-03-28 18:09 | - | |
| tauri2/ | 2026-03-28 18:10 | - | |
| tautulli/ | 2026-03-28 18:10 | - | |
| tcg/ | 2026-03-28 18:09 | - | |
| tcno-account-switcher/ | 2026-03-28 18:09 | - | |
| tcp-client/ | 2026-03-28 18:10 | - | |
| tcp-server/ | 2026-03-28 18:10 | - | |
| tcp/ | 2026-03-28 18:09 | - | |
| tcpinging/ | 2026-03-28 18:10 | - | |
| tcpip-stack/ | 2026-03-28 18:10 | - | |
| tcpip/ | 2026-03-28 18:10 | - | |
| tcpping/ | 2026-03-28 18:10 | - | |
| tcsh/ | 2026-03-28 18:09 | - | |
| tcvn3/ | 2026-03-28 18:10 | - | |
| tdd/ | 2026-03-28 18:10 | - | |
| tdp/ | 2026-03-28 18:09 | - | |
| teach/ | 2026-03-28 18:09 | - | |
| teacher/ | 2026-03-28 18:09 | - | |
| teaching/ | 2026-03-28 18:09 | - | |
| tealdeer/ | 2026-03-28 18:09 | - | |
| team-devtools/ | 2026-03-28 18:09 | - | |
| team/ | 2026-03-28 18:09 | - | |
| teamcity/ | 2026-03-28 18:09 | - | |
| teamfight-tactics/ | 2026-03-28 18:10 | - | |
| teamfoundationserver/ | 2026-03-28 18:09 | - | |
| teammate/ | 2026-03-28 18:09 | - | |
| teams/ | 2026-03-28 18:09 | - | |
| teamviewer/ | 2026-03-28 18:09 | - | |
| tech/ | 2026-03-28 18:09 | - | |
| technische-sicherheitseinrichtung/ | 2026-03-28 18:09 | - | |
| ted/ | 2026-03-28 18:09 | - | |
| telefax/ | 2026-03-28 18:09 | - | |
| telegraf/ | 2026-03-28 18:09 | - | |
| telegram-api/ | 2026-03-28 18:09 | - | |
| telegram-client/ | 2026-03-28 18:09 | - | |
| telegram-desktop-client/ | 2026-03-28 18:09 | - | |
| telegram-desktop/ | 2026-03-28 18:09 | - | |
| telegram/ | 2026-03-28 18:09 | - | |
| telemetry/ | 2026-03-28 18:09 | - | |
| telephone/ | 2026-03-28 18:09 | - | |
| telephony/ | 2026-03-28 18:09 | - | |
| teleprompter/ | 2026-03-28 18:10 | - | |
| telescope/ | 2026-03-28 18:09 | - | |
| teletext/ | 2026-03-28 18:09 | - | |
| television/ | 2026-03-28 18:09 | - | |
| televisionrecordings/ | 2026-03-28 18:10 | - | |
| telex/ | 2026-03-28 18:09 | - | |
| telnet/ | 2026-03-28 18:09 | - | |
| telnetserver/ | 2026-03-28 18:09 | - | |
| temerature-monitoring/ | 2026-03-28 18:09 | - | |
| temp-files/ | 2026-03-28 18:10 | - | |
| temp/ | 2026-03-28 18:09 | - | |
| temp_cleaner/ | 2026-03-28 18:09 | - | |
| temperature/ | 2026-03-28 18:09 | - | |
| temperaturesensors/ | 2026-03-28 18:09 | - | |
| tempfoldercleaning/ | 2026-03-28 18:09 | - | |
| template-engine/ | 2026-03-28 18:09 | - | |
| template/ | 2026-03-28 18:09 | - | |
| templates/ | 2026-03-28 18:09 | - | |
| templating/ | 2026-03-28 18:09 | - | |
| tempo/ | 2026-03-28 18:10 | - | |
| temporal/ | 2026-03-28 18:10 | - | |
| temporary-credentials/ | 2026-03-28 18:09 | - | |
| temporary-files/ | 2026-03-28 18:09 | - | |
| temps/ | 2026-03-28 18:09 | - | |
| temurin/ | 2026-03-28 18:10 | - | |
| ten-framework/ | 2026-03-28 18:10 | - | |
| ten/ | 2026-03-28 18:10 | - | |
| tencent-cloud/ | 2026-03-28 18:09 | - | |
| tencent-meeting/ | 2026-03-28 18:09 | - | |
| tencent/ | 2026-03-28 18:09 | - | |
| tentacle/ | 2026-03-28 18:10 | - | |
| teradata/ | 2026-03-28 18:09 | - | |
| teraterm/ | 2026-03-28 18:09 | - | |
| teraterm5/ | 2026-03-28 18:10 | - | |
| terminal-app/ | 2026-03-28 18:09 | - | |
| terminal-based/ | 2026-03-28 18:09 | - | |
| terminal-emulator/ | 2026-03-28 18:09 | - | |
| terminal-emulators/ | 2026-03-28 18:09 | - | |
| terminal-graphics/ | 2026-03-28 18:09 | - | |
| terminal-pager/ | 2026-03-28 18:10 | - | |
| terminal-ui/ | 2026-03-28 18:09 | - | |
| terminal/ | 2026-03-28 18:09 | - | |
| terminate-process/ | 2026-03-28 18:09 | - | |
| terminus/ | 2026-03-28 18:09 | - | |
| terraform-docs/ | 2026-03-28 18:10 | - | |
| terraform-switcher/ | 2026-03-28 18:10 | - | |
| terraform/ | 2026-03-28 18:09 | - | |
| terragrunt/ | 2026-03-28 18:09 | - | |
| terrain/ | 2026-03-28 18:09 | - | |
| terramate/ | 2026-03-28 18:10 | - | |
| terraria/ | 2026-03-28 18:10 | - | |
| terrestrial/ | 2026-03-28 18:10 | - | |
| tes/ | 2026-03-28 18:10 | - | |
| tesseract-ocr/ | 2026-03-28 18:10 | - | |
| tesseract/ | 2026-03-28 18:09 | - | |
| test-automation/ | 2026-03-28 18:09 | - | |
| test-driven-development/ | 2026-03-28 18:10 | - | |
| test/ | 2026-03-28 18:09 | - | |
| testbench/ | 2026-03-28 18:09 | - | |
| testcoverage/ | 2026-03-28 18:09 | - | |
| testdrivendevelopment/ | 2026-03-28 18:10 | - | |
| tester/ | 2026-03-28 18:09 | - | |
| testing-tools/ | 2026-03-28 18:09 | - | |
| testing/ | 2026-03-28 18:09 | - | |
| tetrate/ | 2026-03-28 18:09 | - | |
| tetrio/ | 2026-03-28 18:10 | - | |
| tetris/ | 2026-03-28 18:09 | - | |
| tetrisclone/ | 2026-03-28 18:10 | - | |
| tetrislike/ | 2026-03-28 18:10 | - | |
| tex/ | 2026-03-28 18:09 | - | |
| texas/ | 2026-03-28 18:09 | - | |
| texmacs/ | 2026-03-28 18:10 | - | |
| texstudio/ | 2026-03-28 18:10 | - | |
| text-analysis-tool-dot-net/ | 2026-03-28 18:09 | - | |
| text-analysis/ | 2026-03-28 18:10 | - | |
| text-compare/ | 2026-03-28 18:10 | - | |
| text-document/ | 2026-03-28 18:09 | - | |
| text-editing/ | 2026-03-28 18:09 | - | |
| text-editor/ | 2026-03-28 18:09 | - | |
| text-encoding/ | 2026-03-28 18:09 | - | |
| text-expander/ | 2026-03-28 18:09 | - | |
| text-expansion/ | 2026-03-28 18:09 | - | |
| text-file/ | 2026-03-28 18:09 | - | |
| text-files/ | 2026-03-28 18:09 | - | |
| text-merge/ | 2026-03-28 18:10 | - | |
| text-prediction/ | 2026-03-28 18:09 | - | |
| text-processing/ | 2026-03-28 18:09 | - | |
| text-replace/ | 2026-03-28 18:09 | - | |
| text-replacement/ | 2026-03-28 18:09 | - | |
| text-replacing/ | 2026-03-28 18:09 | - | |
| text-snippets/ | 2026-03-28 18:09 | - | |
| text-to-audio/ | 2026-03-28 18:09 | - | |
| text-to-diagram/ | 2026-03-28 18:10 | - | |
| text-to-mp3/ | 2026-03-28 18:09 | - | |
| text-to-speech/ | 2026-03-28 18:09 | - | |
| text-tv/ | 2026-03-28 18:10 | - | |
| text-watermark/ | 2026-03-28 18:09 | - | |
| text/ | 2026-03-28 18:09 | - | |
| textanalysistooldotnet/ | 2026-03-28 18:09 | - | |
| textdecoding/ | 2026-03-28 18:10 | - | |
| text editor/ | 2026-03-28 18:10 | - | |
| texteditor/ | 2026-03-28 18:09 | - | |
| textencodingsconverter/ | 2026-03-28 18:09 | - | |
| textfiles/ | 2026-03-28 18:09 | - | |
| texting/ | 2026-03-28 18:09 | - | |
| textmode/ | 2026-03-28 18:09 | - | |
| textreplacement/ | 2026-03-28 18:09 | - | |
| textreplacing/ | 2026-03-28 18:09 | - | |
| texttv/ | 2026-03-28 18:10 | - | |
| texture-atlas/ | 2026-03-28 18:09 | - | |
| texture-packing/ | 2026-03-28 18:09 | - | |
| texture-synthesis/ | 2026-03-28 18:10 | - | |
| texturepacker/ | 2026-03-28 18:09 | - | |
| textures/ | 2026-03-28 18:09 | - | |
| texturing/ | 2026-03-28 18:09 | - | |
| tf/ | 2026-03-28 18:10 | - | |
| tflint/ | 2026-03-28 18:10 | - | |
| tfs/ | 2026-03-28 18:09 | - | |
| tfscmdlets/ | 2026-03-28 18:09 | - | |
| tfswitch/ | 2026-03-28 18:10 | - | |
| tftp-server/ | 2026-03-28 18:09 | - | |
| tftp/ | 2026-03-28 18:09 | - | |
| tga/ | 2026-03-28 18:09 | - | |
| tgz/ | 2026-03-28 18:09 | - | |
| thai/ | 2026-03-28 18:09 | - | |
| thaw/ | 2026-03-28 18:09 | - | |
| the-elder-scrolls-v-skyrim/ | 2026-03-28 18:10 | - | |
| the-elder-scrolls/ | 2026-03-28 18:10 | - | |
| theelderscrollsvskyrim/ | 2026-03-28 18:10 | - | |
| theia/ | 2026-03-28 18:09 | - | |
| theme-customizer/ | 2026-03-28 18:09 | - | |
| theme-hospital/ | 2026-03-28 18:09 | - | |
| theme-support/ | 2026-03-28 18:09 | - | |
| theme-switch/ | 2026-03-28 18:09 | - | |
| theme-switcher/ | 2026-03-28 18:10 | - | |
| theme/ | 2026-03-28 18:09 | - | |
| themes/ | 2026-03-28 18:09 | - | |
| theoldreader/ | 2026-03-28 18:09 | - | |
| theorem-prover/ | 2026-03-28 18:09 | - | |
| thermal/ | 2026-03-28 18:09 | - | |
| thermodynamics/ | 2026-03-28 18:09 | - | |
| thesaurus/ | 2026-03-28 18:09 | - | |
| thesims/ | 2026-03-28 18:10 | - | |
| thesims3/ | 2026-03-28 18:09 | - | |
| thesis/ | 2026-03-28 18:09 | - | |
| theta/ | 2026-03-28 18:10 | - | |
| thinkbook/ | 2026-03-28 18:09 | - | |
| thinkcentre/ | 2026-03-28 18:09 | - | |
| thinkpad/ | 2026-03-28 18:09 | - | |
| thinkserver/ | 2026-03-28 18:09 | - | |
| thinkstation/ | 2026-03-28 18:09 | - | |
| third-party-viewer/ | 2026-03-28 18:10 | - | |
| thorchain/ | 2026-03-28 18:10 | - | |
| thorium-browser/ | 2026-03-28 18:09 | - | |
| thoughts/ | 2026-03-28 18:09 | - | |
| thr-ii/ | 2026-03-28 18:10 | - | |
| thr30iia/ | 2026-03-28 18:10 | - | |
| threat-dragon/ | 2026-03-28 18:10 | - | |
| threat-intelligence/ | 2026-03-28 18:09 | - | |
| threat-modeling/ | 2026-03-28 18:10 | - | |
| three-way/ | 2026-03-28 18:09 | - | |
| threejs/ | 2026-03-28 18:10 | - | |
| threema/ | 2026-03-28 18:10 | - | |
| threshold/ | 2026-03-28 18:09 | - | |
| thruck/ | 2026-03-28 18:09 | - | |
| thu/ | 2026-03-28 18:10 | - | |
| thumbnail-images/ | 2026-03-28 18:09 | - | |
| thumbnail/ | 2026-03-28 18:09 | - | |
| thumbs.db/ | 2026-03-28 18:09 | - | |
| thunderbird/ | 2026-03-28 18:09 | - | |
| thunderbolt-4/ | 2026-03-28 18:09 | - | |
| thunderbolt-5/ | 2026-03-28 18:09 | - | |
| thunderbolt-share/ | 2026-03-28 18:09 | - | |
| thunderbolt4/ | 2026-03-28 18:09 | - | |
| thunderbolt5/ | 2026-03-28 18:09 | - | |
| ti-83-premium-ce/ | 2026-03-28 18:09 | - | |
| ti-84-plus-ce/ | 2026-03-28 18:09 | - | |
| ti-nspire/ | 2026-03-28 18:10 | - | |
| tiberian/ | 2026-03-28 18:09 | - | |
| ticker/ | 2026-03-28 18:09 | - | |
| ticket/ | 2026-03-28 18:09 | - | |
| ticodex/ | 2026-03-28 18:10 | - | |
| tidal-downloader/ | 2026-03-28 18:09 | - | |
| tidal/ | 2026-03-28 18:10 | - | |
| tiddlywiki/ | 2026-03-28 18:10 | - | |
| tif/ | 2026-03-28 18:09 | - | |
| tigerhash/ | 2026-03-28 18:10 | - | |
| tiktok-downloader/ | 2026-03-28 18:10 | - | |
| tiktok-live/ | 2026-03-28 18:09 | - | |
| tiktok/ | 2026-03-28 18:09 | - | |
| tikz/ | 2026-03-28 18:10 | - | |
| tile/ | 2026-03-28 18:09 | - | |
| tiled/ | 2026-03-28 18:09 | - | |
| tilemap/ | 2026-03-28 18:09 | - | |
| tiling-window-manager/ | 2026-03-28 18:09 | - | |
| time-keeping/ | 2026-03-28 18:09 | - | |
| time-management-app/ | 2026-03-28 18:10 | - | |
| time-management-tool/ | 2026-03-28 18:10 | - | |
| time-management/ | 2026-03-28 18:09 | - | |
| time-series/ | 2026-03-28 18:09 | - | |
| time-stretching/ | 2026-03-28 18:09 | - | |
| time-tracker/ | 2026-03-28 18:09 | - | |
| time-tracking-app/ | 2026-03-28 18:10 | - | |
| time-tracking/ | 2026-03-28 18:09 | - | |
| time/ | 2026-03-28 18:09 | - | |
| timeboxing/ | 2026-03-28 18:09 | - | |
| timed-screenshot-taker/ | 2026-03-28 18:09 | - | |
| timedscreenshottaker/ | 2026-03-28 18:09 | - | |
| timeline/ | 2026-03-28 18:09 | - | |
| timelord/ | 2026-03-28 18:09 | - | |
| time management/ | 2026-03-28 18:09 | - | |
| timer/ | 2026-03-28 18:09 | - | |
| timesheet/ | 2026-03-28 18:10 | - | |
| timestamp/ | 2026-03-28 18:09 | - | |
| timesynchronization/ | 2026-03-28 18:09 | - | |
| timesynctool/ | 2026-03-28 18:09 | - | |
| timetable/ | 2026-03-28 18:09 | - | |
| timetracker/ | 2026-03-28 18:10 | - | |
| timetracking/ | 2026-03-28 18:09 | - | |
| timezone/ | 2026-03-28 18:09 | - | |
| timing/ | 2026-03-28 18:09 | - | |
| tinfoil/ | 2026-03-28 18:09 | - | |
| tint/ | 2026-03-28 18:09 | - | |
| tiny-tiny-rss/ | 2026-03-28 18:09 | - | |
| tinygo/ | 2026-03-28 18:10 | - | |
| tinypng/ | 2026-03-28 18:10 | - | |
| titanfall-2/ | 2026-03-28 18:10 | - | |
| titanfall/ | 2026-03-28 18:10 | - | |
| title/ | 2026-03-28 18:09 | - | |
| titlebar/ | 2026-03-28 18:09 | - | |
| titulky/ | 2026-03-28 18:09 | - | |
| tizen-app-installer/ | 2026-03-28 18:09 | - | |
| tizen-os/ | 2026-03-28 18:09 | - | |
| tizen/ | 2026-03-28 18:09 | - | |
| tizenos/ | 2026-03-28 18:09 | - | |
| tkey-ssh-agent/ | 2026-03-28 18:10 | - | |
| tkinter/ | 2026-03-28 18:09 | - | |
| tldr/ | 2026-03-28 18:09 | - | |
| tls/ | 2026-03-28 18:09 | - | |
| tls13/ | 2026-03-28 18:10 | - | |
| tm2/ | 2026-03-28 18:09 | - | |
| tmnf/ | 2026-03-28 18:09 | - | |
| tmuf/ | 2026-03-28 18:09 | - | |
| tmunited/ | 2026-03-28 18:09 | - | |
| tmux/ | 2026-03-28 18:09 | - | |
| tmuxpanel/ | 2026-03-28 18:09 | - | |
| tmuxplugins/ | 2026-03-28 18:09 | - | |
| tmuxthemes/ | 2026-03-28 18:09 | - | |
| tn3270/ | 2026-03-28 18:09 | - | |
| tn3812/ | 2026-03-28 18:09 | - | |
| tn5250/ | 2026-03-28 18:09 | - | |
| to-do-list/ | 2026-03-28 18:09 | - | |
| to-do/ | 2026-03-28 18:09 | - | |
| to/ | 2026-03-28 18:09 | - | |
| toast-notifications/ | 2026-03-28 18:09 | - | |
| todo-app/ | 2026-03-28 18:09 | - | |
| todo-list/ | 2026-03-28 18:09 | - | |
| todo/ | 2026-03-28 18:09 | - | |
| todoapp/ | 2026-03-28 18:09 | - | |
| todolist/ | 2026-03-28 18:09 | - | |
| togaf/ | 2026-03-28 18:09 | - | |
| toggl/ | 2026-03-28 18:10 | - | |
| toggle-hdr/ | 2026-03-28 18:09 | - | |
| toggle/ | 2026-03-28 18:09 | - | |
| togglehdr/ | 2026-03-28 18:09 | - | |
| toho/ | 2026-03-28 18:10 | - | |
| toit/ | 2026-03-28 18:09 | - | |
| tokei/ | 2026-03-28 18:09 | - | |
| token/ | 2026-03-28 18:09 | - | |
| tokenend/ | 2026-03-28 18:10 | - | |
| tokenization/ | 2026-03-28 18:09 | - | |
| tokenizer/ | 2026-03-28 18:09 | - | |
| tomas-rudh/ | 2026-03-28 18:10 | - | |
| tomato-clock/ | 2026-03-28 18:10 | - | |
| tomato-timer/ | 2026-03-28 18:10 | - | |
| tomato/ | 2026-03-28 18:09 | - | |
| tomatoes/ | 2026-03-28 18:09 | - | |
| tomboy-notes-tomboy-ng/ | 2026-03-28 18:10 | - | |
| tomboynotestomboyng/ | 2026-03-28 18:10 | - | |
| toml-parser/ | 2026-03-28 18:10 | - | |
| toml/ | 2026-03-28 18:09 | - | |
| tomtom/ | 2026-03-28 18:09 | - | |
| ton/ | 2026-03-28 18:09 | - | |
| tooka/ | 2026-03-28 18:09 | - | |
| tool-manager/ | 2026-03-28 18:09 | - | |
| tool/ | 2026-03-28 18:09 | - | |
| toolbar/ | 2026-03-28 18:09 | - | |
| toolbox/ | 2026-03-28 18:09 | - | |
| toolchain/ | 2026-03-28 18:10 | - | |
| toolhive/ | 2026-03-28 18:09 | - | |
| tooling-team/ | 2026-03-28 18:10 | - | |
| tooling/ | 2026-03-28 18:09 | - | |
| toolkit/ | 2026-03-28 18:09 | - | |
| tools/ | 2026-03-28 18:09 | - | |
| tooltips/ | 2026-03-28 18:10 | - | |
| top-down/ | 2026-03-28 18:09 | - | |
| top-secret/ | 2026-03-28 18:09 | - | |
| topbar/ | 2026-03-28 18:09 | - | |
| topdown/ | 2026-03-28 18:09 | - | |
| topdownview/ | 2026-03-28 18:09 | - | |
| topo/ | 2026-03-28 18:09 | - | |
| topographic/ | 2026-03-28 18:09 | - | |
| topography/ | 2026-03-28 18:10 | - | |
| tor-onion-service/ | 2026-03-28 18:09 | - | |
| tor/ | 2026-03-28 18:09 | - | |
| torent-management/ | 2026-03-28 18:09 | - | |
| tornetwork/ | 2026-03-28 18:10 | - | |
| torpedo/ | 2026-03-28 18:10 | - | |
| torrent-client/ | 2026-03-28 18:09 | - | |
| torrent-files/ | 2026-03-28 18:10 | - | |
| torrent-management/ | 2026-03-28 18:10 | - | |
| torrent-search-engine/ | 2026-03-28 18:09 | - | |
| torrent/ | 2026-03-28 18:09 | - | |
| torrenting/ | 2026-03-28 18:10 | - | |
| torrents/ | 2026-03-28 18:10 | - | |
| tortoise/ | 2026-03-28 18:09 | - | |
| tos/ | 2026-03-28 18:09 | - | |
| toslink/ | 2026-03-28 18:09 | - | |
| tosu/ | 2026-03-28 18:10 | - | |
| totp-cli/ | 2026-03-28 18:10 | - | |
| totp/ | 2026-03-28 18:09 | - | |
| touch-keyboard/ | 2026-03-28 18:09 | - | |
| touch-screen/ | 2026-03-28 18:09 | - | |
| touch/ | 2026-03-28 18:09 | - | |
| touchkeyboard/ | 2026-03-28 18:09 | - | |
| touchpad-remote/ | 2026-03-28 18:09 | - | |
| touchpad/ | 2026-03-28 18:10 | - | |
| touchscreen/ | 2026-03-28 18:10 | - | |
| touhou/ | 2026-03-28 18:10 | - | |
| tournament/ | 2026-03-28 18:09 | - | |
| toutiao/ | 2026-03-28 18:09 | - | |
| tp/ | 2026-03-28 18:10 | - | |
| tpleditor/ | 2026-03-28 18:09 | - | |
| tplink/ | 2026-03-28 18:10 | - | |
| traceroute/ | 2026-03-28 18:09 | - | |
| tracert/ | 2026-03-28 18:09 | - | |
| traces/ | 2026-03-28 18:09 | - | |
| tracing/ | 2026-03-28 18:09 | - | |
| track/ | 2026-03-28 18:09 | - | |
| tracker-music/ | 2026-03-28 18:09 | - | |
| tracker/ | 2026-03-28 18:09 | - | |
| trackers/ | 2026-03-28 18:09 | - | |
| tracking-protection/ | 2026-03-28 18:09 | - | |
| tracking/ | 2026-03-28 18:09 | - | |
| trackmania/ | 2026-03-28 18:09 | - | |
| trackmania2/ | 2026-03-28 18:09 | - | |
| trackpad/ | 2026-03-28 18:10 | - | |
| trade/ | 2026-03-28 18:09 | - | |
| trading-paints/ | 2026-03-28 18:10 | - | |
| trading/ | 2026-03-28 18:09 | - | |
| traducicmd/ | 2026-03-28 18:09 | - | |
| traffic/ | 2026-03-28 18:09 | - | |
| train/ | 2026-03-28 18:09 | - | |
| trainer/ | 2026-03-28 18:10 | - | |
| training/ | 2026-03-28 18:10 | - | |
| trakt/ | 2026-03-28 18:09 | - | |
| traktor/ | 2026-03-28 18:10 | - | |
| transaction/ | 2026-03-28 18:10 | - | |
| transcode/ | 2026-03-28 18:09 | - | |
| transcoder/ | 2026-03-28 18:09 | - | |
| transcoding/ | 2026-03-28 18:09 | - | |
| transcribe/ | 2026-03-28 18:09 | - | |
| transcriber/ | 2026-03-28 18:09 | - | |
| transcript/ | 2026-03-28 18:10 | - | |
| transcription/ | 2026-03-28 18:09 | - | |
| transfer/ | 2026-03-28 18:09 | - | |
| transform/ | 2026-03-28 18:09 | - | |
| transformation/ | 2026-03-28 18:10 | - | |
| transitions/ | 2026-03-28 18:09 | - | |
| translate/ | 2026-03-28 18:09 | - | |
| translating/ | 2026-03-28 18:09 | - | |
| translatingtool/ | 2026-03-28 18:09 | - | |
| translation/ | 2026-03-28 18:09 | - | |
| translations/ | 2026-03-28 18:09 | - | |
| translationtool/ | 2026-03-28 18:09 | - | |
| translator/ | 2026-03-28 18:09 | - | |
| translucent/ | 2026-03-28 18:09 | - | |
| transmission-daemon/ | 2026-03-28 18:10 | - | |
| transmission/ | 2026-03-28 18:09 | - | |
| transmitter/ | 2026-03-28 18:10 | - | |
| transmore/ | 2026-03-28 18:09 | - | |
| transparency/ | 2026-03-28 18:09 | - | |
| transparent/ | 2026-03-28 18:09 | - | |
| transpiler/ | 2026-03-28 18:09 | - | |
| transport-tycoon/ | 2026-03-28 18:10 | - | |
| trash/ | 2026-03-28 18:10 | - | |
| travel/ | 2026-03-28 18:09 | - | |
| travis-ci/ | 2026-03-28 18:09 | - | |
| travis-lee-robinson/ | 2026-03-28 18:09 | - | |
| travisleerobinson/ | 2026-03-28 18:09 | - | |
| tray-app/ | 2026-03-28 18:09 | - | |
| tray-application/ | 2026-03-28 18:09 | - | |
| tray-icon/ | 2026-03-28 18:09 | - | |
| tray/ | 2026-03-28 18:09 | - | |
| treasure-agent/ | 2026-03-28 18:10 | - | |
| trebleshot/ | 2026-03-28 18:09 | - | |
| tree-sitter/ | 2026-03-28 18:09 | - | |
| tree/ | 2026-03-28 18:09 | - | |
| treemap-charts/ | 2026-03-28 18:10 | - | |
| treemap/ | 2026-03-28 18:09 | - | |
| treemaps/ | 2026-03-28 18:09 | - | |
| trezor/ | 2026-03-28 18:09 | - | |
| trezorbridge/ | 2026-03-28 18:10 | - | |
| trgidd64.inf/ | 2026-03-28 18:09 | - | |
| trh/ | 2026-03-28 18:09 | - | |
| trials/ | 2026-03-28 18:10 | - | |
| trigger-segfault-wiimote-audio-player/ | 2026-03-28 18:10 | - | |
| triggersegfaultwiimoteaudioplayer/ | 2026-03-28 18:10 | - | |
| trilingual/ | 2026-03-28 18:10 | - | |
| trim/ | 2026-03-28 18:09 | - | |
| trip/ | 2026-03-28 18:09 | - | |
| tripitaka/ | 2026-03-28 18:09 | - | |
| tripple-des/ | 2026-03-28 18:09 | - | |
| trld/ | 2026-03-28 18:09 | - | |
| trojan/ | 2026-03-28 18:09 | - | |
| troubleshooting/ | 2026-03-28 18:09 | - | |
| truehd/ | 2026-03-28 18:09 | - | |
| truetype-rasterization/ | 2026-03-28 18:09 | - | |
| trump-suit/ | 2026-03-28 18:09 | - | |
| trusta/ | 2026-03-28 18:09 | - | |
| trustedqsl/ | 2026-03-28 18:09 | - | |
| trzsz trz tsz rz sz ssh zmodem/ | 2026-03-28 18:10 | - | |
| trzsz trz tsz rz sz zmodem tmux lrzsz/ | 2026-03-28 18:10 | - | |
| ts-videofiles/ | 2026-03-28 18:10 | - | |
| ts/ | 2026-03-28 18:09 | - | |
| ts3/ | 2026-03-28 18:09 | - | |
| tse/ | 2026-03-28 18:09 | - | |
| tsf/ | 2026-03-28 18:09 | - | |
| tsinghua-university/ | 2026-03-28 18:10 | - | |
| tsv-diff/ | 2026-03-28 18:09 | - | |
| tsv-files/ | 2026-03-28 18:09 | - | |
| tsv-parser/ | 2026-03-28 18:09 | - | |
| tsv/ | 2026-03-28 18:09 | - | |
| ttd/ | 2026-03-28 18:10 | - | |
| tth/ | 2026-03-28 18:10 | - | |
| ttl/ | 2026-03-28 18:09 | - | |
| tts/ | 2026-03-28 18:09 | - | |
| tty/ | 2026-03-28 18:09 | - | |
| ttyd/ | 2026-03-28 18:10 | - | |
| tuckr/ | 2026-03-28 18:10 | - | |
| tui,podcasts/ | 2026-03-28 18:10 | - | |
| tui-app/ | 2026-03-28 18:10 | - | |
| tui-rs/ | 2026-03-28 18:09 | - | |
| tui/ | 2026-03-28 18:09 | - | |
| tuic/ | 2026-03-28 18:09 | - | |
| tumblr/ | 2026-03-28 18:09 | - | |
| tun-device/ | 2026-03-28 18:10 | - | |
| tun2socks/ | 2026-03-28 18:09 | - | |
| tunet/ | 2026-03-28 18:10 | - | |
| tuning/ | 2026-03-28 18:09 | - | |
| tunnel/ | 2026-03-28 18:09 | - | |
| tunneling/ | 2026-03-28 18:10 | - | |
| turbocor/ | 2026-03-28 18:09 | - | |
| turbografx-16/ | 2026-03-28 18:09 | - | |
| turbografx16/ | 2026-03-28 18:10 | - | |
| turn-based/ | 2026-03-28 18:09 | - | |
| turnbased/ | 2026-03-28 18:09 | - | |
| turnbasedgame/ | 2026-03-28 18:09 | - | |
| turnkey/ | 2026-03-28 18:10 | - | |
| turnoffbingsearch/ | 2026-03-28 18:09 | - | |
| turtle/ | 2026-03-28 18:09 | - | |
| tutorial/ | 2026-03-28 18:09 | - | |
| tux/ | 2026-03-28 18:09 | - | |
| tvåstegsverifiering/ | 2026-03-28 18:09 | - | |
| tv-shows/ | 2026-03-28 18:09 | - | |
| tv/ | 2026-03-28 18:09 | - | |
| tv3play/ | 2026-03-28 18:10 | - | |
| tv4play/ | 2026-03-28 18:10 | - | |
| tvos/ | 2026-03-28 18:09 | - | |
| tvthumb.db/ | 2026-03-28 18:09 | - | |
| tweak/ | 2026-03-28 18:10 | - | |
| tweaker/ | 2026-03-28 18:09 | - | |
| tweaking-tool/ | 2026-03-28 18:10 | - | |
| tweakpower/ | 2026-03-28 18:10 | - | |
| tweaks-collection/ | 2026-03-28 18:10 | - | |
| tweaks/ | 2026-03-28 18:09 | - | |
| tweet/ | 2026-03-28 18:09 | - | |
| tweetdeck/ | 2026-03-28 18:09 | - | |
| tweeten/ | 2026-03-28 18:10 | - | |
| twitch/ | 2026-03-28 18:09 | - | |
| twitter/ | 2026-03-28 18:09 | - | |
| two-way/ | 2026-03-28 18:09 | - | |
| twofactorauthentication/ | 2026-03-28 18:09 | - | |
| txt-editor/ | 2026-03-28 18:09 | - | |
| tycoon/ | 2026-03-28 18:10 | - | |
| type-system/ | 2026-03-28 18:09 | - | |
| typeface/ | 2026-03-28 18:09 | - | |
| typerefhash/ | 2026-03-28 18:09 | - | |
| typescript-react/ | 2026-03-28 18:10 | - | |
| typescript/ | 2026-03-28 18:09 | - | |
| typesetting/ | 2026-03-28 18:09 | - | |
| typing-test/ | 2026-03-28 18:09 | - | |
| typing/ | 2026-03-28 18:09 | - | |
| typography/ | 2026-03-28 18:09 | - | |
| typora/ | 2026-03-28 18:10 | - | |
| typst/ | 2026-03-28 18:09 | - | |
| tyros5/ | 2026-03-28 18:10 | - | |
| uart/ | 2026-03-28 18:09 | - | |
| ubisoft/ | 2026-03-28 18:09 | - | |
| ubisoftconnect/ | 2026-03-28 18:09 | - | |
| ubl/ | 2026-03-28 18:10 | - | |
| ublock-origin-syntax/ | 2026-03-28 18:10 | - | |
| ubo-syntax/ | 2026-03-28 18:10 | - | |
| ubuntu/ | 2026-03-28 18:09 | - | |
| uc/ | 2026-03-28 18:09 | - | |
| ucg/ | 2026-03-28 18:09 | - | |
| uci/ | 2026-03-28 18:09 | - | |
| ucloud/ | 2026-03-28 18:10 | - | |
| udemy-coupon-fetcher/ | 2026-03-28 18:09 | - | |
| udemy-free-coupons/ | 2026-03-28 18:09 | - | |
| udemy-free-courses/ | 2026-03-28 18:09 | - | |
| udemy/ | 2026-03-28 18:09 | - | |
| udp/ | 2026-03-28 18:09 | - | |
| udpport5353/ | 2026-03-28 18:09 | - | |
| uefi/ | 2026-03-28 18:09 | - | |
| uefibiosbootoptionsmanager/ | 2026-03-28 18:09 | - | |
| ufs2/ | 2026-03-28 18:09 | - | |
| ugene/ | 2026-03-28 18:09 | - | |
| ui-automation/ | 2026-03-28 18:09 | - | |
| ui-testing/ | 2026-03-28 18:09 | - | |
| ui/ | 2026-03-28 18:09 | - | |
| uif/ | 2026-03-28 18:10 | - | |
| uinput/ | 2026-03-28 18:09 | - | |
| uint32/ | 2026-03-28 18:10 | - | |
| uint64/ | 2026-03-28 18:10 | - | |
| uktv/ | 2026-03-28 18:09 | - | |
| ukulele/ | 2026-03-28 18:09 | - | |
| uld/ | 2026-03-28 18:10 | - | |
| ultracode/ | 2026-03-28 18:09 | - | |
| ultralight/ | 2026-03-28 18:10 | - | |
| umd/ | 2026-03-28 18:09 | - | |
| uml/ | 2026-03-28 18:09 | - | |
| umlclassdiagrams/ | 2026-03-28 18:09 | - | |
| unachive/ | 2026-03-28 18:09 | - | |
| unachiver/ | 2026-03-28 18:09 | - | |
| unarchive/ | 2026-03-28 18:09 | - | |
| unarchiver/ | 2026-03-28 18:09 | - | |
| unattended-uninstall/ | 2026-03-28 18:09 | - | |
| unattended/ | 2026-03-28 18:09 | - | |
| uncom/ | 2026-03-28 18:09 | - | |
| undelete/ | 2026-03-28 18:09 | - | |
| underground/ | 2026-03-28 18:09 | - | |
| undertale/ | 2026-03-28 18:09 | - | |
| undervolt/ | 2026-03-28 18:09 | - | |
| undervolting/ | 2026-03-28 18:09 | - | |
| unetbootin/ | 2026-03-28 18:09 | - | |
| unfx-proxy-checker/ | 2026-03-28 18:09 | - | |
| ungoogled-chromium/ | 2026-03-28 18:09 | - | |
| ungoogled/ | 2026-03-28 18:09 | - | |
| unicode-support/ | 2026-03-28 18:09 | - | |
| unicode/ | 2026-03-28 18:09 | - | |
| uniconverter/ | 2026-03-28 18:09 | - | |
| unified-intents-unified-remote-server/ | 2026-03-28 18:10 | - | |
| unifiedintentsunifiedremoteserver/ | 2026-03-28 18:10 | - | |
| unifying/ | 2026-03-28 18:09 | - | |
| uniget-ui/ | 2026-03-28 18:09 | - | |
| unigetui/ | 2026-03-28 18:09 | - | |
| unikey/ | 2026-03-28 18:09 | - | |
| unikeyformac/ | 2026-03-28 18:10 | - | |
| unimouse/ | 2026-03-28 18:10 | - | |
| uninstall/ | 2026-03-28 18:09 | - | |
| uninstallation/ | 2026-03-28 18:09 | - | |
| uninstaller/ | 2026-03-28 18:09 | - | |
| uninstalling/ | 2026-03-28 18:09 | - | |
| uninstalltool/ | 2026-03-28 18:10 | - | |
| unique-numbers/ | 2026-03-28 18:09 | - | |
| unit-conversion/ | 2026-03-28 18:09 | - | |
| unit-converter/ | 2026-03-28 18:09 | - | |
| unit-testing-framework/ | 2026-03-28 18:10 | - | |
| unit-testing/ | 2026-03-28 18:09 | - | |
| unit/ | 2026-03-28 18:09 | - | |
| unite/ | 2026-03-28 18:09 | - | |
| units-of-measure/ | 2026-03-28 18:10 | - | |
| units/ | 2026-03-28 18:10 | - | |
| unittestingframework/ | 2026-03-28 18:10 | - | |
| unity/ | 2026-03-28 18:09 | - | |
| unity3d/ | 2026-03-28 18:09 | - | |
| unitywebplayer/ | 2026-03-28 18:10 | - | |
| universal-d3d-mapping-layers/ | 2026-03-28 18:09 | - | |
| universal-media-disc/ | 2026-03-28 18:09 | - | |
| universal-windows-platform/ | 2026-03-28 18:09 | - | |
| universal/ | 2026-03-28 18:10 | - | |
| universal_d3dmappinglayer/ | 2026-03-28 18:09 | - | |
| universald3dmappinglayers/ | 2026-03-28 18:09 | - | |
| universalmediadisc/ | 2026-03-28 18:09 | - | |
| universalserialbus/ | 2026-03-28 18:10 | - | |
| universe/ | 2026-03-28 18:09 | - | |
| university/ | 2026-03-28 18:10 | - | |
| unix-philosophy/ | 2026-03-28 18:10 | - | |
| unix/ | 2026-03-28 18:09 | - | |
| unixporn/ | 2026-03-28 18:09 | - | |
| unlimited/ | 2026-03-28 18:09 | - | |
| unlock-files/ | 2026-03-28 18:10 | - | |
| unlock-folders/ | 2026-03-28 18:10 | - | |
| unlock/ | 2026-03-28 18:09 | - | |
| unlocker/ | 2026-03-28 18:09 | - | |
| unlocking/ | 2026-03-28 18:10 | - | |
| unofficial/ | 2026-03-28 18:10 | - | |
| unpack/ | 2026-03-28 18:09 | - | |
| unpacker/ | 2026-03-28 18:09 | - | |
| unpacking/ | 2026-03-28 18:09 | - | |
| unreal-commander/ | 2026-03-28 18:09 | - | |
| unreal-engine-5/ | 2026-03-28 18:09 | - | |
| unreal-engine/ | 2026-03-28 18:09 | - | |
| unreal/ | 2026-03-28 18:09 | - | |
| unzip/ | 2026-03-28 18:09 | - | |
| uos/ | 2026-03-28 18:09 | - | |
| upc/ | 2026-03-28 18:09 | - | |
| update-blocker/ | 2026-03-28 18:10 | - | |
| update-checker/ | 2026-03-28 18:09 | - | |
| update/ | 2026-03-28 18:09 | - | |
| updatechecker/ | 2026-03-28 18:10 | - | |
| updateinstaller/ | 2026-03-28 18:09 | - | |
| updater/ | 2026-03-28 18:09 | - | |
| updatetool/ | 2026-03-28 18:09 | - | |
| updating/ | 2026-03-28 18:09 | - | |
| upgrades/ | 2026-03-28 18:09 | - | |
| uplay-games/ | 2026-03-28 18:10 | - | |
| uplay/ | 2026-03-28 18:09 | - | |
| uplink-cli/ | 2026-03-28 18:10 | - | |
| uplink/ | 2026-03-28 18:10 | - | |
| upload/ | 2026-03-28 18:09 | - | |
| uploader/ | 2026-03-28 18:09 | - | |
| uploadspeed/ | 2026-03-28 18:09 | - | |
| upnp/ | 2026-03-28 18:09 | - | |
| upnpmediaserver/ | 2026-03-28 18:10 | - | |
| ups/ | 2026-03-28 18:09 | - | |
| upscale/ | 2026-03-28 18:09 | - | |
| upscaling/ | 2026-03-28 18:09 | - | |
| uptodown/ | 2026-03-28 18:10 | - | |
| upyun/ | 2026-03-28 18:09 | - | |
| ur-rt/ | 2026-03-28 18:09 | - | |
| ur22/ | 2026-03-28 18:09 | - | |
| ur44/ | 2026-03-28 18:09 | - | |
| uri-manipulations/ | 2026-03-28 18:10 | - | |
| uri-parser/ | 2026-03-28 18:10 | - | |
| uri-solutions/ | 2026-03-28 18:10 | - | |
| uri/ | 2026-03-28 18:10 | - | |
| url-bruteforcer/ | 2026-03-28 18:09 | - | |
| url-shortener/ | 2026-03-28 18:10 | - | |
| urlblocking/ | 2026-03-28 18:10 | - | |
| urlpathblocking/ | 2026-03-28 18:10 | - | |
| urlscan/ | 2026-03-28 18:10 | - | |
| urrt/ | 2026-03-28 18:09 | - | |
| us-ascii/ | 2026-03-28 18:09 | - | |
| us-international/ | 2026-03-28 18:10 | - | |
| us3/ | 2026-03-28 18:10 | - | |
| usability/ | 2026-03-28 18:09 | - | |
| usable-security/ | 2026-03-28 18:09 | - | |
| usage/ | 2026-03-28 18:09 | - | |
| usb-c/ | 2026-03-28 18:09 | - | |
| usb-devices/ | 2026-03-28 18:09 | - | |
| usb-driver/ | 2026-03-28 18:10 | - | |
| usb-endpoint/ | 2026-03-28 18:10 | - | |
| usb-flash-drive-speed-tests/ | 2026-03-28 18:10 | - | |
| usb-recovery/ | 2026-03-28 18:09 | - | |
| usb-specifications/ | 2026-03-28 18:10 | - | |
| usb-specs/ | 2026-03-28 18:10 | - | |
| usb-type-c/ | 2026-03-28 18:10 | - | |
| usb-versions/ | 2026-03-28 18:10 | - | |
| usb-wi-fi-adapter/ | 2026-03-28 18:09 | - | |
| usb/ | 2026-03-28 18:09 | - | |
| usb3.0/ | 2026-03-28 18:09 | - | |
| usb3/ | 2026-03-28 18:10 | - | |
| usbc/ | 2026-03-28 18:10 | - | |
| usbconnection/ | 2026-03-28 18:09 | - | |
| usbdevices/ | 2026-03-28 18:09 | - | |
| usbdk/ | 2026-03-28 18:10 | - | |
| usbflashdrivespeedtests/ | 2026-03-28 18:10 | - | |
| usbip/ | 2026-03-28 18:10 | - | |
| usbipd-win/ | 2026-03-28 18:10 | - | |
| usbspecifications/ | 2026-03-28 18:10 | - | |
| usbspecs/ | 2026-03-28 18:10 | - | |
| usbversions/ | 2026-03-28 18:10 | - | |
| usbwifiadapter/ | 2026-03-28 18:09 | - | |
| useless/ | 2026-03-28 18:10 | - | |
| usemotion/ | 2026-03-28 18:09 | - | |
| usenet/ | 2026-03-28 18:09 | - | |
| user-accounts/ | 2026-03-28 18:09 | - | |
| user-experience/ | 2026-03-28 18:09 | - | |
| user-focused/ | 2026-03-28 18:09 | - | |
| user-friendly/ | 2026-03-28 18:09 | - | |
| user-guides/ | 2026-03-28 18:09 | - | |
| user-interface-designer/ | 2026-03-28 18:09 | - | |
| user-interface/ | 2026-03-28 18:09 | - | |
| user-profiles/ | 2026-03-28 18:09 | - | |
| user/ | 2026-03-28 18:09 | - | |
| useraccounts/ | 2026-03-28 18:09 | - | |
| userinterfacedesigner/ | 2026-03-28 18:09 | - | |
| username-generator/ | 2026-03-28 18:09 | - | |
| username/ | 2026-03-28 18:09 | - | |
| userprofiles/ | 2026-03-28 18:09 | - | |
| userscripts/ | 2026-03-28 18:09 | - | |
| userspace-driver/ | 2026-03-28 18:10 | - | |
| usi/ | 2026-03-28 18:10 | - | |
| usrp/ | 2026-03-28 18:09 | - | |
| ussf/ | 2026-03-28 18:09 | - | |
| utau/ | 2026-03-28 18:09 | - | |
| utf-7 utf7/ | 2026-03-28 18:09 | - | |
| utf-8 utf8 utf-8-bom utf8bom utf-8-sig/ | 2026-03-28 18:09 | - | |
| utf-16 utf16 utf-16-bom utf-16be utf16be/ | 2026-03-28 18:09 | - | |
| utf-32 utf32 utf-32be utf32be/ | 2026-03-28 18:09 | - | |
| utf/ | 2026-03-28 18:09 | - | |
| utf8/ | 2026-03-28 18:09 | - | |
| utilities/ | 2026-03-28 18:09 | - | |
| utility-application/ | 2026-03-28 18:09 | - | |
| utility/ | 2026-03-28 18:09 | - | |
| utm/ | 2026-03-28 18:10 | - | |
| utools/ | 2026-03-28 18:09 | - | |
| utopia-eden-mingw-pgo/ | 2026-03-28 18:09 | - | |
| utopia-eden-msvc/ | 2026-03-28 18:10 | - | |
| utopiaedenmingwpgo/ | 2026-03-28 18:09 | - | |
| utopiaedenmsvc/ | 2026-03-28 18:10 | - | |
| utrust3700f/ | 2026-03-28 18:10 | - | |
| utssanity/ | 2026-03-28 18:09 | - | |
| uuid/ | 2026-03-28 18:09 | - | |
| uup/ | 2026-03-28 18:09 | - | |
| uvhid.inf/ | 2026-03-28 18:10 | - | |
| uwp-app/ | 2026-03-28 18:09 | - | |
| uwp-applications/ | 2026-03-28 18:09 | - | |
| uwp-apps/ | 2026-03-28 18:09 | - | |
| uwp/ | 2026-03-28 18:09 | - | |
| ux-design/ | 2026-03-28 18:09 | - | |
| ux/ | 2026-03-28 18:09 | - | |
| uxstyle/ | 2026-03-28 18:09 | - | |
| uxtheme/ | 2026-03-28 18:09 | - | |
| uz7ho/ | 2026-03-28 18:09 | - | |
| v.motion/ | 2026-03-28 18:10 | - | |
| v.smile/ | 2026-03-28 18:10 | - | |
| v.smilemotion/ | 2026-03-28 18:10 | - | |
| v.smilepocket/ | 2026-03-28 18:10 | - | |
| v0/ | 2026-03-28 18:09 | - | |
| v2fly/ | 2026-03-28 18:09 | - | |
| v2ray/ | 2026-03-28 18:09 | - | |
| v2v/ | 2026-03-28 18:09 | - | |
| v2x/ | 2026-03-28 18:09 | - | |
| v5/ | 2026-03-28 18:10 | - | |
| v6/ | 2026-03-28 18:10 | - | |
| v8/ | 2026-03-28 18:09 | - | |
| vCard/ | 2026-03-28 18:09 | - | |
| vCards/ | 2026-03-28 18:09 | - | |
| vaadin/ | 2026-03-28 18:10 | - | |
| vale/ | 2026-03-28 18:09 | - | |
| valetudo/ | 2026-03-28 18:09 | - | |
| validate/ | 2026-03-28 18:10 | - | |
| validation/ | 2026-03-28 18:09 | - | |
| validator/ | 2026-03-28 18:09 | - | |
| valley/ | 2026-03-28 18:09 | - | |
| valorant-app/ | 2026-03-28 18:10 | - | |
| valorant/ | 2026-03-28 18:09 | - | |
| value-added-learning/ | 2026-03-28 18:10 | - | |
| valve/ | 2026-03-28 18:09 | - | |
| vantage/ | 2026-03-28 18:09 | - | |
| variables/ | 2026-03-28 18:09 | - | |
| vat/ | 2026-03-28 18:10 | - | |
| vatsim/ | 2026-03-28 18:09 | - | |
| vault/ | 2026-03-28 18:09 | - | |
| vb-net/ | 2026-03-28 18:09 | - | |
| vb/ | 2026-03-28 18:09 | - | |
| vb6/ | 2026-03-28 18:09 | - | |
| vba/ | 2026-03-28 18:09 | - | |
| vbnet/ | 2026-03-28 18:09 | - | |
| vbs-to-msix/ | 2026-03-28 18:09 | - | |
| vc++/ | 2026-03-28 18:09 | - | |
| vc/ | 2026-03-28 18:09 | - | |
| vcdiff/ | 2026-03-28 18:10 | - | |
| vcluster/ | 2026-03-28 18:09 | - | |
| vcpkg/ | 2026-03-28 18:09 | - | |
| vcs/ | 2026-03-28 18:09 | - | |
| vcvrack/ | 2026-03-28 18:09 | - | |
| vdd/ | 2026-03-28 18:09 | - | |
| vdf/ | 2026-03-28 18:09 | - | |
| vdi/ | 2026-03-28 18:09 | - | |
| vector-graphics/ | 2026-03-28 18:09 | - | |
| vector-tiles/ | 2026-03-28 18:09 | - | |
| veeam/ | 2026-03-28 18:09 | - | |
| vehicle/ | 2026-03-28 18:09 | - | |
| vehicles/ | 2026-03-28 18:09 | - | |
| veloren/ | 2026-03-28 18:09 | - | |
| vencord/ | 2026-03-28 18:09 | - | |
| verboseloginstatusmessages/ | 2026-03-28 18:09 | - | |
| verifiable-credentials/ | 2026-03-28 18:10 | - | |
| verification/ | 2026-03-28 18:09 | - | |
| verify/ | 2026-03-28 18:09 | - | |
| verilog/ | 2026-03-28 18:09 | - | |
| verimark/ | 2026-03-28 18:09 | - | |
| versand/ | 2026-03-28 18:09 | - | |
| version-control/ | 2026-03-28 18:09 | - | |
| version-manager/ | 2026-03-28 18:09 | - | |
| version/ | 2026-03-28 18:09 | - | |
| versioncontrol/ | 2026-03-28 18:09 | - | |
| versioning/ | 2026-03-28 18:09 | - | |
| vertica/ | 2026-03-28 18:09 | - | |
| vertical-mouse/ | 2026-03-28 18:09 | - | |
| verticalmouse/ | 2026-03-28 18:09 | - | |
| vex/ | 2026-03-28 18:09 | - | |
| vfp/ | 2026-03-28 18:09 | - | |
| vfs-for-git/ | 2026-03-28 18:09 | - | |
| vfsforgit/ | 2026-03-28 18:09 | - | |
| vfx/ | 2026-03-28 18:09 | - | |
| vga-pci-passthrough/ | 2026-03-28 18:09 | - | |
| vgc/ | 2026-03-28 18:10 | - | |
| vgm/ | 2026-03-28 18:10 | - | |
| vgmstream/ | 2026-03-28 18:10 | - | |
| vgn/ | 2026-03-28 18:09 | - | |
| vgtv/ | 2026-03-28 18:10 | - | |
| vhd/ | 2026-03-28 18:09 | - | |
| vhdl/ | 2026-03-28 18:09 | - | |
| vi/ | 2026-03-28 18:09 | - | |
| victoria/ | 2026-03-28 18:09 | - | |
| victoria3/ | 2026-03-28 18:09 | - | |
| vidair/ | 2026-03-28 18:09 | - | |
| videap/ | 2026-03-28 18:09 | - | |
| video-capture/ | 2026-03-28 18:09 | - | |
| video-card/ | 2026-03-28 18:09 | - | |
| video-codec/ | 2026-03-28 18:10 | - | |
| video-collaboration/ | 2026-03-28 18:09 | - | |
| video-conference/ | 2026-03-28 18:09 | - | |
| video-conferencing/ | 2026-03-28 18:09 | - | |
| video-conversion/ | 2026-03-28 18:09 | - | |
| video-converter/ | 2026-03-28 18:09 | - | |
| video-downloader/ | 2026-03-28 18:09 | - | |
| video-downloadhelper/ | 2026-03-28 18:10 | - | |
| video-editing/ | 2026-03-28 18:09 | - | |
| video-editor/ | 2026-03-28 18:09 | - | |
| video-encoder/ | 2026-03-28 18:10 | - | |
| video-file-thumbnails/ | 2026-03-28 18:10 | - | |
| video-game/ | 2026-03-28 18:09 | - | |
| video-games/ | 2026-03-28 18:09 | - | |
| video-meeting/ | 2026-03-28 18:09 | - | |
| video-player/ | 2026-03-28 18:09 | - | |
| video-processing/ | 2026-03-28 18:09 | - | |
| video-recording/ | 2026-03-28 18:09 | - | |
| video-streamer/ | 2026-03-28 18:09 | - | |
| video-streaming/ | 2026-03-28 18:09 | - | |
| video-thumbnail-generator/ | 2026-03-28 18:10 | - | |
| video-thumbnail/ | 2026-03-28 18:10 | - | |
| video-thumbnails/ | 2026-03-28 18:10 | - | |
| video-to-mp3/ | 2026-03-28 18:10 | - | |
| video-upscaling/ | 2026-03-28 18:10 | - | |
| video-wallpaper/ | 2026-03-28 18:10 | - | |
| video.db/ | 2026-03-28 18:09 | - | |
| video/ | 2026-03-28 18:09 | - | |
| videocapture/ | 2026-03-28 18:09 | - | |
| video downloader/ | 2026-03-28 18:09 | - | |
| videodownloader/ | 2026-03-28 18:10 | - | |
| videoediting/ | 2026-03-28 18:10 | - | |
| videoeditor/ | 2026-03-28 18:10 | - | |
| videofiles/ | 2026-03-28 18:09 | - | |
| videofilethumbnails/ | 2026-03-28 18:10 | - | |
| videoformatplugin/ | 2026-03-28 18:09 | - | |
| videogame/ | 2026-03-28 18:09 | - | |
| videogamecontrollers/ | 2026-03-28 18:09 | - | |
| videomonitoring/ | 2026-03-28 18:10 | - | |
| videoplayer/ | 2026-03-28 18:09 | - | |
| videos/ | 2026-03-28 18:09 | - | |
| videotester/ | 2026-03-28 18:10 | - | |
| videothumbnails/ | 2026-03-28 18:10 | - | |
| vidvoltage/ | 2026-03-28 18:09 | - | |
| vietkey/ | 2026-03-28 18:10 | - | |
| vietnamese/ | 2026-03-28 18:10 | - | |
| viewer/ | 2026-03-28 18:09 | - | |
| vigembus/ | 2026-03-28 18:09 | - | |
| vim-emulation/ | 2026-03-28 18:10 | - | |
| vim-key-binder/ | 2026-03-28 18:10 | - | |
| vim/ | 2026-03-28 18:09 | - | |
| vimeo/ | 2026-03-28 18:09 | - | |
| viofs.inf/ | 2026-03-28 18:09 | - | |
| viogpudo.inf/ | 2026-03-28 18:09 | - | |
| vioinput.inf/ | 2026-03-28 18:09 | - | |
| viomem.inf/ | 2026-03-28 18:09 | - | |
| viorng.inf/ | 2026-03-28 18:09 | - | |
| vioscsi.inf/ | 2026-03-28 18:09 | - | |
| vioser.inf/ | 2026-03-28 18:09 | - | |
| viostor.inf/ | 2026-03-28 18:09 | - | |
| viqr/ | 2026-03-28 18:10 | - | |
| virt-viewer/ | 2026-03-28 18:09 | - | |
| virtual-audio/ | 2026-03-28 18:10 | - | |
| virtual-camera/ | 2026-03-28 18:09 | - | |
| virtual-clusters/ | 2026-03-28 18:09 | - | |
| virtual-desktop/ | 2026-03-28 18:09 | - | |
| virtual-disk/ | 2026-03-28 18:09 | - | |
| virtual-display/ | 2026-03-28 18:09 | - | |
| virtual-inputs/ | 2026-03-28 18:09 | - | |
| virtual-joystick-interface/ | 2026-03-28 18:09 | - | |
| virtual-keyboard/ | 2026-03-28 18:10 | - | |
| virtual-machine/ | 2026-03-28 18:09 | - | |
| virtual-machines/ | 2026-03-28 18:09 | - | |
| virtual-network/ | 2026-03-28 18:09 | - | |
| virtual-reality/ | 2026-03-28 18:09 | - | |
| virtual-serial-port/ | 2026-03-28 18:09 | - | |
| virtual-tabletop/ | 2026-03-28 18:09 | - | |
| virtual-tour/ | 2026-03-28 18:09 | - | |
| virtual/ | 2026-03-28 18:09 | - | |
| virtualboyee cygne wonderswancolor/ | 2026-03-28 18:10 | - | |
| virtualconsole/ | 2026-03-28 18:10 | - | |
| virtual desktop/ | 2026-03-28 18:09 | - | |
| virtualisation/ | 2026-03-28 18:10 | - | |
| virtualization/ | 2026-03-28 18:09 | - | |
| virtualizer/ | 2026-03-28 18:09 | - | |
| virtualjoystickinterface/ | 2026-03-28 18:09 | - | |
| virtualkeyboard/ | 2026-03-28 18:10 | - | |
| virtualmachine/ | 2026-03-28 18:09 | - | |
| virtualmachines/ | 2026-03-28 18:10 | - | |
| virtualstudio/ | 2026-03-28 18:09 | - | |
| virus/ | 2026-03-28 18:09 | - | |
| virustotal/ | 2026-03-28 18:09 | - | |
| virustotalapi/ | 2026-03-28 18:09 | - | |
| viscosity/ | 2026-03-28 18:10 | - | |
| visio/ | 2026-03-28 18:09 | - | |
| vision/ | 2026-03-28 18:09 | - | |
| visual-c++/ | 2026-03-28 18:09 | - | |
| visual-design/ | 2026-03-28 18:09 | - | |
| visual-effects/ | 2026-03-28 18:09 | - | |
| visual-foxpro/ | 2026-03-28 18:09 | - | |
| visual-novel/ | 2026-03-28 18:09 | - | |
| visual-planning/ | 2026-03-28 18:10 | - | |
| visual-programming/ | 2026-03-28 18:09 | - | |
| visual-studio-code/ | 2026-03-28 18:09 | - | |
| visual-studio/ | 2026-03-28 18:09 | - | |
| visual/ | 2026-03-28 18:09 | - | |
| visualbasic/ | 2026-03-28 18:09 | - | |
| visualisation/ | 2026-03-28 18:09 | - | |
| visualization-tools/ | 2026-03-28 18:09 | - | |
| visualization/ | 2026-03-28 18:09 | - | |
| visualize/ | 2026-03-28 18:09 | - | |
| visually-impaired/ | 2026-03-28 18:09 | - | |
| visualstudio/ | 2026-03-28 18:09 | - | |
| vita/ | 2026-03-28 18:10 | - | |
| vite/ | 2026-03-28 18:09 | - | |
| vitejs/ | 2026-03-28 18:10 | - | |
| vivaldi-browser/ | 2026-03-28 18:09 | - | |
| vive/ | 2026-03-28 18:09 | - | |
| vivetool/ | 2026-03-28 18:09 | - | |
| vivo/ | 2026-03-28 18:09 | - | |
| vixen/ | 2026-03-28 18:09 | - | |
| vj/ | 2026-03-28 18:09 | - | |
| vjing/ | 2026-03-28 18:10 | - | |
| vjoy-devices/ | 2026-03-28 18:09 | - | |
| vjoy-driver/ | 2026-03-28 18:09 | - | |
| vjoy.inf/ | 2026-03-28 18:09 | - | |
| vjoydevices/ | 2026-03-28 18:09 | - | |
| vj software/ | 2026-03-28 18:09 | - | |
| vk/ | 2026-03-28 18:09 | - | |
| vl/ | 2026-03-28 18:10 | - | |
| vlc/ | 2026-03-28 18:09 | - | |
| vllm/ | 2026-03-28 18:09 | - | |
| vm-checkpoint/ | 2026-03-28 18:10 | - | |
| vm-snapshot/ | 2026-03-28 18:10 | - | |
| vm/ | 2026-03-28 18:09 | - | |
| vmconversiontool/ | 2026-03-28 18:10 | - | |
| vmotion/ | 2026-03-28 18:10 | - | |
| vmplex-workstation/ | 2026-03-28 18:10 | - | |
| vmplex-ws/ | 2026-03-28 18:10 | - | |
| vmplexworkstation/ | 2026-03-28 18:10 | - | |
| vmtools/ | 2026-03-28 18:10 | - | |
| vna/ | 2026-03-28 18:09 | - | |
| vnc/ | 2026-03-28 18:09 | - | |
| vni/ | 2026-03-28 18:09 | - | |
| vocabulary/ | 2026-03-28 18:09 | - | |
| vocal-synthesis/ | 2026-03-28 18:09 | - | |
| vocal/ | 2026-03-28 18:09 | - | |
| vocaloid/ | 2026-03-28 18:09 | - | |
| vod/ | 2026-03-28 18:09 | - | |
| vogen/ | 2026-03-28 18:09 | - | |
| voice-chat/ | 2026-03-28 18:09 | - | |
| voice-commands/ | 2026-03-28 18:09 | - | |
| voice-conferencing/ | 2026-03-28 18:09 | - | |
| voice-control/ | 2026-03-28 18:09 | - | |
| voice-recognition/ | 2026-03-28 18:09 | - | |
| voice-synthesizer/ | 2026-03-28 18:09 | - | |
| voice/ | 2026-03-28 18:09 | - | |
| voicebank/ | 2026-03-28 18:09 | - | |
| voicemail/ | 2026-03-28 18:10 | - | |
| voicemeeter/ | 2026-03-28 18:10 | - | |
| voip/ | 2026-03-28 18:09 | - | |
| volanta/ | 2026-03-28 18:10 | - | |
| volk/ | 2026-03-28 18:09 | - | |
| volta/ | 2026-03-28 18:10 | - | |
| voltages/ | 2026-03-28 18:09 | - | |
| volume-boost/ | 2026-03-28 18:09 | - | |
| volume-control/ | 2026-03-28 18:09 | - | |
| volume-rendering/ | 2026-03-28 18:09 | - | |
| volume-shadow-copy/ | 2026-03-28 18:09 | - | |
| volume/ | 2026-03-28 18:09 | - | |
| volumebuttons/ | 2026-03-28 18:10 | - | |
| volunteer-computing/ | 2026-03-28 18:09 | - | |
| voodoo-shield/ | 2026-03-28 18:09 | - | |
| vostro/ | 2026-03-28 18:09 | - | |
| voxel-game/ | 2026-03-28 18:09 | - | |
| voxelgame/ | 2026-03-28 18:09 | - | |
| voyage/ | 2026-03-28 18:09 | - | |
| vpk-editor/ | 2026-03-28 18:09 | - | |
| vpk/ | 2026-03-28 18:09 | - | |
| vpm/ | 2026-03-28 18:09 | - | |
| vpn-client/ | 2026-03-28 18:09 | - | |
| vpn-server/ | 2026-03-28 18:09 | - | |
| vpn/ | 2026-03-28 18:09 | - | |
| vr/ | 2026-03-28 18:09 | - | |
| vrchat-creator-companion/ | 2026-03-28 18:09 | - | |
| vrchat-package-manager/ | 2026-03-28 18:09 | - | |
| vrchat/ | 2026-03-28 18:09 | - | |
| vroidproject/ | 2026-03-28 18:10 | - | |
| vs/ | 2026-03-28 18:09 | - | |
| vsat/ | 2026-03-28 18:09 | - | |
| vscode-language-support/ | 2026-03-28 18:09 | - | |
| vscode-languageserver/ | 2026-03-28 18:09 | - | |
| vscode/ | 2026-03-28 18:09 | - | |
| vscodium/ | 2026-03-28 18:09 | - | |
| vsextensions/ | 2026-03-28 18:09 | - | |
| vsix/ | 2026-03-28 18:09 | - | |
| vsmile/ | 2026-03-28 18:10 | - | |
| vsmilemotion/ | 2026-03-28 18:10 | - | |
| vsmilepocket/ | 2026-03-28 18:10 | - | |
| vsphere/ | 2026-03-28 18:10 | - | |
| vst/ | 2026-03-28 18:09 | - | |
| vst3/ | 2026-03-28 18:09 | - | |
| vsti/ | 2026-03-28 18:09 | - | |
| vsts/ | 2026-03-28 18:09 | - | |
| vt/ | 2026-03-28 18:10 | - | |
| vt100/ | 2026-03-28 18:09 | - | |
| vte/ | 2026-03-28 18:09 | - | |
| vtk/ | 2026-03-28 18:09 | - | |
| vtt/ | 2026-03-28 18:09 | - | |
| vttcompile/ | 2026-03-28 18:09 | - | |
| vtuber/ | 2026-03-28 18:09 | - | |
| vue/ | 2026-03-28 18:09 | - | |
| vue3/ | 2026-03-28 18:10 | - | |
| vuejs/ | 2026-03-28 18:09 | - | |
| vuejs3/ | 2026-03-28 18:10 | - | |
| vuetify/ | 2026-03-28 18:09 | - | |
| vulcan/ | 2026-03-28 18:09 | - | |
| vulkan-api/ | 2026-03-28 18:10 | - | |
| vulkan-on-12/ | 2026-03-28 18:09 | - | |
| vulkan/ | 2026-03-28 18:09 | - | |
| vulkanon12/ | 2026-03-28 18:09 | - | |
| vulnerabilities/ | 2026-03-28 18:09 | - | |
| vulnerability-detection/ | 2026-03-28 18:09 | - | |
| vulnerability-detector/ | 2026-03-28 18:09 | - | |
| vulnerability-management/ | 2026-03-28 18:09 | - | |
| vulnerability-scanner/ | 2026-03-28 18:09 | - | |
| vulnerability-scanners/ | 2026-03-28 18:09 | - | |
| vulnerability/ | 2026-03-28 18:09 | - | |
| vultr-cli/ | 2026-03-28 18:10 | - | |
| vultr/ | 2026-03-28 18:10 | - | |
| vup/ | 2026-03-28 18:09 | - | |
| vvvv/ | 2026-03-28 18:10 | - | |
| vvvv gamma launcher/ | 2026-03-28 18:10 | - | |
| vwii/ | 2026-03-28 18:10 | - | |
| vwiiu/ | 2026-03-28 18:10 | - | |
| w32time/ | 2026-03-28 18:09 | - | |
| w32tm/ | 2026-03-28 18:09 | - | |
| wabisabi/ | 2026-03-28 18:09 | - | |
| wacom/ | 2026-03-28 18:09 | - | |
| waifu2x/ | 2026-03-28 18:09 | - | |
| wails-app/ | 2026-03-28 18:09 | - | |
| wails/ | 2026-03-28 18:09 | - | |
| wails2/ | 2026-03-28 18:09 | - | |
| wake-on-lan/ | 2026-03-28 18:09 | - | |
| wallet/ | 2026-03-28 18:09 | - | |
| wallets/ | 2026-03-28 18:09 | - | |
| wallpaper-engine/ | 2026-03-28 18:10 | - | |
| wallpaper/ | 2026-03-28 18:09 | - | |
| wallpapers/ | 2026-03-28 18:09 | - | |
| wally/ | 2026-03-28 18:10 | - | |
| warenwirtschaft/ | 2026-03-28 18:09 | - | |
| warframe/ | 2026-03-28 18:10 | - | |
| wargaming/ | 2026-03-28 18:09 | - | |
| warp/ | 2026-03-28 18:09 | - | |
| warpinator/ | 2026-03-28 18:09 | - | |
| warplanes/ | 2026-03-28 18:09 | - | |
| warships/ | 2026-03-28 18:09 | - | |
| warzone-2100/ | 2026-03-28 18:09 | - | |
| warzone/ | 2026-03-28 18:09 | - | |
| wasabi-wallet/ | 2026-03-28 18:09 | - | |
| wasabi/ | 2026-03-28 18:09 | - | |
| wasapi/ | 2026-03-28 18:10 | - | |
| wasi/ | 2026-03-28 18:09 | - | |
| wasm-component/ | 2026-03-28 18:09 | - | |
| wasm/ | 2026-03-28 18:09 | - | |
| wasmtime/ | 2026-03-28 18:09 | - | |
| watch/ | 2026-03-28 18:09 | - | |
| watchdog/ | 2026-03-28 18:09 | - | |
| watchmaker/ | 2026-03-28 18:09 | - | |
| waterfox/ | 2026-03-28 18:09 | - | |
| watermark-assistant/ | 2026-03-28 18:09 | - | |
| watermark-image/ | 2026-03-28 18:09 | - | |
| watermark-images/ | 2026-03-28 18:09 | - | |
| watermark-pdf/ | 2026-03-28 18:10 | - | |
| watermark-photos/ | 2026-03-28 18:09 | - | |
| watermark-pictures/ | 2026-03-28 18:09 | - | |
| watermark-protection/ | 2026-03-28 18:09 | - | |
| watermark/ | 2026-03-28 18:09 | - | |
| watermarkassistant/ | 2026-03-28 18:09 | - | |
| watermarking/ | 2026-03-28 18:10 | - | |
| wattage/ | 2026-03-28 18:09 | - | |
| wau/ | 2026-03-28 18:09 | - | |
| wausettingsgui/ | 2026-03-28 18:09 | - | |
| wav/ | 2026-03-28 18:09 | - | |
| wave/ | 2026-03-28 18:09 | - | |
| wavefront-threading-for-hardware-design/ | 2026-03-28 18:09 | - | |
| wavefrontthreadingforhardwaredesign/ | 2026-03-28 18:09 | - | |
| wavelink/ | 2026-03-28 18:10 | - | |
| wawi/ | 2026-03-28 18:09 | - | |
| wayland/ | 2026-03-28 18:09 | - | |
| wazero/ | 2026-03-28 18:10 | - | |
| wbbgui/ | 2026-03-28 18:10 | - | |
| wbfs-manager/ | 2026-03-28 18:10 | - | |
| wbfs/ | 2026-03-28 18:09 | - | |
| wbs/ | 2026-03-28 18:09 | - | |
| wdac-toolkit/ | 2026-03-28 18:09 | - | |
| wdac-wizard/ | 2026-03-28 18:09 | - | |
| wdactoolkit/ | 2026-03-28 18:09 | - | |
| wdacwizard/ | 2026-03-28 18:09 | - | |
| wdf/ | 2026-03-28 18:10 | - | |
| wdr/ | 2026-03-28 18:09 | - | |
| wdrt-hl1/ | 2026-03-28 18:10 | - | |
| weasis/ | 2026-03-28 18:10 | - | |
| weather/ | 2026-03-28 18:09 | - | |
| web-application/ | 2026-03-28 18:10 | - | |
| web-applications/ | 2026-03-28 18:09 | - | |
| web-assembly/ | 2026-03-28 18:09 | - | |
| web-audio/ | 2026-03-28 18:10 | - | |
| web-browser/ | 2026-03-28 18:09 | - | |
| web-conferencing/ | 2026-03-28 18:09 | - | |
| web-development/ | 2026-03-28 18:09 | - | |
| web-frontend/ | 2026-03-28 18:10 | - | |
| web-interface/ | 2026-03-28 18:09 | - | |
| web-midi/ | 2026-03-28 18:09 | - | |
| web-pages/ | 2026-03-28 18:09 | - | |
| web-publishing/ | 2026-03-28 18:10 | - | |
| web-server/ | 2026-03-28 18:09 | - | |
| web-services/ | 2026-03-28 18:09 | - | |
| web-site/ | 2026-03-28 18:09 | - | |
| web-technologies/ | 2026-03-28 18:10 | - | |
| web-testing/ | 2026-03-28 18:10 | - | |
| web-video/ | 2026-03-28 18:09 | - | |
| web/ | 2026-03-28 18:09 | - | |
| web3/ | 2026-03-28 18:09 | - | |
| web4premiere/ | 2026-03-28 18:09 | - | |
| webapi/ | 2026-03-28 18:09 | - | |
| webapp/ | 2026-03-28 18:09 | - | |
| webassembly/ | 2026-03-28 18:09 | - | |
| webbrowser/ | 2026-03-28 18:09 | - | |
| webcam-controls/ | 2026-03-28 18:09 | - | |
| webcam-effects/ | 2026-03-28 18:09 | - | |
| webcam-splitter/ | 2026-03-28 18:09 | - | |
| webcam/ | 2026-03-28 18:09 | - | |
| webcamera/ | 2026-03-28 18:09 | - | |
| webclient/ | 2026-03-28 18:09 | - | |
| webdav-server/ | 2026-03-28 18:09 | - | |
| webdav/ | 2026-03-28 18:09 | - | |
| webdev/ | 2026-03-28 18:10 | - | |
| webdevelopment/ | 2026-03-28 18:10 | - | |
| webdriver/ | 2026-03-28 18:09 | - | |
| webex/ | 2026-03-28 18:10 | - | |
| webgl/ | 2026-03-28 18:09 | - | |
| webhost/ | 2026-03-28 18:09 | - | |
| webinar/ | 2026-03-28 18:09 | - | |
| webkit2webprocess/ | 2026-03-28 18:09 | - | |
| webloc/ | 2026-03-28 18:09 | - | |
| weblog/ | 2026-03-28 18:09 | - | |
| weblogic/ | 2026-03-28 18:10 | - | |
| webm-4-premiere/ | 2026-03-28 18:09 | - | |
| webm-for-premiere/ | 2026-03-28 18:09 | - | |
| webm/ | 2026-03-28 18:09 | - | |
| webos-tv/ | 2026-03-28 18:10 | - | |
| webos/ | 2026-03-28 18:09 | - | |
| webosose/ | 2026-03-28 18:10 | - | |
| webp-converter/ | 2026-03-28 18:09 | - | |
| webp/ | 2026-03-28 18:09 | - | |
| webpack/ | 2026-03-28 18:09 | - | |
| webpage/ | 2026-03-28 18:09 | - | |
| webpages/ | 2026-03-28 18:09 | - | |
| webroot/ | 2026-03-28 18:10 | - | |
| webrtc-server/ | 2026-03-28 18:09 | - | |
| webrtc-sfu/ | 2026-03-28 18:09 | - | |
| webrtc-whep/ | 2026-03-28 18:09 | - | |
| webrtc-whip/ | 2026-03-28 18:09 | - | |
| webrtc/ | 2026-03-28 18:09 | - | |
| webserver/ | 2026-03-28 18:09 | - | |
| website-optimization/ | 2026-03-28 18:09 | - | |
| website/ | 2026-03-28 18:09 | - | |
| website blocker/ | 2026-03-28 18:09 | - | |
| websocket/ | 2026-03-28 18:09 | - | |
| websockets/ | 2026-03-28 18:09 | - | |
| webtoon/ | 2026-03-28 18:09 | - | |
| webtoons/ | 2026-03-28 18:09 | - | |
| webui/ | 2026-03-28 18:09 | - | |
| webview/ | 2026-03-28 18:09 | - | |
| webview2/ | 2026-03-28 18:09 | - | |
| wechat/ | 2026-03-28 18:09 | - | |
| weighing-scales/ | 2026-03-28 18:09 | - | |
| weighingscales/ | 2026-03-28 18:09 | - | |
| weight-scales/ | 2026-03-28 18:09 | - | |
| weightscales/ | 2026-03-28 18:09 | - | |
| weixin/ | 2026-03-28 18:09 | - | |
| weiyun/ | 2026-03-28 18:10 | - | |
| wemeet/ | 2026-03-28 18:09 | - | |
| wer/ | 2026-03-28 18:10 | - | |
| westwind/ | 2026-03-28 18:10 | - | |
| wfp/ | 2026-03-28 18:09 | - | |
| wfuse/ | 2026-03-28 18:10 | - | |
| wfview/ | 2026-03-28 18:09 | - | |
| wg-quick/ | 2026-03-28 18:09 | - | |
| wgb/ | 2026-03-28 18:09 | - | |
| wget/ | 2026-03-28 18:09 | - | |
| wgsm/ | 2026-03-28 18:10 | - | |
| wgt-files/ | 2026-03-28 18:09 | - | |
| whalebird/ | 2026-03-28 18:09 | - | |
| whatsapp-web/ | 2026-03-28 18:09 | - | |
| whatsapp/ | 2026-03-28 18:09 | - | |
| whep/ | 2026-03-28 18:09 | - | |
| where/ | 2026-03-28 18:09 | - | |
| whip/ | 2026-03-28 18:09 | - | |
| whisper-cpp/ | 2026-03-28 18:09 | - | |
| whisper/ | 2026-03-28 18:09 | - | |
| whistle/ | 2026-03-28 18:09 | - | |
| white-balance/ | 2026-03-28 18:09 | - | |
| white-noise/ | 2026-03-28 18:09 | - | |
| whiteboard/ | 2026-03-28 18:09 | - | |
| whitenoise/ | 2026-03-28 18:09 | - | |
| whois/ | 2026-03-28 18:09 | - | |
| wi-fi-6/ | 2026-03-28 18:09 | - | |
| wi-fi-ax/ | 2026-03-28 18:09 | - | |
| wi-fi-routers/ | 2026-03-28 18:09 | - | |
| wi-fi/ | 2026-03-28 18:10 | - | |
| widevine/ | 2026-03-28 18:10 | - | |
| widget/ | 2026-03-28 18:09 | - | |
| width/ | 2026-03-28 18:09 | - | |
| wifi/ | 2026-03-28 18:09 | - | |
| wifi6/ | 2026-03-28 18:09 | - | |
| wifiax/ | 2026-03-28 18:09 | - | |
| wificonnection/ | 2026-03-28 18:09 | - | |
| wifirouters/ | 2026-03-28 18:09 | - | |
| wifui/ | 2026-03-28 18:10 | - | |
| wii-balance-board/ | 2026-03-28 18:09 | - | |
| wii-balance-walker/ | 2026-03-28 18:09 | - | |
| wii-remote-plus/ | 2026-03-28 18:09 | - | |
| wii-remote/ | 2026-03-28 18:09 | - | |
| wii-remoteplus/ | 2026-03-28 18:09 | - | |
| wii-u/ | 2026-03-28 18:09 | - | |
| wii/ | 2026-03-28 18:09 | - | |
| wiibalanceboard/ | 2026-03-28 18:09 | - | |
| wiiconnect24/ | 2026-03-28 18:10 | - | |
| wiimote/ | 2026-03-28 18:09 | - | |
| wiimotelib.net/ | 2026-03-28 18:10 | - | |
| wiiremote/ | 2026-03-28 18:09 | - | |
| wiiremoteplus/ | 2026-03-28 18:09 | - | |
| wiishopchannel/ | 2026-03-28 18:10 | - | |
| wiiu/ | 2026-03-28 18:09 | - | |
| wiki/ | 2026-03-28 18:09 | - | |
| wikia/ | 2026-03-28 18:10 | - | |
| wikimed/ | 2026-03-28 18:09 | - | |
| wikimedia/ | 2026-03-28 18:09 | - | |
| wikipedia/ | 2026-03-28 18:09 | - | |
| wikivoyage/ | 2026-03-28 18:09 | - | |
| wim/ | 2026-03-28 18:09 | - | |
| win7/ | 2026-03-28 18:09 | - | |
| win10/ | 2026-03-28 18:09 | - | |
| win11/ | 2026-03-28 18:09 | - | |
| win16/ | 2026-03-28 18:10 | - | |
| win32-api/ | 2026-03-28 18:09 | - | |
| win32/ | 2026-03-28 18:09 | - | |
| winamp/ | 2026-03-28 18:09 | - | |
| winapi/ | 2026-03-28 18:09 | - | |
| winapp2/ | 2026-03-28 18:10 | - | |
| winappsdk/ | 2026-03-28 18:09 | - | |
| winbgp/ | 2026-03-28 18:10 | - | |
| winbox/ | 2026-03-28 18:10 | - | |
| windbg/ | 2026-03-28 18:09 | - | |
| windev/ | 2026-03-28 18:09 | - | |
| windivert/ | 2026-03-28 18:10 | - | |
| window-height/ | 2026-03-28 18:09 | - | |
| window-management/ | 2026-03-28 18:09 | - | |
| window-manager/ | 2026-03-28 18:09 | - | |
| window-position/ | 2026-03-28 18:09 | - | |
| window-resizing/ | 2026-03-28 18:10 | - | |
| window-size/ | 2026-03-28 18:09 | - | |
| window-switcher/ | 2026-03-28 18:10 | - | |
| window-transparency/ | 2026-03-28 18:09 | - | |
| window-width/ | 2026-03-28 18:09 | - | |
| window/ | 2026-03-28 18:09 | - | |
| windowheight/ | 2026-03-28 18:09 | - | |
| windowposition/ | 2026-03-28 18:09 | - | |
| windowrecorder/ | 2026-03-28 18:09 | - | |
| windows-8-1/ | 2026-03-28 18:09 | - | |
| windows-8/ | 2026-03-28 18:09 | - | |
| windows-10/ | 2026-03-28 18:09 | - | |
| windows-11-installation-media/ | 2026-03-28 18:09 | - | |
| windows-11/ | 2026-03-28 18:09 | - | |
| windows-1252/ | 2026-03-28 18:09 | - | |
| windows-admin-center-setup-v2/ | 2026-03-28 18:10 | - | |
| windows-admin-centre/ | 2026-03-28 18:10 | - | |
| windows-api/ | 2026-03-28 18:09 | - | |
| windows-app-sdk/ | 2026-03-28 18:09 | - | |
| windows-app/ | 2026-03-28 18:09 | - | |
| windows-application/ | 2026-03-28 18:09 | - | |
| windows-apps/ | 2026-03-28 18:10 | - | |
| windows-classic/ | 2026-03-28 18:09 | - | |
| windows-command-palette-extension/ | 2026-03-28 18:09 | - | |
| windows-command-palette/ | 2026-03-28 18:09 | - | |
| windows-commandpalette-extension/ | 2026-03-28 18:09 | - | |
| windows-debloat/ | 2026-03-28 18:10 | - | |
| windows-defender/ | 2026-03-28 18:10 | - | |
| windows-desktop/ | 2026-03-28 18:09 | - | |
| windows-development/ | 2026-03-28 18:09 | - | |
| windows-domain-account/ | 2026-03-28 18:10 | - | |
| windows-driver-kit/ | 2026-03-28 18:10 | - | |
| windows-driver/ | 2026-03-28 18:10 | - | |
| windows-event-log-viewer/ | 2026-03-28 18:09 | - | |
| windows-eventlog/ | 2026-03-28 18:09 | - | |
| windows-explorer/ | 2026-03-28 18:09 | - | |
| windows-features/ | 2026-03-28 18:10 | - | |
| windows-file-explorer/ | 2026-03-28 18:09 | - | |
| windows-font-changer/ | 2026-03-28 18:09 | - | |
| windows-forms/ | 2026-03-28 18:09 | - | |
| windows-icons/ | 2026-03-28 18:09 | - | |
| windows-imaging-component/ | 2026-03-28 18:10 | - | |
| windows-insider/ | 2026-03-28 18:10 | - | |
| windows-key-shortcut-guide/ | 2026-03-28 18:09 | - | |
| windows-key/ | 2026-03-28 18:09 | - | |
| windows-management-instrumentation/ | 2026-03-28 18:09 | - | |
| windows-midi-and-musician-settings/ | 2026-03-28 18:09 | - | |
| windows-optimization-tool/ | 2026-03-28 18:09 | - | |
| windows-path-editor/ | 2026-03-28 18:10 | - | |
| windows-pc-health-check/ | 2026-03-28 18:09 | - | |
| windows-phone/ | 2026-03-28 18:10 | - | |
| windows-recovery-environment/ | 2026-03-28 18:09 | - | |
| windows-remote-desktop/ | 2026-03-28 18:10 | - | |
| windows-resource-kits/ | 2026-03-28 18:09 | - | |
| windows-sandbox/ | 2026-03-28 18:09 | - | |
| windows-sdk/ | 2026-03-28 18:09 | - | |
| windows-search/ | 2026-03-28 18:09 | - | |
| windows-security/ | 2026-03-28 18:09 | - | |
| windows-server/ | 2026-03-28 18:09 | - | |
| windows-service/ | 2026-03-28 18:09 | - | |
| windows-setup/ | 2026-03-28 18:09 | - | |
| windows-shell/ | 2026-03-28 18:09 | - | |
| windows-subsystem-for-android/ | 2026-03-28 18:09 | - | |
| windows-subsystem-for-linux-usb/ | 2026-03-28 18:09 | - | |
| windows-subsystem-for-linux/ | 2026-03-28 18:09 | - | |
| windows-tablets/ | 2026-03-28 18:09 | - | |
| windows-taskbar/ | 2026-03-28 18:09 | - | |
| windows-terminal-theme/ | 2026-03-28 18:09 | - | |
| windows-terminal/ | 2026-03-28 18:09 | - | |
| windows-theme/ | 2026-03-28 18:09 | - | |
| windows-tools/ | 2026-03-28 18:09 | - | |
| windows-tuning/ | 2026-03-28 18:10 | - | |
| windows-tweaks/ | 2026-03-28 18:10 | - | |
| windows-update/ | 2026-03-28 18:09 | - | |
| windows-updates/ | 2026-03-28 18:09 | - | |
| windows-utility/ | 2026-03-28 18:09 | - | |
| windows-virtual-desktop-agent/ | 2026-03-28 18:09 | - | |
| windows/ | 2026-03-28 18:09 | - | |
| windows3.0/ | 2026-03-28 18:10 | - | |
| windows3.1/ | 2026-03-28 18:10 | - | |
| windows7/ | 2026-03-28 18:09 | - | |
| windows8-1/ | 2026-03-28 18:09 | - | |
| windows10/ | 2026-03-28 18:09 | - | |
| windows10mobile/ | 2026-03-28 18:09 | - | |
| windows10updates/ | 2026-03-28 18:10 | - | |
| windows11-ad-removal/ | 2026-03-28 18:10 | - | |
| windows11-tweaking-tool/ | 2026-03-28 18:10 | - | |
| windows11/ | 2026-03-28 18:09 | - | |
| windows11installationmedia/ | 2026-03-28 18:09 | - | |
| windows95/ | 2026-03-28 18:10 | - | |
| windows98/ | 2026-03-28 18:10 | - | |
| windowsadmincentersetupv2/ | 2026-03-28 18:10 | - | |
| windowsadmincentre/ | 2026-03-28 18:10 | - | |
| windowsadministratorcenter/ | 2026-03-28 18:10 | - | |
| windowsaudiosettings/ | 2026-03-28 18:09 | - | |
| windowsautonightmode/ | 2026-03-28 18:09 | - | |
| windowseventlogviewer/ | 2026-03-28 18:09 | - | |
| windowsexplorer/ | 2026-03-28 18:09 | - | |
| windows feature/ | 2026-03-28 18:10 | - | |
| windowsfileexplorer/ | 2026-03-28 18:09 | - | |
| windowsfilteringplatform/ | 2026-03-28 18:09 | - | |
| windowsgsm/ | 2026-03-28 18:10 | - | |
| windowshello/ | 2026-03-28 18:09 | - | |
| windowsme/ | 2026-03-28 18:10 | - | |
| windowsmidiandmusiciansettings/ | 2026-03-28 18:09 | - | |
| windowsphone/ | 2026-03-28 18:09 | - | |
| windowsrecoveryenvironment/ | 2026-03-28 18:09 | - | |
| windowsremotedesktop/ | 2026-03-28 18:10 | - | |
| windowsresourcekits/ | 2026-03-28 18:09 | - | |
| windowsrestorepoint/ | 2026-03-28 18:10 | - | |
| windowssandbox/ | 2026-03-28 18:09 | - | |
| windowssdk/ | 2026-03-28 18:09 | - | |
| windowssecurity/ | 2026-03-28 18:09 | - | |
| windows server/ | 2026-03-28 18:09 | - | |
| windowsserver/ | 2026-03-28 18:10 | - | |
| windowsservice/ | 2026-03-28 18:09 | - | |
| windowssetup/ | 2026-03-28 18:09 | - | |
| windowssoundsettings/ | 2026-03-28 18:09 | - | |
| windowssubsystemforlinux/ | 2026-03-28 18:09 | - | |
| windowssubsystemforlinuxusbmanager/ | 2026-03-28 18:09 | - | |
| windowstablets/ | 2026-03-28 18:09 | - | |
| windowstogo/ | 2026-03-28 18:09 | - | |
| windowsupdate/ | 2026-03-28 18:09 | - | |
| windowsupdatecatalog/ | 2026-03-28 18:09 | - | |
| windowsupdates/ | 2026-03-28 18:09 | - | |
| windowtransparency/ | 2026-03-28 18:09 | - | |
| windowwidth/ | 2026-03-28 18:09 | - | |
| winforms/ | 2026-03-28 18:09 | - | |
| winfsp/ | 2026-03-28 18:09 | - | |
| winget-autoupdate/ | 2026-03-28 18:09 | - | |
| winget-cli/ | 2026-03-28 18:10 | - | |
| winget-create/ | 2026-03-28 18:09 | - | |
| winget-pkgs/ | 2026-03-28 18:09 | - | |
| winget-ui/ | 2026-03-28 18:09 | - | |
| winget/ | 2026-03-28 18:09 | - | |
| wingetautoupdate/ | 2026-03-28 18:09 | - | |
| wingetui/ | 2026-03-28 18:09 | - | |
| winhosts-manager/ | 2026-03-28 18:10 | - | |
| winidea/ | 2026-03-28 18:10 | - | |
| winlister/ | 2026-03-28 18:10 | - | |
| winobj/ | 2026-03-28 18:09 | - | |
| winpcap/ | 2026-03-28 18:09 | - | |
| winre/ | 2026-03-28 18:09 | - | |
| winsocket/ | 2026-03-28 18:09 | - | |
| winssh-pageant/ | 2026-03-28 18:09 | - | |
| winsw/ | 2026-03-28 18:09 | - | |
| winterhilld/ | 2026-03-28 18:10 | - | |
| winui-3/ | 2026-03-28 18:10 | - | |
| winui/ | 2026-03-28 18:09 | - | |
| winui2/ | 2026-03-28 18:09 | - | |
| winui3/ | 2026-03-28 18:09 | - | |
| winusb.sys/ | 2026-03-28 18:09 | - | |
| winusb/ | 2026-03-28 18:09 | - | |
| winusb_dfu.inf/ | 2026-03-28 18:09 | - | |
| winusbcompat.inf/ | 2026-03-28 18:10 | - | |
| winver/ | 2026-03-28 18:09 | - | |
| winzip/ | 2026-03-28 18:09 | - | |
| wipe/ | 2026-03-28 18:09 | - | |
| wire/ | 2026-03-28 18:09 | - | |
| wireframe/ | 2026-03-28 18:09 | - | |
| wireguard-ui/ | 2026-03-28 18:09 | - | |
| wireguard-vpn/ | 2026-03-28 18:09 | - | |
| wireguard/ | 2026-03-28 18:09 | - | |
| wireless,scanner/ | 2026-03-28 18:09 | - | |
| wireless-file-sharing/ | 2026-03-28 18:09 | - | |
| wireless-file-transfer/ | 2026-03-28 18:09 | - | |
| wireless/ | 2026-03-28 18:09 | - | |
| wirelessgamepad/ | 2026-03-28 18:09 | - | |
| wirelessnetworking/ | 2026-03-28 18:09 | - | |
| wirelesssound/ | 2026-03-28 18:09 | - | |
| wireshark/ | 2026-03-28 18:09 | - | |
| wiresock/ | 2026-03-28 18:09 | - | |
| wise-memory/ | 2026-03-28 18:09 | - | |
| wise-optimizer/ | 2026-03-28 18:09 | - | |
| wit/ | 2026-03-28 18:10 | - | |
| wix-installer/ | 2026-03-28 18:09 | - | |
| wix/ | 2026-03-28 18:09 | - | |
| wixtoolset/ | 2026-03-28 18:09 | - | |
| wizkey/ | 2026-03-28 18:09 | - | |
| wlan/ | 2026-03-28 18:09 | - | |
| wled/ | 2026-03-28 18:09 | - | |
| wlm/ | 2026-03-28 18:09 | - | |
| wmi/ | 2026-03-28 18:09 | - | |
| wmo/ | 2026-03-28 18:09 | - | |
| wo-mic/ | 2026-03-28 18:10 | - | |
| wol/ | 2026-03-28 18:09 | - | |
| wolfgangrolke/ | 2026-03-28 18:09 | - | |
| wolfram-engine/ | 2026-03-28 18:09 | - | |
| wolfram/ | 2026-03-28 18:09 | - | |
| wolframengine/ | 2026-03-28 18:09 | - | |
| womic.inf/ | 2026-03-28 18:10 | - | |
| wonderswan/ | 2026-03-28 18:10 | - | |
| wonderswancolor/ | 2026-03-28 18:09 | - | |
| woodworking/ | 2026-03-28 18:09 | - | |
| wop/ | 2026-03-28 18:10 | - | |
| word-document/ | 2026-03-28 18:09 | - | |
| word/ | 2026-03-28 18:09 | - | |
| wordpad/ | 2026-03-28 18:09 | - | |
| wordpress/ | 2026-03-28 18:09 | - | |
| work-break/ | 2026-03-28 18:09 | - | |
| work-countdown/ | 2026-03-28 18:09 | - | |
| work/ | 2026-03-28 18:09 | - | |
| workbook/ | 2026-03-28 18:09 | - | |
| workcalendar/ | 2026-03-28 18:09 | - | |
| worker/ | 2026-03-28 18:09 | - | |
| workflow/ | 2026-03-28 18:09 | - | |
| workflows/ | 2026-03-28 18:09 | - | |
| working/ | 2026-03-28 18:09 | - | |
| workiq, copilot/ | 2026-03-28 18:09 | - | |
| workman-us/ | 2026-03-28 18:10 | - | |
| workspace/ | 2026-03-28 18:09 | - | |
| workspaces/ | 2026-03-28 18:09 | - | |
| worktree/ | 2026-03-28 18:09 | - | |
| world-of-tanks/ | 2026-03-28 18:09 | - | |
| world-of-warcraft-addon/ | 2026-03-28 18:09 | - | |
| world-of-warcraft/ | 2026-03-28 18:09 | - | |
| world-of-warplanes/ | 2026-03-28 18:09 | - | |
| world-of-warships/ | 2026-03-28 18:09 | - | |
| worldofpadman/ | 2026-03-28 18:10 | - | |
| worldofwarships/ | 2026-03-28 18:09 | - | |
| wormhole/ | 2026-03-28 18:10 | - | |
| worms/ | 2026-03-28 18:09 | - | |
| wot/ | 2026-03-28 18:09 | - | |
| wow/ | 2026-03-28 18:09 | - | |
| wows/ | 2026-03-28 18:09 | - | |
| wox/ | 2026-03-28 18:09 | - | |
| wpa3/ | 2026-03-28 18:09 | - | |
| wpf-application/ | 2026-03-28 18:09 | - | |
| wpf-ui/ | 2026-03-28 18:10 | - | |
| wpf/ | 2026-03-28 18:09 | - | |
| wps/ | 2026-03-28 18:09 | - | |
| wrapper/ | 2026-03-28 18:09 | - | |
| wrappper/ | 2026-03-28 18:09 | - | |
| wretch/ | 2026-03-28 18:10 | - | |
| wrf-files/ | 2026-03-28 18:09 | - | |
| wrf-recordings/ | 2026-03-28 18:09 | - | |
| wrffiles/ | 2026-03-28 18:09 | - | |
| wrfrecordings/ | 2026-03-28 18:09 | - | |
| write/ | 2026-03-28 18:10 | - | |
| writer/ | 2026-03-28 18:09 | - | |
| writing/ | 2026-03-28 18:09 | - | |
| ws2812/ | 2026-03-28 18:09 | - | |
| ws2812b/ | 2026-03-28 18:09 | - | |
| wsa/ | 2026-03-28 18:09 | - | |
| wsb/ | 2026-03-28 18:09 | - | |
| wsgi/ | 2026-03-28 18:09 | - | |
| wsl-distro/ | 2026-03-28 18:10 | - | |
| wsl-usb-gui/ | 2026-03-28 18:09 | - | |
| wsl-usb-manager/ | 2026-03-28 18:09 | - | |
| wsl/ | 2026-03-28 18:09 | - | |
| wsl2/ | 2026-03-28 18:09 | - | |
| wslusbgui/ | 2026-03-28 18:09 | - | |
| wt/ | 2026-03-28 18:09 | - | |
| wubi/ | 2026-03-28 18:09 | - | |
| wutheringwaves/ | 2026-03-28 18:10 | - | |
| wvd/ | 2026-03-28 18:09 | - | |
| wwmi/ | 2026-03-28 18:09 | - | |
| wwt/ | 2026-03-28 18:10 | - | |
| wxmaxima/ | 2026-03-28 18:09 | - | |
| wxwidgets/ | 2026-03-28 18:10 | - | |
| wysiwyg/ | 2026-03-28 18:09 | - | |
| wz2100/ | 2026-03-28 18:09 | - | |
| x-diesel/ | 2026-03-28 18:09 | - | |
| x-m11-pc/ | 2026-03-28 18:10 | - | |
| x-mac-ce x-mac-cyrillic/ | 2026-03-28 18:09 | - | |
| x-minecraft-launcher/ | 2026-03-28 18:09 | - | |
| x-mouse-button-control/ | 2026-03-28 18:10 | - | |
| x-server/ | 2026-03-28 18:09 | - | |
| x.509/ | 2026-03-28 18:09 | - | |
| x1/ | 2026-03-28 18:10 | - | |
| x3daudio1_7.dll/ | 2026-03-28 18:09 | - | |
| x11/ | 2026-03-28 18:09 | - | |
| x64/ | 2026-03-28 18:09 | - | |
| x86-64/ | 2026-03-28 18:10 | - | |
| x86/ | 2026-03-28 18:09 | - | |
| x509/ | 2026-03-28 18:09 | - | |
| x509certificates/ | 2026-03-28 18:09 | - | |
| xactengine3_7.dll/ | 2026-03-28 18:09 | - | |
| xamarin/ | 2026-03-28 18:10 | - | |
| xaml-islands/ | 2026-03-28 18:09 | - | |
| xaml/ | 2026-03-28 18:09 | - | |
| xapofx1_5.dll/ | 2026-03-28 18:09 | - | |
| xargs/ | 2026-03-28 18:09 | - | |
| xaudio2_7.dll/ | 2026-03-28 18:09 | - | |
| xbin/ | 2026-03-28 18:09 | - | |
| xbmc/ | 2026-03-28 18:09 | - | |
| xbox-gamebar-stub/ | 2026-03-28 18:09 | - | |
| xbox/ | 2026-03-28 18:09 | - | |
| xbox360/ | 2026-03-28 18:09 | - | |
| xboxgamebarstub/ | 2026-03-28 18:09 | - | |
| xchacha20/ | 2026-03-28 18:09 | - | |
| xchat-wdk/ | 2026-03-28 18:09 | - | |
| xchat/ | 2026-03-28 18:09 | - | |
| xcloud/ | 2026-03-28 18:09 | - | |
| xdelta/ | 2026-03-28 18:10 | - | |
| xdg-desktop-portal/ | 2026-03-28 18:09 | - | |
| xdman/ | 2026-03-28 18:10 | - | |
| xencelabstablet.inf/ | 2026-03-28 18:09 | - | |
| xenia/ | 2026-03-28 18:10 | - | |
| xenserver/ | 2026-03-28 18:10 | - | |
| xentools/ | 2026-03-28 18:10 | - | |
| xess/ | 2026-03-28 18:10 | - | |
| xfs/ | 2026-03-28 18:09 | - | |
| xg-c100c/ | 2026-03-28 18:10 | - | |
| xgo/ | 2026-03-28 18:09 | - | |
| xgp/ | 2026-03-28 18:09 | - | |
| xiami-music/ | 2026-03-28 18:09 | - | |
| xiaomi/ | 2026-03-28 18:09 | - | |
| xigua/ | 2026-03-28 18:09 | - | |
| xinput/ | 2026-03-28 18:09 | - | |
| xinput1_3.dll/ | 2026-03-28 18:09 | - | |
| xiph-org-foundation/ | 2026-03-28 18:09 | - | |
| xiph.org-foundation/ | 2026-03-28 18:09 | - | |
| xiph id3 vorbis comment/ | 2026-03-28 18:10 | - | |
| xiphorgfoundation/ | 2026-03-28 18:09 | - | |
| xliff2/ | 2026-03-28 18:10 | - | |
| xlsx/ | 2026-03-28 18:09 | - | |
| xls xlsx ods/ | 2026-03-28 18:10 | - | |
| xmbc/ | 2026-03-28 18:10 | - | |
| xmcl.app/ | 2026-03-28 18:09 | - | |
| xmcl/ | 2026-03-28 18:09 | - | |
| xme11pc/ | 2026-03-28 18:10 | - | |
| xmi/ | 2026-03-28 18:09 | - | |
| xml-editor/ | 2026-03-28 18:10 | - | |
| xml-files/ | 2026-03-28 18:10 | - | |
| xml-statistics/ | 2026-03-28 18:10 | - | |
| xml-user-interface-language/ | 2026-03-28 18:09 | - | |
| xml/ | 2026-03-28 18:09 | - | |
| xmluserinterfacelanguage/ | 2026-03-28 18:09 | - | |
| xmodem/ | 2026-03-28 18:09 | - | |
| xmousebuttoncontrol/ | 2026-03-28 18:10 | - | |
| xmp/ | 2026-03-28 18:09 | - | |
| xmpp-client/ | 2026-03-28 18:10 | - | |
| xmpp/ | 2026-03-28 18:09 | - | |
| xna-framework-redistributable/ | 2026-03-28 18:09 | - | |
| xna-redistributable/ | 2026-03-28 18:09 | - | |
| xnaframeworkredistributable/ | 2026-03-28 18:09 | - | |
| xnafx40/ | 2026-03-28 18:09 | - | |
| xnanative.dll/ | 2026-03-28 18:09 | - | |
| xnaredistributable/ | 2026-03-28 18:09 | - | |
| xnavisualizer.dll/ | 2026-03-28 18:09 | - | |
| xonsh/ | 2026-03-28 18:10 | - | |
| xontrib/ | 2026-03-28 18:10 | - | |
| xor-shift/ | 2026-03-28 18:09 | - | |
| xorangekiller/ | 2026-03-28 18:09 | - | |
| xorg/ | 2026-03-28 18:09 | - | |
| xp-11/ | 2026-03-28 18:10 | - | |
| xp8jrf5sxv03zm/ | 2026-03-28 18:09 | - | |
| xp8k0j757hhrdw/ | 2026-03-28 18:09 | - | |
| xp9cdqw6ml4nqn/ | 2026-03-28 18:10 | - | |
| xp99gvqdx7jpr4/ | 2026-03-28 18:10 | - | |
| xpath/ | 2026-03-28 18:09 | - | |
| xpcom/ | 2026-03-28 18:10 | - | |
| xpdfmxbjpl5ssr/ | 2026-03-28 18:09 | - | |
| xpdlpkwg9sw2wd/ | 2026-03-28 18:09 | - | |
| xpdm5vsmtkqlbj/ | 2026-03-28 18:09 | - | |
| xpdnx7g06blh2g/ | 2026-03-28 18:09 | - | |
| xperia/ | 2026-03-28 18:09 | - | |
| xpffff6nn1lzdq/ | 2026-03-28 18:09 | - | |
| xpfm11z0w10r7g/ | 2026-03-28 18:09 | - | |
| xpg/ | 2026-03-28 18:09 | - | |
| xplat/ | 2026-03-28 18:10 | - | |
| xpressmusic/ | 2026-03-28 18:09 | - | |
| xps/ | 2026-03-28 18:09 | - | |
| xray-core/ | 2026-03-28 18:09 | - | |
| xray/ | 2026-03-28 18:09 | - | |
| xrechnung-viewer/ | 2026-03-28 18:10 | - | |
| xrechnung/ | 2026-03-28 18:10 | - | |
| xrmtoolbox/ | 2026-03-28 18:09 | - | |
| xserver/ | 2026-03-28 18:09 | - | |
| xshell/ | 2026-03-28 18:09 | - | |
| xslt/ | 2026-03-28 18:10 | - | |
| xterm/ | 2026-03-28 18:09 | - | |
| xtls/ | 2026-03-28 18:09 | - | |
| xtu/ | 2026-03-28 18:09 | - | |
| xul/ | 2026-03-28 18:09 | - | |
| xxh3 xxh32 xxh64 xxh128/ | 2026-03-28 18:10 | - | |
| xxhash3/ | 2026-03-28 18:10 | - | |
| xxmi/ | 2026-03-28 18:09 | - | |
| xyplorer/ | 2026-03-28 18:09 | - | |
| yacc/ | 2026-03-28 18:09 | - | |
| yacreader/ | 2026-03-28 18:10 | - | |
| yacy/ | 2026-03-28 18:10 | - | |
| yadm/ | 2026-03-28 18:10 | - | |
| yahtzee/ | 2026-03-28 18:09 | - | |
| yaml-files/ | 2026-03-28 18:09 | - | |
| yaml-processor/ | 2026-03-28 18:09 | - | |
| yaml/ | 2026-03-28 18:09 | - | |
| yandex-dns/ | 2026-03-28 18:10 | - | |
| yandex-music/ | 2026-03-28 18:09 | - | |
| yandex/ | 2026-03-28 18:10 | - | |
| yandexdns/ | 2026-03-28 18:10 | - | |
| yapf/ | 2026-03-28 18:10 | - | |
| yara/ | 2026-03-28 18:09 | - | |
| yarn/ | 2026-03-28 18:09 | - | |
| yarp/ | 2026-03-28 18:09 | - | |
| yasb/ | 2026-03-28 18:09 | - | |
| yasp/ | 2026-03-28 18:09 | - | |
| yatzy/ | 2026-03-28 18:09 | - | |
| yawnme/ | 2026-03-28 18:10 | - | |
| yazi/ | 2026-03-28 18:10 | - | |
| yealink/ | 2026-03-28 18:09 | - | |
| yeastar/ | 2026-03-28 18:09 | - | |
| yet-another-server-picker/ | 2026-03-28 18:09 | - | |
| yinxiang/ | 2026-03-28 18:09 | - | |
| ykman/ | 2026-03-28 18:10 | - | |
| yml/ | 2026-03-28 18:09 | - | |
| yoga/ | 2026-03-28 18:09 | - | |
| youdao/ | 2026-03-28 18:09 | - | |
| youtrack/ | 2026-03-28 18:09 | - | |
| youtube-dl-gui/ | 2026-03-28 18:09 | - | |
| youtube-dl/ | 2026-03-28 18:09 | - | |
| youtube-dlc/ | 2026-03-28 18:10 | - | |
| youtube-dlp/ | 2026-03-28 18:10 | - | |
| youtube-downloader/ | 2026-03-28 18:09 | - | |
| youtube-music-player/ | 2026-03-28 18:09 | - | |
| youtube-music/ | 2026-03-28 18:09 | - | |
| youtube-player/ | 2026-03-28 18:09 | - | |
| youtube-playlist/ | 2026-03-28 18:09 | - | |
| youtube/ | 2026-03-28 18:09 | - | |
| ysf/ | 2026-03-28 18:10 | - | |
| ysusb_w10.inf/ | 2026-03-28 18:09 | - | |
| yt-dlp-gui/ | 2026-03-28 18:09 | - | |
| yt-dlp/ | 2026-03-28 18:09 | - | |
| yt-dlp extension/ | 2026-03-28 18:09 | - | |
| ytdlp/ | 2026-03-28 18:10 | - | |
| ytdownloader/ | 2026-03-28 18:09 | - | |
| yuanshen/ | 2026-03-28 18:09 | - | |
| yubi/ | 2026-03-28 18:10 | - | |
| yubikey/ | 2026-03-28 18:09 | - | |
| yum/ | 2026-03-28 18:09 | - | |
| z/ | 2026-03-28 18:10 | - | |
| z690/ | 2026-03-28 18:09 | - | |
| zabbix/ | 2026-03-28 18:10 | - | |
| zai/ | 2026-03-28 18:09 | - | |
| zanzibar/ | 2026-03-28 18:09 | - | |
| zaproxy/ | 2026-03-28 18:09 | - | |
| zebra-printer/ | 2026-03-28 18:09 | - | |
| zebra/ | 2026-03-28 18:09 | - | |
| zed/ | 2026-03-28 18:09 | - | |
| zelda/ | 2026-03-28 18:09 | - | |
| zen/ | 2026-03-28 18:09 | - | |
| zenless-zone-zero/ | 2026-03-28 18:10 | - | |
| zenn/ | 2026-03-28 18:10 | - | |
| zermelo/ | 2026-03-28 18:10 | - | |
| zero-configuration/ | 2026-03-28 18:10 | - | |
| zero-copy/ | 2026-03-28 18:09 | - | |
| zero-install/ | 2026-03-28 18:09 | - | |
| zero-knowledge/ | 2026-03-28 18:09 | - | |
| zero-trust-network-access/ | 2026-03-28 18:09 | - | |
| zero-trust/ | 2026-03-28 18:09 | - | |
| zeroc/ | 2026-03-28 18:10 | - | |
| zeromq/ | 2026-03-28 18:10 | - | |
| zeronet/ | 2026-03-28 18:10 | - | |
| zerotier/ | 2026-03-28 18:09 | - | |
| zeus/ | 2026-03-28 18:09 | - | |
| zfs/ | 2026-03-28 18:09 | - | |
| zig-package/ | 2026-03-28 18:09 | - | |
| zig-program/ | 2026-03-28 18:09 | - | |
| zig/ | 2026-03-28 18:09 | - | |
| ziglang/ | 2026-03-28 18:10 | - | |
| zim/ | 2026-03-28 18:09 | - | |
| zip/ | 2026-03-28 18:09 | - | |
| ziphelp/ | 2026-03-28 18:09 | - | |
| zipx/ | 2026-03-28 18:09 | - | |
| zkp/ | 2026-03-28 18:10 | - | |
| zlib/ | 2026-03-28 18:10 | - | |
| zmodem/ | 2026-03-28 18:09 | - | |
| zng/ | 2026-03-28 18:09 | - | |
| znote/ | 2026-03-28 18:09 | - | |
| zookeeper/ | 2026-03-28 18:09 | - | |
| zoom/ | 2026-03-28 18:09 | - | |
| zoomable-images/ | 2026-03-28 18:09 | - | |
| zoomify/ | 2026-03-28 18:09 | - | |
| zoomtext/ | 2026-03-28 18:09 | - | |
| zotero/ | 2026-03-28 18:09 | - | |
| zpl/ | 2026-03-28 18:09 | - | |
| zq/ | 2026-03-28 18:09 | - | |
| zsh-prompt/ | 2026-03-28 18:09 | - | |
| zsh-theme/ | 2026-03-28 18:09 | - | |
| zsh/ | 2026-03-28 18:09 | - | |
| zspace/ | 2026-03-28 18:10 | - | |
| zsso/ | 2026-03-28 18:10 | - | |
| zstandard/ | 2026-03-28 18:09 | - | |
| zstd/ | 2026-03-28 18:09 | - | |
| ztna/ | 2026-03-28 18:10 | - | |
| ztnet/ | 2026-03-28 18:09 | - | |
| zugferd/ | 2026-03-28 18:09 | - | |
| zui/ | 2026-03-28 18:09 | - | |
| zulu/ | 2026-03-28 18:10 | - | |
| zxing/ | 2026-03-28 18:10 | - | |
| zydis/ | 2026-03-28 18:10 | - | |
| zype/ | 2026-03-28 18:09 | - | |
| zzmi/ | 2026-03-28 18:09 | - | |
![[TXT]](/icons/text.gif) | tags.html | 2026-03-28 18:10 | 3.1M | |
|
|---|